From 545a47455906590c14f1b03f5117fb22f83a3d32 Mon Sep 17 00:00:00 2001 From: "Stanislav N. aka pztrn" Date: Fri, 17 May 2019 19:06:13 +0500 Subject: [PATCH] Initial commit. --- .gitignore | 1 + Gopkg.lock | 66 + Gopkg.toml | 34 + README.md | 9 + cmd/ffmpeger/ffmpeger.go | 43 + .../send_example_message.go | 72 + config/exported.go | 66 + config/struct.go | 11 + converter/exported.go | 185 + converter/find_ffmpeg.go | 36 + converter/task.go | 101 + data/.gitkeep | 0 docker-compose.yaml | 13 + ffmpeger.dist.yaml | 2 + nats/exported.go | 87 + nats/handler.go | 6 + vendor/github.com/nats-io/go-nats/LICENSE | 201 + .../go-nats/encoders/builtin/default_enc.go | 117 + .../go-nats/encoders/builtin/gob_enc.go | 45 + .../go-nats/encoders/builtin/json_enc.go | 56 + vendor/github.com/nats-io/go-nats/util/tls.go | 27 + .../nats-io/go-nats/util/tls_go17.go | 49 + vendor/github.com/nats-io/nats.go/.gitignore | 39 + vendor/github.com/nats-io/nats.go/.travis.yml | 21 + .../github.com/nats-io/nats.go/GOVERNANCE.md | 3 + vendor/github.com/nats-io/nats.go/LICENSE | 201 + .../github.com/nats-io/nats.go/MAINTAINERS.md | 10 + vendor/github.com/nats-io/nats.go/README.md | 384 ++ vendor/github.com/nats-io/nats.go/TODO.md | 26 + vendor/github.com/nats-io/nats.go/context.go | 241 + vendor/github.com/nats-io/nats.go/enc.go | 269 ++ vendor/github.com/nats-io/nats.go/nats.go | 3940 +++++++++++++++++ vendor/github.com/nats-io/nats.go/netchan.go | 111 + vendor/github.com/nats-io/nats.go/parser.go | 481 ++ .../nats-io/nats.go/staticcheck.ignore | 4 + vendor/github.com/nats-io/nats.go/timer.go | 56 + vendor/github.com/nats-io/nkeys/.gitignore | 15 + .../github.com/nats-io/nkeys/.goreleaser.yml | 38 + vendor/github.com/nats-io/nkeys/.travis.yml | 32 + vendor/github.com/nats-io/nkeys/GOVERNANCE.md | 3 + vendor/github.com/nats-io/nkeys/LICENSE | 201 + .../github.com/nats-io/nkeys/MAINTAINERS.md | 6 + vendor/github.com/nats-io/nkeys/README.md | 72 + vendor/github.com/nats-io/nkeys/TODO.md | 5 + vendor/github.com/nats-io/nkeys/crc16.go | 75 + vendor/github.com/nats-io/nkeys/go.mod | 3 + vendor/github.com/nats-io/nkeys/go.sum | 2 + vendor/github.com/nats-io/nkeys/keypair.go | 117 + vendor/github.com/nats-io/nkeys/main.go | 103 + vendor/github.com/nats-io/nkeys/public.go | 66 + vendor/github.com/nats-io/nkeys/strkey.go | 290 ++ vendor/github.com/nats-io/nuid/.gitignore | 24 + vendor/github.com/nats-io/nuid/.travis.yml | 17 + vendor/github.com/nats-io/nuid/GOVERNANCE.md | 3 + vendor/github.com/nats-io/nuid/LICENSE | 201 + vendor/github.com/nats-io/nuid/MAINTAINERS.md | 6 + vendor/github.com/nats-io/nuid/README.md | 47 + vendor/github.com/nats-io/nuid/nuid.go | 135 + vendor/golang.org/x/crypto/AUTHORS | 3 + vendor/golang.org/x/crypto/CONTRIBUTORS | 3 + vendor/golang.org/x/crypto/LICENSE | 27 + vendor/golang.org/x/crypto/PATENTS | 22 + vendor/golang.org/x/crypto/ed25519/ed25519.go | 217 + .../ed25519/internal/edwards25519/const.go | 1422 ++++++ .../internal/edwards25519/edwards25519.go | 1793 ++++++++ vendor/gopkg.in/yaml.v2/.travis.yml | 12 + vendor/gopkg.in/yaml.v2/LICENSE | 201 + vendor/gopkg.in/yaml.v2/LICENSE.libyaml | 31 + vendor/gopkg.in/yaml.v2/NOTICE | 13 + vendor/gopkg.in/yaml.v2/README.md | 133 + vendor/gopkg.in/yaml.v2/apic.go | 739 ++++ vendor/gopkg.in/yaml.v2/decode.go | 775 ++++ vendor/gopkg.in/yaml.v2/emitterc.go | 1685 +++++++ vendor/gopkg.in/yaml.v2/encode.go | 390 ++ vendor/gopkg.in/yaml.v2/go.mod | 5 + vendor/gopkg.in/yaml.v2/parserc.go | 1095 +++++ vendor/gopkg.in/yaml.v2/readerc.go | 412 ++ vendor/gopkg.in/yaml.v2/resolve.go | 258 ++ vendor/gopkg.in/yaml.v2/scannerc.go | 2696 +++++++++++ vendor/gopkg.in/yaml.v2/sorter.go | 113 + vendor/gopkg.in/yaml.v2/writerc.go | 26 + vendor/gopkg.in/yaml.v2/yaml.go | 466 ++ vendor/gopkg.in/yaml.v2/yamlh.go | 738 +++ vendor/gopkg.in/yaml.v2/yamlprivateh.go | 173 + 84 files changed, 21922 insertions(+) create mode 100644 .gitignore create mode 100644 Gopkg.lock create mode 100644 Gopkg.toml create mode 100644 README.md create mode 100644 cmd/ffmpeger/ffmpeger.go create mode 100644 cmd/send_example_message/send_example_message.go create mode 100644 config/exported.go create mode 100644 config/struct.go create mode 100644 converter/exported.go create mode 100644 converter/find_ffmpeg.go create mode 100644 converter/task.go create mode 100644 data/.gitkeep create mode 100644 docker-compose.yaml create mode 100644 ffmpeger.dist.yaml create mode 100644 nats/exported.go create mode 100644 nats/handler.go create mode 100644 vendor/github.com/nats-io/go-nats/LICENSE create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls_go17.go create mode 100644 vendor/github.com/nats-io/nats.go/.gitignore create mode 100644 vendor/github.com/nats-io/nats.go/.travis.yml create mode 100644 vendor/github.com/nats-io/nats.go/GOVERNANCE.md create mode 100644 vendor/github.com/nats-io/nats.go/LICENSE create mode 100644 vendor/github.com/nats-io/nats.go/MAINTAINERS.md create mode 100644 vendor/github.com/nats-io/nats.go/README.md create mode 100644 vendor/github.com/nats-io/nats.go/TODO.md create mode 100644 vendor/github.com/nats-io/nats.go/context.go create mode 100644 vendor/github.com/nats-io/nats.go/enc.go create mode 100644 vendor/github.com/nats-io/nats.go/nats.go create mode 100644 vendor/github.com/nats-io/nats.go/netchan.go create mode 100644 vendor/github.com/nats-io/nats.go/parser.go create mode 100644 vendor/github.com/nats-io/nats.go/staticcheck.ignore create mode 100644 vendor/github.com/nats-io/nats.go/timer.go create mode 100644 vendor/github.com/nats-io/nkeys/.gitignore create mode 100644 vendor/github.com/nats-io/nkeys/.goreleaser.yml create mode 100644 vendor/github.com/nats-io/nkeys/.travis.yml create mode 100644 vendor/github.com/nats-io/nkeys/GOVERNANCE.md create mode 100644 vendor/github.com/nats-io/nkeys/LICENSE create mode 100644 vendor/github.com/nats-io/nkeys/MAINTAINERS.md create mode 100644 vendor/github.com/nats-io/nkeys/README.md create mode 100644 vendor/github.com/nats-io/nkeys/TODO.md create mode 100644 vendor/github.com/nats-io/nkeys/crc16.go create mode 100644 vendor/github.com/nats-io/nkeys/go.mod create mode 100644 vendor/github.com/nats-io/nkeys/go.sum create mode 100644 vendor/github.com/nats-io/nkeys/keypair.go create mode 100644 vendor/github.com/nats-io/nkeys/main.go create mode 100644 vendor/github.com/nats-io/nkeys/public.go create mode 100644 vendor/github.com/nats-io/nkeys/strkey.go create mode 100644 vendor/github.com/nats-io/nuid/.gitignore create mode 100644 vendor/github.com/nats-io/nuid/.travis.yml create mode 100644 vendor/github.com/nats-io/nuid/GOVERNANCE.md create mode 100644 vendor/github.com/nats-io/nuid/LICENSE create mode 100644 vendor/github.com/nats-io/nuid/MAINTAINERS.md create mode 100644 vendor/github.com/nats-io/nuid/README.md create mode 100644 vendor/github.com/nats-io/nuid/nuid.go create mode 100644 vendor/golang.org/x/crypto/AUTHORS create mode 100644 vendor/golang.org/x/crypto/CONTRIBUTORS create mode 100644 vendor/golang.org/x/crypto/LICENSE create mode 100644 vendor/golang.org/x/crypto/PATENTS create mode 100644 vendor/golang.org/x/crypto/ed25519/ed25519.go create mode 100644 vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go create mode 100644 vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go create mode 100644 vendor/gopkg.in/yaml.v2/.travis.yml create mode 100644 vendor/gopkg.in/yaml.v2/LICENSE create mode 100644 vendor/gopkg.in/yaml.v2/LICENSE.libyaml create mode 100644 vendor/gopkg.in/yaml.v2/NOTICE create mode 100644 vendor/gopkg.in/yaml.v2/README.md create mode 100644 vendor/gopkg.in/yaml.v2/apic.go create mode 100644 vendor/gopkg.in/yaml.v2/decode.go create mode 100644 vendor/gopkg.in/yaml.v2/emitterc.go create mode 100644 vendor/gopkg.in/yaml.v2/encode.go create mode 100644 vendor/gopkg.in/yaml.v2/go.mod create mode 100644 vendor/gopkg.in/yaml.v2/parserc.go create mode 100644 vendor/gopkg.in/yaml.v2/readerc.go create mode 100644 vendor/gopkg.in/yaml.v2/resolve.go create mode 100644 vendor/gopkg.in/yaml.v2/scannerc.go create mode 100644 vendor/gopkg.in/yaml.v2/sorter.go create mode 100644 vendor/gopkg.in/yaml.v2/writerc.go create mode 100644 vendor/gopkg.in/yaml.v2/yaml.go create mode 100644 vendor/gopkg.in/yaml.v2/yamlh.go create mode 100644 vendor/gopkg.in/yaml.v2/yamlprivateh.go diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..6320cd2 --- /dev/null +++ b/.gitignore @@ -0,0 +1 @@ +data \ No newline at end of file diff --git a/Gopkg.lock b/Gopkg.lock new file mode 100644 index 0000000..db3cdae --- /dev/null +++ b/Gopkg.lock @@ -0,0 +1,66 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + digest = "1:95837473f879ea39a76b82c43c7badf93a4b27b2d5654182ec3d1728f8ebec30" + name = "github.com/nats-io/go-nats" + packages = [ + "encoders/builtin", + "util", + ] + pruneopts = "UT" + revision = "70fe06cee50d4b6f98248d9675fb55f2a3aa7228" + version = "v1.7.2" + +[[projects]] + digest = "1:dcb8019bc74228b95b7cd74fd8eaced3ea528290d85cc8cc864b071e98422ee9" + name = "github.com/nats-io/nats.go" + packages = ["."] + pruneopts = "UT" + revision = "70fe06cee50d4b6f98248d9675fb55f2a3aa7228" + version = "v1.7.2" + +[[projects]] + digest = "1:0b5d91120efc54504bc253fda90b08c4be88cd78a4023ef60019e95bb0cdc136" + name = "github.com/nats-io/nkeys" + packages = ["."] + pruneopts = "UT" + revision = "1546a3320a8f195a5b5c84aef8309377c2e411d5" + version = "v0.0.2" + +[[projects]] + digest = "1:599f3202ce0a754144ddc4be4c6df9c6ab27b1d722a63ede6b2e0c3a2cc338a8" + name = "github.com/nats-io/nuid" + packages = ["."] + pruneopts = "UT" + revision = "4b96681fa6d28dd0ab5fe79bac63b3a493d9ee94" + version = "v1.0.1" + +[[projects]] + branch = "master" + digest = "1:d5891c5bca9c62e5d394ca26491d2b710a1dc08cedeb0ca8f9ac4c3305120b02" + name = "golang.org/x/crypto" + packages = [ + "ed25519", + "ed25519/internal/edwards25519", + ] + pruneopts = "UT" + revision = "22d7a77e9e5f409e934ed268692e56707cd169e5" + +[[projects]] + digest = "1:4d2e5a73dc1500038e504a8d78b986630e3626dc027bc030ba5c75da257cdb96" + name = "gopkg.in/yaml.v2" + packages = ["."] + pruneopts = "UT" + revision = "51d6538a90f86fe93ac480b35f37b2be17fef232" + version = "v2.2.2" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "github.com/nats-io/nats.go", + "gopkg.in/yaml.v2", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/Gopkg.toml b/Gopkg.toml new file mode 100644 index 0000000..c95545d --- /dev/null +++ b/Gopkg.toml @@ -0,0 +1,34 @@ +# Gopkg.toml example +# +# Refer to https://golang.github.io/dep/docs/Gopkg.toml.html +# for detailed Gopkg.toml documentation. +# +# required = ["github.com/user/thing/cmd/thing"] +# ignored = ["github.com/user/project/pkgX", "bitbucket.org/user/project/pkgA/pkgY"] +# +# [[constraint]] +# name = "github.com/user/project" +# version = "1.0.0" +# +# [[constraint]] +# name = "github.com/user/project2" +# branch = "dev" +# source = "github.com/myfork/project2" +# +# [[override]] +# name = "github.com/x/y" +# version = "2.4.0" +# +# [prune] +# non-go = false +# go-tests = true +# unused-packages = true + + +[[constraint]] + name = "gopkg.in/yaml.v2" + version = "2.2.2" + +[prune] + go-tests = true + unused-packages = true diff --git a/README.md b/README.md new file mode 100644 index 0000000..e64e4f2 --- /dev/null +++ b/README.md @@ -0,0 +1,9 @@ +# FFMpeger + +Simple microservice to convert video files with ffmpeg and receiving commands via NATS. + +## How to use + +1. Launch docker-compose to start required services. +2. Start ``ffmpeger.go`` from ``cmd/ffmpeger``. Please take a look at help (``-h``)! +3. Launch example message sender from ``cmd/send_example_message`` specifying input and output video files paths. See help (``-h``). \ No newline at end of file diff --git a/cmd/ffmpeger/ffmpeger.go b/cmd/ffmpeger/ffmpeger.go new file mode 100644 index 0000000..ffab473 --- /dev/null +++ b/cmd/ffmpeger/ffmpeger.go @@ -0,0 +1,43 @@ +package main + +import ( + // stdlib + "flag" + "log" + "os" + "os/signal" + "syscall" + + // local + "github.com/pztrn/ffmpeger/config" + "github.com/pztrn/ffmpeger/converter" + "github.com/pztrn/ffmpeger/nats" +) + +func main() { + log.Println("Starting video conversion service") + + config.Initialize() + nats.Initialize() + converter.Initialize() + + flag.Parse() + + config.Load() + nats.StartListening() + converter.Start() + + // CTRL+C handler. + signalHandler := make(chan os.Signal, 1) + shutdownDone := make(chan bool, 1) + signal.Notify(signalHandler, os.Interrupt, syscall.SIGTERM) + go func() { + <-signalHandler + nats.Shutdown() + converter.Shutdown() + shutdownDone <- true + }() + + <-shutdownDone + os.Exit(0) +} diff --git a/cmd/send_example_message/send_example_message.go b/cmd/send_example_message/send_example_message.go new file mode 100644 index 0000000..4929a8b --- /dev/null +++ b/cmd/send_example_message/send_example_message.go @@ -0,0 +1,72 @@ +package main + +import ( + // stdlib + "encoding/json" + "flag" + "log" + "path/filepath" + + // local + "github.com/pztrn/ffmpeger/config" + "github.com/pztrn/ffmpeger/converter" + mynats "github.com/pztrn/ffmpeger/nats" + + // other + "github.com/nats-io/nats.go" +) + +var ( + inputFilename string + outputFilename string +) + +func main() { + log.Println("Starting example message sender...") + + flag.StringVar(&inputFilename, "input", "", "Input file name") + flag.StringVar(&outputFilename, "output", "", "Output file name") + + config.Initialize() + + flag.Parse() + + if inputFilename == "" || outputFilename == "" { + log.Fatalln("Please specify both input and output file name!") + } + + var err error + inputFilename, err = filepath.Abs(inputFilename) + if err != nil { + log.Fatalln("Failed to get absolute path for input filename:", err.Error()) + } + outputFilename, err = filepath.Abs(outputFilename) + if err != nil { + log.Fatalln("Failed to get absolute path for output filename:", err.Error()) + } + + config.Load() + + nc, err := nats.Connect(config.Cfg.NATS.ConnectionString) + if err != nil { + log.Fatalln("Failed to connect to NATS server:", err.Error()) + } + + t := &converter.Task{ + InputFile: inputFilename, + OutputFile: outputFilename, + } + + data, err1 := json.Marshal(t) + if err1 != nil { + log.Fatalln("Failed to encode message:", err1.Error()) + } + + err2 := nc.Publish(mynats.Topic, data) + if err2 != nil { + log.Fatalln("Failed to publish message:", err2.Error()) + } + + log.Println("Message published") + nc.Close() +} diff --git a/config/exported.go b/config/exported.go new file mode 100644 index 0000000..a2f989e --- /dev/null +++ b/config/exported.go @@ -0,0 +1,66 @@ +package config + +import ( + // stdlib + "flag" + "io/ioutil" + "log" + "os/user" + "path/filepath" + "strings" + + // other + "gopkg.in/yaml.v2" +) + +var ( + configPathRaw string + Cfg *Config +) + +// Initialize initializes package. +func Initialize() { + log.Println("Initializing configuration...") + + flag.StringVar(&configPathRaw, "conf", "", "Path to configuration file, should be absolute.") +} + +// Load loads configuration into memory and parses it into Config struct. +func Load() { + if configPathRaw == "" { + log.Fatalln("No configuration file path defined! See '-h'!") + } + + log.Println("Loading configuration from file:", configPathRaw) + + // Replace home directory if "~" was specified. + if strings.Contains(configPathRaw, "~") { + u, err := user.Current() + if err != nil { + log.Fatalln("Failed to get current user's data:", err.Error()) + } + + configPathRaw = strings.Replace(configPathRaw, "~", u.HomeDir, 1) + } + + // Get absolute path to configuration file. + configPath, err := filepath.Abs(configPathRaw) + if err != nil { + log.Fatalln("Failed to get real configuration file path:", err.Error()) + } + + // Read it. + configFileData, err := ioutil.ReadFile(configPath) + if err != nil { + log.Fatalln("Failed to load configuration file data:", err.Error()) + } + + // Parse it. + Cfg = &Config{} + err1 := yaml.Unmarshal(configFileData, Cfg) + if err1 != nil { + log.Fatalln("Failed to parse configuration file:", err1.Error()) + } + + log.Printf("Configuration file parsed: %+v\n", Cfg) +} diff --git a/config/struct.go b/config/struct.go new file mode 100644 index 0000000..aca3977 --- /dev/null +++ b/config/struct.go @@ -0,0 +1,11 @@ +package config + +// Config represents whole configuration file structure. +type Config struct { + NATS Nats `yaml:"nats"` +} + +// Nats represents NATS connection configuration. +type Nats struct { + ConnectionString string `yaml:"connection_string"` +} diff --git a/converter/exported.go b/converter/exported.go new file mode 100644 index 0000000..e296069 --- /dev/null +++ b/converter/exported.go @@ -0,0 +1,185 @@ +package converter + +import ( + // stdlib + "encoding/json" + "flag" + "log" + "sync" + "time" + + // local + "github.com/pztrn/ffmpeger/nats" +) + +var ( + // ffmpeg path. + ffmpegPath string + + // Tasks queue. + tasks []*Task + tasksMutex sync.Mutex + + // Currently running tasks. + // Reason why this isn't from atomic package is because atomic's + // integers (as well as other things) doesn't neccessarily changed + // when Add* functions called but we need to make sure that our + // running count is precise. + // Mutex is here because value will be decremented/incremented from + // worker goroutine and read from control goroutine. + currentlyRunning int + currentlyRunningMutex sync.Mutex + + // Maximum tasks that should be executed concurrently. + // No mutex here because it will be accessed from only one place + // after initialization. + maximumConcurrentTasks int + + // Indicates that we should shutdown working goroutine. + shouldShutdown bool + shouldShutdownMutex sync.Mutex + + // Indicates that goroutine was successfully shutdown. + shuttedDown chan bool +) + +// AddTask adds task to processing queue. +func AddTask(task *Task) { + tasksMutex.Lock() + tasks = append(tasks, task) + tasksMutex.Unlock() +} + +// Initialize initializes package. +func Initialize() { + log.Println("Initializing converter...") + + tasks = make([]*Task, 0, 64) + shuttedDown = make(chan bool, 1) + + flag.IntVar(&maximumConcurrentTasks, "maxconcurrency", 1, "Maximum conversion tasks that should be run concurrently") + + handler := &nats.Handler{ + Name: "converter", + Func: natsMessageHandler, + } + nats.AddHandler(handler) +} + +func natsMessageHandler(data []byte) { + t := &Task{} + json.Unmarshal(data, t) + log.Printf("Received task: %+v\n", t) + + tasksMutex.Lock() + tasks = append(tasks, t) + tasksMutex.Unlock() +} + +// Shutdown sets shutdown flag and waits until shuttedDown channel will +// get any message means that shutdown was completed. +func Shutdown() { + log.Println("Starting converter shutdown...") + shouldShutdownMutex.Lock() + shouldShutdown = true + shouldShutdownMutex.Unlock() + + <-shuttedDown + log.Println("Converter shutted down") +} + +// Start starts working goroutine. +func Start() { + log.Println("Starting converter controlling goroutine...") + log.Println("Maximum simultaneous tasks to run:", maximumConcurrentTasks) + findffmpeg() + + go startReally() +} + +// Real start for working goroutine. +func startReally() { + tick := time.NewTicker(time.Second * 1) + for range tick.C { + // Check for shutdown. + // Boolean values aren't goroutine-safe that's why we create local + // copy of package variable. + shouldShutdownMutex.Lock() + weHaveToShutdown := shouldShutdown + shouldShutdownMutex.Unlock() + + if weHaveToShutdown { + log.Println("Stopping tasks distribution...") + break + } + + // Check for tasks available and currently running counts. + currentlyRunningMutex.Lock() + curRunning := currentlyRunning + currentlyRunningMutex.Unlock() + + // Skip iteration if we have maximum tasks launched. + if curRunning >= maximumConcurrentTasks { + continue + } + + // Check if we have tasks at all. + tasksMutex.Lock() + tasksCount := len(tasks) + tasksMutex.Unlock() + if tasksCount == 0 { + log.Println("No tasks to launch") + continue + } + + // If we're here - we should launch a task! Lets get them. + tasksToRunCount := maximumConcurrentTasks - curRunning + tasksToRun := make([]*Task, 0, tasksToRunCount) + tasksMutex.Lock() + // To ensure that our tasks queue will be clean we will copy + // queue, clear it and re-add if queue items still be there. + tasksQueue := make([]*Task, 0, tasksCount) + tasksQueue = append(tasksQueue, tasks...) + tasksMutex.Unlock() + + // Get tasks list to launch. + for taskID, task := range tasksQueue { + if taskID == tasksToRunCount { + break + } + tasksToRun = append(tasksToRun, task) + } + // Remove tasks that will be launched now. + tasksQueue = tasksQueue[tasksToRunCount:] + // Re-add remaining tasks to queue. + // Note: if another task was added to queue while we compose + // our tasks list to launch - it will be executed BEFORE remaining + // tasks. + tasksMutex.Lock() + tasks = append(tasks, tasksQueue...) + tasksMutex.Unlock() + + log.Println("Got", len(tasksToRun), "tasks to run") + + // Launch tasks. + for _, task := range tasksToRun { + go task.Convert() + } + } + + // Waiting until all child goroutines will also shut down. + log.Println("Waiting for all child goroutines to stop...") + shutdownTicker := time.NewTicker(time.Millisecond * 500) + for range shutdownTicker.C { + currentlyRunningMutex.Lock() + curRunning := currentlyRunning + currentlyRunningMutex.Unlock() + + log.Println("Currently running converter goroutines:", curRunning) + if curRunning == 0 { + break + } + } + + shuttedDown <- true +} diff --git a/converter/find_ffmpeg.go b/converter/find_ffmpeg.go new file mode 100644 index 0000000..6ea1440 --- /dev/null +++ b/converter/find_ffmpeg.go @@ -0,0 +1,36 @@ +package converter + +import ( + // stdlib + "bytes" + "log" + "os/exec" + "strings" +) + +func findffmpeg() { + // Search for ffmpeg. + var err error + ffmpegPath, err = exec.LookPath("ffmpeg") + if err != nil { + log.Fatalln("Failed to find ffmpeg in path:", err.Error()) + } + + // Get ffmpeg version. + stdout := bytes.NewBuffer(nil) + ffmpegVersionCmd := exec.Command(ffmpegPath, "-version") + ffmpegVersionCmd.Stdout = stdout + err1 := ffmpegVersionCmd.Run() + if err1 != nil { + log.Fatalln("Failed to get ffmpeg version:", err1.Error()) + } + + stdoutString := stdout.String() + if len(stdoutString) == 0 { + log.Fatalln("Something weird happened and '" + ffmpegPath + " -version' returns nothing! Check your ffmpeg installation!") + } + // ffmpeg prints it's version on line 1. + ffmpegVersion := strings.Split(stdoutString, " ")[2] + + log.Println("ffmpeg found at", ffmpegPath, "with version", ffmpegVersion) +} diff --git a/converter/task.go b/converter/task.go new file mode 100644 index 0000000..243880b --- /dev/null +++ b/converter/task.go @@ -0,0 +1,101 @@ +package converter + +import ( + // stdlib + "bufio" + "log" + "os/exec" + "time" +) + +// Task represents a single task received via NATS. +type Task struct { + Name string + InputFile string + OutputFile string + + // Filed in conversion. + totalFrames int + + // State information. + gotInput bool + gotDuration bool + + // File info. + duration string +} + +// Convert launches conversion procedure. Should be launched in separate +// goroutine. +func (t *Task) Convert() { + log.Printf("Starting conversion task: %+v\n", t) + currentlyRunningMutex.Lock() + currentlyRunning++ + currentlyRunningMutex.Unlock() + + defer func() { + currentlyRunningMutex.Lock() + currentlyRunning-- + currentlyRunningMutex.Unlock() + }() + + ffmpegCmd := exec.Command(ffmpegPath, "-i", t.InputFile, "-c:v", "libx264", "-b:v", "1000k", "-c:a", "aac", "-f", "mp4", t.OutputFile, "-y") + stderr, err := ffmpegCmd.StderrPipe() + if err != nil { + log.Fatalln("Error while preparing to redirect ffmpeg's stderr:", err.Error()) + } + stderrScanner := bufio.NewScanner(stderr) + stderrScanner.Split(bufio.ScanWords) + + // We will check state every 500ms. + go func() { + checkTick := time.NewTicker(time.Millisecond * 500) + err1 := ffmpegCmd.Start() + if err1 != nil { + log.Fatalln("Failed to start ffmpeg:", err1.Error()) + } + + for range checkTick.C { + // Should we shutdown immediately? + shouldShutdownMutex.Lock() + shouldWeStop := shouldShutdown + shouldShutdownMutex.Unlock() + + if shouldWeStop { + log.Println("Killing converter goroutine...") + err := ffmpegCmd.Process.Kill() + if err != nil { + log.Println("ERROR: failed to kill ffmpeg process:", err.Error()) + } + ffmpegCmd.Process.Release() + break + } + } + + log.Println("Child ffmpeg process killed") + }() + + // Read output. + for { + // Should we shutdown immediately? + shouldShutdownMutex.Lock() + shouldWeStop := shouldShutdown + shouldShutdownMutex.Unlock() + if shouldWeStop { + break + } + + stderrScanner.Scan() + t.workWithOutput(stderrScanner.Text()) + } + + log.Println("Stopped reading ffmpeg output") +} + +// Printing progress for this task. +func (t *Task) workWithOutput(output string) { + if output == "" { + return + } + +} diff --git a/data/.gitkeep b/data/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/docker-compose.yaml b/docker-compose.yaml new file mode 100644 index 0000000..3c326dd --- /dev/null +++ b/docker-compose.yaml @@ -0,0 +1,13 @@ +version: "3.7" + +services: + nats: + image: "nats:1.4.1" + command: "-c gnatsd.conf -DV" + ports: + # Clients. + - "14222:4222" + # Clustering. + - "16222:6222" + # HTTP management. + - "18222:8222" diff --git a/ffmpeger.dist.yaml b/ffmpeger.dist.yaml new file mode 100644 index 0000000..ab98250 --- /dev/null +++ b/ffmpeger.dist.yaml @@ -0,0 +1,2 @@ +nats: + connection_string: "nats://127.0.0.1:14222" \ No newline at end of file diff --git a/nats/exported.go b/nats/exported.go new file mode 100644 index 0000000..56a4cc7 --- /dev/null +++ b/nats/exported.go @@ -0,0 +1,87 @@ +package nats + +import ( + // stdlib + "log" + "sync" + + // local + "github.com/pztrn/ffmpeger/config" + + // other + "github.com/nats-io/nats.go" +) + +const ( + Topic = "ffmpeger.v1" +) + +var ( + natsConn *nats.Conn + natsSubscription *nats.Subscription + + // Handlers. + handlers []*Handler + handlersMutex sync.Mutex +) + +// AddHandler adds handler for received NATS messages. +func AddHandler(hndl *Handler) { + handlersMutex.Lock() + handlers = append(handlers, hndl) + handlersMutex.Unlock() +} + +// Initialize initializes package. +func Initialize() { + log.Println("Initializing NATS handler...") + + handlers = make([]*Handler, 0, 8) +} + +// Handler for NATS messages. +func messageHandler(msg *nats.Msg) { + log.Println("Received message:", string(msg.Data)) + + handlersMutex.Lock() + for _, hndl := range handlers { + hndl.Func(msg.Data) + } + handlersMutex.Unlock() +} + +// Shutdown unsubscribes from topic and disconnects from NATS. +func Shutdown() { + log.Println("Unsuscribing from NATS topic...") + err := natsSubscription.Unsubscribe() + if err != nil { + log.Println("ERROR unsubscribing", Topic, "topic:", err.Error()) + } + + if natsConn != nil { + log.Println("Closing connection to NATS...") + natsConn.Close() + } else { + log.Println("Connection to NATS wasn't established") + } +} + +// StartListening connects to NATS and starts to listen for messages. +func StartListening() { + nc, err := nats.Connect(config.Cfg.NATS.ConnectionString) + if err != nil { + log.Fatalln("Failed to connect to NATS:", err.Error()) + } + + natsConn = nc + log.Println("NATS connection established") + + // Beware - if ffmpeger will be launched more than once and subscribed + // to same topic (which is hardcoded here) then ALL instances of + // ffmpeger will receive this message! + sub, err1 := nc.Subscribe(Topic, messageHandler) + if err1 != nil { + log.Fatalln("Failed to subscribe to", Topic, "topic:", err1.Error()) + } + natsSubscription = sub +} diff --git a/nats/handler.go b/nats/handler.go new file mode 100644 index 0000000..09b0eb3 --- /dev/null +++ b/nats/handler.go @@ -0,0 +1,6 @@ +package nats + +type Handler struct { + Name string + Func func(data []byte) +} diff --git a/vendor/github.com/nats-io/go-nats/LICENSE b/vendor/github.com/nats-io/go-nats/LICENSE new file mode 100644 index 0000000..261eeb9 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go new file mode 100644 index 0000000..46d918e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go @@ -0,0 +1,117 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "bytes" + "fmt" + "reflect" + "strconv" + "unsafe" +) + +// DefaultEncoder implementation for EncodedConn. +// This encoder will leave []byte and string untouched, but will attempt to +// turn numbers into appropriate strings that can be decoded. It will also +// propely encoded and decode bools. If will encode a struct, but if you want +// to properly handle structures you should use JsonEncoder. +type DefaultEncoder struct { + // Empty +} + +var trueB = []byte("true") +var falseB = []byte("false") +var nilB = []byte("") + +// Encode +func (je *DefaultEncoder) Encode(subject string, v interface{}) ([]byte, error) { + switch arg := v.(type) { + case string: + bytes := *(*[]byte)(unsafe.Pointer(&arg)) + return bytes, nil + case []byte: + return arg, nil + case bool: + if arg { + return trueB, nil + } else { + return falseB, nil + } + case nil: + return nilB, nil + default: + var buf bytes.Buffer + fmt.Fprintf(&buf, "%+v", arg) + return buf.Bytes(), nil + } +} + +// Decode +func (je *DefaultEncoder) Decode(subject string, data []byte, vPtr interface{}) error { + // Figure out what it's pointing to... + sData := *(*string)(unsafe.Pointer(&data)) + switch arg := vPtr.(type) { + case *string: + *arg = sData + return nil + case *[]byte: + *arg = data + return nil + case *int: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int(n) + return nil + case *int32: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int32(n) + return nil + case *int64: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int64(n) + return nil + case *float32: + n, err := strconv.ParseFloat(sData, 32) + if err != nil { + return err + } + *arg = float32(n) + return nil + case *float64: + n, err := strconv.ParseFloat(sData, 64) + if err != nil { + return err + } + *arg = float64(n) + return nil + case *bool: + b, err := strconv.ParseBool(sData) + if err != nil { + return err + } + *arg = b + return nil + default: + vt := reflect.TypeOf(arg).Elem() + return fmt.Errorf("nats: Default Encoder can't decode to type %s", vt) + } +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go new file mode 100644 index 0000000..632bcbd --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go @@ -0,0 +1,45 @@ +// Copyright 2013-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "bytes" + "encoding/gob" +) + +// GobEncoder is a Go specific GOB Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/gob to Marshal +// and Unmarshal most types, including structs. +type GobEncoder struct { + // Empty +} + +// FIXME(dlc) - This could probably be more efficient. + +// Encode +func (ge *GobEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b := new(bytes.Buffer) + enc := gob.NewEncoder(b) + if err := enc.Encode(v); err != nil { + return nil, err + } + return b.Bytes(), nil +} + +// Decode +func (ge *GobEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + dec := gob.NewDecoder(bytes.NewBuffer(data)) + err = dec.Decode(vPtr) + return +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go new file mode 100644 index 0000000..c9670f3 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go @@ -0,0 +1,56 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package builtin + +import ( + "encoding/json" + "strings" +) + +// JsonEncoder is a JSON Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/json to Marshal +// and Unmarshal most types, including structs. +type JsonEncoder struct { + // Empty +} + +// Encode +func (je *JsonEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b, err := json.Marshal(v) + if err != nil { + return nil, err + } + return b, nil +} + +// Decode +func (je *JsonEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + switch arg := vPtr.(type) { + case *string: + // If they want a string and it is a JSON string, strip quotes + // This allows someone to send a struct but receive as a plain string + // This cast should be efficient for Go 1.3 and beyond. + str := string(data) + if strings.HasPrefix(str, `"`) && strings.HasSuffix(str, `"`) { + *arg = str[1 : len(str)-1] + } else { + *arg = str + } + case *[]byte: + *arg = data + default: + err = json.Unmarshal(data, arg) + } + return +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls.go b/vendor/github.com/nats-io/go-nats/util/tls.go new file mode 100644 index 0000000..53ff9aa --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls.go @@ -0,0 +1,27 @@ +// Copyright 2017-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.8 + +package util + +import "crypto/tls" + +// CloneTLSConfig returns a copy of c. +func CloneTLSConfig(c *tls.Config) *tls.Config { + if c == nil { + return &tls.Config{} + } + + return c.Clone() +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls_go17.go b/vendor/github.com/nats-io/go-nats/util/tls_go17.go new file mode 100644 index 0000000..fd646d3 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls_go17.go @@ -0,0 +1,49 @@ +// Copyright 2016-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.7,!go1.8 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + DynamicRecordSizingDisabled: c.DynamicRecordSizingDisabled, + Renegotiation: c.Renegotiation, + } +} diff --git a/vendor/github.com/nats-io/nats.go/.gitignore b/vendor/github.com/nats-io/nats.go/.gitignore new file mode 100644 index 0000000..3d5981f --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/.gitignore @@ -0,0 +1,39 @@ +# Compiled Object files, Static and Dynamic libs (Shared Objects) +*.o +*.a +*.so + +# Folders +_obj +_test + +# Architecture specific extensions/prefixes +*.[568vq] +[568vq].out + +*.cgo1.go +*.cgo2.c +_cgo_defun.c +_cgo_gotypes.go +_cgo_export.* + +_testmain.go + +*.exe + +# Emacs +*~ +\#*\# +.\#* + +# vi/vim +.??*.swp + +# Mac +.DS_Store + +# Eclipse +.project +.settings/ + +# bin diff --git a/vendor/github.com/nats-io/nats.go/.travis.yml b/vendor/github.com/nats-io/nats.go/.travis.yml new file mode 100644 index 0000000..b46060d --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/.travis.yml @@ -0,0 +1,21 @@ +language: go +sudo: false +go: +- 1.11.x +- 1.10.x +go_import_path: github.com/nats-io/go-nats +install: +- go get -t ./... +- go get github.com/nats-io/gnatsd +- go get github.com/mattn/goveralls +- go get github.com/wadey/gocovmerge +- go get -u honnef.co/go/tools/cmd/staticcheck +- go get -u github.com/client9/misspell/cmd/misspell +before_script: +- $(exit $(go fmt ./... | wc -l)) +- go vet ./... +- misspell -error -locale US . +- staticcheck -ignore "$(cat staticcheck.ignore)" ./... +script: +- go test -i -race ./... +- if [[ "$TRAVIS_GO_VERSION" =~ 1.11 ]]; then ./scripts/cov.sh TRAVIS; else go test -race ./...; fi diff --git a/vendor/github.com/nats-io/nats.go/GOVERNANCE.md b/vendor/github.com/nats-io/nats.go/GOVERNANCE.md new file mode 100644 index 0000000..1d5a7be --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/GOVERNANCE.md @@ -0,0 +1,3 @@ +# NATS Go Client Governance + +NATS Go Client (go-nats) is part of the NATS project and is subject to the [NATS Governance](https://github.com/nats-io/nats-general/blob/master/GOVERNANCE.md). \ No newline at end of file diff --git a/vendor/github.com/nats-io/nats.go/LICENSE b/vendor/github.com/nats-io/nats.go/LICENSE new file mode 100644 index 0000000..261eeb9 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/nats-io/nats.go/MAINTAINERS.md b/vendor/github.com/nats-io/nats.go/MAINTAINERS.md new file mode 100644 index 0000000..323faa8 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/MAINTAINERS.md @@ -0,0 +1,10 @@ +# Maintainers + +Maintainership is on a per project basis. + +### Core-maintainers + - Derek Collison [@derekcollison](https://github.com/derekcollison) + - Ivan Kozlovic [@kozlovic](https://github.com/kozlovic) + +### Maintainers + - Waldemar Quevedo [@wallyqs](https://github.com/wallyqs) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nats.go/README.md b/vendor/github.com/nats-io/nats.go/README.md new file mode 100644 index 0000000..a2bbdf9 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/README.md @@ -0,0 +1,384 @@ +# NATS - Go Client +A [Go](http://golang.org) client for the [NATS messaging system](https://nats.io). + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats?ref=badge_shield) +[![Go Report Card](https://goreportcard.com/badge/github.com/nats-io/go-nats)](https://goreportcard.com/report/github.com/nats-io/go-nats) [![Build Status](https://travis-ci.org/nats-io/go-nats.svg?branch=master)](http://travis-ci.org/nats-io/go-nats) [![GoDoc](https://godoc.org/github.com/nats-io/go-nats?status.svg)](http://godoc.org/github.com/nats-io/go-nats) [![Coverage Status](https://coveralls.io/repos/nats-io/go-nats/badge.svg?branch=master)](https://coveralls.io/r/nats-io/go-nats?branch=master) + +## Installation + +```bash +# Go client +go get github.com/nats-io/go-nats + +# Server +go get github.com/nats-io/gnatsd +``` + +## Basic Usage + +```go +import nats "github.com/nats-io/go-nats" + +// Connect to a server +nc, _ := nats.Connect(nats.DefaultURL) + +// Simple Publisher +nc.Publish("foo", []byte("Hello World")) + +// Simple Async Subscriber +nc.Subscribe("foo", func(m *nats.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +// Simple Sync Subscriber +sub, err := nc.SubscribeSync("foo") +m, err := sub.NextMsg(timeout) + +// Channel Subscriber +ch := make(chan *nats.Msg, 64) +sub, err := nc.ChanSubscribe("foo", ch) +msg := <- ch + +// Unsubscribe +sub.Unsubscribe() + +// Drain +sub.Drain() + +// Requests +msg, err := nc.Request("help", []byte("help me"), 10*time.Millisecond) + +// Replies +nc.Subscribe("help", func(m *Msg) { + nc.Publish(m.Reply, []byte("I can help!")) +}) + +// Drain connection (Preferred for responders) +// Close() not needed if this is called. +nc.Drain() + +// Close connection +nc.Close() +``` + +## Encoded Connections + +```go + +nc, _ := nats.Connect(nats.DefaultURL) +c, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer c.Close() + +// Simple Publisher +c.Publish("foo", "Hello World") + +// Simple Async Subscriber +c.Subscribe("foo", func(s string) { + fmt.Printf("Received a message: %s\n", s) +}) + +// EncodedConn can Publish any raw Go type using the registered Encoder +type person struct { + Name string + Address string + Age int +} + +// Go type Subscriber +c.Subscribe("hello", func(p *person) { + fmt.Printf("Received a person: %+v\n", p) +}) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street, San Francisco, CA"} + +// Go type Publisher +c.Publish("hello", me) + +// Unsubscribe +sub, err := c.Subscribe("foo", nil) +... +sub.Unsubscribe() + +// Requests +var response string +err := c.Request("help", "help me", &response, 10*time.Millisecond) +if err != nil { + fmt.Printf("Request failed: %v\n", err) +} + +// Replying +c.Subscribe("help", func(subj, reply string, msg string) { + c.Publish(reply, "I can help!") +}) + +// Close connection +c.Close(); +``` + +## New Authentication (Nkeys and User Credentials) +This requires server with version >= 2.0.0 + +NATS servers have a new security and authentication mechanism to authenticate with user credentials and Nkeys. +The simplest form is to use the helper method UserCredentials(credsFilepath). +```go +nc, err := nats.Connect(url, UserCredentials("user.creds")) +``` + +The helper methos creates two callback handlers to present the user JWT and sign the nonce challenge from the server. +The core client library never has direct access to your private key and simply performs the callback for signing the server challenge. +The helper will load and wipe and erase memory it uses for each connect or reconnect. + +The helper also can take two entries, one for the JWT and one for the NKey seed file. +```go +nc, err := nats.Connect(url, UserCredentials("user.jwt", "user.nk")) +``` + +You can also set the callback handlers directly and manage challenge signing directly. +```go +nc, err := nats.Connect(url, UserJWT(jwtCB, sigCB)) +``` + +Bare Nkeys are also supported. The nkey seed should be in a read only file, e.g. seed.txt +```bash +> cat seed.txt +# This is my seed nkey! +SUAGMJH5XLGZKQQWAWKRZJIGMOU4HPFUYLXJMXOO5NLFEO2OOQJ5LPRDPM +``` + +This is a helper function which will load and decode and do the proper signing for the server nonce. +It will clear memory in between invocations. +You can choose to use the low level option and provide the public key and a signature callback on your own. + +```go +opt, err := nats.NkeyOptionFromSeed("seed.txt") +nc, err := nats.Connect(serverUrl, opt) + +// Direct +nc, err := nats.Connect(serverUrl, Nkey(pubNkey, sigCB)) +``` + +## TLS + +```go +// tls as a scheme will enable secure connections by default. This will also verify the server name. +nc, err := nats.Connect("tls://nats.demo.io:4443") + +// If you are using a self-signed certificate, you need to have a tls.Config with RootCAs setup. +// We provide a helper method to make this case easier. +nc, err = nats.Connect("tls://localhost:4443", nats.RootCAs("./configs/certs/ca.pem")) + +// If the server requires client certificate, there is an helper function for that too: +cert := nats.ClientCert("./configs/certs/client-cert.pem", "./configs/certs/client-key.pem") +nc, err = nats.Connect("tls://localhost:4443", cert) + +// You can also supply a complete tls.Config + +certFile := "./configs/certs/client-cert.pem" +keyFile := "./configs/certs/client-key.pem" +cert, err := tls.LoadX509KeyPair(certFile, keyFile) +if err != nil { + t.Fatalf("error parsing X509 certificate/key pair: %v", err) +} + +config := &tls.Config{ + ServerName: opts.Host, + Certificates: []tls.Certificate{cert}, + RootCAs: pool, + MinVersion: tls.VersionTLS12, +} + +nc, err = nats.Connect("nats://localhost:4443", nats.Secure(config)) +if err != nil { + t.Fatalf("Got an error on Connect with Secure Options: %+v\n", err) +} + +``` + +## Using Go Channels (netchan) + +```go +nc, _ := nats.Connect(nats.DefaultURL) +ec, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer ec.Close() + +type person struct { + Name string + Address string + Age int +} + +recvCh := make(chan *person) +ec.BindRecvChan("hello", recvCh) + +sendCh := make(chan *person) +ec.BindSendChan("hello", sendCh) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street"} + +// Send via Go channels +sendCh <- me + +// Receive via Go channels +who := <- recvCh +``` + +## Wildcard Subscriptions + +```go + +// "*" matches any token, at any level of the subject. +nc.Subscribe("foo.*.baz", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +nc.Subscribe("foo.bar.*", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// ">" matches any length of the tail of a subject, and can only be the last token +// E.g. 'foo.>' will match 'foo.bar', 'foo.bar.baz', 'foo.foo.bar.bax.22' +nc.Subscribe("foo.>", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// Matches all of the above +nc.Publish("foo.bar.baz", []byte("Hello World")) + +``` + +## Queue Groups + +```go +// All subscriptions with the same queue name will form a queue group. +// Each message will be delivered to only one subscriber per queue group, +// using queuing semantics. You can have as many queue groups as you wish. +// Normal subscribers will continue to work as expected. + +nc.QueueSubscribe("foo", "job_workers", func(_ *Msg) { + received += 1; +}) + +``` + +## Advanced Usage + +```go + +// Flush connection to server, returns when all messages have been processed. +nc.Flush() +fmt.Println("All clear!") + +// FlushTimeout specifies a timeout value as well. +err := nc.FlushTimeout(1*time.Second) +if err != nil { + fmt.Println("All clear!") +} else { + fmt.Println("Flushed timed out!") +} + +// Auto-unsubscribe after MAX_WANTED messages received +const MAX_WANTED = 10 +sub, err := nc.Subscribe("foo") +sub.AutoUnsubscribe(MAX_WANTED) + +// Multiple connections +nc1 := nats.Connect("nats://host1:4222") +nc2 := nats.Connect("nats://host2:4222") + +nc1.Subscribe("foo", func(m *Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +nc2.Publish("foo", []byte("Hello World!")); + +``` + +## Clustered Usage + +```go + +var servers = "nats://localhost:1222, nats://localhost:1223, nats://localhost:1224" + +nc, err := nats.Connect(servers) + +// Optionally set ReconnectWait and MaxReconnect attempts. +// This example means 10 seconds total per backend. +nc, err = nats.Connect(servers, nats.MaxReconnects(5), nats.ReconnectWait(2 * time.Second)) + +// Optionally disable randomization of the server pool +nc, err = nats.Connect(servers, nats.DontRandomize()) + +// Setup callbacks to be notified on disconnects, reconnects and connection closed. +nc, err = nats.Connect(servers, + nats.DisconnectHandler(func(nc *nats.Conn) { + fmt.Printf("Got disconnected!\n") + }), + nats.ReconnectHandler(func(nc *nats.Conn) { + fmt.Printf("Got reconnected to %v!\n", nc.ConnectedUrl()) + }), + nats.ClosedHandler(func(nc *nats.Conn) { + fmt.Printf("Connection closed. Reason: %q\n", nc.LastError()) + }) +) + +// When connecting to a mesh of servers with auto-discovery capabilities, +// you may need to provide a username/password or token in order to connect +// to any server in that mesh when authentication is required. +// Instead of providing the credentials in the initial URL, you will use +// new option setters: +nc, err = nats.Connect("nats://localhost:4222", nats.UserInfo("foo", "bar")) + +// For token based authentication: +nc, err = nats.Connect("nats://localhost:4222", nats.Token("S3cretT0ken")) + +// You can even pass the two at the same time in case one of the server +// in the mesh requires token instead of user name and password. +nc, err = nats.Connect("nats://localhost:4222", + nats.UserInfo("foo", "bar"), + nats.Token("S3cretT0ken")) + +// Note that if credentials are specified in the initial URLs, they take +// precedence on the credentials specfied through the options. +// For instance, in the connect call below, the client library will use +// the user "my" and password "pwd" to connect to locahost:4222, however, +// it will use username "foo" and password "bar" when (re)connecting to +// a different server URL that it got as part of the auto-discovery. +nc, err = nats.Connect("nats://my:pwd@localhost:4222", nats.UserInfo("foo", "bar")) + +``` + +## Context support (+Go 1.7) + +```go +ctx, cancel := context.WithTimeout(context.Background(), 2*time.Second) +defer cancel() + +nc, err := nats.Connect(nats.DefaultURL) + +// Request with context +msg, err := nc.RequestWithContext(ctx, "foo", []byte("bar")) + +// Synchronous subscriber with context +sub, err := nc.SubscribeSync("foo") +msg, err := sub.NextMsgWithContext(ctx) + +// Encoded Request with context +c, err := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +type request struct { + Message string `json:"message"` +} +type response struct { + Code int `json:"code"` +} +req := &request{Message: "Hello"} +resp := &response{} +err := c.RequestWithContext(ctx, "foo", req, resp) +``` + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. + +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats.svg?type=large)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fgo-nats?ref=badge_large) diff --git a/vendor/github.com/nats-io/nats.go/TODO.md b/vendor/github.com/nats-io/nats.go/TODO.md new file mode 100644 index 0000000..213aaec --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/TODO.md @@ -0,0 +1,26 @@ + +- [ ] Better constructors, options handling +- [ ] Functions for callback settings after connection created. +- [ ] Better options for subscriptions. Slow Consumer state settable, Go routines vs Inline. +- [ ] Move off of channels for subscribers, use syncPool linkedLists, etc with highwater. +- [ ] Test for valid subjects on publish and subscribe? +- [ ] SyncSubscriber and Next for EncodedConn +- [ ] Fast Publisher? +- [ ] pooling for structs used? leaky bucket? +- [ ] Timeout 0 should work as no timeout +- [x] Ping timer +- [x] Name in Connect for gnatsd +- [x] Asynchronous error handling +- [x] Parser rewrite +- [x] Reconnect +- [x] Hide Lock +- [x] Easier encoder interface +- [x] QueueSubscribeSync +- [x] Make nats specific errors prefixed with 'nats:' +- [x] API test for closed connection +- [x] TLS/SSL +- [x] Stats collection +- [x] Disconnect detection +- [x] Optimized Publish (coalescing) +- [x] Do Examples via Go style +- [x] Standardized Errors diff --git a/vendor/github.com/nats-io/nats.go/context.go b/vendor/github.com/nats-io/nats.go/context.go new file mode 100644 index 0000000..ee5576f --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/context.go @@ -0,0 +1,241 @@ +// Copyright 2016-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.7 + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "context" + "reflect" +) + +// RequestWithContext takes a context, a subject and payload +// in bytes and request expecting a single response. +func (nc *Conn) RequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if nc == nil { + return nil, ErrInvalidConnection + } + // Check whether the context is done already before making + // the request. + if ctx.Err() != nil { + return nil, ctx.Err() + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequestWithContext(ctx, subj, data) + } + + // Do setup for the new style. + if nc.respMap == nil { + nc.initNewResp() + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + err := nc.PublishRequest(subj, respInbox, data) + if err != nil { + return nil, err + } + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-ctx.Done(): + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ctx.Err() + } + + return msg, nil +} + +// oldRequestWithContext utilizes inbox and subscription per request. +func (nc *Conn) oldRequestWithContext(ctx context.Context, subj string, data []byte) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + + return s.NextMsgWithContext(ctx) +} + +// NextMsgWithContext takes a context and returns the next message +// available to a synchronous subscriber, blocking until it is delivered +// or context gets canceled. +func (s *Subscription) NextMsgWithContext(ctx context.Context) (*Msg, error) { + if ctx == nil { + return nil, ErrInvalidContext + } + if s == nil { + return nil, ErrBadSubscription + } + if ctx.Err() != nil { + return nil, ctx.Err() + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + // If something is available right away, let's optimize that case. + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } else { + return msg, nil + } + default: + } + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } + case <-ctx.Done(): + return nil, ctx.Err() + } + + return msg, nil +} + +// FlushWithContext will allow a context to control the duration +// of a Flush() call. This context should be non-nil and should +// have a deadline set. We will return an error if none is present. +func (nc *Conn) FlushWithContext(ctx context.Context) error { + if nc == nil { + return ErrInvalidConnection + } + if ctx == nil { + return ErrInvalidContext + } + _, ok := ctx.Deadline() + if !ok { + return ErrNoDeadlineContext + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + // Create a buffered channel to prevent chan send to block + // in processPong() + ch := make(chan struct{}, 1) + nc.sendPing(ch) + nc.mu.Unlock() + + var err error + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-ctx.Done(): + err = ctx.Err() + } + + if err != nil { + nc.removeFlushEntry(ch) + } + + return err +} + +// RequestWithContext will create an Inbox and perform a Request +// using the provided cancellation context with the Inbox reply +// for the data v. A response will be decoded into the vPtrResponse. +func (c *EncodedConn) RequestWithContext(ctx context.Context, subject string, v interface{}, vPtr interface{}) error { + if ctx == nil { + return ErrInvalidContext + } + + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.RequestWithContext(ctx, subject, b) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err := c.Enc.Decode(m.Subject, m.Data, vPtr) + if err != nil { + return err + } + } + + return nil +} diff --git a/vendor/github.com/nats-io/nats.go/enc.go b/vendor/github.com/nats-io/nats.go/enc.go new file mode 100644 index 0000000..9a0dd2c --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/enc.go @@ -0,0 +1,269 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "errors" + "fmt" + "reflect" + "sync" + "time" + + // Default Encoders + "github.com/nats-io/go-nats/encoders/builtin" +) + +// Encoder interface is for all register encoders +type Encoder interface { + Encode(subject string, v interface{}) ([]byte, error) + Decode(subject string, data []byte, vPtr interface{}) error +} + +var encMap map[string]Encoder +var encLock sync.Mutex + +// Indexe names into the Registered Encoders. +const ( + JSON_ENCODER = "json" + GOB_ENCODER = "gob" + DEFAULT_ENCODER = "default" +) + +func init() { + encMap = make(map[string]Encoder) + // Register json, gob and default encoder + RegisterEncoder(JSON_ENCODER, &builtin.JsonEncoder{}) + RegisterEncoder(GOB_ENCODER, &builtin.GobEncoder{}) + RegisterEncoder(DEFAULT_ENCODER, &builtin.DefaultEncoder{}) +} + +// EncodedConn are the preferred way to interface with NATS. They wrap a bare connection to +// a nats server and have an extendable encoder system that will encode and decode messages +// from raw Go types. +type EncodedConn struct { + Conn *Conn + Enc Encoder +} + +// NewEncodedConn will wrap an existing Connection and utilize the appropriate registered +// encoder. +func NewEncodedConn(c *Conn, encType string) (*EncodedConn, error) { + if c == nil { + return nil, errors.New("nats: Nil Connection") + } + if c.IsClosed() { + return nil, ErrConnectionClosed + } + ec := &EncodedConn{Conn: c, Enc: EncoderForType(encType)} + if ec.Enc == nil { + return nil, fmt.Errorf("no encoder registered for '%s'", encType) + } + return ec, nil +} + +// RegisterEncoder will register the encType with the given Encoder. Useful for customization. +func RegisterEncoder(encType string, enc Encoder) { + encLock.Lock() + defer encLock.Unlock() + encMap[encType] = enc +} + +// EncoderForType will return the registered Encoder for the encType. +func EncoderForType(encType string) Encoder { + encLock.Lock() + defer encLock.Unlock() + return encMap[encType] +} + +// Publish publishes the data argument to the given subject. The data argument +// will be encoded using the associated encoder. +func (c *EncodedConn) Publish(subject string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, _EMPTY_, b) +} + +// PublishRequest will perform a Publish() expecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (c *EncodedConn) PublishRequest(subject, reply string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, reply, b) +} + +// Request will create an Inbox and perform a Request() call +// with the Inbox reply for the data v. A response will be +// decoded into the vPtrResponse. +func (c *EncodedConn) Request(subject string, v interface{}, vPtr interface{}, timeout time.Duration) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.Request(subject, b, timeout) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err = c.Enc.Decode(m.Subject, m.Data, vPtr) + } + return err +} + +// Handler is a specific callback used for Subscribe. It is generalized to +// an interface{}, but we will discover its format and arguments at runtime +// and perform the correct callback, including de-marshaling JSON strings +// back into the appropriate struct based on the signature of the Handler. +// +// Handlers are expected to have one of four signatures. +// +// type person struct { +// Name string `json:"name,omitempty"` +// Age uint `json:"age,omitempty"` +// } +// +// handler := func(m *Msg) +// handler := func(p *person) +// handler := func(subject string, o *obj) +// handler := func(subject, reply string, o *obj) +// +// These forms allow a callback to request a raw Msg ptr, where the processing +// of the message from the wire is untouched. Process a JSON representation +// and demarshal it into the given struct, e.g. person. +// There are also variants where the callback wants either the subject, or the +// subject and the reply subject. +type Handler interface{} + +// Dissect the cb Handler's signature +func argInfo(cb Handler) (reflect.Type, int) { + cbType := reflect.TypeOf(cb) + if cbType.Kind() != reflect.Func { + panic("nats: Handler needs to be a func") + } + numArgs := cbType.NumIn() + if numArgs == 0 { + return nil, numArgs + } + return cbType.In(numArgs - 1), numArgs +} + +var emptyMsgType = reflect.TypeOf(&Msg{}) + +// Subscribe will create a subscription on the given subject and process incoming +// messages using the specified Handler. The Handler should be a func that matches +// a signature from the description of Handler from above. +func (c *EncodedConn) Subscribe(subject string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, _EMPTY_, cb) +} + +// QueueSubscribe will create a queue subscription on the given subject and process +// incoming messages using the specified Handler. The Handler should be a func that +// matches a signature from the description of Handler from above. +func (c *EncodedConn) QueueSubscribe(subject, queue string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, queue, cb) +} + +// Internal implementation that all public functions will use. +func (c *EncodedConn) subscribe(subject, queue string, cb Handler) (*Subscription, error) { + if cb == nil { + return nil, errors.New("nats: Handler required for EncodedConn Subscription") + } + argType, numArgs := argInfo(cb) + if argType == nil { + return nil, errors.New("nats: Handler requires at least one argument") + } + + cbValue := reflect.ValueOf(cb) + wantsRaw := (argType == emptyMsgType) + + natsCB := func(m *Msg) { + var oV []reflect.Value + if wantsRaw { + oV = []reflect.Value{reflect.ValueOf(m)} + } else { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach.push(func() { + c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, errors.New("nats: Got an error trying to unmarshal: "+err.Error())) + }) + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + + // Callback Arity + switch numArgs { + case 1: + oV = []reflect.Value{oPtr} + case 2: + subV := reflect.ValueOf(m.Subject) + oV = []reflect.Value{subV, oPtr} + case 3: + subV := reflect.ValueOf(m.Subject) + replyV := reflect.ValueOf(m.Reply) + oV = []reflect.Value{subV, replyV, oPtr} + } + + } + cbValue.Call(oV) + } + + return c.Conn.subscribe(subject, queue, natsCB, nil) +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (c *EncodedConn) FlushTimeout(timeout time.Duration) (err error) { + return c.Conn.FlushTimeout(timeout) +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (c *EncodedConn) Flush() error { + return c.Conn.Flush() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush(), etc. +func (c *EncodedConn) Close() { + c.Conn.Close() +} + +// Drain will put a connection into a drain state. All subscriptions will +// immediately be put into a drain state. Upon completion, the publishers +// will be drained and can not publish any additional messages. Upon draining +// of the publishers, the connection will be closed. Use the ClosedCB() +// option to know when the connection has moved from draining to closed. +func (c *EncodedConn) Drain() error { + return c.Conn.Drain() +} + +// LastError reports the last error encountered via the Connection. +func (c *EncodedConn) LastError() error { + return c.Conn.err +} diff --git a/vendor/github.com/nats-io/nats.go/nats.go b/vendor/github.com/nats-io/nats.go/nats.go new file mode 100644 index 0000000..ec43708 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/nats.go @@ -0,0 +1,3940 @@ +// Copyright 2012-2019 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "bufio" + "bytes" + "crypto/tls" + "crypto/x509" + "encoding/base64" + "encoding/json" + "errors" + "fmt" + "io" + "io/ioutil" + "math/rand" + "net" + "net/url" + "regexp" + "runtime" + "strconv" + "strings" + "sync" + "sync/atomic" + "time" + + "github.com/nats-io/go-nats/util" + "github.com/nats-io/nkeys" + "github.com/nats-io/nuid" +) + +// Default Constants +const ( + Version = "1.7.2" + DefaultURL = "nats://localhost:4222" + DefaultPort = 4222 + DefaultMaxReconnect = 60 + DefaultReconnectWait = 2 * time.Second + DefaultTimeout = 2 * time.Second + DefaultPingInterval = 2 * time.Minute + DefaultMaxPingOut = 2 + DefaultMaxChanLen = 8192 // 8k + DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB + RequestChanLen = 8 + DefaultDrainTimeout = 30 * time.Second + LangString = "go" +) + +const ( + // STALE_CONNECTION is for detection and proper handling of stale connections. + STALE_CONNECTION = "stale connection" + + // PERMISSIONS_ERR is for when nats server subject authorization has failed. + PERMISSIONS_ERR = "permissions violation" + + // AUTHORIZATION_ERR is for when nats server user authorization has failed. + AUTHORIZATION_ERR = "authorization violation" +) + +// Errors +var ( + ErrConnectionClosed = errors.New("nats: connection closed") + ErrConnectionDraining = errors.New("nats: connection draining") + ErrDrainTimeout = errors.New("nats: draining connection timed out") + ErrConnectionReconnecting = errors.New("nats: connection reconnecting") + ErrSecureConnRequired = errors.New("nats: secure connection required") + ErrSecureConnWanted = errors.New("nats: secure connection not available") + ErrBadSubscription = errors.New("nats: invalid subscription") + ErrTypeSubscription = errors.New("nats: invalid subscription type") + ErrBadSubject = errors.New("nats: invalid subject") + ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped") + ErrTimeout = errors.New("nats: timeout") + ErrBadTimeout = errors.New("nats: timeout invalid") + ErrAuthorization = errors.New("nats: authorization violation") + ErrNoServers = errors.New("nats: no servers available for connection") + ErrJsonParse = errors.New("nats: connect message, json parse error") + ErrChanArg = errors.New("nats: argument needs to be a channel type") + ErrMaxPayload = errors.New("nats: maximum payload exceeded") + ErrMaxMessages = errors.New("nats: maximum messages delivered") + ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription") + ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed") + ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received") + ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded") + ErrInvalidConnection = errors.New("nats: invalid connection") + ErrInvalidMsg = errors.New("nats: invalid message or message nil") + ErrInvalidArg = errors.New("nats: invalid argument") + ErrInvalidContext = errors.New("nats: invalid context") + ErrNoDeadlineContext = errors.New("nats: context requires a deadline") + ErrNoEchoNotSupported = errors.New("nats: no echo option not supported by this server") + ErrClientIDNotSupported = errors.New("nats: client ID not supported by this server") + ErrUserButNoSigCB = errors.New("nats: user callback defined without a signature handler") + ErrNkeyButNoSigCB = errors.New("nats: nkey defined without a signature handler") + ErrNoUserCB = errors.New("nats: user callback not defined") + ErrNkeyAndUser = errors.New("nats: user callback and nkey defined") + ErrNkeysNotSupported = errors.New("nats: nkeys not supported by the server") + ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION) + ErrTokenAlreadySet = errors.New("nats: token and token handler both set") +) + +// GetDefaultOptions returns default configuration options for the client. +func GetDefaultOptions() Options { + return Options{ + AllowReconnect: true, + MaxReconnect: DefaultMaxReconnect, + ReconnectWait: DefaultReconnectWait, + Timeout: DefaultTimeout, + PingInterval: DefaultPingInterval, + MaxPingsOut: DefaultMaxPingOut, + SubChanLen: DefaultMaxChanLen, + ReconnectBufSize: DefaultReconnectBufSize, + DrainTimeout: DefaultDrainTimeout, + } +} + +// DEPRECATED: Use GetDefaultOptions() instead. +// DefaultOptions is not safe for use by multiple clients. +// For details see #308. +var DefaultOptions = GetDefaultOptions() + +// Status represents the state of the connection. +type Status int + +const ( + DISCONNECTED = Status(iota) + CONNECTED + CLOSED + RECONNECTING + CONNECTING + DRAINING_SUBS + DRAINING_PUBS +) + +// ConnHandler is used for asynchronous events such as +// disconnected and closed connections. +type ConnHandler func(*Conn) + +// ErrHandler is used to process asynchronous errors encountered +// while processing inbound messages. +type ErrHandler func(*Conn, *Subscription, error) + +// UserJWTHandler is used to fetch and return the account signed +// JWT for this user. +type UserJWTHandler func() (string, error) + +// SignatureHandler is used to sign a nonce from the server while +// authenticating with nkeys. The user should sign the nonce and +// return the base64 encoded signature. +type SignatureHandler func([]byte) ([]byte, error) + +// AuthTokenHandler is used to generate a new token. +type AuthTokenHandler func() string + +// asyncCB is used to preserve order for async callbacks. +type asyncCB struct { + f func() + next *asyncCB +} + +type asyncCallbacksHandler struct { + mu sync.Mutex + cond *sync.Cond + head *asyncCB + tail *asyncCB +} + +// Option is a function on the options for a connection. +type Option func(*Options) error + +// CustomDialer can be used to specify any dialer, not necessarily +// a *net.Dialer. +type CustomDialer interface { + Dial(network, address string) (net.Conn, error) +} + +// Options can be used to create a customized connection. +type Options struct { + + // Url represents a single NATS server url to which the client + // will be connecting. If the Servers option is also set, it + // then becomes the first server in the Servers array. + Url string + + // Servers is a configured set of servers which this client + // will use when attempting to connect. + Servers []string + + // NoRandomize configures whether we will randomize the + // server pool. + NoRandomize bool + + // NoEcho configures whether the server will echo back messages + // that are sent on this connection if we also have matching subscriptions. + // Note this is supported on servers >= version 1.2. Proto 1 or greater. + NoEcho bool + + // Name is an optional name label which will be sent to the server + // on CONNECT to identify the client. + Name string + + // Verbose signals the server to send an OK ack for commands + // successfully processed by the server. + Verbose bool + + // Pedantic signals the server whether it should be doing further + // validation of subjects. + Pedantic bool + + // Secure enables TLS secure connections that skip server + // verification by default. NOT RECOMMENDED. + Secure bool + + // TLSConfig is a custom TLS configuration to use for secure + // transports. + TLSConfig *tls.Config + + // AllowReconnect enables reconnection logic to be used when we + // encounter a disconnect from the current server. + AllowReconnect bool + + // MaxReconnect sets the number of reconnect attempts that will be + // tried before giving up. If negative, then it will never give up + // trying to reconnect. + MaxReconnect int + + // ReconnectWait sets the time to backoff after attempting a reconnect + // to a server that we were already connected to previously. + ReconnectWait time.Duration + + // Timeout sets the timeout for a Dial operation on a connection. + Timeout time.Duration + + // DrainTimeout sets the timeout for a Drain Operation to complete. + DrainTimeout time.Duration + + // FlusherTimeout is the maximum time to wait for write operations + // to the underlying connection to complete (including the flusher loop). + FlusherTimeout time.Duration + + // PingInterval is the period at which the client will be sending ping + // commands to the server, disabled if 0 or negative. + PingInterval time.Duration + + // MaxPingsOut is the maximum number of pending ping commands that can + // be awaiting a response before raising an ErrStaleConnection error. + MaxPingsOut int + + // ClosedCB sets the closed handler that is called when a client will + // no longer be connected. + ClosedCB ConnHandler + + // DisconnectedCB sets the disconnected handler that is called + // whenever the connection is disconnected. + DisconnectedCB ConnHandler + + // ReconnectedCB sets the reconnected handler called whenever + // the connection is successfully reconnected. + ReconnectedCB ConnHandler + + // DiscoveredServersCB sets the callback that is invoked whenever a new + // server has joined the cluster. + DiscoveredServersCB ConnHandler + + // AsyncErrorCB sets the async error handler (e.g. slow consumer errors) + AsyncErrorCB ErrHandler + + // ReconnectBufSize is the size of the backing bufio during reconnect. + // Once this has been exhausted publish operations will return an error. + ReconnectBufSize int + + // SubChanLen is the size of the buffered channel used between the socket + // Go routine and the message delivery for SyncSubscriptions. + // NOTE: This does not affect AsyncSubscriptions which are + // dictated by PendingLimits() + SubChanLen int + + // UserJWT sets the callback handler that will fetch a user's JWT. + UserJWT UserJWTHandler + + // Nkey sets the public nkey that will be used to authenticate + // when connecting to the server. UserJWT and Nkey are mutually exclusive + // and if defined, UserJWT will take precedence. + Nkey string + + // SignatureCB designates the function used to sign the nonce + // presented from the server. + SignatureCB SignatureHandler + + // User sets the username to be used when connecting to the server. + User string + + // Password sets the password to be used when connecting to a server. + Password string + + // Token sets the token to be used when connecting to a server. + Token string + + // TokenHandler designates the function used to generate the token to be used when connecting to a server. + TokenHandler AuthTokenHandler + + // Dialer allows a custom net.Dialer when forming connections. + // DEPRECATED: should use CustomDialer instead. + Dialer *net.Dialer + + // CustomDialer allows to specify a custom dialer (not necessarily + // a *net.Dialer). + CustomDialer CustomDialer + + // UseOldRequestStyle forces the old method of Requests that utilize + // a new Inbox and a new Subscription for each request. + UseOldRequestStyle bool +} + +const ( + // Scratch storage for assembling protocol headers + scratchSize = 512 + + // The size of the bufio reader/writer on top of the socket. + defaultBufSize = 32768 + + // The buffered size of the flush "kick" channel + flushChanSize = 1024 + + // Default server pool size + srvPoolSize = 4 + + // NUID size + nuidSize = 22 + + // Default port used if none is specified in given URL(s) + defaultPortString = "4222" +) + +// A Conn represents a bare connection to a nats-server. +// It can send and receive []byte payloads. +type Conn struct { + // Keep all members for which we use atomic at the beginning of the + // struct and make sure they are all 64bits (or use padding if necessary). + // atomic.* functions crash on 32bit machines if operand is not aligned + // at 64bit. See https://github.com/golang/go/issues/599 + Statistics + mu sync.Mutex + // Opts holds the configuration of the Conn. + // Modifying the configuration of a running Conn is a race. + Opts Options + wg sync.WaitGroup + srvPool []*srv + current *srv + urls map[string]struct{} // Keep track of all known URLs (used by processInfo) + conn net.Conn + bw *bufio.Writer + pending *bytes.Buffer + fch chan struct{} + info serverInfo + ssid int64 + subsMu sync.RWMutex + subs map[int64]*Subscription + ach *asyncCallbacksHandler + pongs []chan struct{} + scratch [scratchSize]byte + status Status + initc bool // true if the connection is performing the initial connect + err error + ps *parseState + ptmr *time.Timer + pout int + + // New style response handler + respSub string // The wildcard subject + respMux *Subscription // A single response subscription + respMap map[string]chan *Msg // Request map for the response msg channels + respSetup sync.Once // Ensures response subscription occurs once + respRand *rand.Rand // Used for generating suffix. +} + +// A Subscription represents interest in a given subject. +type Subscription struct { + mu sync.Mutex + sid int64 + + // Subject that represents this subscription. This can be different + // than the received subject inside a Msg if this is a wildcard. + Subject string + + // Optional queue group name. If present, all subscriptions with the + // same name will form a distributed queue, and each message will + // only be processed by one member of the group. + Queue string + + delivered uint64 + max uint64 + conn *Conn + mcb MsgHandler + mch chan *Msg + closed bool + sc bool + connClosed bool + + // Type of Subscription + typ SubscriptionType + + // Async linked list + pHead *Msg + pTail *Msg + pCond *sync.Cond + + // Pending stats, async subscriptions, high-speed etc. + pMsgs int + pBytes int + pMsgsMax int + pBytesMax int + pMsgsLimit int + pBytesLimit int + dropped int +} + +// Msg is a structure used by Subscribers and PublishMsg(). +type Msg struct { + Subject string + Reply string + Data []byte + Sub *Subscription + next *Msg + barrier *barrierInfo +} + +type barrierInfo struct { + refs int64 + f func() +} + +// Tracks various stats received and sent on this connection, +// including counts for messages and bytes. +type Statistics struct { + InMsgs uint64 + OutMsgs uint64 + InBytes uint64 + OutBytes uint64 + Reconnects uint64 +} + +// Tracks individual backend servers. +type srv struct { + url *url.URL + didConnect bool + reconnects int + lastAttempt time.Time + isImplicit bool + tlsName string +} + +type serverInfo struct { + Id string `json:"server_id"` + Host string `json:"host"` + Port uint `json:"port"` + Version string `json:"version"` + AuthRequired bool `json:"auth_required"` + TLSRequired bool `json:"tls_required"` + MaxPayload int64 `json:"max_payload"` + ConnectURLs []string `json:"connect_urls,omitempty"` + Proto int `json:"proto,omitempty"` + CID uint64 `json:"client_id,omitempty"` + Nonce string `json:"nonce,omitempty"` +} + +const ( + // clientProtoZero is the original client protocol from 2009. + // http://nats.io/documentation/internals/nats-protocol/ + /* clientProtoZero */ _ = iota + // clientProtoInfo signals a client can receive more then the original INFO block. + // This can be used to update clients on other cluster members, etc. + clientProtoInfo +) + +type connectInfo struct { + Verbose bool `json:"verbose"` + Pedantic bool `json:"pedantic"` + UserJWT string `json:"jwt,omitempty"` + Nkey string `json:"nkey,omitempty"` + Signature string `json:"sig,omitempty"` + User string `json:"user,omitempty"` + Pass string `json:"pass,omitempty"` + Token string `json:"auth_token,omitempty"` + TLS bool `json:"tls_required"` + Name string `json:"name"` + Lang string `json:"lang"` + Version string `json:"version"` + Protocol int `json:"protocol"` + Echo bool `json:"echo"` +} + +// MsgHandler is a callback function that processes messages delivered to +// asynchronous subscribers. +type MsgHandler func(msg *Msg) + +// Connect will attempt to connect to the NATS system. +// The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222 +// Comma separated arrays are also supported, e.g. urlA, urlB. +// Options start with the defaults but can be overridden. +func Connect(url string, options ...Option) (*Conn, error) { + opts := GetDefaultOptions() + opts.Servers = processUrlString(url) + for _, opt := range options { + if opt != nil { + if err := opt(&opts); err != nil { + return nil, err + } + } + } + return opts.Connect() +} + +// Options that can be passed to Connect. + +// Name is an Option to set the client name. +func Name(name string) Option { + return func(o *Options) error { + o.Name = name + return nil + } +} + +// Secure is an Option to enable TLS secure connections that skip server verification by default. +// Pass a TLS Configuration for proper TLS. +// NOTE: This should NOT be used in a production setting. +func Secure(tls ...*tls.Config) Option { + return func(o *Options) error { + o.Secure = true + // Use of variadic just simplifies testing scenarios. We only take the first one. + if len(tls) > 1 { + return ErrMultipleTLSConfigs + } + if len(tls) == 1 { + o.TLSConfig = tls[0] + } + return nil + } +} + +// RootCAs is a helper option to provide the RootCAs pool from a list of filenames. +// If Secure is not already set this will set it as well. +func RootCAs(file ...string) Option { + return func(o *Options) error { + pool := x509.NewCertPool() + for _, f := range file { + rootPEM, err := ioutil.ReadFile(f) + if err != nil || rootPEM == nil { + return fmt.Errorf("nats: error loading or parsing rootCA file: %v", err) + } + ok := pool.AppendCertsFromPEM(rootPEM) + if !ok { + return fmt.Errorf("nats: failed to parse root certificate from %q", f) + } + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.RootCAs = pool + o.Secure = true + return nil + } +} + +// ClientCert is a helper option to provide the client certificate from a file. +// If Secure is not already set this will set it as well. +func ClientCert(certFile, keyFile string) Option { + return func(o *Options) error { + cert, err := tls.LoadX509KeyPair(certFile, keyFile) + if err != nil { + return fmt.Errorf("nats: error loading client certificate: %v", err) + } + cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0]) + if err != nil { + return fmt.Errorf("nats: error parsing client certificate: %v", err) + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.Certificates = []tls.Certificate{cert} + o.Secure = true + return nil + } +} + +// NoReconnect is an Option to turn off reconnect behavior. +func NoReconnect() Option { + return func(o *Options) error { + o.AllowReconnect = false + return nil + } +} + +// DontRandomize is an Option to turn off randomizing the server pool. +func DontRandomize() Option { + return func(o *Options) error { + o.NoRandomize = true + return nil + } +} + +// NoEcho is an Option to turn off messages echoing back from a server. +// Note this is supported on servers >= version 1.2. Proto 1 or greater. +func NoEcho() Option { + return func(o *Options) error { + o.NoEcho = true + return nil + } +} + +// ReconnectWait is an Option to set the wait time between reconnect attempts. +func ReconnectWait(t time.Duration) Option { + return func(o *Options) error { + o.ReconnectWait = t + return nil + } +} + +// MaxReconnects is an Option to set the maximum number of reconnect attempts. +func MaxReconnects(max int) Option { + return func(o *Options) error { + o.MaxReconnect = max + return nil + } +} + +// PingInterval is an Option to set the period for client ping commands. +func PingInterval(t time.Duration) Option { + return func(o *Options) error { + o.PingInterval = t + return nil + } +} + +// MaxPingsOutstanding is an Option to set the maximum number of ping requests +// that can go un-answered by the server before closing the connection. +func MaxPingsOutstanding(max int) Option { + return func(o *Options) error { + o.MaxPingsOut = max + return nil + } +} + +// ReconnectBufSize sets the buffer size of messages kept while busy reconnecting. +func ReconnectBufSize(size int) Option { + return func(o *Options) error { + o.ReconnectBufSize = size + return nil + } +} + +// Timeout is an Option to set the timeout for Dial on a connection. +func Timeout(t time.Duration) Option { + return func(o *Options) error { + o.Timeout = t + return nil + } +} + +// FlusherTimeout is an Option to set the write (and flush) timeout on a connection. +func FlusherTimeout(t time.Duration) Option { + return func(o *Options) error { + o.FlusherTimeout = t + return nil + } +} + +// DrainTimeout is an Option to set the timeout for draining a connection. +func DrainTimeout(t time.Duration) Option { + return func(o *Options) error { + o.DrainTimeout = t + return nil + } +} + +// DisconnectHandler is an Option to set the disconnected handler. +func DisconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DisconnectedCB = cb + return nil + } +} + +// ReconnectHandler is an Option to set the reconnected handler. +func ReconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ReconnectedCB = cb + return nil + } +} + +// ClosedHandler is an Option to set the closed handler. +func ClosedHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ClosedCB = cb + return nil + } +} + +// DiscoveredServersHandler is an Option to set the new servers handler. +func DiscoveredServersHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DiscoveredServersCB = cb + return nil + } +} + +// ErrorHandler is an Option to set the async error handler. +func ErrorHandler(cb ErrHandler) Option { + return func(o *Options) error { + o.AsyncErrorCB = cb + return nil + } +} + +// UserInfo is an Option to set the username and password to +// use when not included directly in the URLs. +func UserInfo(user, password string) Option { + return func(o *Options) error { + o.User = user + o.Password = password + return nil + } +} + +// Token is an Option to set the token to use +// when a token is not included directly in the URLs +// and when a token handler is not provided. +func Token(token string) Option { + return func(o *Options) error { + if o.TokenHandler != nil { + return ErrTokenAlreadySet + } + o.Token = token + return nil + } +} + +// TokenHandler is an Option to set the token handler to use +// when a token is not included directly in the URLs +// and when a token is not set. +func TokenHandler(cb AuthTokenHandler) Option { + return func(o *Options) error { + if o.Token != "" { + return ErrTokenAlreadySet + } + o.TokenHandler = cb + return nil + } +} + +// UserCredentials is a convenience function that takes a filename +// for a user's JWT and a filename for the user's private Nkey seed. +func UserCredentials(userOrChainedFile string, seedFiles ...string) Option { + userCB := func() (string, error) { + return userFromFile(userOrChainedFile) + } + var keyFile string + if len(seedFiles) > 0 { + keyFile = seedFiles[0] + } else { + keyFile = userOrChainedFile + } + sigCB := func(nonce []byte) ([]byte, error) { + return sigHandler(nonce, keyFile) + } + return UserJWT(userCB, sigCB) +} + +// UserJWT will set the callbacks to retrieve the user's JWT and +// the signature callback to sign the server nonce. This an the Nkey +// option are mutually exclusive. +func UserJWT(userCB UserJWTHandler, sigCB SignatureHandler) Option { + return func(o *Options) error { + if userCB == nil { + return ErrNoUserCB + } + if sigCB == nil { + return ErrUserButNoSigCB + } + o.UserJWT = userCB + o.SignatureCB = sigCB + return nil + } +} + +// Nkey will set the public Nkey and the signature callback to +// sign the server nonce. +func Nkey(pubKey string, sigCB SignatureHandler) Option { + return func(o *Options) error { + o.Nkey = pubKey + o.SignatureCB = sigCB + if pubKey != "" && sigCB == nil { + return ErrNkeyButNoSigCB + } + return nil + } +} + +// SyncQueueLen will set the maximum queue len for the internal +// channel used for SubscribeSync(). +func SyncQueueLen(max int) Option { + return func(o *Options) error { + o.SubChanLen = max + return nil + } +} + +// Dialer is an Option to set the dialer which will be used when +// attempting to establish a connection. +// DEPRECATED: Should use CustomDialer instead. +func Dialer(dialer *net.Dialer) Option { + return func(o *Options) error { + o.Dialer = dialer + return nil + } +} + +// SetCustomDialer is an Option to set a custom dialer which will be +// used when attempting to establish a connection. If both Dialer +// and CustomDialer are specified, CustomDialer takes precedence. +func SetCustomDialer(dialer CustomDialer) Option { + return func(o *Options) error { + o.CustomDialer = dialer + return nil + } +} + +// UseOldRequestStyle is an Option to force usage of the old Request style. +func UseOldRequestStyle() Option { + return func(o *Options) error { + o.UseOldRequestStyle = true + return nil + } +} + +// Handler processing + +// SetDisconnectHandler will set the disconnect event handler. +func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DisconnectedCB = dcb +} + +// SetReconnectHandler will set the reconnect event handler. +func (nc *Conn) SetReconnectHandler(rcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ReconnectedCB = rcb +} + +// SetDiscoveredServersHandler will set the discovered servers handler. +func (nc *Conn) SetDiscoveredServersHandler(dscb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DiscoveredServersCB = dscb +} + +// SetClosedHandler will set the reconnect event handler. +func (nc *Conn) SetClosedHandler(cb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ClosedCB = cb +} + +// SetErrorHandler will set the async error handler. +func (nc *Conn) SetErrorHandler(cb ErrHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.AsyncErrorCB = cb +} + +// Process the url string argument to Connect. +// Return an array of urls, even if only one. +func processUrlString(url string) []string { + urls := strings.Split(url, ",") + for i, s := range urls { + urls[i] = strings.TrimSpace(s) + } + return urls +} + +// Connect will attempt to connect to a NATS server with multiple options. +func (o Options) Connect() (*Conn, error) { + nc := &Conn{Opts: o} + + // Some default options processing. + if nc.Opts.MaxPingsOut == 0 { + nc.Opts.MaxPingsOut = DefaultMaxPingOut + } + // Allow old default for channel length to work correctly. + if nc.Opts.SubChanLen == 0 { + nc.Opts.SubChanLen = DefaultMaxChanLen + } + // Default ReconnectBufSize + if nc.Opts.ReconnectBufSize == 0 { + nc.Opts.ReconnectBufSize = DefaultReconnectBufSize + } + // Ensure that Timeout is not 0 + if nc.Opts.Timeout == 0 { + nc.Opts.Timeout = DefaultTimeout + } + + // Check first for user jwt callback being defined and nkey. + if nc.Opts.UserJWT != nil && nc.Opts.Nkey != "" { + return nil, ErrNkeyAndUser + } + + // Check if we have an nkey but no signature callback defined. + if nc.Opts.Nkey != "" && nc.Opts.SignatureCB == nil { + return nil, ErrNkeyButNoSigCB + } + + // Allow custom Dialer for connecting using DialTimeout by default + if nc.Opts.Dialer == nil { + nc.Opts.Dialer = &net.Dialer{ + Timeout: nc.Opts.Timeout, + } + } + + if err := nc.setupServerPool(); err != nil { + return nil, err + } + + // Create the async callback handler. + nc.ach = &asyncCallbacksHandler{} + nc.ach.cond = sync.NewCond(&nc.ach.mu) + + if err := nc.connect(); err != nil { + return nil, err + } + + // Spin up the async cb dispatcher on success + go nc.ach.asyncCBDispatcher() + + return nc, nil +} + +const ( + _CRLF_ = "\r\n" + _EMPTY_ = "" + _SPC_ = " " + _PUB_P_ = "PUB " +) + +const ( + _OK_OP_ = "+OK" + _ERR_OP_ = "-ERR" + _PONG_OP_ = "PONG" + _INFO_OP_ = "INFO" +) + +const ( + conProto = "CONNECT %s" + _CRLF_ + pingProto = "PING" + _CRLF_ + pongProto = "PONG" + _CRLF_ + subProto = "SUB %s %s %d" + _CRLF_ + unsubProto = "UNSUB %d %s" + _CRLF_ + okProto = _OK_OP_ + _CRLF_ +) + +// Return the currently selected server +func (nc *Conn) currentServer() (int, *srv) { + for i, s := range nc.srvPool { + if s == nil { + continue + } + if s == nc.current { + return i, s + } + } + return -1, nil +} + +// Pop the current server and put onto the end of the list. Select head of list as long +// as number of reconnect attempts under MaxReconnect. +func (nc *Conn) selectNextServer() (*srv, error) { + i, s := nc.currentServer() + if i < 0 { + return nil, ErrNoServers + } + sp := nc.srvPool + num := len(sp) + copy(sp[i:num-1], sp[i+1:num]) + maxReconnect := nc.Opts.MaxReconnect + if maxReconnect < 0 || s.reconnects < maxReconnect { + nc.srvPool[num-1] = s + } else { + nc.srvPool = sp[0 : num-1] + } + if len(nc.srvPool) <= 0 { + nc.current = nil + return nil, ErrNoServers + } + nc.current = nc.srvPool[0] + return nc.srvPool[0], nil +} + +// Will assign the correct server to nc.current +func (nc *Conn) pickServer() error { + nc.current = nil + if len(nc.srvPool) <= 0 { + return ErrNoServers + } + + for _, s := range nc.srvPool { + if s != nil { + nc.current = s + return nil + } + } + return ErrNoServers +} + +const tlsScheme = "tls" + +// Create the server pool using the options given. +// We will place a Url option first, followed by any +// Server Options. We will randomize the server pool unless +// the NoRandomize flag is set. +func (nc *Conn) setupServerPool() error { + nc.srvPool = make([]*srv, 0, srvPoolSize) + nc.urls = make(map[string]struct{}, srvPoolSize) + + // Create srv objects from each url string in nc.Opts.Servers + // and add them to the pool. + for _, urlString := range nc.Opts.Servers { + if err := nc.addURLToPool(urlString, false, false); err != nil { + return err + } + } + + // Randomize if allowed to + if !nc.Opts.NoRandomize { + nc.shufflePool() + } + + // Normally, if this one is set, Options.Servers should not be, + // but we always allowed that, so continue to do so. + if nc.Opts.Url != _EMPTY_ { + // Add to the end of the array + if err := nc.addURLToPool(nc.Opts.Url, false, false); err != nil { + return err + } + // Then swap it with first to guarantee that Options.Url is tried first. + last := len(nc.srvPool) - 1 + if last > 0 { + nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0] + } + } else if len(nc.srvPool) <= 0 { + // Place default URL if pool is empty. + if err := nc.addURLToPool(DefaultURL, false, false); err != nil { + return err + } + } + + // Check for Scheme hint to move to TLS mode. + for _, srv := range nc.srvPool { + if srv.url.Scheme == tlsScheme { + // FIXME(dlc), this is for all in the pool, should be case by case. + nc.Opts.Secure = true + if nc.Opts.TLSConfig == nil { + nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + } + } + + return nc.pickServer() +} + +// Helper function to return scheme +func (nc *Conn) connScheme() string { + if nc.Opts.Secure { + return tlsScheme + } + return "nats" +} + +// Return true iff u.Hostname() is an IP address. +func hostIsIP(u *url.URL) bool { + return net.ParseIP(u.Hostname()) != nil +} + +// addURLToPool adds an entry to the server pool +func (nc *Conn) addURLToPool(sURL string, implicit, saveTLSName bool) error { + if !strings.Contains(sURL, "://") { + sURL = fmt.Sprintf("%s://%s", nc.connScheme(), sURL) + } + var ( + u *url.URL + err error + ) + for i := 0; i < 2; i++ { + u, err = url.Parse(sURL) + if err != nil { + return err + } + if u.Port() != "" { + break + } + // In case given URL is of the form "localhost:", just add + // the port number at the end, otherwise, add ":4222". + if sURL[len(sURL)-1] != ':' { + sURL += ":" + } + sURL += defaultPortString + } + + var tlsName string + if implicit { + curl := nc.current.url + // Check to see if we do not have a url.User but current connected + // url does. If so copy over. + if u.User == nil && curl.User != nil { + u.User = curl.User + } + // We are checking to see if we have a secure connection and are + // adding an implicit server that just has an IP. If so we will remember + // the current hostname we are connected to. + if saveTLSName && hostIsIP(u) { + tlsName = curl.Hostname() + } + } + + s := &srv{url: u, isImplicit: implicit, tlsName: tlsName} + nc.srvPool = append(nc.srvPool, s) + nc.urls[u.Host] = struct{}{} + return nil +} + +// shufflePool swaps randomly elements in the server pool +func (nc *Conn) shufflePool() { + if len(nc.srvPool) <= 1 { + return + } + source := rand.NewSource(time.Now().UnixNano()) + r := rand.New(source) + for i := range nc.srvPool { + j := r.Intn(i + 1) + nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i] + } +} + +func (nc *Conn) newBuffer() *bufio.Writer { + var w io.Writer = nc.conn + if nc.Opts.FlusherTimeout > 0 { + w = &timeoutWriter{conn: nc.conn, timeout: nc.Opts.FlusherTimeout} + } + return bufio.NewWriterSize(w, defaultBufSize) +} + +// createConn will connect to the server and wrap the appropriate +// bufio structures. It will do the right thing when an existing +// connection is in place. +func (nc *Conn) createConn() (err error) { + if nc.Opts.Timeout < 0 { + return ErrBadTimeout + } + if _, cur := nc.currentServer(); cur == nil { + return ErrNoServers + } else { + cur.lastAttempt = time.Now() + } + + // We will auto-expand host names if they resolve to multiple IPs + hosts := map[string]struct{}{} + u := nc.current.url + + if net.ParseIP(u.Hostname()) == nil { + addrs, _ := net.LookupHost(u.Hostname()) + for _, addr := range addrs { + hosts[net.JoinHostPort(addr, u.Port())] = struct{}{} + } + } + // Fall back to what we were given. + if len(hosts) == 0 { + hosts[u.Host] = struct{}{} + } + + // CustomDialer takes precedence. If not set, use Opts.Dialer which + // is set to a default *net.Dialer (in Connect()) if not explicitly + // set by the user. + dialer := nc.Opts.CustomDialer + if dialer == nil { + // We will copy and shorten the timeout if we have multiple hosts to try. + copyDialer := *nc.Opts.Dialer + copyDialer.Timeout = copyDialer.Timeout / time.Duration(len(hosts)) + dialer = ©Dialer + } + + for host := range hosts { + nc.conn, err = dialer.Dial("tcp", host) + if err == nil { + break + } + } + if err != nil { + return err + } + + // No clue why, but this stalls and kills performance on Mac (Mavericks). + // https://code.google.com/p/go/issues/detail?id=6930 + //if ip, ok := nc.conn.(*net.TCPConn); ok { + // ip.SetReadBuffer(defaultBufSize) + //} + + if nc.pending != nil && nc.bw != nil { + // Move to pending buffer. + nc.bw.Flush() + } + nc.bw = nc.newBuffer() + return nil +} + +// makeTLSConn will wrap an existing Conn using TLS +func (nc *Conn) makeTLSConn() error { + // Allow the user to configure their own tls.Config structure. + var tlsCopy *tls.Config + if nc.Opts.TLSConfig != nil { + tlsCopy = util.CloneTLSConfig(nc.Opts.TLSConfig) + } else { + tlsCopy = &tls.Config{} + } + // If its blank we will override it with the current host + if tlsCopy.ServerName == _EMPTY_ { + if nc.current.tlsName != _EMPTY_ { + tlsCopy.ServerName = nc.current.tlsName + } else { + h, _, _ := net.SplitHostPort(nc.current.url.Host) + tlsCopy.ServerName = h + } + } + nc.conn = tls.Client(nc.conn, tlsCopy) + conn := nc.conn.(*tls.Conn) + if err := conn.Handshake(); err != nil { + return err + } + nc.bw = nc.newBuffer() + return nil +} + +// waitForExits will wait for all socket watcher Go routines to +// be shutdown before proceeding. +func (nc *Conn) waitForExits() { + // Kick old flusher forcefully. + select { + case nc.fch <- struct{}{}: + default: + } + + // Wait for any previous go routines. + nc.wg.Wait() +} + +// Report the connected server's Url +func (nc *Conn) ConnectedUrl() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.current.url.String() +} + +// ConnectedAddr returns the connected server's IP +func (nc *Conn) ConnectedAddr() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.conn.RemoteAddr().String() +} + +// Report the connected server's Id +func (nc *Conn) ConnectedServerId() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.info.Id +} + +// Low level setup for structs, etc +func (nc *Conn) setup() { + nc.subs = make(map[int64]*Subscription) + nc.pongs = make([]chan struct{}, 0, 8) + + nc.fch = make(chan struct{}, flushChanSize) + + // Setup scratch outbound buffer for PUB + pub := nc.scratch[:len(_PUB_P_)] + copy(pub, _PUB_P_) +} + +// Process a connected connection and initialize properly. +func (nc *Conn) processConnectInit() error { + + // Set our deadline for the whole connect process + nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout)) + defer nc.conn.SetDeadline(time.Time{}) + + // Set our status to connecting. + nc.status = CONNECTING + + // Process the INFO protocol received from the server + err := nc.processExpectedInfo() + if err != nil { + return err + } + + // Send the CONNECT protocol along with the initial PING protocol. + // Wait for the PONG response (or any error that we get from the server). + err = nc.sendConnect() + if err != nil { + return err + } + + // Reset the number of PING sent out + nc.pout = 0 + + // Start or reset Timer + if nc.Opts.PingInterval > 0 { + if nc.ptmr == nil { + nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer) + } else { + nc.ptmr.Reset(nc.Opts.PingInterval) + } + } + + // Start the readLoop and flusher go routines, we will wait on both on a reconnect event. + nc.wg.Add(2) + go nc.readLoop() + go nc.flusher() + + return nil +} + +// Main connect function. Will connect to the nats-server +func (nc *Conn) connect() error { + var returnedErr error + + // Create actual socket connection + // For first connect we walk all servers in the pool and try + // to connect immediately. + nc.mu.Lock() + nc.initc = true + // The pool may change inside the loop iteration due to INFO protocol. + for i := 0; i < len(nc.srvPool); i++ { + nc.current = nc.srvPool[i] + + if err := nc.createConn(); err == nil { + // This was moved out of processConnectInit() because + // that function is now invoked from doReconnect() too. + nc.setup() + + err = nc.processConnectInit() + + if err == nil { + nc.srvPool[i].didConnect = true + nc.srvPool[i].reconnects = 0 + returnedErr = nil + break + } else { + returnedErr = err + nc.mu.Unlock() + nc.close(DISCONNECTED, false) + nc.mu.Lock() + nc.current = nil + } + } else { + // Cancel out default connection refused, will trigger the + // No servers error conditional + if strings.Contains(err.Error(), "connection refused") { + returnedErr = nil + } + } + } + nc.initc = false + defer nc.mu.Unlock() + + if returnedErr == nil && nc.status != CONNECTED { + returnedErr = ErrNoServers + } + return returnedErr +} + +// This will check to see if the connection should be +// secure. This can be dictated from either end and should +// only be called after the INIT protocol has been received. +func (nc *Conn) checkForSecure() error { + // Check to see if we need to engage TLS + o := nc.Opts + + // Check for mismatch in setups + if o.Secure && !nc.info.TLSRequired { + return ErrSecureConnWanted + } else if nc.info.TLSRequired && !o.Secure { + // Switch to Secure since server needs TLS. + o.Secure = true + } + + // Need to rewrap with bufio + if o.Secure { + if err := nc.makeTLSConn(); err != nil { + return err + } + } + return nil +} + +// processExpectedInfo will look for the expected first INFO message +// sent when a connection is established. The lock should be held entering. +func (nc *Conn) processExpectedInfo() error { + + c := &control{} + + // Read the protocol + err := nc.readOp(c) + if err != nil { + return err + } + + // The nats protocol should send INFO first always. + if c.op != _INFO_OP_ { + return ErrNoInfoReceived + } + + // Parse the protocol + if err := nc.processInfo(c.args); err != nil { + return err + } + + if nc.Opts.Nkey != "" && nc.info.Nonce == "" { + return ErrNkeysNotSupported + } + + return nc.checkForSecure() +} + +// Sends a protocol control message by queuing into the bufio writer +// and kicking the flush Go routine. These writes are protected. +func (nc *Conn) sendProto(proto string) { + nc.mu.Lock() + nc.bw.WriteString(proto) + nc.kickFlusher() + nc.mu.Unlock() +} + +// Generate a connect protocol message, issuing user/password if +// applicable. The lock is assumed to be held upon entering. +func (nc *Conn) connectProto() (string, error) { + o := nc.Opts + var nkey, sig, user, pass, token, ujwt string + u := nc.current.url.User + if u != nil { + // if no password, assume username is authToken + if _, ok := u.Password(); !ok { + token = u.Username() + } else { + user = u.Username() + pass, _ = u.Password() + } + } else { + // Take from options (possibly all empty strings) + user = o.User + pass = o.Password + token = o.Token + nkey = o.Nkey + } + + // Look for user jwt. + if o.UserJWT != nil { + if jwt, err := o.UserJWT(); err != nil { + return _EMPTY_, err + } else { + ujwt = jwt + } + if nkey != _EMPTY_ { + return _EMPTY_, ErrNkeyAndUser + } + } + + if ujwt != _EMPTY_ || nkey != _EMPTY_ { + if o.SignatureCB == nil { + if ujwt == _EMPTY_ { + return _EMPTY_, ErrNkeyButNoSigCB + } + return _EMPTY_, ErrUserButNoSigCB + } + sigraw, err := o.SignatureCB([]byte(nc.info.Nonce)) + if err != nil { + return _EMPTY_, err + } + sig = base64.RawURLEncoding.EncodeToString(sigraw) + } + + if nc.Opts.TokenHandler != nil { + if token != _EMPTY_ { + return _EMPTY_, ErrTokenAlreadySet + } + token = nc.Opts.TokenHandler() + } + + cinfo := connectInfo{o.Verbose, o.Pedantic, ujwt, nkey, sig, user, pass, token, + o.Secure, o.Name, LangString, Version, clientProtoInfo, !o.NoEcho} + + b, err := json.Marshal(cinfo) + if err != nil { + return _EMPTY_, ErrJsonParse + } + + // Check if NoEcho is set and we have a server that supports it. + if o.NoEcho && nc.info.Proto < 1 { + return _EMPTY_, ErrNoEchoNotSupported + } + + return fmt.Sprintf(conProto, b), nil +} + +// normalizeErr removes the prefix -ERR, trim spaces and remove the quotes. +func normalizeErr(line string) string { + s := strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_)) + s = strings.TrimLeft(strings.TrimRight(s, "'"), "'") + return s +} + +// Send a connect protocol message to the server, issue user/password if +// applicable. Will wait for a flush to return from the server for error +// processing. +func (nc *Conn) sendConnect() error { + + // Construct the CONNECT protocol string + cProto, err := nc.connectProto() + if err != nil { + return err + } + + // Write the protocol into the buffer + _, err = nc.bw.WriteString(cProto) + if err != nil { + return err + } + + // Add to the buffer the PING protocol + _, err = nc.bw.WriteString(pingProto) + if err != nil { + return err + } + + // Flush the buffer + err = nc.bw.Flush() + if err != nil { + return err + } + + // We don't want to read more than we need here, otherwise + // we would need to transfer the excess read data to the readLoop. + // Since in normal situations we just are looking for a PONG\r\n, + // reading byte-by-byte here is ok. + proto, err := nc.readProto() + if err != nil { + return err + } + + // If opts.Verbose is set, handle +OK + if nc.Opts.Verbose && proto == okProto { + // Read the rest now... + proto, err = nc.readProto() + if err != nil { + return err + } + } + + // We expect a PONG + if proto != pongProto { + // But it could be something else, like -ERR + + // Since we no longer use ReadLine(), trim the trailing "\r\n" + proto = strings.TrimRight(proto, "\r\n") + + // If it's a server error... + if strings.HasPrefix(proto, _ERR_OP_) { + // Remove -ERR, trim spaces and quotes, and convert to lower case. + proto = normalizeErr(proto) + return errors.New("nats: " + proto) + } + + // Notify that we got an unexpected protocol. + return fmt.Errorf("nats: expected '%s', got '%s'", _PONG_OP_, proto) + } + + // This is where we are truly connected. + nc.status = CONNECTED + + return nil +} + +// reads a protocol one byte at a time. +func (nc *Conn) readProto() (string, error) { + var ( + _buf = [10]byte{} + buf = _buf[:0] + b = [1]byte{} + protoEnd = byte('\n') + ) + for { + if _, err := nc.conn.Read(b[:1]); err != nil { + // Do not report EOF error + if err == io.EOF { + return string(buf), nil + } + return "", err + } + buf = append(buf, b[0]) + if b[0] == protoEnd { + return string(buf), nil + } + } +} + +// A control protocol line. +type control struct { + op, args string +} + +// Read a control line and process the intended op. +func (nc *Conn) readOp(c *control) error { + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + parseControl(line, c) + return nil +} + +// Parse a control line from the server. +func parseControl(line string, c *control) { + toks := strings.SplitN(line, _SPC_, 2) + if len(toks) == 1 { + c.op = strings.TrimSpace(toks[0]) + c.args = _EMPTY_ + } else if len(toks) == 2 { + c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1]) + } else { + c.op = _EMPTY_ + } +} + +// flushReconnectPending will push the pending items that were +// gathered while we were in a RECONNECTING state to the socket. +func (nc *Conn) flushReconnectPendingItems() { + if nc.pending == nil { + return + } + if nc.pending.Len() > 0 { + nc.bw.Write(nc.pending.Bytes()) + } +} + +// Stops the ping timer if set. +// Connection lock is held on entry. +func (nc *Conn) stopPingTimer() { + if nc.ptmr != nil { + nc.ptmr.Stop() + } +} + +// Try to reconnect using the option parameters. +// This function assumes we are allowed to reconnect. +func (nc *Conn) doReconnect() { + // We want to make sure we have the other watchers shutdown properly + // here before we proceed past this point. + nc.waitForExits() + + // FIXME(dlc) - We have an issue here if we have + // outstanding flush points (pongs) and they were not + // sent out, but are still in the pipe. + + // Hold the lock manually and release where needed below, + // can't do defer here. + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any errors. + nc.err = nil + // Perform appropriate callback if needed for a disconnect. + if nc.Opts.DisconnectedCB != nil { + nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) }) + } + + // This is used to wait on go routines exit if we start them in the loop + // but an error occurs after that. + waitForGoRoutines := false + + for len(nc.srvPool) > 0 { + cur, err := nc.selectNextServer() + if err != nil { + nc.err = err + break + } + + sleepTime := int64(0) + + // Sleep appropriate amount of time before the + // connection attempt if connecting to same server + // we just got disconnected from.. + if time.Since(cur.lastAttempt) < nc.Opts.ReconnectWait { + sleepTime = int64(nc.Opts.ReconnectWait - time.Since(cur.lastAttempt)) + } + + // On Windows, createConn() will take more than a second when no + // server is running at that address. So it could be that the + // time elapsed between reconnect attempts is always > than + // the set option. Release the lock to give a chance to a parallel + // nc.Close() to break the loop. + nc.mu.Unlock() + if sleepTime <= 0 { + runtime.Gosched() + } else { + time.Sleep(time.Duration(sleepTime)) + } + // If the readLoop, etc.. go routines were started, wait for them to complete. + if waitForGoRoutines { + nc.waitForExits() + waitForGoRoutines = false + } + nc.mu.Lock() + + // Check if we have been closed first. + if nc.isClosed() { + break + } + + // Mark that we tried a reconnect + cur.reconnects++ + + // Try to create a new connection + err = nc.createConn() + + // Not yet connected, retry... + // Continue to hold the lock + if err != nil { + nc.err = nil + continue + } + + // We are reconnected + nc.Reconnects++ + + // Process connect logic + if nc.err = nc.processConnectInit(); nc.err != nil { + nc.status = RECONNECTING + // Reset the buffered writer to the pending buffer + // (was set to a buffered writer on nc.conn in createConn) + nc.bw.Reset(nc.pending) + continue + } + + // Clear out server stats for the server we connected to.. + cur.didConnect = true + cur.reconnects = 0 + + // Send existing subscription state + nc.resendSubscriptions() + + // Now send off and clear pending buffer + nc.flushReconnectPendingItems() + + // Flush the buffer + nc.err = nc.bw.Flush() + if nc.err != nil { + nc.status = RECONNECTING + // Reset the buffered writer to the pending buffer (bytes.Buffer). + nc.bw.Reset(nc.pending) + // Stop the ping timer (if set) + nc.stopPingTimer() + // Since processConnectInit() returned without error, the + // go routines were started, so wait for them to return + // on the next iteration (after releasing the lock). + waitForGoRoutines = true + continue + } + + // Done with the pending buffer + nc.pending = nil + + // This is where we are truly connected. + nc.status = CONNECTED + + // Queue up the reconnect callback. + if nc.Opts.ReconnectedCB != nil { + nc.ach.push(func() { nc.Opts.ReconnectedCB(nc) }) + } + // Release lock here, we will return below. + nc.mu.Unlock() + + // Make sure to flush everything + nc.Flush() + + return + } + + // Call into close.. We have no servers left.. + if nc.err == nil { + nc.err = ErrNoServers + } + nc.mu.Unlock() + nc.Close() +} + +// processOpErr handles errors from reading or parsing the protocol. +// The lock should not be held entering this function. +func (nc *Conn) processOpErr(err error) { + nc.mu.Lock() + if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() { + nc.mu.Unlock() + return + } + + if nc.Opts.AllowReconnect && nc.status == CONNECTED { + // Set our new status + nc.status = RECONNECTING + // Stop ping timer if set + nc.stopPingTimer() + if nc.conn != nil { + nc.bw.Flush() + nc.conn.Close() + nc.conn = nil + } + + // Create pending buffer before reconnecting. + nc.pending = new(bytes.Buffer) + nc.bw.Reset(nc.pending) + + go nc.doReconnect() + nc.mu.Unlock() + return + } + + nc.status = DISCONNECTED + nc.err = err + nc.mu.Unlock() + nc.Close() +} + +// dispatch is responsible for calling any async callbacks +func (ac *asyncCallbacksHandler) asyncCBDispatcher() { + for { + ac.mu.Lock() + // Protect for spurious wakeups. We should get out of the + // wait only if there is an element to pop from the list. + for ac.head == nil { + ac.cond.Wait() + } + cur := ac.head + ac.head = cur.next + if cur == ac.tail { + ac.tail = nil + } + ac.mu.Unlock() + + // This signals that the dispatcher has been closed and all + // previous callbacks have been dispatched. + if cur.f == nil { + return + } + // Invoke callback outside of handler's lock + cur.f() + } +} + +// Add the given function to the tail of the list and +// signals the dispatcher. +func (ac *asyncCallbacksHandler) push(f func()) { + ac.pushOrClose(f, false) +} + +// Signals that we are closing... +func (ac *asyncCallbacksHandler) close() { + ac.pushOrClose(nil, true) +} + +// Add the given function to the tail of the list and +// signals the dispatcher. +func (ac *asyncCallbacksHandler) pushOrClose(f func(), close bool) { + ac.mu.Lock() + defer ac.mu.Unlock() + // Make sure that library is not calling push with nil function, + // since this is used to notify the dispatcher that it should stop. + if !close && f == nil { + panic("pushing a nil callback") + } + cb := &asyncCB{f: f} + if ac.tail != nil { + ac.tail.next = cb + } else { + ac.head = cb + } + ac.tail = cb + if close { + ac.cond.Broadcast() + } else { + ac.cond.Signal() + } +} + +// readLoop() will sit on the socket reading and processing the +// protocol from the server. It will dispatch appropriately based +// on the op type. +func (nc *Conn) readLoop() { + // Release the wait group on exit + defer nc.wg.Done() + + // Create a parseState if needed. + nc.mu.Lock() + if nc.ps == nil { + nc.ps = &parseState{} + } + nc.mu.Unlock() + + // Stack based buffer. + b := make([]byte, defaultBufSize) + + for { + // FIXME(dlc): RWLock here? + nc.mu.Lock() + sb := nc.isClosed() || nc.isReconnecting() + if sb { + nc.ps = &parseState{} + } + conn := nc.conn + nc.mu.Unlock() + + if sb || conn == nil { + break + } + + n, err := conn.Read(b) + if err != nil { + nc.processOpErr(err) + break + } + if err := nc.parse(b[:n]); err != nil { + nc.processOpErr(err) + break + } + } + // Clear the parseState here.. + nc.mu.Lock() + nc.ps = nil + nc.mu.Unlock() +} + +// waitForMsgs waits on the conditional shared with readLoop and processMsg. +// It is used to deliver messages to asynchronous subscribers. +func (nc *Conn) waitForMsgs(s *Subscription) { + var closed bool + var delivered, max uint64 + + // Used to account for adjustments to sub.pBytes when we wrap back around. + msgLen := -1 + + for { + s.mu.Lock() + // Do accounting for last msg delivered here so we only lock once + // and drain state trips after callback has returned. + if msgLen >= 0 { + s.pMsgs-- + s.pBytes -= msgLen + msgLen = -1 + } + + if s.pHead == nil && !s.closed { + s.pCond.Wait() + } + // Pop the msg off the list + m := s.pHead + if m != nil { + s.pHead = m.next + if s.pHead == nil { + s.pTail = nil + } + if m.barrier != nil { + s.mu.Unlock() + if atomic.AddInt64(&m.barrier.refs, -1) == 0 { + m.barrier.f() + } + continue + } + msgLen = len(m.Data) + } + mcb := s.mcb + max = s.max + closed = s.closed + if !s.closed { + s.delivered++ + delivered = s.delivered + } + s.mu.Unlock() + + if closed { + break + } + + // Deliver the message. + if m != nil && (max == 0 || delivered <= max) { + mcb(m) + } + // If we have hit the max for delivered msgs, remove sub. + if max > 0 && delivered >= max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + break + } + } + // Check for barrier messages + s.mu.Lock() + for m := s.pHead; m != nil; m = s.pHead { + if m.barrier != nil { + s.mu.Unlock() + if atomic.AddInt64(&m.barrier.refs, -1) == 0 { + m.barrier.f() + } + s.mu.Lock() + } + s.pHead = m.next + } + s.mu.Unlock() +} + +// processMsg is called by parse and will place the msg on the +// appropriate channel/pending queue for processing. If the channel is full, +// or the pending queue is over the pending limits, the connection is +// considered a slow consumer. +func (nc *Conn) processMsg(data []byte) { + // Don't lock the connection to avoid server cutting us off if the + // flusher is holding the connection lock, trying to send to the server + // that is itself trying to send data to us. + nc.subsMu.RLock() + + // Stats + nc.InMsgs++ + nc.InBytes += uint64(len(data)) + + sub := nc.subs[nc.ps.ma.sid] + if sub == nil { + nc.subsMu.RUnlock() + return + } + + // Copy them into string + subj := string(nc.ps.ma.subject) + reply := string(nc.ps.ma.reply) + + // Doing message create outside of the sub's lock to reduce contention. + // It's possible that we end-up not using the message, but that's ok. + + // FIXME(dlc): Need to copy, should/can do COW? + msgPayload := make([]byte, len(data)) + copy(msgPayload, data) + + // FIXME(dlc): Should we recycle these containers? + m := &Msg{Data: msgPayload, Subject: subj, Reply: reply, Sub: sub} + + sub.mu.Lock() + + // Subscription internal stats (applicable only for non ChanSubscription's) + if sub.typ != ChanSubscription { + sub.pMsgs++ + if sub.pMsgs > sub.pMsgsMax { + sub.pMsgsMax = sub.pMsgs + } + sub.pBytes += len(m.Data) + if sub.pBytes > sub.pBytesMax { + sub.pBytesMax = sub.pBytes + } + + // Check for a Slow Consumer + if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) || + (sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) { + goto slowConsumer + } + } + + // We have two modes of delivery. One is the channel, used by channel + // subscribers and syncSubscribers, the other is a linked list for async. + if sub.mch != nil { + select { + case sub.mch <- m: + default: + goto slowConsumer + } + } else { + // Push onto the async pList + if sub.pHead == nil { + sub.pHead = m + sub.pTail = m + sub.pCond.Signal() + } else { + sub.pTail.next = m + sub.pTail = m + } + } + + // Clear SlowConsumer status. + sub.sc = false + + sub.mu.Unlock() + nc.subsMu.RUnlock() + return + +slowConsumer: + sub.dropped++ + sc := !sub.sc + sub.sc = true + // Undo stats from above + if sub.typ != ChanSubscription { + sub.pMsgs-- + sub.pBytes -= len(m.Data) + } + sub.mu.Unlock() + nc.subsMu.RUnlock() + if sc { + // Now we need connection's lock and we may end-up in the situation + // that we were trying to avoid, except that in this case, the client + // is already experiencing client-side slow consumer situation. + nc.mu.Lock() + nc.err = ErrSlowConsumer + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, sub, ErrSlowConsumer) }) + } + nc.mu.Unlock() + } +} + +// processPermissionsViolation is called when the server signals a subject +// permissions violation on either publish or subscribe. +func (nc *Conn) processPermissionsViolation(err string) { + nc.mu.Lock() + // create error here so we can pass it as a closure to the async cb dispatcher. + e := errors.New("nats: " + err) + nc.err = e + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, e) }) + } + nc.mu.Unlock() +} + +// processAuthorizationViolation is called when the server signals a user +// authorization violation. +func (nc *Conn) processAuthorizationViolation(err string) { + nc.mu.Lock() + nc.err = ErrAuthorization + if nc.Opts.AsyncErrorCB != nil { + nc.ach.push(func() { nc.Opts.AsyncErrorCB(nc, nil, ErrAuthorization) }) + } + nc.mu.Unlock() +} + +// flusher is a separate Go routine that will process flush requests for the write +// bufio. This allows coalescing of writes to the underlying socket. +func (nc *Conn) flusher() { + // Release the wait group + defer nc.wg.Done() + + // snapshot the bw and conn since they can change from underneath of us. + nc.mu.Lock() + bw := nc.bw + conn := nc.conn + fch := nc.fch + nc.mu.Unlock() + + if conn == nil || bw == nil { + return + } + + for { + if _, ok := <-fch; !ok { + return + } + nc.mu.Lock() + + // Check to see if we should bail out. + if !nc.isConnected() || nc.isConnecting() || bw != nc.bw || conn != nc.conn { + nc.mu.Unlock() + return + } + if bw.Buffered() > 0 { + if err := bw.Flush(); err != nil { + if nc.err == nil { + nc.err = err + } + } + } + nc.mu.Unlock() + } +} + +// processPing will send an immediate pong protocol response to the +// server. The server uses this mechanism to detect dead clients. +func (nc *Conn) processPing() { + nc.sendProto(pongProto) +} + +// processPong is used to process responses to the client's ping +// messages. We use pings for the flush mechanism as well. +func (nc *Conn) processPong() { + var ch chan struct{} + + nc.mu.Lock() + if len(nc.pongs) > 0 { + ch = nc.pongs[0] + nc.pongs = nc.pongs[1:] + } + nc.pout = 0 + nc.mu.Unlock() + if ch != nil { + ch <- struct{}{} + } +} + +// processOK is a placeholder for processing OK messages. +func (nc *Conn) processOK() { + // do nothing +} + +// processInfo is used to parse the info messages sent +// from the server. +// This function may update the server pool. +func (nc *Conn) processInfo(info string) error { + if info == _EMPTY_ { + return nil + } + ncInfo := serverInfo{} + if err := json.Unmarshal([]byte(info), &ncInfo); err != nil { + return err + } + // Copy content into connection's info structure. + nc.info = ncInfo + // The array could be empty/not present on initial connect, + // if advertise is disabled on that server, or servers that + // did not include themselves in the async INFO protocol. + // If empty, do not remove the implicit servers from the pool. + if len(ncInfo.ConnectURLs) == 0 { + return nil + } + // Note about pool randomization: when the pool was first created, + // it was randomized (if allowed). We keep the order the same (removing + // implicit servers that are no longer sent to us). New URLs are sent + // to us in no specific order so don't need extra randomization. + hasNew := false + // This is what we got from the server we are connected to. + urls := nc.info.ConnectURLs + // Transform that to a map for easy lookups + tmp := make(map[string]struct{}, len(urls)) + for _, curl := range urls { + tmp[curl] = struct{}{} + } + // Walk the pool and removed the implicit servers that are no longer in the + // given array/map + sp := nc.srvPool + for i := 0; i < len(sp); i++ { + srv := sp[i] + curl := srv.url.Host + // Check if this URL is in the INFO protocol + _, inInfo := tmp[curl] + // Remove from the temp map so that at the end we are left with only + // new (or restarted) servers that need to be added to the pool. + delete(tmp, curl) + // Keep servers that were set through Options, but also the one that + // we are currently connected to (even if it is a discovered server). + if !srv.isImplicit || srv.url == nc.current.url { + continue + } + if !inInfo { + // Remove from server pool. Keep current order. + copy(sp[i:], sp[i+1:]) + nc.srvPool = sp[:len(sp)-1] + sp = nc.srvPool + i-- + } + } + // Figure out if we should save off the current non-IP hostname if we encounter a bare IP. + var saveTLS bool + if nc.current != nil && nc.Opts.Secure && !hostIsIP(nc.current.url) { + saveTLS = true + } + // If there are any left in the tmp map, these are new (or restarted) servers + // and need to be added to the pool. + for curl := range tmp { + // Before adding, check if this is a new (as in never seen) URL. + // This is used to figure out if we invoke the DiscoveredServersCB + if _, present := nc.urls[curl]; !present { + hasNew = true + } + nc.addURLToPool(fmt.Sprintf("%s://%s", nc.connScheme(), curl), true, saveTLS) + } + if hasNew && !nc.initc && nc.Opts.DiscoveredServersCB != nil { + nc.ach.push(func() { nc.Opts.DiscoveredServersCB(nc) }) + } + + return nil +} + +// processAsyncInfo does the same than processInfo, but is called +// from the parser. Calls processInfo under connection's lock +// protection. +func (nc *Conn) processAsyncInfo(info []byte) { + nc.mu.Lock() + // Ignore errors, we will simply not update the server pool... + nc.processInfo(string(info)) + nc.mu.Unlock() +} + +// LastError reports the last error encountered via the connection. +// It can be used reliably within ClosedCB in order to find out reason +// why connection was closed for example. +func (nc *Conn) LastError() error { + if nc == nil { + return ErrInvalidConnection + } + nc.mu.Lock() + err := nc.err + nc.mu.Unlock() + return err +} + +// processErr processes any error messages from the server and +// sets the connection's lastError. +func (nc *Conn) processErr(ie string) { + // Trim, remove quotes + ne := normalizeErr(ie) + // convert to lower case. + e := strings.ToLower(ne) + + // FIXME(dlc) - process Slow Consumer signals special. + if e == STALE_CONNECTION { + nc.processOpErr(ErrStaleConnection) + } else if strings.HasPrefix(e, PERMISSIONS_ERR) { + nc.processPermissionsViolation(ne) + } else if strings.HasPrefix(e, AUTHORIZATION_ERR) { + nc.processAuthorizationViolation(ne) + } else { + nc.mu.Lock() + nc.err = errors.New("nats: " + ne) + nc.mu.Unlock() + nc.Close() + } +} + +// kickFlusher will send a bool on a channel to kick the +// flush Go routine to flush data to the server. +func (nc *Conn) kickFlusher() { + if nc.bw != nil { + select { + case nc.fch <- struct{}{}: + default: + } + } +} + +// Publish publishes the data argument to the given subject. The data +// argument is left untouched and needs to be correctly interpreted on +// the receiver. +func (nc *Conn) Publish(subj string, data []byte) error { + return nc.publish(subj, _EMPTY_, data) +} + +// PublishMsg publishes the Msg structure, which includes the +// Subject, an optional Reply and an optional Data field. +func (nc *Conn) PublishMsg(m *Msg) error { + if m == nil { + return ErrInvalidMsg + } + return nc.publish(m.Subject, m.Reply, m.Data) +} + +// PublishRequest will perform a Publish() excpecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (nc *Conn) PublishRequest(subj, reply string, data []byte) error { + return nc.publish(subj, reply, data) +} + +// Used for handrolled itoa +const digits = "0123456789" + +// publish is the internal function to publish messages to a nats-server. +// Sends a protocol data message by queuing into the bufio writer +// and kicking the flush go routine. These writes should be protected. +func (nc *Conn) publish(subj, reply string, data []byte) error { + if nc == nil { + return ErrInvalidConnection + } + if subj == "" { + return ErrBadSubject + } + nc.mu.Lock() + + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + + if nc.isDrainingPubs() { + nc.mu.Unlock() + return ErrConnectionDraining + } + + // Proactively reject payloads over the threshold set by server. + msgSize := int64(len(data)) + if msgSize > nc.info.MaxPayload { + nc.mu.Unlock() + return ErrMaxPayload + } + + // Check if we are reconnecting, and if so check if + // we have exceeded our reconnect outbound buffer limits. + if nc.isReconnecting() { + // Flush to underlying buffer. + nc.bw.Flush() + // Check if we are over + if nc.pending.Len() >= nc.Opts.ReconnectBufSize { + nc.mu.Unlock() + return ErrReconnectBufExceeded + } + } + + msgh := nc.scratch[:len(_PUB_P_)] + msgh = append(msgh, subj...) + msgh = append(msgh, ' ') + if reply != "" { + msgh = append(msgh, reply...) + msgh = append(msgh, ' ') + } + + // We could be smarter here, but simple loop is ok, + // just avoid strconv in fast path + // FIXME(dlc) - Find a better way here. + // msgh = strconv.AppendInt(msgh, int64(len(data)), 10) + + var b [12]byte + var i = len(b) + if len(data) > 0 { + for l := len(data); l > 0; l /= 10 { + i -= 1 + b[i] = digits[l%10] + } + } else { + i -= 1 + b[i] = digits[0] + } + + msgh = append(msgh, b[i:]...) + msgh = append(msgh, _CRLF_...) + + _, err := nc.bw.Write(msgh) + if err == nil { + _, err = nc.bw.Write(data) + } + if err == nil { + _, err = nc.bw.WriteString(_CRLF_) + } + if err != nil { + nc.mu.Unlock() + return err + } + + nc.OutMsgs++ + nc.OutBytes += uint64(len(data)) + + if len(nc.fch) == 0 { + nc.kickFlusher() + } + nc.mu.Unlock() + return nil +} + +// respHandler is the global response handler. It will look up +// the appropriate channel based on the last token and place +// the message on the channel if possible. +func (nc *Conn) respHandler(m *Msg) { + rt := respToken(m.Subject) + + nc.mu.Lock() + // Just return if closed. + if nc.isClosed() { + nc.mu.Unlock() + return + } + + // Grab mch + mch := nc.respMap[rt] + // Delete the key regardless, one response only. + // FIXME(dlc) - should we track responses past 1 + // just statistics wise? + delete(nc.respMap, rt) + nc.mu.Unlock() + + // Don't block, let Request timeout instead, mch is + // buffered and we should delete the key before a + // second response is processed. + select { + case mch <- m: + default: + return + } +} + +// Create the response subscription we will use for all +// new style responses. This will be on an _INBOX with an +// additional terminal token. The subscription will be on +// a wildcard. Caller is responsible for ensuring this is +// only called once. +func (nc *Conn) createRespMux(respSub string) error { + s, err := nc.Subscribe(respSub, nc.respHandler) + if err != nil { + return err + } + nc.mu.Lock() + nc.respMux = s + nc.mu.Unlock() + return nil +} + +// Request will send a request payload and deliver the response message, +// or an error, including a timeout if no message was received properly. +func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + + nc.mu.Lock() + // If user wants the old style. + if nc.Opts.UseOldRequestStyle { + nc.mu.Unlock() + return nc.oldRequest(subj, data, timeout) + } + + // Do setup for the new style. + if nc.respMap == nil { + nc.initNewResp() + } + // Create literal Inbox and map to a chan msg. + mch := make(chan *Msg, RequestChanLen) + respInbox := nc.newRespInbox() + token := respToken(respInbox) + nc.respMap[token] = mch + createSub := nc.respMux == nil + ginbox := nc.respSub + nc.mu.Unlock() + + if createSub { + // Make sure scoped subscription is setup only once. + var err error + nc.respSetup.Do(func() { err = nc.createRespMux(ginbox) }) + if err != nil { + return nil, err + } + } + + if err := nc.PublishRequest(subj, respInbox, data); err != nil { + return nil, err + } + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + var ok bool + var msg *Msg + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + case <-t.C: + nc.mu.Lock() + delete(nc.respMap, token) + nc.mu.Unlock() + return nil, ErrTimeout + } + + return msg, nil +} + +// oldRequest will create an Inbox and perform a Request() call +// with the Inbox reply and return the first reply received. +// This is optimized for the case of multiple responses. +func (nc *Conn) oldRequest(subj string, data []byte, timeout time.Duration) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + return s.NextMsg(timeout) +} + +// InboxPrefix is the prefix for all inbox subjects. +const ( + InboxPrefix = "_INBOX." + inboxPrefixLen = len(InboxPrefix) + respInboxPrefixLen = inboxPrefixLen + nuidSize + 1 + replySuffixLen = 8 // Gives us 62^8 + rdigits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" + base = 62 +) + +// NewInbox will return an inbox string which can be used for directed replies from +// subscribers. These are guaranteed to be unique, but can be shared and subscribed +// to by others. +func NewInbox() string { + var b [inboxPrefixLen + nuidSize]byte + pres := b[:inboxPrefixLen] + copy(pres, InboxPrefix) + ns := b[inboxPrefixLen:] + copy(ns, nuid.Next()) + return string(b[:]) +} + +// Function to init new response structures. +func (nc *Conn) initNewResp() { + // _INBOX wildcard + nc.respSub = fmt.Sprintf("%s.*", NewInbox()) + nc.respMap = make(map[string]chan *Msg) + nc.respRand = rand.New(rand.NewSource(time.Now().UnixNano())) +} + +// newRespInbox creates a new literal response subject +// that will trigger the mux subscription handler. +// Lock should be held. +func (nc *Conn) newRespInbox() string { + if nc.respMap == nil { + nc.initNewResp() + } + var b [respInboxPrefixLen + replySuffixLen]byte + pres := b[:respInboxPrefixLen] + copy(pres, nc.respSub) + rn := nc.respRand.Int63() + for i, l := respInboxPrefixLen, rn; i < len(b); i++ { + b[i] = rdigits[l%base] + l /= base + } + return string(b[:]) +} + +// NewRespInbox is the new format used for _INBOX. +func (nc *Conn) NewRespInbox() string { + nc.mu.Lock() + s := nc.newRespInbox() + nc.mu.Unlock() + return s +} + +// respToken will return the last token of a literal response inbox +// which we use for the message channel lookup. +func respToken(respInbox string) string { + return respInbox[respInboxPrefixLen:] +} + +// Subscribe will express interest in the given subject. The subject +// can have wildcards (partial:*, full:>). Messages will be delivered +// to the associated MsgHandler. +func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, cb, nil) +} + +// ChanSubscribe will express interest in the given subject and place +// all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, nil, ch) +} + +// ChanQueueSubscribe will express interest in the given subject. +// All subscribers with the same queue name will form the queue group +// and only one member of the group will be selected to receive any given message, +// which will be placed on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +// Note: This is the same than QueueSubscribeSyncWithChan. +func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, group, nil, ch) +} + +// SubscribeSync will express interest on the given subject. Messages will +// be received synchronously using Subscription.NextMsg(). +func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, _EMPTY_, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribe creates an asynchronous queue subscriber on the given subject. +// All subscribers with the same queue name will form the queue group and +// only one member of the group will be selected to receive any given +// message asynchronously. +func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, queue, cb, nil) +} + +// QueueSubscribeSync creates a synchronous queue subscriber on the given +// subject. All subscribers with the same queue name will form the queue +// group and only one member of the group will be selected to receive any +// given message synchronously using Subscription.NextMsg(). +func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) { + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, queue, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribeSyncWithChan will express interest in the given subject. +// All subscribers with the same queue name will form the queue group +// and only one member of the group will be selected to receive any given message, +// which will be placed on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +// Note: This is the same than ChanQueueSubscribe. +func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, queue, nil, ch) +} + +// subscribe is the internal subscribe function that indicates interest in a subject. +func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + nc.mu.Lock() + // ok here, but defer is generally expensive + defer nc.mu.Unlock() + + // Check for some error conditions. + if nc.isClosed() { + return nil, ErrConnectionClosed + } + if nc.isDraining() { + return nil, ErrConnectionDraining + } + + if cb == nil && ch == nil { + return nil, ErrBadSubscription + } + + sub := &Subscription{Subject: subj, Queue: queue, mcb: cb, conn: nc} + // Set pending limits. + sub.pMsgsLimit = DefaultSubPendingMsgsLimit + sub.pBytesLimit = DefaultSubPendingBytesLimit + + // If we have an async callback, start up a sub specific + // Go routine to deliver the messages. + if cb != nil { + sub.typ = AsyncSubscription + sub.pCond = sync.NewCond(&sub.mu) + go nc.waitForMsgs(sub) + } else { + sub.typ = ChanSubscription + sub.mch = ch + } + + nc.subsMu.Lock() + nc.ssid++ + sub.sid = nc.ssid + nc.subs[sub.sid] = sub + nc.subsMu.Unlock() + + // We will send these for all subs when we reconnect + // so that we can suppress here if reconnecting. + if !nc.isReconnecting() { + fmt.Fprintf(nc.bw, subProto, subj, queue, sub.sid) + // Kick flusher if needed. + if len(nc.fch) == 0 { + nc.kickFlusher() + } + } + + return sub, nil +} + +// NumSubscriptions returns active number of subscriptions. +func (nc *Conn) NumSubscriptions() int { + nc.mu.Lock() + defer nc.mu.Unlock() + return len(nc.subs) +} + +// Lock for nc should be held here upon entry +func (nc *Conn) removeSub(s *Subscription) { + nc.subsMu.Lock() + delete(nc.subs, s.sid) + nc.subsMu.Unlock() + s.mu.Lock() + defer s.mu.Unlock() + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + + // Mark as invalid + s.conn = nil + s.closed = true + if s.pCond != nil { + s.pCond.Broadcast() + } +} + +// SubscriptionType is the type of the Subscription. +type SubscriptionType int + +// The different types of subscription types. +const ( + AsyncSubscription = SubscriptionType(iota) + SyncSubscription + ChanSubscription + NilSubscription +) + +// Type returns the type of Subscription. +func (s *Subscription) Type() SubscriptionType { + if s == nil { + return NilSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + return s.typ +} + +// IsValid returns a boolean indicating whether the subscription +// is still active. This will return false if the subscription has +// already been closed. +func (s *Subscription) IsValid() bool { + if s == nil { + return false + } + s.mu.Lock() + defer s.mu.Unlock() + return s.conn != nil +} + +// Drain will remove interest but continue callbacks until all messages +// have been processed. +func (s *Subscription) Drain() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, 0, true) +} + +// Unsubscribe will remove interest in the given subject. +func (s *Subscription) Unsubscribe() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + if conn.IsDraining() { + return ErrConnectionDraining + } + return conn.unsubscribe(s, 0, false) +} + +// checkDrained will watch for a subscription to be fully drained +// and then remove it. +func (nc *Conn) checkDrained(sub *Subscription) { + if nc == nil || sub == nil { + return + } + + // This allows us to know that whatever we have in the client pending + // is correct and the server will not send additional information. + nc.Flush() + + // Once we are here we just wait for Pending to reach 0 or + // any other state to exit this go routine. + for { + // check connection is still valid. + if nc.IsClosed() { + return + } + + // Check subscription state + sub.mu.Lock() + conn := sub.conn + closed := sub.closed + pMsgs := sub.pMsgs + sub.mu.Unlock() + + if conn == nil || closed || pMsgs == 0 { + nc.mu.Lock() + nc.removeSub(sub) + nc.mu.Unlock() + return + } + + time.Sleep(100 * time.Millisecond) + } +} + +// AutoUnsubscribe will issue an automatic Unsubscribe that is +// processed by the server when max messages have been received. +// This can be useful when sending a request to an unknown number +// of subscribers. +func (s *Subscription) AutoUnsubscribe(max int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, max, false) +} + +// unsubscribe performs the low level unsubscribe to the server. +// Use Subscription.Unsubscribe() +func (nc *Conn) unsubscribe(sub *Subscription, max int, drainMode bool) error { + nc.mu.Lock() + // ok here, but defer is expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + if nc.isClosed() { + return ErrConnectionClosed + } + + nc.subsMu.RLock() + s := nc.subs[sub.sid] + nc.subsMu.RUnlock() + // Already unsubscribed + if s == nil { + return nil + } + + maxStr := _EMPTY_ + if max > 0 { + s.max = uint64(max) + maxStr = strconv.Itoa(max) + } else if !drainMode { + nc.removeSub(s) + } + + if drainMode { + go nc.checkDrained(sub) + } + + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr) + } + return nil +} + +// NextMsg will return the next message available to a synchronous subscriber +// or block until one is available. A timeout can be used to return when no +// message has been delivered. +func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) { + if s == nil { + return nil, ErrBadSubscription + } + + s.mu.Lock() + err := s.validateNextMsgState() + if err != nil { + s.mu.Unlock() + return nil, err + } + + // snapshot + mch := s.mch + s.mu.Unlock() + + var ok bool + var msg *Msg + + // If something is available right away, let's optimize that case. + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } else { + return msg, nil + } + default: + } + + // If we are here a message was not immediately available, so lets loop + // with a timeout. + + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + if err := s.processNextMsgDelivered(msg); err != nil { + return nil, err + } + case <-t.C: + return nil, ErrTimeout + } + + return msg, nil +} + +// validateNextMsgState checks whether the subscription is in a valid +// state to call NextMsg and be delivered another message synchronously. +// This should be called while holding the lock. +func (s *Subscription) validateNextMsgState() error { + if s.connClosed { + return ErrConnectionClosed + } + if s.mch == nil { + if s.max > 0 && s.delivered >= s.max { + return ErrMaxMessages + } else if s.closed { + return ErrBadSubscription + } + } + if s.mcb != nil { + return ErrSyncSubRequired + } + if s.sc { + s.sc = false + return ErrSlowConsumer + } + + return nil +} + +// processNextMsgDelivered takes a message and applies the needed +// accounting to the stats from the subscription, returning an +// error in case we have the maximum number of messages have been +// delivered already. It should not be called while holding the lock. +func (s *Subscription) processNextMsgDelivered(msg *Msg) error { + s.mu.Lock() + nc := s.conn + max := s.max + + // Update some stats. + s.delivered++ + delivered := s.delivered + if s.typ == SyncSubscription { + s.pMsgs-- + s.pBytes -= len(msg.Data) + } + s.mu.Unlock() + + if max > 0 { + if delivered > max { + return ErrMaxMessages + } + // Remove subscription if we have reached max. + if delivered == max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + } + } + + return nil +} + +// Queued returns the number of queued messages in the client for this subscription. +// DEPRECATED: Use Pending() +func (s *Subscription) QueuedMsgs() (int, error) { + m, _, err := s.Pending() + return int(m), err +} + +// Pending returns the number of queued messages and queued bytes in the client for this subscription. +func (s *Subscription) Pending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgs, s.pBytes, nil +} + +// MaxPending returns the maximum number of queued messages and queued bytes seen so far. +func (s *Subscription) MaxPending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsMax, s.pBytesMax, nil +} + +// ClearMaxPending resets the maximums seen so far. +func (s *Subscription) ClearMaxPending() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + s.pMsgsMax, s.pBytesMax = 0, 0 + return nil +} + +// Pending Limits +const ( + DefaultSubPendingMsgsLimit = 65536 + DefaultSubPendingBytesLimit = 65536 * 1024 +) + +// PendingLimits returns the current limits for this subscription. +// If no error is returned, a negative value indicates that the +// given metric is not limited. +func (s *Subscription) PendingLimits() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsLimit, s.pBytesLimit, nil +} + +// SetPendingLimits sets the limits for pending msgs and bytes for this subscription. +// Zero is not allowed. Any negative value means that the given metric is not limited. +func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + if msgLimit == 0 || bytesLimit == 0 { + return ErrInvalidArg + } + s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit + return nil +} + +// Delivered returns the number of delivered messages for this subscription. +func (s *Subscription) Delivered() (int64, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return int64(s.delivered), nil +} + +// Dropped returns the number of known dropped messages for this subscription. +// This will correspond to messages dropped by violations of PendingLimits. If +// the server declares the connection a SlowConsumer, this number may not be +// valid. +func (s *Subscription) Dropped() (int, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return s.dropped, nil +} + +// FIXME: This is a hack +// removeFlushEntry is needed when we need to discard queued up responses +// for our pings as part of a flush call. This happens when we have a flush +// call outstanding and we call close. +func (nc *Conn) removeFlushEntry(ch chan struct{}) bool { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.pongs == nil { + return false + } + for i, c := range nc.pongs { + if c == ch { + nc.pongs[i] = nil + return true + } + } + return false +} + +// The lock must be held entering this function. +func (nc *Conn) sendPing(ch chan struct{}) { + nc.pongs = append(nc.pongs, ch) + nc.bw.WriteString(pingProto) + // Flush in place. + nc.bw.Flush() +} + +// This will fire periodically and send a client origin +// ping to the server. Will also check that we have received +// responses from the server. +func (nc *Conn) processPingTimer() { + nc.mu.Lock() + + if nc.status != CONNECTED { + nc.mu.Unlock() + return + } + + // Check for violation + nc.pout++ + if nc.pout > nc.Opts.MaxPingsOut { + nc.mu.Unlock() + nc.processOpErr(ErrStaleConnection) + return + } + + nc.sendPing(nil) + nc.ptmr.Reset(nc.Opts.PingInterval) + nc.mu.Unlock() +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) { + if nc == nil { + return ErrInvalidConnection + } + if timeout <= 0 { + return ErrBadTimeout + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + t := globalTimerPool.Get(timeout) + defer globalTimerPool.Put(t) + + // Create a buffered channel to prevent chan send to block + // in processPong() if this code here times out just when + // PONG was received. + ch := make(chan struct{}, 1) + nc.sendPing(ch) + nc.mu.Unlock() + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-t.C: + err = ErrTimeout + } + + if err != nil { + nc.removeFlushEntry(ch) + } + return +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (nc *Conn) Flush() error { + return nc.FlushTimeout(60 * time.Second) +} + +// Buffered will return the number of bytes buffered to be sent to the server. +// FIXME(dlc) take into account disconnected state. +func (nc *Conn) Buffered() (int, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() || nc.bw == nil { + return -1, ErrConnectionClosed + } + return nc.bw.Buffered(), nil +} + +// resendSubscriptions will send our subscription state back to the +// server. Used in reconnects +func (nc *Conn) resendSubscriptions() { + // Since we are going to send protocols to the server, we don't want to + // be holding the subsMu lock (which is used in processMsg). So copy + // the subscriptions in a temporary array. + nc.subsMu.RLock() + subs := make([]*Subscription, 0, len(nc.subs)) + for _, s := range nc.subs { + subs = append(subs, s) + } + nc.subsMu.RUnlock() + for _, s := range subs { + adjustedMax := uint64(0) + s.mu.Lock() + if s.max > 0 { + if s.delivered < s.max { + adjustedMax = s.max - s.delivered + } + // adjustedMax could be 0 here if the number of delivered msgs + // reached the max, if so unsubscribe. + if adjustedMax == 0 { + s.mu.Unlock() + fmt.Fprintf(nc.bw, unsubProto, s.sid, _EMPTY_) + continue + } + } + s.mu.Unlock() + + fmt.Fprintf(nc.bw, subProto, s.Subject, s.Queue, s.sid) + if adjustedMax > 0 { + maxStr := strconv.Itoa(int(adjustedMax)) + fmt.Fprintf(nc.bw, unsubProto, s.sid, maxStr) + } + } +} + +// This will clear any pending flush calls and release pending calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingFlushCalls() { + // Clear any queued pongs, e.g. pending flush calls. + for _, ch := range nc.pongs { + if ch != nil { + close(ch) + } + } + nc.pongs = nil +} + +// This will clear any pending Request calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingRequestCalls() { + if nc.respMap == nil { + return + } + for key, ch := range nc.respMap { + if ch != nil { + close(ch) + delete(nc.respMap, key) + } + } +} + +// Low level close call that will do correct cleanup and set +// desired status. Also controls whether user defined callbacks +// will be triggered. The lock should not be held entering this +// function. This function will handle the locking manually. +func (nc *Conn) close(status Status, doCBs bool) { + nc.mu.Lock() + if nc.isClosed() { + nc.status = status + nc.mu.Unlock() + return + } + nc.status = CLOSED + + // Kick the Go routines so they fall out. + nc.kickFlusher() + nc.mu.Unlock() + + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any queued and blocking Requests. + nc.clearPendingRequestCalls() + + // Stop ping timer if set. + nc.stopPingTimer() + nc.ptmr = nil + + // Go ahead and make sure we have flushed the outbound + if nc.conn != nil { + nc.bw.Flush() + defer nc.conn.Close() + } + + // Close sync subscriber channels and release any + // pending NextMsg() calls. + nc.subsMu.Lock() + for _, s := range nc.subs { + s.mu.Lock() + + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + // Mark as invalid, for signaling to deliverMsgs + s.closed = true + // Mark connection closed in subscription + s.connClosed = true + // If we have an async subscription, signals it to exit + if s.typ == AsyncSubscription && s.pCond != nil { + s.pCond.Signal() + } + + s.mu.Unlock() + } + nc.subs = nil + nc.subsMu.Unlock() + + nc.status = status + + // Perform appropriate callback if needed for a disconnect. + if doCBs { + if nc.Opts.DisconnectedCB != nil && nc.conn != nil { + nc.ach.push(func() { nc.Opts.DisconnectedCB(nc) }) + } + if nc.Opts.ClosedCB != nil { + nc.ach.push(func() { nc.Opts.ClosedCB(nc) }) + } + nc.ach.close() + } + nc.mu.Unlock() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush() and NextMsg() +func (nc *Conn) Close() { + nc.close(CLOSED, true) +} + +// IsClosed tests if a Conn has been closed. +func (nc *Conn) IsClosed() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isClosed() +} + +// IsReconnecting tests if a Conn is reconnecting. +func (nc *Conn) IsReconnecting() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isReconnecting() +} + +// IsConnected tests if a Conn is connected. +func (nc *Conn) IsConnected() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isConnected() +} + +// drainConnection will run in a separate Go routine and will +// flush all publishes and drain all active subscriptions. +func (nc *Conn) drainConnection() { + // Snapshot subs list. + nc.mu.Lock() + subs := make([]*Subscription, 0, len(nc.subs)) + for _, s := range nc.subs { + subs = append(subs, s) + } + errCB := nc.Opts.AsyncErrorCB + drainWait := nc.Opts.DrainTimeout + nc.mu.Unlock() + + // for pushing errors with context. + pushErr := func(err error) { + nc.mu.Lock() + nc.err = err + if errCB != nil { + nc.ach.push(func() { errCB(nc, nil, err) }) + } + nc.mu.Unlock() + } + + // Do subs first + for _, s := range subs { + if err := s.Drain(); err != nil { + // We will notify about these but continue. + pushErr(err) + } + } + + // Wait for the subscriptions to drop to zero. + timeout := time.Now().Add(drainWait) + for time.Now().Before(timeout) { + if nc.NumSubscriptions() == 0 { + break + } + time.Sleep(10 * time.Millisecond) + } + + // Check if we timed out. + if nc.NumSubscriptions() != 0 { + pushErr(ErrDrainTimeout) + } + + // Flip State + nc.mu.Lock() + nc.status = DRAINING_PUBS + nc.mu.Unlock() + + // Do publish drain via Flush() call. + err := nc.Flush() + if err != nil { + pushErr(err) + nc.Close() + return + } + + // Move to closed state. + nc.Close() +} + +// Drain will put a connection into a drain state. All subscriptions will +// immediately be put into a drain state. Upon completion, the publishers +// will be drained and can not publish any additional messages. Upon draining +// of the publishers, the connection will be closed. Use the ClosedCB() +// option to know when the connection has moved from draining to closed. +func (nc *Conn) Drain() error { + nc.mu.Lock() + defer nc.mu.Unlock() + + if nc.isClosed() { + return ErrConnectionClosed + } + if nc.isConnecting() || nc.isReconnecting() { + return ErrConnectionReconnecting + } + if nc.isDraining() { + return nil + } + + nc.status = DRAINING_SUBS + go nc.drainConnection() + return nil +} + +// IsDraining tests if a Conn is in the draining state. +func (nc *Conn) IsDraining() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isDraining() +} + +// caller must lock +func (nc *Conn) getServers(implicitOnly bool) []string { + poolSize := len(nc.srvPool) + var servers = make([]string, 0) + for i := 0; i < poolSize; i++ { + if implicitOnly && !nc.srvPool[i].isImplicit { + continue + } + url := nc.srvPool[i].url + servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host)) + } + return servers +} + +// Servers returns the list of known server urls, including additional +// servers discovered after a connection has been established. If +// authentication is enabled, use UserInfo or Token when connecting with +// these urls. +func (nc *Conn) Servers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(false) +} + +// DiscoveredServers returns only the server urls that have been discovered +// after a connection has been established. If authentication is enabled, +// use UserInfo or Token when connecting with these urls. +func (nc *Conn) DiscoveredServers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(true) +} + +// Status returns the current state of the connection. +func (nc *Conn) Status() Status { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.status +} + +// Test if Conn has been closed Lock is assumed held. +func (nc *Conn) isClosed() bool { + return nc.status == CLOSED +} + +// Test if Conn is in the process of connecting +func (nc *Conn) isConnecting() bool { + return nc.status == CONNECTING +} + +// Test if Conn is being reconnected. +func (nc *Conn) isReconnecting() bool { + return nc.status == RECONNECTING +} + +// Test if Conn is connected or connecting. +func (nc *Conn) isConnected() bool { + return nc.status == CONNECTED || nc.isDraining() +} + +// Test if Conn is in the draining state. +func (nc *Conn) isDraining() bool { + return nc.status == DRAINING_SUBS || nc.status == DRAINING_PUBS +} + +// Test if Conn is in the draining state for pubs. +func (nc *Conn) isDrainingPubs() bool { + return nc.status == DRAINING_PUBS +} + +// Stats will return a race safe copy of the Statistics section for the connection. +func (nc *Conn) Stats() Statistics { + // Stats are updated either under connection's mu or subsMu mutexes. + // Lock both to safely get them. + nc.mu.Lock() + nc.subsMu.RLock() + stats := Statistics{ + InMsgs: nc.InMsgs, + InBytes: nc.InBytes, + OutMsgs: nc.OutMsgs, + OutBytes: nc.OutBytes, + Reconnects: nc.Reconnects, + } + nc.subsMu.RUnlock() + nc.mu.Unlock() + return stats +} + +// MaxPayload returns the size limit that a message payload can have. +// This is set by the server configuration and delivered to the client +// upon connect. +func (nc *Conn) MaxPayload() int64 { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.MaxPayload +} + +// AuthRequired will return if the connected server requires authorization. +func (nc *Conn) AuthRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.AuthRequired +} + +// TLSRequired will return if the connected server requires TLS connections. +func (nc *Conn) TLSRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.TLSRequired +} + +// Barrier schedules the given function `f` to all registered asynchronous +// subscriptions. +// Only the last subscription to see this barrier will invoke the function. +// If no subscription is registered at the time of this call, `f()` is invoked +// right away. +// ErrConnectionClosed is returned if the connection is closed prior to +// the call. +func (nc *Conn) Barrier(f func()) error { + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + nc.subsMu.Lock() + // Need to figure out how many non chan subscriptions there are + numSubs := 0 + for _, sub := range nc.subs { + if sub.typ == AsyncSubscription { + numSubs++ + } + } + if numSubs == 0 { + nc.subsMu.Unlock() + nc.mu.Unlock() + f() + return nil + } + barrier := &barrierInfo{refs: int64(numSubs), f: f} + for _, sub := range nc.subs { + sub.mu.Lock() + if sub.mch == nil { + msg := &Msg{barrier: barrier} + // Push onto the async pList + if sub.pTail != nil { + sub.pTail.next = msg + } else { + sub.pHead = msg + sub.pCond.Signal() + } + sub.pTail = msg + } + sub.mu.Unlock() + } + nc.subsMu.Unlock() + nc.mu.Unlock() + return nil +} + +// GetClientID returns the client ID assigned by the server to which +// the client is currently connected to. Note that the value may change if +// the client reconnects. +// This function returns ErrNoClientIDReturned if the server is of a +// version prior to 1.2.0. +func (nc *Conn) GetClientID() (uint64, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() { + return 0, ErrConnectionClosed + } + if nc.info.CID == 0 { + return 0, ErrClientIDNotSupported + } + return nc.info.CID, nil +} + +// NkeyOptionFromSeed will load an nkey pair from a seed file. +// It will return the NKey Option and will handle +// signing of nonce challenges from the server. It will take +// care to not hold keys in memory and to wipe memory. +func NkeyOptionFromSeed(seedFile string) (Option, error) { + kp, err := nkeyPairFromSeedFile(seedFile) + if err != nil { + return nil, err + } + // Wipe our key on exit. + defer kp.Wipe() + + pub, err := kp.PublicKey() + if err != nil { + return nil, err + } + if !nkeys.IsValidPublicUserKey(pub) { + return nil, fmt.Errorf("nats: Not a valid nkey user seed") + } + sigCB := func(nonce []byte) ([]byte, error) { + return sigHandler(nonce, seedFile) + } + return Nkey(string(pub), sigCB), nil +} + +// This is a regex to match decorated jwts in keys/seeds. +// .e.g. +// -----BEGIN NATS USER JWT----- +// eyJ0eXAiOiJqd3QiLCJhbGciOiJlZDI1NTE5... +// ------END NATS USER JWT------ +// +// ************************* IMPORTANT ************************* +// NKEY Seed printed below can be used sign and prove identity. +// NKEYs are sensitive and should be treated as secrets. +// +// -----BEGIN USER NKEY SEED----- +// SUAIO3FHUX5PNV2LQIIP7TZ3N4L7TX3W53MQGEIVYFIGA635OZCKEYHFLM +// ------END USER NKEY SEED------ + +var nscDecoratedRe = regexp.MustCompile(`\s*(?:(?:[-]{3,}[^\n]*[-]{3,}\n)(.+)(?:\n\s*[-]{3,}[^\n]*[-]{3,}\n))`) + +func userFromFile(userFile string) (string, error) { + contents, err := ioutil.ReadFile(userFile) + if err != nil { + return _EMPTY_, fmt.Errorf("nats: %v", err) + } + defer wipeSlice(contents) + + items := nscDecoratedRe.FindAllSubmatch(contents, -1) + if len(items) == 0 { + return string(contents), nil + } + // First result should be the user JWT. + // We copy here so that if the file contained a seed file too we wipe appropriately. + raw := items[0][1] + tmp := make([]byte, len(raw)) + copy(tmp, raw) + return string(tmp), nil +} + +func nkeyPairFromSeedFile(seedFile string) (nkeys.KeyPair, error) { + var seed []byte + contents, err := ioutil.ReadFile(seedFile) + if err != nil { + return nil, fmt.Errorf("nats: %v", err) + } + defer wipeSlice(contents) + + items := nscDecoratedRe.FindAllSubmatch(contents, -1) + if len(items) > 1 { + seed = items[1][1] + } else { + lines := bytes.Split(contents, []byte("\n")) + for _, line := range lines { + if bytes.HasPrefix(bytes.TrimSpace(line), []byte("SU")) { + seed = line + break + } + } + } + + if seed == nil { + return nil, fmt.Errorf("nats: No nkey user seed found in %q", seedFile) + } + kp, err := nkeys.FromSeed(seed) + if err != nil { + return nil, err + } + return kp, nil +} + +// Sign authentication challenges from the server. +// Do not keep private seed in memory. +func sigHandler(nonce []byte, seedFile string) ([]byte, error) { + kp, err := nkeyPairFromSeedFile(seedFile) + if err != nil { + return nil, err + } + // Wipe our key on exit. + defer kp.Wipe() + + sig, _ := kp.Sign(nonce) + return sig, nil +} + +// Just wipe slice with 'x', for clearing contents of nkey seed file. +func wipeSlice(buf []byte) { + for i := range buf { + buf[i] = 'x' + } +} + +type timeoutWriter struct { + timeout time.Duration + conn net.Conn + err error +} + +// Write implements the io.Writer interface. +func (tw *timeoutWriter) Write(p []byte) (int, error) { + if tw.err != nil { + return 0, tw.err + } + + var n int + tw.conn.SetWriteDeadline(time.Now().Add(tw.timeout)) + n, tw.err = tw.conn.Write(p) + tw.conn.SetWriteDeadline(time.Time{}) + return n, tw.err +} diff --git a/vendor/github.com/nats-io/nats.go/netchan.go b/vendor/github.com/nats-io/nats.go/netchan.go new file mode 100644 index 0000000..add3cba --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/netchan.go @@ -0,0 +1,111 @@ +// Copyright 2013-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "errors" + "reflect" +) + +// This allows the functionality for network channels by binding send and receive Go chans +// to subjects and optionally queue groups. +// Data will be encoded and decoded via the EncodedConn and its associated encoders. + +// BindSendChan binds a channel for send operations to NATS. +func (c *EncodedConn) BindSendChan(subject string, channel interface{}) error { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return ErrChanArg + } + go chPublish(c, chVal, subject) + return nil +} + +// Publish all values that arrive on the channel until it is closed or we +// encounter an error. +func chPublish(c *EncodedConn, chVal reflect.Value, subject string) { + for { + val, ok := chVal.Recv() + if !ok { + // Channel has most likely been closed. + return + } + if e := c.Publish(subject, val.Interface()); e != nil { + // Do this under lock. + c.Conn.mu.Lock() + defer c.Conn.mu.Unlock() + + if c.Conn.Opts.AsyncErrorCB != nil { + // FIXME(dlc) - Not sure this is the right thing to do. + // FIXME(ivan) - If the connection is not yet closed, try to schedule the callback + if c.Conn.isClosed() { + go c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) + } else { + c.Conn.ach.push(func() { c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) }) + } + } + return + } + } +} + +// BindRecvChan binds a channel for receive operations from NATS. +func (c *EncodedConn) BindRecvChan(subject string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, _EMPTY_, channel) +} + +// BindRecvQueueChan binds a channel for queue-based receive operations from NATS. +func (c *EncodedConn) BindRecvQueueChan(subject, queue string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, queue, channel) +} + +// Internal function to bind receive operations for a channel. +func (c *EncodedConn) bindRecvChan(subject, queue string, channel interface{}) (*Subscription, error) { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return nil, ErrChanArg + } + argType := chVal.Type().Elem() + + cb := func(m *Msg) { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + c.Conn.err = errors.New("nats: Got an error trying to unmarshal: " + err.Error()) + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach.push(func() { c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, c.Conn.err) }) + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + // This is a bit hacky, but in this instance we may be trying to send to a closed channel. + // and the user does not know when it is safe to close the channel. + defer func() { + // If we have panicked, recover and close the subscription. + if r := recover(); r != nil { + m.Sub.Unsubscribe() + } + }() + // Actually do the send to the channel. + chVal.Send(oPtr) + } + + return c.Conn.subscribe(subject, queue, cb, nil) +} diff --git a/vendor/github.com/nats-io/nats.go/parser.go b/vendor/github.com/nats-io/nats.go/parser.go new file mode 100644 index 0000000..a4b3ea0 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/parser.go @@ -0,0 +1,481 @@ +// Copyright 2012-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "fmt" +) + +type msgArg struct { + subject []byte + reply []byte + sid int64 + size int +} + +const MAX_CONTROL_LINE_SIZE = 1024 + +type parseState struct { + state int + as int + drop int + ma msgArg + argBuf []byte + msgBuf []byte + scratch [MAX_CONTROL_LINE_SIZE]byte +} + +const ( + OP_START = iota + OP_PLUS + OP_PLUS_O + OP_PLUS_OK + OP_MINUS + OP_MINUS_E + OP_MINUS_ER + OP_MINUS_ERR + OP_MINUS_ERR_SPC + MINUS_ERR_ARG + OP_M + OP_MS + OP_MSG + OP_MSG_SPC + MSG_ARG + MSG_PAYLOAD + MSG_END + OP_P + OP_PI + OP_PIN + OP_PING + OP_PO + OP_PON + OP_PONG + OP_I + OP_IN + OP_INF + OP_INFO + OP_INFO_SPC + INFO_ARG +) + +// parse is the fast protocol parser engine. +func (nc *Conn) parse(buf []byte) error { + var i int + var b byte + + // Move to loop instead of range syntax to allow jumping of i + for i = 0; i < len(buf); i++ { + b = buf[i] + + switch nc.ps.state { + case OP_START: + switch b { + case 'M', 'm': + nc.ps.state = OP_M + case 'P', 'p': + nc.ps.state = OP_P + case '+': + nc.ps.state = OP_PLUS + case '-': + nc.ps.state = OP_MINUS + case 'I', 'i': + nc.ps.state = OP_I + default: + goto parseErr + } + case OP_M: + switch b { + case 'S', 's': + nc.ps.state = OP_MS + default: + goto parseErr + } + case OP_MS: + switch b { + case 'G', 'g': + nc.ps.state = OP_MSG + default: + goto parseErr + } + case OP_MSG: + switch b { + case ' ', '\t': + nc.ps.state = OP_MSG_SPC + default: + goto parseErr + } + case OP_MSG_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MSG_ARG + nc.ps.as = i + } + case MSG_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + if err := nc.processMsgArgs(arg); err != nil { + return err + } + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, MSG_PAYLOAD + + // jump ahead with the index. If this overruns + // what is left we fall out and process split + // buffer. + i = nc.ps.as + nc.ps.ma.size - 1 + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case MSG_PAYLOAD: + if nc.ps.msgBuf != nil { + if len(nc.ps.msgBuf) >= nc.ps.ma.size { + nc.processMsg(nc.ps.msgBuf) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } else { + // copy as much as we can to the buffer and skip ahead. + toCopy := nc.ps.ma.size - len(nc.ps.msgBuf) + avail := len(buf) - i + + if avail < toCopy { + toCopy = avail + } + + if toCopy > 0 { + start := len(nc.ps.msgBuf) + // This is needed for copy to work. + nc.ps.msgBuf = nc.ps.msgBuf[:start+toCopy] + copy(nc.ps.msgBuf[start:], buf[i:i+toCopy]) + // Update our index + i = (i + toCopy) - 1 + } else { + nc.ps.msgBuf = append(nc.ps.msgBuf, b) + } + } + } else if i-nc.ps.as >= nc.ps.ma.size { + nc.processMsg(buf[nc.ps.as:i]) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } + case MSG_END: + switch b { + case '\n': + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + continue + } + case OP_PLUS: + switch b { + case 'O', 'o': + nc.ps.state = OP_PLUS_O + default: + goto parseErr + } + case OP_PLUS_O: + switch b { + case 'K', 'k': + nc.ps.state = OP_PLUS_OK + default: + goto parseErr + } + case OP_PLUS_OK: + switch b { + case '\n': + nc.processOK() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_MINUS: + switch b { + case 'E', 'e': + nc.ps.state = OP_MINUS_E + default: + goto parseErr + } + case OP_MINUS_E: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ER + default: + goto parseErr + } + case OP_MINUS_ER: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ERR + default: + goto parseErr + } + case OP_MINUS_ERR: + switch b { + case ' ', '\t': + nc.ps.state = OP_MINUS_ERR_SPC + default: + goto parseErr + } + case OP_MINUS_ERR_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MINUS_ERR_ARG + nc.ps.as = i + } + case MINUS_ERR_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processErr(string(arg)) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case OP_P: + switch b { + case 'I', 'i': + nc.ps.state = OP_PI + case 'O', 'o': + nc.ps.state = OP_PO + default: + goto parseErr + } + case OP_PO: + switch b { + case 'N', 'n': + nc.ps.state = OP_PON + default: + goto parseErr + } + case OP_PON: + switch b { + case 'G', 'g': + nc.ps.state = OP_PONG + default: + goto parseErr + } + case OP_PONG: + switch b { + case '\n': + nc.processPong() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_PI: + switch b { + case 'N', 'n': + nc.ps.state = OP_PIN + default: + goto parseErr + } + case OP_PIN: + switch b { + case 'G', 'g': + nc.ps.state = OP_PING + default: + goto parseErr + } + case OP_PING: + switch b { + case '\n': + nc.processPing() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_I: + switch b { + case 'N', 'n': + nc.ps.state = OP_IN + default: + goto parseErr + } + case OP_IN: + switch b { + case 'F', 'f': + nc.ps.state = OP_INF + default: + goto parseErr + } + case OP_INF: + switch b { + case 'O', 'o': + nc.ps.state = OP_INFO + default: + goto parseErr + } + case OP_INFO: + switch b { + case ' ', '\t': + nc.ps.state = OP_INFO_SPC + default: + goto parseErr + } + case OP_INFO_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = INFO_ARG + nc.ps.as = i + } + case INFO_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processAsyncInfo(arg) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + default: + goto parseErr + } + } + // Check for split buffer scenarios + if (nc.ps.state == MSG_ARG || nc.ps.state == MINUS_ERR_ARG || nc.ps.state == INFO_ARG) && nc.ps.argBuf == nil { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, buf[nc.ps.as:i-nc.ps.drop]...) + // FIXME, check max len + } + // Check for split msg + if nc.ps.state == MSG_PAYLOAD && nc.ps.msgBuf == nil { + // We need to clone the msgArg if it is still referencing the + // read buffer and we are not able to process the msg. + if nc.ps.argBuf == nil { + nc.cloneMsgArg() + } + + // If we will overflow the scratch buffer, just create a + // new buffer to hold the split message. + if nc.ps.ma.size > cap(nc.ps.scratch)-len(nc.ps.argBuf) { + lrem := len(buf[nc.ps.as:]) + + nc.ps.msgBuf = make([]byte, lrem, nc.ps.ma.size) + copy(nc.ps.msgBuf, buf[nc.ps.as:]) + } else { + nc.ps.msgBuf = nc.ps.scratch[len(nc.ps.argBuf):len(nc.ps.argBuf)] + nc.ps.msgBuf = append(nc.ps.msgBuf, (buf[nc.ps.as:])...) + } + } + + return nil + +parseErr: + return fmt.Errorf("nats: Parse Error [%d]: '%s'", nc.ps.state, buf[i:]) +} + +// cloneMsgArg is used when the split buffer scenario has the pubArg in the existing read buffer, but +// we need to hold onto it into the next read. +func (nc *Conn) cloneMsgArg() { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.subject...) + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.reply...) + nc.ps.ma.subject = nc.ps.argBuf[:len(nc.ps.ma.subject)] + if nc.ps.ma.reply != nil { + nc.ps.ma.reply = nc.ps.argBuf[len(nc.ps.ma.subject):] + } +} + +const argsLenMax = 4 + +func (nc *Conn) processMsgArgs(arg []byte) error { + // Unroll splitArgs to avoid runtime/heap issues + a := [argsLenMax][]byte{} + args := a[:0] + start := -1 + for i, b := range arg { + switch b { + case ' ', '\t', '\r', '\n': + if start >= 0 { + args = append(args, arg[start:i]) + start = -1 + } + default: + if start < 0 { + start = i + } + } + } + if start >= 0 { + args = append(args, arg[start:]) + } + + switch len(args) { + case 3: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = nil + nc.ps.ma.size = int(parseInt64(args[2])) + case 4: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = args[2] + nc.ps.ma.size = int(parseInt64(args[3])) + default: + return fmt.Errorf("nats: processMsgArgs Parse Error: '%s'", arg) + } + if nc.ps.ma.sid < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Sid: '%s'", arg) + } + if nc.ps.ma.size < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Size: '%s'", arg) + } + return nil +} + +// Ascii numbers 0-9 +const ( + ascii_0 = 48 + ascii_9 = 57 +) + +// parseInt64 expects decimal positive numbers. We +// return -1 to signal error +func parseInt64(d []byte) (n int64) { + if len(d) == 0 { + return -1 + } + for _, dec := range d { + if dec < ascii_0 || dec > ascii_9 { + return -1 + } + n = n*10 + (int64(dec) - ascii_0) + } + return n +} diff --git a/vendor/github.com/nats-io/nats.go/staticcheck.ignore b/vendor/github.com/nats-io/nats.go/staticcheck.ignore new file mode 100644 index 0000000..25bbf02 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/staticcheck.ignore @@ -0,0 +1,4 @@ +github.com/nats-io/go-nats/*_test.go:SA2002 +github.com/nats-io/go-nats/*/*_test.go:SA2002 +github.com/nats-io/go-nats/test/context_test.go:SA1012 +github.com/nats-io/go-nats/nats.go:SA6000 diff --git a/vendor/github.com/nats-io/nats.go/timer.go b/vendor/github.com/nats-io/nats.go/timer.go new file mode 100644 index 0000000..1216762 --- /dev/null +++ b/vendor/github.com/nats-io/nats.go/timer.go @@ -0,0 +1,56 @@ +// Copyright 2017-2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nats + +import ( + "sync" + "time" +) + +// global pool of *time.Timer's. can be used by multiple goroutines concurrently. +var globalTimerPool timerPool + +// timerPool provides GC-able pooling of *time.Timer's. +// can be used by multiple goroutines concurrently. +type timerPool struct { + p sync.Pool +} + +// Get returns a timer that completes after the given duration. +func (tp *timerPool) Get(d time.Duration) *time.Timer { + if t, _ := tp.p.Get().(*time.Timer); t != nil { + t.Reset(d) + return t + } + + return time.NewTimer(d) +} + +// Put pools the given timer. +// +// There is no need to call t.Stop() before calling Put. +// +// Put will try to stop the timer before pooling. If the +// given timer already expired, Put will read the unreceived +// value if there is one. +func (tp *timerPool) Put(t *time.Timer) { + if !t.Stop() { + select { + case <-t.C: + default: + } + } + + tp.p.Put(t) +} diff --git a/vendor/github.com/nats-io/nkeys/.gitignore b/vendor/github.com/nats-io/nkeys/.gitignore new file mode 100644 index 0000000..9dca5eb --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.gitignore @@ -0,0 +1,15 @@ +# Binaries for programs and plugins +*.exe +*.dll +*.so +*.dylib +build/ + +# Test binary, build with `go test -c` +*.test + +# Output of the go coverage tool, specifically when used with LiteIDE +*.out + +# Project-local glide cache, RE: https://github.com/Masterminds/glide/issues/736 +.glide/ diff --git a/vendor/github.com/nats-io/nkeys/.goreleaser.yml b/vendor/github.com/nats-io/nkeys/.goreleaser.yml new file mode 100644 index 0000000..6df08be --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.goreleaser.yml @@ -0,0 +1,38 @@ +project_name: nkeys +release: + github: + owner: nats-io + name: nkeys + name_template: '{{.Tag}}' + draft: true +builds: + - main: ./nk/main.go + ldflags: "-X main.Version={{.Tag}}_{{.Commit}}" + binary: nk + goos: + - linux + - darwin + goarch: + - amd64 + + +dist: build + +archive: + wrap_in_directory: true + name_template: '{{ .ProjectName }}-v{{ .Version }}-{{ .Os }}-{{ .Arch }}{{ if .Arm + }}v{{ .Arm }}{{ end }}' + format: zip + +checksum: + name_template: '{{ .ProjectName }}-v{{ .Version }}-checksums.txt' + +snapshot: + name_template: 'dev' + +nfpm: + formats: + - deb + bindir: /usr/local/bin + description: NKeys utility cli program + vendor: nats-io diff --git a/vendor/github.com/nats-io/nkeys/.travis.yml b/vendor/github.com/nats-io/nkeys/.travis.yml new file mode 100644 index 0000000..59041cd --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/.travis.yml @@ -0,0 +1,32 @@ +language: go +sudo: false +go: +- 1.11 +- 1.10.x +- 1.9.x + +install: +- go get -t ./... +- go get github.com/mattn/goveralls +- go get -u honnef.co/go/tools/cmd/megacheck +- go get -u github.com/client9/misspell/cmd/misspell + +before_script: +- $(exit $(go fmt ./... | wc -l)) +- go vet ./... +- misspell -error -locale US . +- megacheck -ignore "$(cat staticcheck.ignore)" ./... + +script: +- go test -v +- go test -v --race +- go test -v -covermode=count -coverprofile=coverage.out +- $HOME/gopath/bin/goveralls -coverprofile coverage.out -service travis-ci + +#deploy: +#- provider: script +# skip_cleanup: true +# script: curl -sL http://git.io/goreleaser | bash +# on: +# tags: true +# condition: $TRAVIS_OS_NAME = linux \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/GOVERNANCE.md b/vendor/github.com/nats-io/nkeys/GOVERNANCE.md new file mode 100644 index 0000000..744d3bc --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/GOVERNANCE.md @@ -0,0 +1,3 @@ +# NATS NKEYS Governance + +NATS NKEYS is part of the NATS project and is subject to the [NATS Governance](https://github.com/nats-io/nats-general/blob/master/GOVERNANCE.md). \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/LICENSE b/vendor/github.com/nats-io/nkeys/LICENSE new file mode 100644 index 0000000..261eeb9 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/nats-io/nkeys/MAINTAINERS.md b/vendor/github.com/nats-io/nkeys/MAINTAINERS.md new file mode 100644 index 0000000..6d0ed3e --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/MAINTAINERS.md @@ -0,0 +1,6 @@ +# Maintainers + +Maintainership is on a per project basis. + +### Core-maintainers + - Derek Collison [@derekcollison](https://github.com/derekcollison) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/README.md b/vendor/github.com/nats-io/nkeys/README.md new file mode 100644 index 0000000..5cb8786 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/README.md @@ -0,0 +1,72 @@ +# NKEYS + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![ReportCard](http://goreportcard.com/badge/nats-io/nkeys)](http://goreportcard.com/report/nats-io/nkeys) +[![Build Status](https://travis-ci.org/nats-io/nkeys.svg?branch=master)](http://travis-ci.org/nats-io/nkeys) +[![GoDoc](http://godoc.org/github.com/nats-io/nkeys?status.svg)](http://godoc.org/github.com/nats-io/nkeys) +[![Coverage Status](https://coveralls.io/repos/github/nats-io/nkeys/badge.svg?branch=master&service=github)](https://coveralls.io/github/nats-io/nkeys?branch=master) +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys?ref=badge_shield) + +A public-key signature system based on [Ed25519](https://ed25519.cr.yp.to/) for the NATS ecosystem. + +## About + +The NATS ecosystem will be moving to [Ed25519](https://ed25519.cr.yp.to/) keys for identity, authentication and authorization for entities such as Accounts, Users, Servers and Clusters. + +Ed25519 is fast and resistant to side channel attacks. Generation of a seed key is all that is needed to be stored and kept safe, as the seed can generate both the public and private keys. + +The NATS system will utilize Ed25519 keys, meaning that NATS systems will never store or even have access to any private keys. Authentication will utilize a random challenge response mechanism. + +Dealing with 32 byte and 64 byte raw keys can be challenging. NKEYS is designed to formulate keys in a much friendlier fashion and references work done in cryptocurrencies, specifically [Stellar](https://www.stellar.org/). Bitcoin and others used a form of Base58 (or Base58Check) to endode raw keys. Stellar utilized a more traditonal Base32 with a CRC16 and a version or prefix byte. NKEYS utilizes a similar format where the prefix will be 1 byte for public and private keys and will be 2 bytes for seeds. The base32 encoding of these prefixes will yield friendly human readbable prefixes, e.g. '**N**' = server, '**C**' = cluster, '**O**' = operator, '**A**' = account, and '**U**' = user. '**P**' is used for private keys. For seeds, the first encoded prefix is '**S**', and the second character will be the type for the public key, e.g. "**SU**" is a seed for a user key pair, "**SA**" is a seed for an account key pair. + +## Installation + +Use the `go` command: + + $ go get github.com/nats-io/nkeys + +## nk - Command Line Utility + +Located under the nk [directory](https://github.com/nats-io/nkeys/tree/master/nk). + +## Basic API Usage +```go + +// Create a new User KeyPair +user, _ := nkeys.CreateUser() + +// Sign some data with a full key pair user. +data := []byte("Hello World") +sig, _ := user.Sign(data) + +// Verify the signature. +err = user.Verify(data, sig) + +// Access the seed, the only thing that needs to be stored and kept safe. +// seed = "SUAKYRHVIOREXV7EUZTBHUHL7NUMHPMAS7QMDU3GTIUWEI5LDNOXD43IZY" +seed, _ := user.Seed() + +// Access the public key which can be shared. +// publicKey = "UD466L6EBCM3YY5HEGHJANNTN4LSKTSUXTH7RILHCKEQMQHTBNLHJJXT" +publicKey, _ := user.PublicKey() + +// Create a full User who can sign and verify from a private seed. +user, _ = nkeys.FromSeed(seed) + +// Create a User who can only verify signatures via a public key. +user, _ = nkeys.FromPublicKey(publicKey) + +// Create a User KeyPair with our own random data. +var rawSeed [32]byte +_, err := io.ReadFull(rand.Reader, rawSeed[:]) // Or some other random source. +user2, _ := nkeys.FromRawSeed(PrefixByteUser, rawSeed) + +``` + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. + + +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys.svg?type=large)](https://app.fossa.io/projects/git%2Bgithub.com%2Fnats-io%2Fnkeys?ref=badge_large) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nkeys/TODO.md b/vendor/github.com/nats-io/nkeys/TODO.md new file mode 100644 index 0000000..2649c9e --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/TODO.md @@ -0,0 +1,5 @@ + +# General + +- [ ] Child key derivation +- [ ] Hardware support, e.g. YubiHSM diff --git a/vendor/github.com/nats-io/nkeys/crc16.go b/vendor/github.com/nats-io/nkeys/crc16.go new file mode 100644 index 0000000..c3356cf --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/crc16.go @@ -0,0 +1,75 @@ +// Copyright 2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nkeys + +import ( + "errors" +) + +// An implementation of crc16 according to CCITT standards for XMODEM. + +// ErrInvalidChecksum indicates a failed verification. +var ErrInvalidChecksum = errors.New("nkeys: invalid checksum") + +var crc16tab = [256]uint16{ + 0x0000, 0x1021, 0x2042, 0x3063, 0x4084, 0x50a5, 0x60c6, 0x70e7, + 0x8108, 0x9129, 0xa14a, 0xb16b, 0xc18c, 0xd1ad, 0xe1ce, 0xf1ef, + 0x1231, 0x0210, 0x3273, 0x2252, 0x52b5, 0x4294, 0x72f7, 0x62d6, + 0x9339, 0x8318, 0xb37b, 0xa35a, 0xd3bd, 0xc39c, 0xf3ff, 0xe3de, + 0x2462, 0x3443, 0x0420, 0x1401, 0x64e6, 0x74c7, 0x44a4, 0x5485, + 0xa56a, 0xb54b, 0x8528, 0x9509, 0xe5ee, 0xf5cf, 0xc5ac, 0xd58d, + 0x3653, 0x2672, 0x1611, 0x0630, 0x76d7, 0x66f6, 0x5695, 0x46b4, + 0xb75b, 0xa77a, 0x9719, 0x8738, 0xf7df, 0xe7fe, 0xd79d, 0xc7bc, + 0x48c4, 0x58e5, 0x6886, 0x78a7, 0x0840, 0x1861, 0x2802, 0x3823, + 0xc9cc, 0xd9ed, 0xe98e, 0xf9af, 0x8948, 0x9969, 0xa90a, 0xb92b, + 0x5af5, 0x4ad4, 0x7ab7, 0x6a96, 0x1a71, 0x0a50, 0x3a33, 0x2a12, + 0xdbfd, 0xcbdc, 0xfbbf, 0xeb9e, 0x9b79, 0x8b58, 0xbb3b, 0xab1a, + 0x6ca6, 0x7c87, 0x4ce4, 0x5cc5, 0x2c22, 0x3c03, 0x0c60, 0x1c41, + 0xedae, 0xfd8f, 0xcdec, 0xddcd, 0xad2a, 0xbd0b, 0x8d68, 0x9d49, + 0x7e97, 0x6eb6, 0x5ed5, 0x4ef4, 0x3e13, 0x2e32, 0x1e51, 0x0e70, + 0xff9f, 0xefbe, 0xdfdd, 0xcffc, 0xbf1b, 0xaf3a, 0x9f59, 0x8f78, + 0x9188, 0x81a9, 0xb1ca, 0xa1eb, 0xd10c, 0xc12d, 0xf14e, 0xe16f, + 0x1080, 0x00a1, 0x30c2, 0x20e3, 0x5004, 0x4025, 0x7046, 0x6067, + 0x83b9, 0x9398, 0xa3fb, 0xb3da, 0xc33d, 0xd31c, 0xe37f, 0xf35e, + 0x02b1, 0x1290, 0x22f3, 0x32d2, 0x4235, 0x5214, 0x6277, 0x7256, + 0xb5ea, 0xa5cb, 0x95a8, 0x8589, 0xf56e, 0xe54f, 0xd52c, 0xc50d, + 0x34e2, 0x24c3, 0x14a0, 0x0481, 0x7466, 0x6447, 0x5424, 0x4405, + 0xa7db, 0xb7fa, 0x8799, 0x97b8, 0xe75f, 0xf77e, 0xc71d, 0xd73c, + 0x26d3, 0x36f2, 0x0691, 0x16b0, 0x6657, 0x7676, 0x4615, 0x5634, + 0xd94c, 0xc96d, 0xf90e, 0xe92f, 0x99c8, 0x89e9, 0xb98a, 0xa9ab, + 0x5844, 0x4865, 0x7806, 0x6827, 0x18c0, 0x08e1, 0x3882, 0x28a3, + 0xcb7d, 0xdb5c, 0xeb3f, 0xfb1e, 0x8bf9, 0x9bd8, 0xabbb, 0xbb9a, + 0x4a75, 0x5a54, 0x6a37, 0x7a16, 0x0af1, 0x1ad0, 0x2ab3, 0x3a92, + 0xfd2e, 0xed0f, 0xdd6c, 0xcd4d, 0xbdaa, 0xad8b, 0x9de8, 0x8dc9, + 0x7c26, 0x6c07, 0x5c64, 0x4c45, 0x3ca2, 0x2c83, 0x1ce0, 0x0cc1, + 0xef1f, 0xff3e, 0xcf5d, 0xdf7c, 0xaf9b, 0xbfba, 0x8fd9, 0x9ff8, + 0x6e17, 0x7e36, 0x4e55, 0x5e74, 0x2e93, 0x3eb2, 0x0ed1, 0x1ef0, +} + +// crc16 returns the 2-byte crc for the data provided. +func crc16(data []byte) uint16 { + var crc uint16 + for _, b := range data { + crc = ((crc << 8) & 0xffff) ^ crc16tab[((crc>>8)^uint16(b))&0x00FF] + } + return crc +} + +// validate will check the calculated crc16 checksum for data against the expected. +func validate(data []byte, expected uint16) error { + if crc16(data) != expected { + return ErrInvalidChecksum + } + return nil +} diff --git a/vendor/github.com/nats-io/nkeys/go.mod b/vendor/github.com/nats-io/nkeys/go.mod new file mode 100644 index 0000000..64a700a --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/go.mod @@ -0,0 +1,3 @@ +module github.com/nats-io/nkeys + +require golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 diff --git a/vendor/github.com/nats-io/nkeys/go.sum b/vendor/github.com/nats-io/nkeys/go.sum new file mode 100644 index 0000000..8c4e7ae --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/go.sum @@ -0,0 +1,2 @@ +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9 h1:mKdxBk7AujPs8kU4m80U72y/zjbZ3UcXC7dClwKbUI0= +golang.org/x/crypto v0.0.0-20181203042331-505ab145d0a9/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4= diff --git a/vendor/github.com/nats-io/nkeys/keypair.go b/vendor/github.com/nats-io/nkeys/keypair.go new file mode 100644 index 0000000..acd8674 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/keypair.go @@ -0,0 +1,117 @@ +// Copyright 2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nkeys + +import ( + "bytes" + "crypto/rand" + "io" + + "golang.org/x/crypto/ed25519" +) + +// kp is the internal struct for a kepypair using seed. +type kp struct { + seed []byte +} + +// CreatePair will create a KeyPair based on the rand entropy and a type/prefix byte. rand can be nil. +func CreatePair(prefix PrefixByte) (KeyPair, error) { + var rawSeed [32]byte + + _, err := io.ReadFull(rand.Reader, rawSeed[:]) + if err != nil { + return nil, err + } + + seed, err := EncodeSeed(prefix, rawSeed[:]) + if err != nil { + return nil, err + } + return &kp{seed}, nil +} + +// rawSeed will return the raw, decoded 64 byte seed. +func (pair *kp) rawSeed() ([]byte, error) { + _, raw, err := DecodeSeed(pair.seed) + return raw, err +} + +// keys will return a 32 byte public key and a 64 byte private key utilizing the seed. +func (pair *kp) keys() (ed25519.PublicKey, ed25519.PrivateKey, error) { + raw, err := pair.rawSeed() + if err != nil { + return nil, nil, err + } + return ed25519.GenerateKey(bytes.NewReader(raw)) +} + +// Wipe will randomize the contents of the seed key +func (pair *kp) Wipe() { + io.ReadFull(rand.Reader, pair.seed) + pair.seed = nil +} + +// Seed will return the encoded seed. +func (pair *kp) Seed() ([]byte, error) { + return pair.seed, nil +} + +// PublicKey will return the encoded public key associated with the KeyPair. +// All KeyPairs have a public key. +func (pair *kp) PublicKey() (string, error) { + public, raw, err := DecodeSeed(pair.seed) + if err != nil { + return "", err + } + pub, _, err := ed25519.GenerateKey(bytes.NewReader(raw)) + if err != nil { + return "", err + } + pk, err := Encode(public, pub) + if err != nil { + return "", err + } + return string(pk), nil +} + +// PrivateKey will return the encoded private key for KeyPair. +func (pair *kp) PrivateKey() ([]byte, error) { + _, priv, err := pair.keys() + if err != nil { + return nil, err + } + return Encode(PrefixBytePrivate, priv) +} + +// Sign will sign the input with KeyPair's private key. +func (pair *kp) Sign(input []byte) ([]byte, error) { + _, priv, err := pair.keys() + if err != nil { + return nil, err + } + return ed25519.Sign(priv, input), nil +} + +// Verify will verify the input against a signature utilizing the public key. +func (pair *kp) Verify(input []byte, sig []byte) error { + pub, _, err := pair.keys() + if err != nil { + return err + } + if !ed25519.Verify(pub, input, sig) { + return ErrInvalidSignature + } + return nil +} diff --git a/vendor/github.com/nats-io/nkeys/main.go b/vendor/github.com/nats-io/nkeys/main.go new file mode 100644 index 0000000..5b05df5 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/main.go @@ -0,0 +1,103 @@ +// Copyright 2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package nkeys is an Ed25519 based public-key signature system that simplifies keys and seeds +// and performs signing and verification. +package nkeys + +import ( + "errors" +) + +// Version +const Version = "0.0.2" + +// Errors +var ( + ErrInvalidPrefixByte = errors.New("nkeys: invalid prefix byte") + ErrInvalidKey = errors.New("nkeys: invalid key") + ErrInvalidPublicKey = errors.New("nkeys: invalid public key") + ErrInvalidSeedLen = errors.New("nkeys: invalid seed length") + ErrInvalidSeed = errors.New("nkeys: invalid seed") + ErrInvalidEncoding = errors.New("nkeys: invalid encoded key") + ErrInvalidSignature = errors.New("nkeys: signature verification failed") + ErrCannotSign = errors.New("nkeys: can not sign, no private key available") + ErrPublicKeyOnly = errors.New("nkeys: no seed or private key available") +) + +// KeyPair provides the central interface to nkeys. +type KeyPair interface { + Seed() ([]byte, error) + PublicKey() (string, error) + PrivateKey() ([]byte, error) + Sign(input []byte) ([]byte, error) + Verify(input []byte, sig []byte) error + Wipe() +} + +// CreateUser will create a User typed KeyPair. +func CreateUser() (KeyPair, error) { + return CreatePair(PrefixByteUser) +} + +// CreateAccount will create an Account typed KeyPair. +func CreateAccount() (KeyPair, error) { + return CreatePair(PrefixByteAccount) +} + +// CreateServer will create a Server typed KeyPair. +func CreateServer() (KeyPair, error) { + return CreatePair(PrefixByteServer) +} + +// CreateCluster will create a Cluster typed KeyPair. +func CreateCluster() (KeyPair, error) { + return CreatePair(PrefixByteCluster) +} + +// CreateOperator will create an Operator typed KeyPair. +func CreateOperator() (KeyPair, error) { + return CreatePair(PrefixByteOperator) +} + +// FromPublicKey will create a KeyPair capable of verifying signatures. +func FromPublicKey(public string) (KeyPair, error) { + raw, err := decode([]byte(public)) + if err != nil { + return nil, err + } + pre := PrefixByte(raw[0]) + if err := checkValidPublicPrefixByte(pre); err != nil { + return nil, ErrInvalidPublicKey + } + return &pub{pre, raw[1:]}, nil +} + +// FromSeed will create a KeyPair capable of signing and verifying signatures. +func FromSeed(seed []byte) (KeyPair, error) { + _, _, err := DecodeSeed(seed) + if err != nil { + return nil, err + } + copy := append([]byte{}, seed...) + return &kp{copy}, nil +} + +// Create a KeyPair from the raw 32 byte seed for a given type. +func FromRawSeed(prefix PrefixByte, rawSeed []byte) (KeyPair, error) { + seed, err := EncodeSeed(prefix, rawSeed) + if err != nil { + return nil, err + } + return &kp{seed}, nil +} diff --git a/vendor/github.com/nats-io/nkeys/public.go b/vendor/github.com/nats-io/nkeys/public.go new file mode 100644 index 0000000..cb7927a --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/public.go @@ -0,0 +1,66 @@ +// Copyright 2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nkeys + +import ( + "crypto/rand" + "io" + + "golang.org/x/crypto/ed25519" +) + +// A KeyPair from a public key capable of verifying only. +type pub struct { + pre PrefixByte + pub ed25519.PublicKey +} + +// PublicKey will return the encoded public key associated with the KeyPair. +// All KeyPairs have a public key. +func (p *pub) PublicKey() (string, error) { + pk, err := Encode(p.pre, p.pub) + if err != nil { + return "", err + } + return string(pk), nil +} + +// Seed will return an error since this is not available for public key only KeyPairs. +func (p *pub) Seed() ([]byte, error) { + return nil, ErrPublicKeyOnly +} + +// PrivateKey will return an error since this is not available for public key only KeyPairs. +func (p *pub) PrivateKey() ([]byte, error) { + return nil, ErrPublicKeyOnly +} + +// Sign will return an error since this is not available for public key only KeyPairs. +func (p *pub) Sign(input []byte) ([]byte, error) { + return nil, ErrCannotSign +} + +// Verify will verify the input against a signature utilizing the public key. +func (p *pub) Verify(input []byte, sig []byte) error { + if !ed25519.Verify(p.pub, input, sig) { + return ErrInvalidSignature + } + return nil +} + +// Wipe will randomize the public key and erase the pre byte. +func (p *pub) Wipe() { + p.pre = '0' + io.ReadFull(rand.Reader, p.pub) +} diff --git a/vendor/github.com/nats-io/nkeys/strkey.go b/vendor/github.com/nats-io/nkeys/strkey.go new file mode 100644 index 0000000..7a2ce98 --- /dev/null +++ b/vendor/github.com/nats-io/nkeys/strkey.go @@ -0,0 +1,290 @@ +// Copyright 2018 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package nkeys + +import ( + "bytes" + "encoding/base32" + "encoding/binary" + + "golang.org/x/crypto/ed25519" +) + +// PrefixByte is a lead byte representing the type. +type PrefixByte byte + +const ( + // PrefixByteSeed is the version byte used for encoded NATS Seeds + PrefixByteSeed PrefixByte = 18 << 3 // Base32-encodes to 'S...' + + // PrefixBytePrivate is the version byte used for encoded NATS Private keys + PrefixBytePrivate PrefixByte = 15 << 3 // Base32-encodes to 'P...' + + // PrefixByteServer is the version byte used for encoded NATS Servers + PrefixByteServer PrefixByte = 13 << 3 // Base32-encodes to 'N...' + + // PrefixByteCluster is the version byte used for encoded NATS Clusters + PrefixByteCluster PrefixByte = 2 << 3 // Base32-encodes to 'C...' + + // PrefixByteOperator is the version byte used for encoded NATS Operators + PrefixByteOperator PrefixByte = 14 << 3 // Base32-encodes to 'O...' + + // PrefixByteAccount is the version byte used for encoded NATS Accounts + PrefixByteAccount PrefixByte = 0 // Base32-encodes to 'A...' + + // PrefixByteUser is the version byte used for encoded NATS Users + PrefixByteUser PrefixByte = 20 << 3 // Base32-encodes to 'U...' + + // PrefixByteUnknown is for unknown prefixes. + PrefixByteUknown PrefixByte = 23 << 3 // Base32-encodes to 'X...' +) + +// Set our encoding to not include padding '==' +var b32Enc = base32.StdEncoding.WithPadding(base32.NoPadding) + +// Encode will encode a raw key or seed with the prefix and crc16 and then base32 encoded. +func Encode(prefix PrefixByte, src []byte) ([]byte, error) { + if err := checkValidPrefixByte(prefix); err != nil { + return nil, err + } + + var raw bytes.Buffer + + // write prefix byte + if err := raw.WriteByte(byte(prefix)); err != nil { + return nil, err + } + + // write payload + if _, err := raw.Write(src); err != nil { + return nil, err + } + + // Calculate and write crc16 checksum + err := binary.Write(&raw, binary.LittleEndian, crc16(raw.Bytes())) + if err != nil { + return nil, err + } + + data := raw.Bytes() + buf := make([]byte, b32Enc.EncodedLen(len(data))) + b32Enc.Encode(buf, data) + return buf[:], nil +} + +// EncodeSeed will encode a raw key with the prefix and then seed prefix and crc16 and then base32 encoded. +func EncodeSeed(public PrefixByte, src []byte) ([]byte, error) { + if err := checkValidPublicPrefixByte(public); err != nil { + return nil, err + } + + if len(src) != ed25519.SeedSize { + return nil, ErrInvalidSeedLen + } + + // In order to make this human printable for both bytes, we need to do a little + // bit manipulation to setup for base32 encoding which takes 5 bits at a time. + b1 := byte(PrefixByteSeed) | (byte(public) >> 5) + b2 := (byte(public) & 31) << 3 // 31 = 00011111 + + var raw bytes.Buffer + + raw.WriteByte(b1) + raw.WriteByte(b2) + + // write payload + if _, err := raw.Write(src); err != nil { + return nil, err + } + + // Calculate and write crc16 checksum + err := binary.Write(&raw, binary.LittleEndian, crc16(raw.Bytes())) + if err != nil { + return nil, err + } + + data := raw.Bytes() + buf := make([]byte, b32Enc.EncodedLen(len(data))) + b32Enc.Encode(buf, data) + return buf, nil +} + +// IsValidEncoding will tell you if the encoding is a valid key. +func IsValidEncoding(src []byte) bool { + _, err := decode(src) + return err == nil +} + +// decode will decode the base32 and check crc16 and the prefix for validity. +func decode(src []byte) ([]byte, error) { + raw := make([]byte, b32Enc.EncodedLen(len(src))) + n, err := b32Enc.Decode(raw, src) + if err != nil { + return nil, err + } + raw = raw[:n] + + if len(raw) < 4 { + return nil, ErrInvalidEncoding + } + + var crc uint16 + checksum := bytes.NewReader(raw[len(raw)-2:]) + if err := binary.Read(checksum, binary.LittleEndian, &crc); err != nil { + return nil, err + } + + // ensure checksum is valid + if err := validate(raw[0:len(raw)-2], crc); err != nil { + return nil, err + } + + return raw[:len(raw)-2], nil +} + +// Decode will decode the base32 string and check crc16 and enforce the prefix is what is expected. +func Decode(expectedPrefix PrefixByte, src []byte) ([]byte, error) { + if err := checkValidPrefixByte(expectedPrefix); err != nil { + return nil, err + } + raw, err := decode(src) + if err != nil { + return nil, err + } + if prefix := PrefixByte(raw[0]); prefix != expectedPrefix { + return nil, ErrInvalidPrefixByte + } + return raw[1:], nil +} + +// DecodeSeed will decode the base32 string and check crc16 and enforce the prefix is a seed +// and the subsequent type is a valid type. +func DecodeSeed(src []byte) (PrefixByte, []byte, error) { + raw, err := decode(src) + if err != nil { + return PrefixByteSeed, nil, err + } + // Need to do the reverse here to get back to internal representation. + b1 := raw[0] & 248 // 248 = 11111000 + b2 := (raw[0]&7)<<5 | ((raw[1] & 248) >> 3) // 7 = 00000111 + + if PrefixByte(b1) != PrefixByteSeed { + return PrefixByteSeed, nil, ErrInvalidSeed + } + if checkValidPublicPrefixByte(PrefixByte(b2)) != nil { + return PrefixByteSeed, nil, ErrInvalidSeed + } + return PrefixByte(b2), raw[2:], nil +} + +func Prefix(src string) PrefixByte { + b, err := decode([]byte(src)) + if err != nil { + return PrefixByteUknown + } + prefix := PrefixByte(b[0]) + err = checkValidPrefixByte(prefix) + if err == nil { + return prefix + } + // Might be a seed. + b1 := b[0] & 248 + if PrefixByte(b1) == PrefixByteSeed { + return PrefixByteSeed + } + return PrefixByteUknown +} + +// IsValidPublicKey will decode and verify that the string is a valid encoded public key. +func IsValidPublicKey(src string) bool { + b, err := decode([]byte(src)) + if err != nil { + return false + } + if prefix := PrefixByte(b[0]); checkValidPublicPrefixByte(prefix) != nil { + return false + } + return true +} + +// IsValidPublicUserKey will decode and verify the string is a valid encoded Public User Key. +func IsValidPublicUserKey(src string) bool { + _, err := Decode(PrefixByteUser, []byte(src)) + return err == nil +} + +// IsValidPublicAccountKey will decode and verify the string is a valid encoded Public Account Key. +func IsValidPublicAccountKey(src string) bool { + _, err := Decode(PrefixByteAccount, []byte(src)) + return err == nil +} + +// IsValidPublicServerKey will decode and verify the string is a valid encoded Public Server Key. +func IsValidPublicServerKey(src string) bool { + _, err := Decode(PrefixByteServer, []byte(src)) + return err == nil +} + +// IsValidPublicClusterKey will decode and verify the string is a valid encoded Public Cluster Key. +func IsValidPublicClusterKey(src string) bool { + _, err := Decode(PrefixByteCluster, []byte(src)) + return err == nil +} + +// IsValidPublicOperatorKey will decode and verify the string is a valid encoded Public Operator Key. +func IsValidPublicOperatorKey(src string) bool { + _, err := Decode(PrefixByteOperator, []byte(src)) + return err == nil +} + +// checkValidPrefixByte returns an error if the provided value +// is not one of the defined valid prefix byte constants. +func checkValidPrefixByte(prefix PrefixByte) error { + switch prefix { + case PrefixByteOperator, PrefixByteServer, PrefixByteCluster, + PrefixByteAccount, PrefixByteUser, PrefixByteSeed, PrefixBytePrivate: + return nil + } + return ErrInvalidPrefixByte +} + +// checkValidPublicPrefixByte returns an error if the provided value +// is not one of the public defined valid prefix byte constants. +func checkValidPublicPrefixByte(prefix PrefixByte) error { + switch prefix { + case PrefixByteServer, PrefixByteCluster, PrefixByteOperator, PrefixByteAccount, PrefixByteUser: + return nil + } + return ErrInvalidPrefixByte +} + +func (p PrefixByte) String() string { + switch p { + case PrefixByteOperator: + return "operator" + case PrefixByteServer: + return "server" + case PrefixByteCluster: + return "cluster" + case PrefixByteAccount: + return "account" + case PrefixByteUser: + return "user" + case PrefixByteSeed: + return "seed" + case PrefixBytePrivate: + return "private" + } + return "unknown" +} diff --git a/vendor/github.com/nats-io/nuid/.gitignore b/vendor/github.com/nats-io/nuid/.gitignore new file mode 100644 index 0000000..daf913b --- /dev/null +++ b/vendor/github.com/nats-io/nuid/.gitignore @@ -0,0 +1,24 @@ +# Compiled Object files, Static and Dynamic libs (Shared Objects) +*.o +*.a +*.so + +# Folders +_obj +_test + +# Architecture specific extensions/prefixes +*.[568vq] +[568vq].out + +*.cgo1.go +*.cgo2.c +_cgo_defun.c +_cgo_gotypes.go +_cgo_export.* + +_testmain.go + +*.exe +*.test +*.prof diff --git a/vendor/github.com/nats-io/nuid/.travis.yml b/vendor/github.com/nats-io/nuid/.travis.yml new file mode 100644 index 0000000..52be726 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/.travis.yml @@ -0,0 +1,17 @@ +language: go +sudo: false +go: +- 1.9.x +- 1.10.x + +install: +- go get -t ./... +- go get github.com/mattn/goveralls + +script: +- go fmt ./... +- go vet ./... +- go test -v +- go test -v --race +- go test -v -covermode=count -coverprofile=coverage.out +- $HOME/gopath/bin/goveralls -coverprofile coverage.out -service travis-ci diff --git a/vendor/github.com/nats-io/nuid/GOVERNANCE.md b/vendor/github.com/nats-io/nuid/GOVERNANCE.md new file mode 100644 index 0000000..01aee70 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/GOVERNANCE.md @@ -0,0 +1,3 @@ +# NATS NUID Governance + +NATS NUID is part of the NATS project and is subject to the [NATS Governance](https://github.com/nats-io/nats-general/blob/master/GOVERNANCE.md). \ No newline at end of file diff --git a/vendor/github.com/nats-io/nuid/LICENSE b/vendor/github.com/nats-io/nuid/LICENSE new file mode 100644 index 0000000..261eeb9 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/github.com/nats-io/nuid/MAINTAINERS.md b/vendor/github.com/nats-io/nuid/MAINTAINERS.md new file mode 100644 index 0000000..6d0ed3e --- /dev/null +++ b/vendor/github.com/nats-io/nuid/MAINTAINERS.md @@ -0,0 +1,6 @@ +# Maintainers + +Maintainership is on a per project basis. + +### Core-maintainers + - Derek Collison [@derekcollison](https://github.com/derekcollison) \ No newline at end of file diff --git a/vendor/github.com/nats-io/nuid/README.md b/vendor/github.com/nats-io/nuid/README.md new file mode 100644 index 0000000..16e5394 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/README.md @@ -0,0 +1,47 @@ +# NUID + +[![License Apache 2](https://img.shields.io/badge/License-Apache2-blue.svg)](https://www.apache.org/licenses/LICENSE-2.0) +[![ReportCard](http://goreportcard.com/badge/nats-io/nuid)](http://goreportcard.com/report/nats-io/nuid) +[![Build Status](https://travis-ci.org/nats-io/nuid.svg?branch=master)](http://travis-ci.org/nats-io/nuid) +[![Release](https://img.shields.io/badge/release-v1.0.1-1eb0fc.svg)](https://github.com/nats-io/nuid/releases/tag/v1.0.1) +[![GoDoc](http://godoc.org/github.com/nats-io/nuid?status.png)](http://godoc.org/github.com/nats-io/nuid) +[![Coverage Status](https://coveralls.io/repos/github/nats-io/nuid/badge.svg?branch=master)](https://coveralls.io/github/nats-io/nuid?branch=master) + +A highly performant unique identifier generator. + +## Installation + +Use the `go` command: + + $ go get github.com/nats-io/nuid + +## Basic Usage +```go + +// Utilize the global locked instance +nuid := nuid.Next() + +// Create an instance, these are not locked. +n := nuid.New() +nuid = n.Next() + +// Generate a new crypto/rand seeded prefix. +// Generally not needed, happens automatically. +n.RandomizePrefix() +``` + +## Performance +NUID needs to be very fast to generate and be truly unique, all while being entropy pool friendly. +NUID uses 12 bytes of crypto generated data (entropy draining), and 10 bytes of pseudo-random +sequential data that increments with a pseudo-random increment. + +Total length of a NUID string is 22 bytes of base 62 ascii text, so 62^22 or +2707803647802660400290261537185326956544 possibilities. + +NUID can generate identifiers as fast as 60ns, or ~16 million per second. There is an associated +benchmark you can use to test performance on your own hardware. + +## License + +Unless otherwise noted, the NATS source files are distributed +under the Apache Version 2.0 license found in the LICENSE file. diff --git a/vendor/github.com/nats-io/nuid/nuid.go b/vendor/github.com/nats-io/nuid/nuid.go new file mode 100644 index 0000000..8134c76 --- /dev/null +++ b/vendor/github.com/nats-io/nuid/nuid.go @@ -0,0 +1,135 @@ +// Copyright 2016-2019 The NATS Authors +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// A unique identifier generator that is high performance, very fast, and tries to be entropy pool friendly. +package nuid + +import ( + "crypto/rand" + "fmt" + "math" + "math/big" + "sync" + "time" + + prand "math/rand" +) + +// NUID needs to be very fast to generate and truly unique, all while being entropy pool friendly. +// We will use 12 bytes of crypto generated data (entropy draining), and 10 bytes of sequential data +// that is started at a pseudo random number and increments with a pseudo-random increment. +// Total is 22 bytes of base 62 ascii text :) + +// Version of the library +const Version = "1.0.1" + +const ( + digits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz" + base = 62 + preLen = 12 + seqLen = 10 + maxSeq = int64(839299365868340224) // base^seqLen == 62^10 + minInc = int64(33) + maxInc = int64(333) + totalLen = preLen + seqLen +) + +type NUID struct { + pre []byte + seq int64 + inc int64 +} + +type lockedNUID struct { + sync.Mutex + *NUID +} + +// Global NUID +var globalNUID *lockedNUID + +// Seed sequential random with crypto or math/random and current time +// and generate crypto prefix. +func init() { + r, err := rand.Int(rand.Reader, big.NewInt(math.MaxInt64)) + if err != nil { + prand.Seed(time.Now().UnixNano()) + } else { + prand.Seed(r.Int64()) + } + globalNUID = &lockedNUID{NUID: New()} + globalNUID.RandomizePrefix() +} + +// New will generate a new NUID and properly initialize the prefix, sequential start, and sequential increment. +func New() *NUID { + n := &NUID{ + seq: prand.Int63n(maxSeq), + inc: minInc + prand.Int63n(maxInc-minInc), + pre: make([]byte, preLen), + } + n.RandomizePrefix() + return n +} + +// Generate the next NUID string from the global locked NUID instance. +func Next() string { + globalNUID.Lock() + nuid := globalNUID.Next() + globalNUID.Unlock() + return nuid +} + +// Generate the next NUID string. +func (n *NUID) Next() string { + // Increment and capture. + n.seq += n.inc + if n.seq >= maxSeq { + n.RandomizePrefix() + n.resetSequential() + } + seq := n.seq + + // Copy prefix + var b [totalLen]byte + bs := b[:preLen] + copy(bs, n.pre) + + // copy in the seq in base62. + for i, l := len(b), seq; i > preLen; l /= base { + i -= 1 + b[i] = digits[l%base] + } + return string(b[:]) +} + +// Resets the sequential portion of the NUID. +func (n *NUID) resetSequential() { + n.seq = prand.Int63n(maxSeq) + n.inc = minInc + prand.Int63n(maxInc-minInc) +} + +// Generate a new prefix from crypto/rand. +// This call *can* drain entropy and will be called automatically when we exhaust the sequential range. +// Will panic if it gets an error from rand.Int() +func (n *NUID) RandomizePrefix() { + var cb [preLen]byte + cbs := cb[:] + if nb, err := rand.Read(cbs); nb != preLen || err != nil { + panic(fmt.Sprintf("nuid: failed generating crypto random number: %v\n", err)) + } + + for i := 0; i < preLen; i++ { + n.pre[i] = digits[int(cbs[i])%base] + } +} diff --git a/vendor/golang.org/x/crypto/AUTHORS b/vendor/golang.org/x/crypto/AUTHORS new file mode 100644 index 0000000..2b00ddb --- /dev/null +++ b/vendor/golang.org/x/crypto/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at https://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/crypto/CONTRIBUTORS b/vendor/golang.org/x/crypto/CONTRIBUTORS new file mode 100644 index 0000000..1fbd3e9 --- /dev/null +++ b/vendor/golang.org/x/crypto/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at https://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/crypto/LICENSE b/vendor/golang.org/x/crypto/LICENSE new file mode 100644 index 0000000..6a66aea --- /dev/null +++ b/vendor/golang.org/x/crypto/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/crypto/PATENTS b/vendor/golang.org/x/crypto/PATENTS new file mode 100644 index 0000000..7330990 --- /dev/null +++ b/vendor/golang.org/x/crypto/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/crypto/ed25519/ed25519.go b/vendor/golang.org/x/crypto/ed25519/ed25519.go new file mode 100644 index 0000000..d6f683b --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/ed25519.go @@ -0,0 +1,217 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package ed25519 implements the Ed25519 signature algorithm. See +// https://ed25519.cr.yp.to/. +// +// These functions are also compatible with the “Ed25519” function defined in +// RFC 8032. However, unlike RFC 8032's formulation, this package's private key +// representation includes a public key suffix to make multiple signing +// operations with the same key more efficient. This package refers to the RFC +// 8032 private key as the “seed”. +package ed25519 + +// This code is a port of the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +import ( + "bytes" + "crypto" + cryptorand "crypto/rand" + "crypto/sha512" + "errors" + "io" + "strconv" + + "golang.org/x/crypto/ed25519/internal/edwards25519" +) + +const ( + // PublicKeySize is the size, in bytes, of public keys as used in this package. + PublicKeySize = 32 + // PrivateKeySize is the size, in bytes, of private keys as used in this package. + PrivateKeySize = 64 + // SignatureSize is the size, in bytes, of signatures generated and verified by this package. + SignatureSize = 64 + // SeedSize is the size, in bytes, of private key seeds. These are the private key representations used by RFC 8032. + SeedSize = 32 +) + +// PublicKey is the type of Ed25519 public keys. +type PublicKey []byte + +// PrivateKey is the type of Ed25519 private keys. It implements crypto.Signer. +type PrivateKey []byte + +// Public returns the PublicKey corresponding to priv. +func (priv PrivateKey) Public() crypto.PublicKey { + publicKey := make([]byte, PublicKeySize) + copy(publicKey, priv[32:]) + return PublicKey(publicKey) +} + +// Seed returns the private key seed corresponding to priv. It is provided for +// interoperability with RFC 8032. RFC 8032's private keys correspond to seeds +// in this package. +func (priv PrivateKey) Seed() []byte { + seed := make([]byte, SeedSize) + copy(seed, priv[:32]) + return seed +} + +// Sign signs the given message with priv. +// Ed25519 performs two passes over messages to be signed and therefore cannot +// handle pre-hashed messages. Thus opts.HashFunc() must return zero to +// indicate the message hasn't been hashed. This can be achieved by passing +// crypto.Hash(0) as the value for opts. +func (priv PrivateKey) Sign(rand io.Reader, message []byte, opts crypto.SignerOpts) (signature []byte, err error) { + if opts.HashFunc() != crypto.Hash(0) { + return nil, errors.New("ed25519: cannot sign hashed message") + } + + return Sign(priv, message), nil +} + +// GenerateKey generates a public/private key pair using entropy from rand. +// If rand is nil, crypto/rand.Reader will be used. +func GenerateKey(rand io.Reader) (PublicKey, PrivateKey, error) { + if rand == nil { + rand = cryptorand.Reader + } + + seed := make([]byte, SeedSize) + if _, err := io.ReadFull(rand, seed); err != nil { + return nil, nil, err + } + + privateKey := NewKeyFromSeed(seed) + publicKey := make([]byte, PublicKeySize) + copy(publicKey, privateKey[32:]) + + return publicKey, privateKey, nil +} + +// NewKeyFromSeed calculates a private key from a seed. It will panic if +// len(seed) is not SeedSize. This function is provided for interoperability +// with RFC 8032. RFC 8032's private keys correspond to seeds in this +// package. +func NewKeyFromSeed(seed []byte) PrivateKey { + if l := len(seed); l != SeedSize { + panic("ed25519: bad seed length: " + strconv.Itoa(l)) + } + + digest := sha512.Sum512(seed) + digest[0] &= 248 + digest[31] &= 127 + digest[31] |= 64 + + var A edwards25519.ExtendedGroupElement + var hBytes [32]byte + copy(hBytes[:], digest[:]) + edwards25519.GeScalarMultBase(&A, &hBytes) + var publicKeyBytes [32]byte + A.ToBytes(&publicKeyBytes) + + privateKey := make([]byte, PrivateKeySize) + copy(privateKey, seed) + copy(privateKey[32:], publicKeyBytes[:]) + + return privateKey +} + +// Sign signs the message with privateKey and returns a signature. It will +// panic if len(privateKey) is not PrivateKeySize. +func Sign(privateKey PrivateKey, message []byte) []byte { + if l := len(privateKey); l != PrivateKeySize { + panic("ed25519: bad private key length: " + strconv.Itoa(l)) + } + + h := sha512.New() + h.Write(privateKey[:32]) + + var digest1, messageDigest, hramDigest [64]byte + var expandedSecretKey [32]byte + h.Sum(digest1[:0]) + copy(expandedSecretKey[:], digest1[:]) + expandedSecretKey[0] &= 248 + expandedSecretKey[31] &= 63 + expandedSecretKey[31] |= 64 + + h.Reset() + h.Write(digest1[32:]) + h.Write(message) + h.Sum(messageDigest[:0]) + + var messageDigestReduced [32]byte + edwards25519.ScReduce(&messageDigestReduced, &messageDigest) + var R edwards25519.ExtendedGroupElement + edwards25519.GeScalarMultBase(&R, &messageDigestReduced) + + var encodedR [32]byte + R.ToBytes(&encodedR) + + h.Reset() + h.Write(encodedR[:]) + h.Write(privateKey[32:]) + h.Write(message) + h.Sum(hramDigest[:0]) + var hramDigestReduced [32]byte + edwards25519.ScReduce(&hramDigestReduced, &hramDigest) + + var s [32]byte + edwards25519.ScMulAdd(&s, &hramDigestReduced, &expandedSecretKey, &messageDigestReduced) + + signature := make([]byte, SignatureSize) + copy(signature[:], encodedR[:]) + copy(signature[32:], s[:]) + + return signature +} + +// Verify reports whether sig is a valid signature of message by publicKey. It +// will panic if len(publicKey) is not PublicKeySize. +func Verify(publicKey PublicKey, message, sig []byte) bool { + if l := len(publicKey); l != PublicKeySize { + panic("ed25519: bad public key length: " + strconv.Itoa(l)) + } + + if len(sig) != SignatureSize || sig[63]&224 != 0 { + return false + } + + var A edwards25519.ExtendedGroupElement + var publicKeyBytes [32]byte + copy(publicKeyBytes[:], publicKey) + if !A.FromBytes(&publicKeyBytes) { + return false + } + edwards25519.FeNeg(&A.X, &A.X) + edwards25519.FeNeg(&A.T, &A.T) + + h := sha512.New() + h.Write(sig[:32]) + h.Write(publicKey[:]) + h.Write(message) + var digest [64]byte + h.Sum(digest[:0]) + + var hReduced [32]byte + edwards25519.ScReduce(&hReduced, &digest) + + var R edwards25519.ProjectiveGroupElement + var s [32]byte + copy(s[:], sig[32:]) + + // https://tools.ietf.org/html/rfc8032#section-5.1.7 requires that s be in + // the range [0, order) in order to prevent signature malleability. + if !edwards25519.ScMinimal(&s) { + return false + } + + edwards25519.GeDoubleScalarMultVartime(&R, &hReduced, &A, &s) + + var checkR [32]byte + R.ToBytes(&checkR) + return bytes.Equal(sig[:32], checkR[:]) +} diff --git a/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go new file mode 100644 index 0000000..e39f086 --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go @@ -0,0 +1,1422 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package edwards25519 + +// These values are from the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +// d is a constant in the Edwards curve equation. +var d = FieldElement{ + -10913610, 13857413, -15372611, 6949391, 114729, -8787816, -6275908, -3247719, -18696448, -12055116, +} + +// d2 is 2*d. +var d2 = FieldElement{ + -21827239, -5839606, -30745221, 13898782, 229458, 15978800, -12551817, -6495438, 29715968, 9444199, +} + +// SqrtM1 is the square-root of -1 in the field. +var SqrtM1 = FieldElement{ + -32595792, -7943725, 9377950, 3500415, 12389472, -272473, -25146209, -2005654, 326686, 11406482, +} + +// A is a constant in the Montgomery-form of curve25519. +var A = FieldElement{ + 486662, 0, 0, 0, 0, 0, 0, 0, 0, 0, +} + +// bi contains precomputed multiples of the base-point. See the Ed25519 paper +// for a discussion about how these values are used. +var bi = [8]PreComputedGroupElement{ + { + FieldElement{25967493, -14356035, 29566456, 3660896, -12694345, 4014787, 27544626, -11754271, -6079156, 2047605}, + FieldElement{-12545711, 934262, -2722910, 3049990, -727428, 9406986, 12720692, 5043384, 19500929, -15469378}, + FieldElement{-8738181, 4489570, 9688441, -14785194, 10184609, -12363380, 29287919, 11864899, -24514362, -4438546}, + }, + { + FieldElement{15636291, -9688557, 24204773, -7912398, 616977, -16685262, 27787600, -14772189, 28944400, -1550024}, + FieldElement{16568933, 4717097, -11556148, -1102322, 15682896, -11807043, 16354577, -11775962, 7689662, 11199574}, + FieldElement{30464156, -5976125, -11779434, -15670865, 23220365, 15915852, 7512774, 10017326, -17749093, -9920357}, + }, + { + FieldElement{10861363, 11473154, 27284546, 1981175, -30064349, 12577861, 32867885, 14515107, -15438304, 10819380}, + FieldElement{4708026, 6336745, 20377586, 9066809, -11272109, 6594696, -25653668, 12483688, -12668491, 5581306}, + FieldElement{19563160, 16186464, -29386857, 4097519, 10237984, -4348115, 28542350, 13850243, -23678021, -15815942}, + }, + { + FieldElement{5153746, 9909285, 1723747, -2777874, 30523605, 5516873, 19480852, 5230134, -23952439, -15175766}, + FieldElement{-30269007, -3463509, 7665486, 10083793, 28475525, 1649722, 20654025, 16520125, 30598449, 7715701}, + FieldElement{28881845, 14381568, 9657904, 3680757, -20181635, 7843316, -31400660, 1370708, 29794553, -1409300}, + }, + { + FieldElement{-22518993, -6692182, 14201702, -8745502, -23510406, 8844726, 18474211, -1361450, -13062696, 13821877}, + FieldElement{-6455177, -7839871, 3374702, -4740862, -27098617, -10571707, 31655028, -7212327, 18853322, -14220951}, + FieldElement{4566830, -12963868, -28974889, -12240689, -7602672, -2830569, -8514358, -10431137, 2207753, -3209784}, + }, + { + FieldElement{-25154831, -4185821, 29681144, 7868801, -6854661, -9423865, -12437364, -663000, -31111463, -16132436}, + FieldElement{25576264, -2703214, 7349804, -11814844, 16472782, 9300885, 3844789, 15725684, 171356, 6466918}, + FieldElement{23103977, 13316479, 9739013, -16149481, 817875, -15038942, 8965339, -14088058, -30714912, 16193877}, + }, + { + FieldElement{-33521811, 3180713, -2394130, 14003687, -16903474, -16270840, 17238398, 4729455, -18074513, 9256800}, + FieldElement{-25182317, -4174131, 32336398, 5036987, -21236817, 11360617, 22616405, 9761698, -19827198, 630305}, + FieldElement{-13720693, 2639453, -24237460, -7406481, 9494427, -5774029, -6554551, -15960994, -2449256, -14291300}, + }, + { + FieldElement{-3151181, -5046075, 9282714, 6866145, -31907062, -863023, -18940575, 15033784, 25105118, -7894876}, + FieldElement{-24326370, 15950226, -31801215, -14592823, -11662737, -5090925, 1573892, -2625887, 2198790, -15804619}, + FieldElement{-3099351, 10324967, -2241613, 7453183, -5446979, -2735503, -13812022, -16236442, -32461234, -12290683}, + }, +} + +// base contains precomputed multiples of the base-point. See the Ed25519 paper +// for a discussion about how these values are used. +var base = [32][8]PreComputedGroupElement{ + { + { + FieldElement{25967493, -14356035, 29566456, 3660896, -12694345, 4014787, 27544626, -11754271, -6079156, 2047605}, + FieldElement{-12545711, 934262, -2722910, 3049990, -727428, 9406986, 12720692, 5043384, 19500929, -15469378}, + FieldElement{-8738181, 4489570, 9688441, -14785194, 10184609, -12363380, 29287919, 11864899, -24514362, -4438546}, + }, + { + FieldElement{-12815894, -12976347, -21581243, 11784320, -25355658, -2750717, -11717903, -3814571, -358445, -10211303}, + FieldElement{-21703237, 6903825, 27185491, 6451973, -29577724, -9554005, -15616551, 11189268, -26829678, -5319081}, + FieldElement{26966642, 11152617, 32442495, 15396054, 14353839, -12752335, -3128826, -9541118, -15472047, -4166697}, + }, + { + FieldElement{15636291, -9688557, 24204773, -7912398, 616977, -16685262, 27787600, -14772189, 28944400, -1550024}, + FieldElement{16568933, 4717097, -11556148, -1102322, 15682896, -11807043, 16354577, -11775962, 7689662, 11199574}, + FieldElement{30464156, -5976125, -11779434, -15670865, 23220365, 15915852, 7512774, 10017326, -17749093, -9920357}, + }, + { + FieldElement{-17036878, 13921892, 10945806, -6033431, 27105052, -16084379, -28926210, 15006023, 3284568, -6276540}, + FieldElement{23599295, -8306047, -11193664, -7687416, 13236774, 10506355, 7464579, 9656445, 13059162, 10374397}, + FieldElement{7798556, 16710257, 3033922, 2874086, 28997861, 2835604, 32406664, -3839045, -641708, -101325}, + }, + { + FieldElement{10861363, 11473154, 27284546, 1981175, -30064349, 12577861, 32867885, 14515107, -15438304, 10819380}, + FieldElement{4708026, 6336745, 20377586, 9066809, -11272109, 6594696, -25653668, 12483688, -12668491, 5581306}, + FieldElement{19563160, 16186464, -29386857, 4097519, 10237984, -4348115, 28542350, 13850243, -23678021, -15815942}, + }, + { + FieldElement{-15371964, -12862754, 32573250, 4720197, -26436522, 5875511, -19188627, -15224819, -9818940, -12085777}, + FieldElement{-8549212, 109983, 15149363, 2178705, 22900618, 4543417, 3044240, -15689887, 1762328, 14866737}, + FieldElement{-18199695, -15951423, -10473290, 1707278, -17185920, 3916101, -28236412, 3959421, 27914454, 4383652}, + }, + { + FieldElement{5153746, 9909285, 1723747, -2777874, 30523605, 5516873, 19480852, 5230134, -23952439, -15175766}, + FieldElement{-30269007, -3463509, 7665486, 10083793, 28475525, 1649722, 20654025, 16520125, 30598449, 7715701}, + FieldElement{28881845, 14381568, 9657904, 3680757, -20181635, 7843316, -31400660, 1370708, 29794553, -1409300}, + }, + { + FieldElement{14499471, -2729599, -33191113, -4254652, 28494862, 14271267, 30290735, 10876454, -33154098, 2381726}, + FieldElement{-7195431, -2655363, -14730155, 462251, -27724326, 3941372, -6236617, 3696005, -32300832, 15351955}, + FieldElement{27431194, 8222322, 16448760, -3907995, -18707002, 11938355, -32961401, -2970515, 29551813, 10109425}, + }, + }, + { + { + FieldElement{-13657040, -13155431, -31283750, 11777098, 21447386, 6519384, -2378284, -1627556, 10092783, -4764171}, + FieldElement{27939166, 14210322, 4677035, 16277044, -22964462, -12398139, -32508754, 12005538, -17810127, 12803510}, + FieldElement{17228999, -15661624, -1233527, 300140, -1224870, -11714777, 30364213, -9038194, 18016357, 4397660}, + }, + { + FieldElement{-10958843, -7690207, 4776341, -14954238, 27850028, -15602212, -26619106, 14544525, -17477504, 982639}, + FieldElement{29253598, 15796703, -2863982, -9908884, 10057023, 3163536, 7332899, -4120128, -21047696, 9934963}, + FieldElement{5793303, 16271923, -24131614, -10116404, 29188560, 1206517, -14747930, 4559895, -30123922, -10897950}, + }, + { + FieldElement{-27643952, -11493006, 16282657, -11036493, 28414021, -15012264, 24191034, 4541697, -13338309, 5500568}, + FieldElement{12650548, -1497113, 9052871, 11355358, -17680037, -8400164, -17430592, 12264343, 10874051, 13524335}, + FieldElement{25556948, -3045990, 714651, 2510400, 23394682, -10415330, 33119038, 5080568, -22528059, 5376628}, + }, + { + FieldElement{-26088264, -4011052, -17013699, -3537628, -6726793, 1920897, -22321305, -9447443, 4535768, 1569007}, + FieldElement{-2255422, 14606630, -21692440, -8039818, 28430649, 8775819, -30494562, 3044290, 31848280, 12543772}, + FieldElement{-22028579, 2943893, -31857513, 6777306, 13784462, -4292203, -27377195, -2062731, 7718482, 14474653}, + }, + { + FieldElement{2385315, 2454213, -22631320, 46603, -4437935, -15680415, 656965, -7236665, 24316168, -5253567}, + FieldElement{13741529, 10911568, -33233417, -8603737, -20177830, -1033297, 33040651, -13424532, -20729456, 8321686}, + FieldElement{21060490, -2212744, 15712757, -4336099, 1639040, 10656336, 23845965, -11874838, -9984458, 608372}, + }, + { + FieldElement{-13672732, -15087586, -10889693, -7557059, -6036909, 11305547, 1123968, -6780577, 27229399, 23887}, + FieldElement{-23244140, -294205, -11744728, 14712571, -29465699, -2029617, 12797024, -6440308, -1633405, 16678954}, + FieldElement{-29500620, 4770662, -16054387, 14001338, 7830047, 9564805, -1508144, -4795045, -17169265, 4904953}, + }, + { + FieldElement{24059557, 14617003, 19037157, -15039908, 19766093, -14906429, 5169211, 16191880, 2128236, -4326833}, + FieldElement{-16981152, 4124966, -8540610, -10653797, 30336522, -14105247, -29806336, 916033, -6882542, -2986532}, + FieldElement{-22630907, 12419372, -7134229, -7473371, -16478904, 16739175, 285431, 2763829, 15736322, 4143876}, + }, + { + FieldElement{2379352, 11839345, -4110402, -5988665, 11274298, 794957, 212801, -14594663, 23527084, -16458268}, + FieldElement{33431127, -11130478, -17838966, -15626900, 8909499, 8376530, -32625340, 4087881, -15188911, -14416214}, + FieldElement{1767683, 7197987, -13205226, -2022635, -13091350, 448826, 5799055, 4357868, -4774191, -16323038}, + }, + }, + { + { + FieldElement{6721966, 13833823, -23523388, -1551314, 26354293, -11863321, 23365147, -3949732, 7390890, 2759800}, + FieldElement{4409041, 2052381, 23373853, 10530217, 7676779, -12885954, 21302353, -4264057, 1244380, -12919645}, + FieldElement{-4421239, 7169619, 4982368, -2957590, 30256825, -2777540, 14086413, 9208236, 15886429, 16489664}, + }, + { + FieldElement{1996075, 10375649, 14346367, 13311202, -6874135, -16438411, -13693198, 398369, -30606455, -712933}, + FieldElement{-25307465, 9795880, -2777414, 14878809, -33531835, 14780363, 13348553, 12076947, -30836462, 5113182}, + FieldElement{-17770784, 11797796, 31950843, 13929123, -25888302, 12288344, -30341101, -7336386, 13847711, 5387222}, + }, + { + FieldElement{-18582163, -3416217, 17824843, -2340966, 22744343, -10442611, 8763061, 3617786, -19600662, 10370991}, + FieldElement{20246567, -14369378, 22358229, -543712, 18507283, -10413996, 14554437, -8746092, 32232924, 16763880}, + FieldElement{9648505, 10094563, 26416693, 14745928, -30374318, -6472621, 11094161, 15689506, 3140038, -16510092}, + }, + { + FieldElement{-16160072, 5472695, 31895588, 4744994, 8823515, 10365685, -27224800, 9448613, -28774454, 366295}, + FieldElement{19153450, 11523972, -11096490, -6503142, -24647631, 5420647, 28344573, 8041113, 719605, 11671788}, + FieldElement{8678025, 2694440, -6808014, 2517372, 4964326, 11152271, -15432916, -15266516, 27000813, -10195553}, + }, + { + FieldElement{-15157904, 7134312, 8639287, -2814877, -7235688, 10421742, 564065, 5336097, 6750977, -14521026}, + FieldElement{11836410, -3979488, 26297894, 16080799, 23455045, 15735944, 1695823, -8819122, 8169720, 16220347}, + FieldElement{-18115838, 8653647, 17578566, -6092619, -8025777, -16012763, -11144307, -2627664, -5990708, -14166033}, + }, + { + FieldElement{-23308498, -10968312, 15213228, -10081214, -30853605, -11050004, 27884329, 2847284, 2655861, 1738395}, + FieldElement{-27537433, -14253021, -25336301, -8002780, -9370762, 8129821, 21651608, -3239336, -19087449, -11005278}, + FieldElement{1533110, 3437855, 23735889, 459276, 29970501, 11335377, 26030092, 5821408, 10478196, 8544890}, + }, + { + FieldElement{32173121, -16129311, 24896207, 3921497, 22579056, -3410854, 19270449, 12217473, 17789017, -3395995}, + FieldElement{-30552961, -2228401, -15578829, -10147201, 13243889, 517024, 15479401, -3853233, 30460520, 1052596}, + FieldElement{-11614875, 13323618, 32618793, 8175907, -15230173, 12596687, 27491595, -4612359, 3179268, -9478891}, + }, + { + FieldElement{31947069, -14366651, -4640583, -15339921, -15125977, -6039709, -14756777, -16411740, 19072640, -9511060}, + FieldElement{11685058, 11822410, 3158003, -13952594, 33402194, -4165066, 5977896, -5215017, 473099, 5040608}, + FieldElement{-20290863, 8198642, -27410132, 11602123, 1290375, -2799760, 28326862, 1721092, -19558642, -3131606}, + }, + }, + { + { + FieldElement{7881532, 10687937, 7578723, 7738378, -18951012, -2553952, 21820786, 8076149, -27868496, 11538389}, + FieldElement{-19935666, 3899861, 18283497, -6801568, -15728660, -11249211, 8754525, 7446702, -5676054, 5797016}, + FieldElement{-11295600, -3793569, -15782110, -7964573, 12708869, -8456199, 2014099, -9050574, -2369172, -5877341}, + }, + { + FieldElement{-22472376, -11568741, -27682020, 1146375, 18956691, 16640559, 1192730, -3714199, 15123619, 10811505}, + FieldElement{14352098, -3419715, -18942044, 10822655, 32750596, 4699007, -70363, 15776356, -28886779, -11974553}, + FieldElement{-28241164, -8072475, -4978962, -5315317, 29416931, 1847569, -20654173, -16484855, 4714547, -9600655}, + }, + { + FieldElement{15200332, 8368572, 19679101, 15970074, -31872674, 1959451, 24611599, -4543832, -11745876, 12340220}, + FieldElement{12876937, -10480056, 33134381, 6590940, -6307776, 14872440, 9613953, 8241152, 15370987, 9608631}, + FieldElement{-4143277, -12014408, 8446281, -391603, 4407738, 13629032, -7724868, 15866074, -28210621, -8814099}, + }, + { + FieldElement{26660628, -15677655, 8393734, 358047, -7401291, 992988, -23904233, 858697, 20571223, 8420556}, + FieldElement{14620715, 13067227, -15447274, 8264467, 14106269, 15080814, 33531827, 12516406, -21574435, -12476749}, + FieldElement{236881, 10476226, 57258, -14677024, 6472998, 2466984, 17258519, 7256740, 8791136, 15069930}, + }, + { + FieldElement{1276410, -9371918, 22949635, -16322807, -23493039, -5702186, 14711875, 4874229, -30663140, -2331391}, + FieldElement{5855666, 4990204, -13711848, 7294284, -7804282, 1924647, -1423175, -7912378, -33069337, 9234253}, + FieldElement{20590503, -9018988, 31529744, -7352666, -2706834, 10650548, 31559055, -11609587, 18979186, 13396066}, + }, + { + FieldElement{24474287, 4968103, 22267082, 4407354, 24063882, -8325180, -18816887, 13594782, 33514650, 7021958}, + FieldElement{-11566906, -6565505, -21365085, 15928892, -26158305, 4315421, -25948728, -3916677, -21480480, 12868082}, + FieldElement{-28635013, 13504661, 19988037, -2132761, 21078225, 6443208, -21446107, 2244500, -12455797, -8089383}, + }, + { + FieldElement{-30595528, 13793479, -5852820, 319136, -25723172, -6263899, 33086546, 8957937, -15233648, 5540521}, + FieldElement{-11630176, -11503902, -8119500, -7643073, 2620056, 1022908, -23710744, -1568984, -16128528, -14962807}, + FieldElement{23152971, 775386, 27395463, 14006635, -9701118, 4649512, 1689819, 892185, -11513277, -15205948}, + }, + { + FieldElement{9770129, 9586738, 26496094, 4324120, 1556511, -3550024, 27453819, 4763127, -19179614, 5867134}, + FieldElement{-32765025, 1927590, 31726409, -4753295, 23962434, -16019500, 27846559, 5931263, -29749703, -16108455}, + FieldElement{27461885, -2977536, 22380810, 1815854, -23033753, -3031938, 7283490, -15148073, -19526700, 7734629}, + }, + }, + { + { + FieldElement{-8010264, -9590817, -11120403, 6196038, 29344158, -13430885, 7585295, -3176626, 18549497, 15302069}, + FieldElement{-32658337, -6171222, -7672793, -11051681, 6258878, 13504381, 10458790, -6418461, -8872242, 8424746}, + FieldElement{24687205, 8613276, -30667046, -3233545, 1863892, -1830544, 19206234, 7134917, -11284482, -828919}, + }, + { + FieldElement{11334899, -9218022, 8025293, 12707519, 17523892, -10476071, 10243738, -14685461, -5066034, 16498837}, + FieldElement{8911542, 6887158, -9584260, -6958590, 11145641, -9543680, 17303925, -14124238, 6536641, 10543906}, + FieldElement{-28946384, 15479763, -17466835, 568876, -1497683, 11223454, -2669190, -16625574, -27235709, 8876771}, + }, + { + FieldElement{-25742899, -12566864, -15649966, -846607, -33026686, -796288, -33481822, 15824474, -604426, -9039817}, + FieldElement{10330056, 70051, 7957388, -9002667, 9764902, 15609756, 27698697, -4890037, 1657394, 3084098}, + FieldElement{10477963, -7470260, 12119566, -13250805, 29016247, -5365589, 31280319, 14396151, -30233575, 15272409}, + }, + { + FieldElement{-12288309, 3169463, 28813183, 16658753, 25116432, -5630466, -25173957, -12636138, -25014757, 1950504}, + FieldElement{-26180358, 9489187, 11053416, -14746161, -31053720, 5825630, -8384306, -8767532, 15341279, 8373727}, + FieldElement{28685821, 7759505, -14378516, -12002860, -31971820, 4079242, 298136, -10232602, -2878207, 15190420}, + }, + { + FieldElement{-32932876, 13806336, -14337485, -15794431, -24004620, 10940928, 8669718, 2742393, -26033313, -6875003}, + FieldElement{-1580388, -11729417, -25979658, -11445023, -17411874, -10912854, 9291594, -16247779, -12154742, 6048605}, + FieldElement{-30305315, 14843444, 1539301, 11864366, 20201677, 1900163, 13934231, 5128323, 11213262, 9168384}, + }, + { + FieldElement{-26280513, 11007847, 19408960, -940758, -18592965, -4328580, -5088060, -11105150, 20470157, -16398701}, + FieldElement{-23136053, 9282192, 14855179, -15390078, -7362815, -14408560, -22783952, 14461608, 14042978, 5230683}, + FieldElement{29969567, -2741594, -16711867, -8552442, 9175486, -2468974, 21556951, 3506042, -5933891, -12449708}, + }, + { + FieldElement{-3144746, 8744661, 19704003, 4581278, -20430686, 6830683, -21284170, 8971513, -28539189, 15326563}, + FieldElement{-19464629, 10110288, -17262528, -3503892, -23500387, 1355669, -15523050, 15300988, -20514118, 9168260}, + FieldElement{-5353335, 4488613, -23803248, 16314347, 7780487, -15638939, -28948358, 9601605, 33087103, -9011387}, + }, + { + FieldElement{-19443170, -15512900, -20797467, -12445323, -29824447, 10229461, -27444329, -15000531, -5996870, 15664672}, + FieldElement{23294591, -16632613, -22650781, -8470978, 27844204, 11461195, 13099750, -2460356, 18151676, 13417686}, + FieldElement{-24722913, -4176517, -31150679, 5988919, -26858785, 6685065, 1661597, -12551441, 15271676, -15452665}, + }, + }, + { + { + FieldElement{11433042, -13228665, 8239631, -5279517, -1985436, -725718, -18698764, 2167544, -6921301, -13440182}, + FieldElement{-31436171, 15575146, 30436815, 12192228, -22463353, 9395379, -9917708, -8638997, 12215110, 12028277}, + FieldElement{14098400, 6555944, 23007258, 5757252, -15427832, -12950502, 30123440, 4617780, -16900089, -655628}, + }, + { + FieldElement{-4026201, -15240835, 11893168, 13718664, -14809462, 1847385, -15819999, 10154009, 23973261, -12684474}, + FieldElement{-26531820, -3695990, -1908898, 2534301, -31870557, -16550355, 18341390, -11419951, 32013174, -10103539}, + FieldElement{-25479301, 10876443, -11771086, -14625140, -12369567, 1838104, 21911214, 6354752, 4425632, -837822}, + }, + { + FieldElement{-10433389, -14612966, 22229858, -3091047, -13191166, 776729, -17415375, -12020462, 4725005, 14044970}, + FieldElement{19268650, -7304421, 1555349, 8692754, -21474059, -9910664, 6347390, -1411784, -19522291, -16109756}, + FieldElement{-24864089, 12986008, -10898878, -5558584, -11312371, -148526, 19541418, 8180106, 9282262, 10282508}, + }, + { + FieldElement{-26205082, 4428547, -8661196, -13194263, 4098402, -14165257, 15522535, 8372215, 5542595, -10702683}, + FieldElement{-10562541, 14895633, 26814552, -16673850, -17480754, -2489360, -2781891, 6993761, -18093885, 10114655}, + FieldElement{-20107055, -929418, 31422704, 10427861, -7110749, 6150669, -29091755, -11529146, 25953725, -106158}, + }, + { + FieldElement{-4234397, -8039292, -9119125, 3046000, 2101609, -12607294, 19390020, 6094296, -3315279, 12831125}, + FieldElement{-15998678, 7578152, 5310217, 14408357, -33548620, -224739, 31575954, 6326196, 7381791, -2421839}, + FieldElement{-20902779, 3296811, 24736065, -16328389, 18374254, 7318640, 6295303, 8082724, -15362489, 12339664}, + }, + { + FieldElement{27724736, 2291157, 6088201, -14184798, 1792727, 5857634, 13848414, 15768922, 25091167, 14856294}, + FieldElement{-18866652, 8331043, 24373479, 8541013, -701998, -9269457, 12927300, -12695493, -22182473, -9012899}, + FieldElement{-11423429, -5421590, 11632845, 3405020, 30536730, -11674039, -27260765, 13866390, 30146206, 9142070}, + }, + { + FieldElement{3924129, -15307516, -13817122, -10054960, 12291820, -668366, -27702774, 9326384, -8237858, 4171294}, + FieldElement{-15921940, 16037937, 6713787, 16606682, -21612135, 2790944, 26396185, 3731949, 345228, -5462949}, + FieldElement{-21327538, 13448259, 25284571, 1143661, 20614966, -8849387, 2031539, -12391231, -16253183, -13582083}, + }, + { + FieldElement{31016211, -16722429, 26371392, -14451233, -5027349, 14854137, 17477601, 3842657, 28012650, -16405420}, + FieldElement{-5075835, 9368966, -8562079, -4600902, -15249953, 6970560, -9189873, 16292057, -8867157, 3507940}, + FieldElement{29439664, 3537914, 23333589, 6997794, -17555561, -11018068, -15209202, -15051267, -9164929, 6580396}, + }, + }, + { + { + FieldElement{-12185861, -7679788, 16438269, 10826160, -8696817, -6235611, 17860444, -9273846, -2095802, 9304567}, + FieldElement{20714564, -4336911, 29088195, 7406487, 11426967, -5095705, 14792667, -14608617, 5289421, -477127}, + FieldElement{-16665533, -10650790, -6160345, -13305760, 9192020, -1802462, 17271490, 12349094, 26939669, -3752294}, + }, + { + FieldElement{-12889898, 9373458, 31595848, 16374215, 21471720, 13221525, -27283495, -12348559, -3698806, 117887}, + FieldElement{22263325, -6560050, 3984570, -11174646, -15114008, -566785, 28311253, 5358056, -23319780, 541964}, + FieldElement{16259219, 3261970, 2309254, -15534474, -16885711, -4581916, 24134070, -16705829, -13337066, -13552195}, + }, + { + FieldElement{9378160, -13140186, -22845982, -12745264, 28198281, -7244098, -2399684, -717351, 690426, 14876244}, + FieldElement{24977353, -314384, -8223969, -13465086, 28432343, -1176353, -13068804, -12297348, -22380984, 6618999}, + FieldElement{-1538174, 11685646, 12944378, 13682314, -24389511, -14413193, 8044829, -13817328, 32239829, -5652762}, + }, + { + FieldElement{-18603066, 4762990, -926250, 8885304, -28412480, -3187315, 9781647, -10350059, 32779359, 5095274}, + FieldElement{-33008130, -5214506, -32264887, -3685216, 9460461, -9327423, -24601656, 14506724, 21639561, -2630236}, + FieldElement{-16400943, -13112215, 25239338, 15531969, 3987758, -4499318, -1289502, -6863535, 17874574, 558605}, + }, + { + FieldElement{-13600129, 10240081, 9171883, 16131053, -20869254, 9599700, 33499487, 5080151, 2085892, 5119761}, + FieldElement{-22205145, -2519528, -16381601, 414691, -25019550, 2170430, 30634760, -8363614, -31999993, -5759884}, + FieldElement{-6845704, 15791202, 8550074, -1312654, 29928809, -12092256, 27534430, -7192145, -22351378, 12961482}, + }, + { + FieldElement{-24492060, -9570771, 10368194, 11582341, -23397293, -2245287, 16533930, 8206996, -30194652, -5159638}, + FieldElement{-11121496, -3382234, 2307366, 6362031, -135455, 8868177, -16835630, 7031275, 7589640, 8945490}, + FieldElement{-32152748, 8917967, 6661220, -11677616, -1192060, -15793393, 7251489, -11182180, 24099109, -14456170}, + }, + { + FieldElement{5019558, -7907470, 4244127, -14714356, -26933272, 6453165, -19118182, -13289025, -6231896, -10280736}, + FieldElement{10853594, 10721687, 26480089, 5861829, -22995819, 1972175, -1866647, -10557898, -3363451, -6441124}, + FieldElement{-17002408, 5906790, 221599, -6563147, 7828208, -13248918, 24362661, -2008168, -13866408, 7421392}, + }, + { + FieldElement{8139927, -6546497, 32257646, -5890546, 30375719, 1886181, -21175108, 15441252, 28826358, -4123029}, + FieldElement{6267086, 9695052, 7709135, -16603597, -32869068, -1886135, 14795160, -7840124, 13746021, -1742048}, + FieldElement{28584902, 7787108, -6732942, -15050729, 22846041, -7571236, -3181936, -363524, 4771362, -8419958}, + }, + }, + { + { + FieldElement{24949256, 6376279, -27466481, -8174608, -18646154, -9930606, 33543569, -12141695, 3569627, 11342593}, + FieldElement{26514989, 4740088, 27912651, 3697550, 19331575, -11472339, 6809886, 4608608, 7325975, -14801071}, + FieldElement{-11618399, -14554430, -24321212, 7655128, -1369274, 5214312, -27400540, 10258390, -17646694, -8186692}, + }, + { + FieldElement{11431204, 15823007, 26570245, 14329124, 18029990, 4796082, -31446179, 15580664, 9280358, -3973687}, + FieldElement{-160783, -10326257, -22855316, -4304997, -20861367, -13621002, -32810901, -11181622, -15545091, 4387441}, + FieldElement{-20799378, 12194512, 3937617, -5805892, -27154820, 9340370, -24513992, 8548137, 20617071, -7482001}, + }, + { + FieldElement{-938825, -3930586, -8714311, 16124718, 24603125, -6225393, -13775352, -11875822, 24345683, 10325460}, + FieldElement{-19855277, -1568885, -22202708, 8714034, 14007766, 6928528, 16318175, -1010689, 4766743, 3552007}, + FieldElement{-21751364, -16730916, 1351763, -803421, -4009670, 3950935, 3217514, 14481909, 10988822, -3994762}, + }, + { + FieldElement{15564307, -14311570, 3101243, 5684148, 30446780, -8051356, 12677127, -6505343, -8295852, 13296005}, + FieldElement{-9442290, 6624296, -30298964, -11913677, -4670981, -2057379, 31521204, 9614054, -30000824, 12074674}, + FieldElement{4771191, -135239, 14290749, -13089852, 27992298, 14998318, -1413936, -1556716, 29832613, -16391035}, + }, + { + FieldElement{7064884, -7541174, -19161962, -5067537, -18891269, -2912736, 25825242, 5293297, -27122660, 13101590}, + FieldElement{-2298563, 2439670, -7466610, 1719965, -27267541, -16328445, 32512469, -5317593, -30356070, -4190957}, + FieldElement{-30006540, 10162316, -33180176, 3981723, -16482138, -13070044, 14413974, 9515896, 19568978, 9628812}, + }, + { + FieldElement{33053803, 199357, 15894591, 1583059, 27380243, -4580435, -17838894, -6106839, -6291786, 3437740}, + FieldElement{-18978877, 3884493, 19469877, 12726490, 15913552, 13614290, -22961733, 70104, 7463304, 4176122}, + FieldElement{-27124001, 10659917, 11482427, -16070381, 12771467, -6635117, -32719404, -5322751, 24216882, 5944158}, + }, + { + FieldElement{8894125, 7450974, -2664149, -9765752, -28080517, -12389115, 19345746, 14680796, 11632993, 5847885}, + FieldElement{26942781, -2315317, 9129564, -4906607, 26024105, 11769399, -11518837, 6367194, -9727230, 4782140}, + FieldElement{19916461, -4828410, -22910704, -11414391, 25606324, -5972441, 33253853, 8220911, 6358847, -1873857}, + }, + { + FieldElement{801428, -2081702, 16569428, 11065167, 29875704, 96627, 7908388, -4480480, -13538503, 1387155}, + FieldElement{19646058, 5720633, -11416706, 12814209, 11607948, 12749789, 14147075, 15156355, -21866831, 11835260}, + FieldElement{19299512, 1155910, 28703737, 14890794, 2925026, 7269399, 26121523, 15467869, -26560550, 5052483}, + }, + }, + { + { + FieldElement{-3017432, 10058206, 1980837, 3964243, 22160966, 12322533, -6431123, -12618185, 12228557, -7003677}, + FieldElement{32944382, 14922211, -22844894, 5188528, 21913450, -8719943, 4001465, 13238564, -6114803, 8653815}, + FieldElement{22865569, -4652735, 27603668, -12545395, 14348958, 8234005, 24808405, 5719875, 28483275, 2841751}, + }, + { + FieldElement{-16420968, -1113305, -327719, -12107856, 21886282, -15552774, -1887966, -315658, 19932058, -12739203}, + FieldElement{-11656086, 10087521, -8864888, -5536143, -19278573, -3055912, 3999228, 13239134, -4777469, -13910208}, + FieldElement{1382174, -11694719, 17266790, 9194690, -13324356, 9720081, 20403944, 11284705, -14013818, 3093230}, + }, + { + FieldElement{16650921, -11037932, -1064178, 1570629, -8329746, 7352753, -302424, 16271225, -24049421, -6691850}, + FieldElement{-21911077, -5927941, -4611316, -5560156, -31744103, -10785293, 24123614, 15193618, -21652117, -16739389}, + FieldElement{-9935934, -4289447, -25279823, 4372842, 2087473, 10399484, 31870908, 14690798, 17361620, 11864968}, + }, + { + FieldElement{-11307610, 6210372, 13206574, 5806320, -29017692, -13967200, -12331205, -7486601, -25578460, -16240689}, + FieldElement{14668462, -12270235, 26039039, 15305210, 25515617, 4542480, 10453892, 6577524, 9145645, -6443880}, + FieldElement{5974874, 3053895, -9433049, -10385191, -31865124, 3225009, -7972642, 3936128, -5652273, -3050304}, + }, + { + FieldElement{30625386, -4729400, -25555961, -12792866, -20484575, 7695099, 17097188, -16303496, -27999779, 1803632}, + FieldElement{-3553091, 9865099, -5228566, 4272701, -5673832, -16689700, 14911344, 12196514, -21405489, 7047412}, + FieldElement{20093277, 9920966, -11138194, -5343857, 13161587, 12044805, -32856851, 4124601, -32343828, -10257566}, + }, + { + FieldElement{-20788824, 14084654, -13531713, 7842147, 19119038, -13822605, 4752377, -8714640, -21679658, 2288038}, + FieldElement{-26819236, -3283715, 29965059, 3039786, -14473765, 2540457, 29457502, 14625692, -24819617, 12570232}, + FieldElement{-1063558, -11551823, 16920318, 12494842, 1278292, -5869109, -21159943, -3498680, -11974704, 4724943}, + }, + { + FieldElement{17960970, -11775534, -4140968, -9702530, -8876562, -1410617, -12907383, -8659932, -29576300, 1903856}, + FieldElement{23134274, -14279132, -10681997, -1611936, 20684485, 15770816, -12989750, 3190296, 26955097, 14109738}, + FieldElement{15308788, 5320727, -30113809, -14318877, 22902008, 7767164, 29425325, -11277562, 31960942, 11934971}, + }, + { + FieldElement{-27395711, 8435796, 4109644, 12222639, -24627868, 14818669, 20638173, 4875028, 10491392, 1379718}, + FieldElement{-13159415, 9197841, 3875503, -8936108, -1383712, -5879801, 33518459, 16176658, 21432314, 12180697}, + FieldElement{-11787308, 11500838, 13787581, -13832590, -22430679, 10140205, 1465425, 12689540, -10301319, -13872883}, + }, + }, + { + { + FieldElement{5414091, -15386041, -21007664, 9643570, 12834970, 1186149, -2622916, -1342231, 26128231, 6032912}, + FieldElement{-26337395, -13766162, 32496025, -13653919, 17847801, -12669156, 3604025, 8316894, -25875034, -10437358}, + FieldElement{3296484, 6223048, 24680646, -12246460, -23052020, 5903205, -8862297, -4639164, 12376617, 3188849}, + }, + { + FieldElement{29190488, -14659046, 27549113, -1183516, 3520066, -10697301, 32049515, -7309113, -16109234, -9852307}, + FieldElement{-14744486, -9309156, 735818, -598978, -20407687, -5057904, 25246078, -15795669, 18640741, -960977}, + FieldElement{-6928835, -16430795, 10361374, 5642961, 4910474, 12345252, -31638386, -494430, 10530747, 1053335}, + }, + { + FieldElement{-29265967, -14186805, -13538216, -12117373, -19457059, -10655384, -31462369, -2948985, 24018831, 15026644}, + FieldElement{-22592535, -3145277, -2289276, 5953843, -13440189, 9425631, 25310643, 13003497, -2314791, -15145616}, + FieldElement{-27419985, -603321, -8043984, -1669117, -26092265, 13987819, -27297622, 187899, -23166419, -2531735}, + }, + { + FieldElement{-21744398, -13810475, 1844840, 5021428, -10434399, -15911473, 9716667, 16266922, -5070217, 726099}, + FieldElement{29370922, -6053998, 7334071, -15342259, 9385287, 2247707, -13661962, -4839461, 30007388, -15823341}, + FieldElement{-936379, 16086691, 23751945, -543318, -1167538, -5189036, 9137109, 730663, 9835848, 4555336}, + }, + { + FieldElement{-23376435, 1410446, -22253753, -12899614, 30867635, 15826977, 17693930, 544696, -11985298, 12422646}, + FieldElement{31117226, -12215734, -13502838, 6561947, -9876867, -12757670, -5118685, -4096706, 29120153, 13924425}, + FieldElement{-17400879, -14233209, 19675799, -2734756, -11006962, -5858820, -9383939, -11317700, 7240931, -237388}, + }, + { + FieldElement{-31361739, -11346780, -15007447, -5856218, -22453340, -12152771, 1222336, 4389483, 3293637, -15551743}, + FieldElement{-16684801, -14444245, 11038544, 11054958, -13801175, -3338533, -24319580, 7733547, 12796905, -6335822}, + FieldElement{-8759414, -10817836, -25418864, 10783769, -30615557, -9746811, -28253339, 3647836, 3222231, -11160462}, + }, + { + FieldElement{18606113, 1693100, -25448386, -15170272, 4112353, 10045021, 23603893, -2048234, -7550776, 2484985}, + FieldElement{9255317, -3131197, -12156162, -1004256, 13098013, -9214866, 16377220, -2102812, -19802075, -3034702}, + FieldElement{-22729289, 7496160, -5742199, 11329249, 19991973, -3347502, -31718148, 9936966, -30097688, -10618797}, + }, + { + FieldElement{21878590, -5001297, 4338336, 13643897, -3036865, 13160960, 19708896, 5415497, -7360503, -4109293}, + FieldElement{27736861, 10103576, 12500508, 8502413, -3413016, -9633558, 10436918, -1550276, -23659143, -8132100}, + FieldElement{19492550, -12104365, -29681976, -852630, -3208171, 12403437, 30066266, 8367329, 13243957, 8709688}, + }, + }, + { + { + FieldElement{12015105, 2801261, 28198131, 10151021, 24818120, -4743133, -11194191, -5645734, 5150968, 7274186}, + FieldElement{2831366, -12492146, 1478975, 6122054, 23825128, -12733586, 31097299, 6083058, 31021603, -9793610}, + FieldElement{-2529932, -2229646, 445613, 10720828, -13849527, -11505937, -23507731, 16354465, 15067285, -14147707}, + }, + { + FieldElement{7840942, 14037873, -33364863, 15934016, -728213, -3642706, 21403988, 1057586, -19379462, -12403220}, + FieldElement{915865, -16469274, 15608285, -8789130, -24357026, 6060030, -17371319, 8410997, -7220461, 16527025}, + FieldElement{32922597, -556987, 20336074, -16184568, 10903705, -5384487, 16957574, 52992, 23834301, 6588044}, + }, + { + FieldElement{32752030, 11232950, 3381995, -8714866, 22652988, -10744103, 17159699, 16689107, -20314580, -1305992}, + FieldElement{-4689649, 9166776, -25710296, -10847306, 11576752, 12733943, 7924251, -2752281, 1976123, -7249027}, + FieldElement{21251222, 16309901, -2983015, -6783122, 30810597, 12967303, 156041, -3371252, 12331345, -8237197}, + }, + { + FieldElement{8651614, -4477032, -16085636, -4996994, 13002507, 2950805, 29054427, -5106970, 10008136, -4667901}, + FieldElement{31486080, 15114593, -14261250, 12951354, 14369431, -7387845, 16347321, -13662089, 8684155, -10532952}, + FieldElement{19443825, 11385320, 24468943, -9659068, -23919258, 2187569, -26263207, -6086921, 31316348, 14219878}, + }, + { + FieldElement{-28594490, 1193785, 32245219, 11392485, 31092169, 15722801, 27146014, 6992409, 29126555, 9207390}, + FieldElement{32382935, 1110093, 18477781, 11028262, -27411763, -7548111, -4980517, 10843782, -7957600, -14435730}, + FieldElement{2814918, 7836403, 27519878, -7868156, -20894015, -11553689, -21494559, 8550130, 28346258, 1994730}, + }, + { + FieldElement{-19578299, 8085545, -14000519, -3948622, 2785838, -16231307, -19516951, 7174894, 22628102, 8115180}, + FieldElement{-30405132, 955511, -11133838, -15078069, -32447087, -13278079, -25651578, 3317160, -9943017, 930272}, + FieldElement{-15303681, -6833769, 28856490, 1357446, 23421993, 1057177, 24091212, -1388970, -22765376, -10650715}, + }, + { + FieldElement{-22751231, -5303997, -12907607, -12768866, -15811511, -7797053, -14839018, -16554220, -1867018, 8398970}, + FieldElement{-31969310, 2106403, -4736360, 1362501, 12813763, 16200670, 22981545, -6291273, 18009408, -15772772}, + FieldElement{-17220923, -9545221, -27784654, 14166835, 29815394, 7444469, 29551787, -3727419, 19288549, 1325865}, + }, + { + FieldElement{15100157, -15835752, -23923978, -1005098, -26450192, 15509408, 12376730, -3479146, 33166107, -8042750}, + FieldElement{20909231, 13023121, -9209752, 16251778, -5778415, -8094914, 12412151, 10018715, 2213263, -13878373}, + FieldElement{32529814, -11074689, 30361439, -16689753, -9135940, 1513226, 22922121, 6382134, -5766928, 8371348}, + }, + }, + { + { + FieldElement{9923462, 11271500, 12616794, 3544722, -29998368, -1721626, 12891687, -8193132, -26442943, 10486144}, + FieldElement{-22597207, -7012665, 8587003, -8257861, 4084309, -12970062, 361726, 2610596, -23921530, -11455195}, + FieldElement{5408411, -1136691, -4969122, 10561668, 24145918, 14240566, 31319731, -4235541, 19985175, -3436086}, + }, + { + FieldElement{-13994457, 16616821, 14549246, 3341099, 32155958, 13648976, -17577068, 8849297, 65030, 8370684}, + FieldElement{-8320926, -12049626, 31204563, 5839400, -20627288, -1057277, -19442942, 6922164, 12743482, -9800518}, + FieldElement{-2361371, 12678785, 28815050, 4759974, -23893047, 4884717, 23783145, 11038569, 18800704, 255233}, + }, + { + FieldElement{-5269658, -1773886, 13957886, 7990715, 23132995, 728773, 13393847, 9066957, 19258688, -14753793}, + FieldElement{-2936654, -10827535, -10432089, 14516793, -3640786, 4372541, -31934921, 2209390, -1524053, 2055794}, + FieldElement{580882, 16705327, 5468415, -2683018, -30926419, -14696000, -7203346, -8994389, -30021019, 7394435}, + }, + { + FieldElement{23838809, 1822728, -15738443, 15242727, 8318092, -3733104, -21672180, -3492205, -4821741, 14799921}, + FieldElement{13345610, 9759151, 3371034, -16137791, 16353039, 8577942, 31129804, 13496856, -9056018, 7402518}, + FieldElement{2286874, -4435931, -20042458, -2008336, -13696227, 5038122, 11006906, -15760352, 8205061, 1607563}, + }, + { + FieldElement{14414086, -8002132, 3331830, -3208217, 22249151, -5594188, 18364661, -2906958, 30019587, -9029278}, + FieldElement{-27688051, 1585953, -10775053, 931069, -29120221, -11002319, -14410829, 12029093, 9944378, 8024}, + FieldElement{4368715, -3709630, 29874200, -15022983, -20230386, -11410704, -16114594, -999085, -8142388, 5640030}, + }, + { + FieldElement{10299610, 13746483, 11661824, 16234854, 7630238, 5998374, 9809887, -16694564, 15219798, -14327783}, + FieldElement{27425505, -5719081, 3055006, 10660664, 23458024, 595578, -15398605, -1173195, -18342183, 9742717}, + FieldElement{6744077, 2427284, 26042789, 2720740, -847906, 1118974, 32324614, 7406442, 12420155, 1994844}, + }, + { + FieldElement{14012521, -5024720, -18384453, -9578469, -26485342, -3936439, -13033478, -10909803, 24319929, -6446333}, + FieldElement{16412690, -4507367, 10772641, 15929391, -17068788, -4658621, 10555945, -10484049, -30102368, -4739048}, + FieldElement{22397382, -7767684, -9293161, -12792868, 17166287, -9755136, -27333065, 6199366, 21880021, -12250760}, + }, + { + FieldElement{-4283307, 5368523, -31117018, 8163389, -30323063, 3209128, 16557151, 8890729, 8840445, 4957760}, + FieldElement{-15447727, 709327, -6919446, -10870178, -29777922, 6522332, -21720181, 12130072, -14796503, 5005757}, + FieldElement{-2114751, -14308128, 23019042, 15765735, -25269683, 6002752, 10183197, -13239326, -16395286, -2176112}, + }, + }, + { + { + FieldElement{-19025756, 1632005, 13466291, -7995100, -23640451, 16573537, -32013908, -3057104, 22208662, 2000468}, + FieldElement{3065073, -1412761, -25598674, -361432, -17683065, -5703415, -8164212, 11248527, -3691214, -7414184}, + FieldElement{10379208, -6045554, 8877319, 1473647, -29291284, -12507580, 16690915, 2553332, -3132688, 16400289}, + }, + { + FieldElement{15716668, 1254266, -18472690, 7446274, -8448918, 6344164, -22097271, -7285580, 26894937, 9132066}, + FieldElement{24158887, 12938817, 11085297, -8177598, -28063478, -4457083, -30576463, 64452, -6817084, -2692882}, + FieldElement{13488534, 7794716, 22236231, 5989356, 25426474, -12578208, 2350710, -3418511, -4688006, 2364226}, + }, + { + FieldElement{16335052, 9132434, 25640582, 6678888, 1725628, 8517937, -11807024, -11697457, 15445875, -7798101}, + FieldElement{29004207, -7867081, 28661402, -640412, -12794003, -7943086, 31863255, -4135540, -278050, -15759279}, + FieldElement{-6122061, -14866665, -28614905, 14569919, -10857999, -3591829, 10343412, -6976290, -29828287, -10815811}, + }, + { + FieldElement{27081650, 3463984, 14099042, -4517604, 1616303, -6205604, 29542636, 15372179, 17293797, 960709}, + FieldElement{20263915, 11434237, -5765435, 11236810, 13505955, -10857102, -16111345, 6493122, -19384511, 7639714}, + FieldElement{-2830798, -14839232, 25403038, -8215196, -8317012, -16173699, 18006287, -16043750, 29994677, -15808121}, + }, + { + FieldElement{9769828, 5202651, -24157398, -13631392, -28051003, -11561624, -24613141, -13860782, -31184575, 709464}, + FieldElement{12286395, 13076066, -21775189, -1176622, -25003198, 4057652, -32018128, -8890874, 16102007, 13205847}, + FieldElement{13733362, 5599946, 10557076, 3195751, -5557991, 8536970, -25540170, 8525972, 10151379, 10394400}, + }, + { + FieldElement{4024660, -16137551, 22436262, 12276534, -9099015, -2686099, 19698229, 11743039, -33302334, 8934414}, + FieldElement{-15879800, -4525240, -8580747, -2934061, 14634845, -698278, -9449077, 3137094, -11536886, 11721158}, + FieldElement{17555939, -5013938, 8268606, 2331751, -22738815, 9761013, 9319229, 8835153, -9205489, -1280045}, + }, + { + FieldElement{-461409, -7830014, 20614118, 16688288, -7514766, -4807119, 22300304, 505429, 6108462, -6183415}, + FieldElement{-5070281, 12367917, -30663534, 3234473, 32617080, -8422642, 29880583, -13483331, -26898490, -7867459}, + FieldElement{-31975283, 5726539, 26934134, 10237677, -3173717, -605053, 24199304, 3795095, 7592688, -14992079}, + }, + { + FieldElement{21594432, -14964228, 17466408, -4077222, 32537084, 2739898, 6407723, 12018833, -28256052, 4298412}, + FieldElement{-20650503, -11961496, -27236275, 570498, 3767144, -1717540, 13891942, -1569194, 13717174, 10805743}, + FieldElement{-14676630, -15644296, 15287174, 11927123, 24177847, -8175568, -796431, 14860609, -26938930, -5863836}, + }, + }, + { + { + FieldElement{12962541, 5311799, -10060768, 11658280, 18855286, -7954201, 13286263, -12808704, -4381056, 9882022}, + FieldElement{18512079, 11319350, -20123124, 15090309, 18818594, 5271736, -22727904, 3666879, -23967430, -3299429}, + FieldElement{-6789020, -3146043, 16192429, 13241070, 15898607, -14206114, -10084880, -6661110, -2403099, 5276065}, + }, + { + FieldElement{30169808, -5317648, 26306206, -11750859, 27814964, 7069267, 7152851, 3684982, 1449224, 13082861}, + FieldElement{10342826, 3098505, 2119311, 193222, 25702612, 12233820, 23697382, 15056736, -21016438, -8202000}, + FieldElement{-33150110, 3261608, 22745853, 7948688, 19370557, -15177665, -26171976, 6482814, -10300080, -11060101}, + }, + { + FieldElement{32869458, -5408545, 25609743, 15678670, -10687769, -15471071, 26112421, 2521008, -22664288, 6904815}, + FieldElement{29506923, 4457497, 3377935, -9796444, -30510046, 12935080, 1561737, 3841096, -29003639, -6657642}, + FieldElement{10340844, -6630377, -18656632, -2278430, 12621151, -13339055, 30878497, -11824370, -25584551, 5181966}, + }, + { + FieldElement{25940115, -12658025, 17324188, -10307374, -8671468, 15029094, 24396252, -16450922, -2322852, -12388574}, + FieldElement{-21765684, 9916823, -1300409, 4079498, -1028346, 11909559, 1782390, 12641087, 20603771, -6561742}, + FieldElement{-18882287, -11673380, 24849422, 11501709, 13161720, -4768874, 1925523, 11914390, 4662781, 7820689}, + }, + { + FieldElement{12241050, -425982, 8132691, 9393934, 32846760, -1599620, 29749456, 12172924, 16136752, 15264020}, + FieldElement{-10349955, -14680563, -8211979, 2330220, -17662549, -14545780, 10658213, 6671822, 19012087, 3772772}, + FieldElement{3753511, -3421066, 10617074, 2028709, 14841030, -6721664, 28718732, -15762884, 20527771, 12988982}, + }, + { + FieldElement{-14822485, -5797269, -3707987, 12689773, -898983, -10914866, -24183046, -10564943, 3299665, -12424953}, + FieldElement{-16777703, -15253301, -9642417, 4978983, 3308785, 8755439, 6943197, 6461331, -25583147, 8991218}, + FieldElement{-17226263, 1816362, -1673288, -6086439, 31783888, -8175991, -32948145, 7417950, -30242287, 1507265}, + }, + { + FieldElement{29692663, 6829891, -10498800, 4334896, 20945975, -11906496, -28887608, 8209391, 14606362, -10647073}, + FieldElement{-3481570, 8707081, 32188102, 5672294, 22096700, 1711240, -33020695, 9761487, 4170404, -2085325}, + FieldElement{-11587470, 14855945, -4127778, -1531857, -26649089, 15084046, 22186522, 16002000, -14276837, -8400798}, + }, + { + FieldElement{-4811456, 13761029, -31703877, -2483919, -3312471, 7869047, -7113572, -9620092, 13240845, 10965870}, + FieldElement{-7742563, -8256762, -14768334, -13656260, -23232383, 12387166, 4498947, 14147411, 29514390, 4302863}, + FieldElement{-13413405, -12407859, 20757302, -13801832, 14785143, 8976368, -5061276, -2144373, 17846988, -13971927}, + }, + }, + { + { + FieldElement{-2244452, -754728, -4597030, -1066309, -6247172, 1455299, -21647728, -9214789, -5222701, 12650267}, + FieldElement{-9906797, -16070310, 21134160, 12198166, -27064575, 708126, 387813, 13770293, -19134326, 10958663}, + FieldElement{22470984, 12369526, 23446014, -5441109, -21520802, -9698723, -11772496, -11574455, -25083830, 4271862}, + }, + { + FieldElement{-25169565, -10053642, -19909332, 15361595, -5984358, 2159192, 75375, -4278529, -32526221, 8469673}, + FieldElement{15854970, 4148314, -8893890, 7259002, 11666551, 13824734, -30531198, 2697372, 24154791, -9460943}, + FieldElement{15446137, -15806644, 29759747, 14019369, 30811221, -9610191, -31582008, 12840104, 24913809, 9815020}, + }, + { + FieldElement{-4709286, -5614269, -31841498, -12288893, -14443537, 10799414, -9103676, 13438769, 18735128, 9466238}, + FieldElement{11933045, 9281483, 5081055, -5183824, -2628162, -4905629, -7727821, -10896103, -22728655, 16199064}, + FieldElement{14576810, 379472, -26786533, -8317236, -29426508, -10812974, -102766, 1876699, 30801119, 2164795}, + }, + { + FieldElement{15995086, 3199873, 13672555, 13712240, -19378835, -4647646, -13081610, -15496269, -13492807, 1268052}, + FieldElement{-10290614, -3659039, -3286592, 10948818, 23037027, 3794475, -3470338, -12600221, -17055369, 3565904}, + FieldElement{29210088, -9419337, -5919792, -4952785, 10834811, -13327726, -16512102, -10820713, -27162222, -14030531}, + }, + { + FieldElement{-13161890, 15508588, 16663704, -8156150, -28349942, 9019123, -29183421, -3769423, 2244111, -14001979}, + FieldElement{-5152875, -3800936, -9306475, -6071583, 16243069, 14684434, -25673088, -16180800, 13491506, 4641841}, + FieldElement{10813417, 643330, -19188515, -728916, 30292062, -16600078, 27548447, -7721242, 14476989, -12767431}, + }, + { + FieldElement{10292079, 9984945, 6481436, 8279905, -7251514, 7032743, 27282937, -1644259, -27912810, 12651324}, + FieldElement{-31185513, -813383, 22271204, 11835308, 10201545, 15351028, 17099662, 3988035, 21721536, -3148940}, + FieldElement{10202177, -6545839, -31373232, -9574638, -32150642, -8119683, -12906320, 3852694, 13216206, 14842320}, + }, + { + FieldElement{-15815640, -10601066, -6538952, -7258995, -6984659, -6581778, -31500847, 13765824, -27434397, 9900184}, + FieldElement{14465505, -13833331, -32133984, -14738873, -27443187, 12990492, 33046193, 15796406, -7051866, -8040114}, + FieldElement{30924417, -8279620, 6359016, -12816335, 16508377, 9071735, -25488601, 15413635, 9524356, -7018878}, + }, + { + FieldElement{12274201, -13175547, 32627641, -1785326, 6736625, 13267305, 5237659, -5109483, 15663516, 4035784}, + FieldElement{-2951309, 8903985, 17349946, 601635, -16432815, -4612556, -13732739, -15889334, -22258478, 4659091}, + FieldElement{-16916263, -4952973, -30393711, -15158821, 20774812, 15897498, 5736189, 15026997, -2178256, -13455585}, + }, + }, + { + { + FieldElement{-8858980, -2219056, 28571666, -10155518, -474467, -10105698, -3801496, 278095, 23440562, -290208}, + FieldElement{10226241, -5928702, 15139956, 120818, -14867693, 5218603, 32937275, 11551483, -16571960, -7442864}, + FieldElement{17932739, -12437276, -24039557, 10749060, 11316803, 7535897, 22503767, 5561594, -3646624, 3898661}, + }, + { + FieldElement{7749907, -969567, -16339731, -16464, -25018111, 15122143, -1573531, 7152530, 21831162, 1245233}, + FieldElement{26958459, -14658026, 4314586, 8346991, -5677764, 11960072, -32589295, -620035, -30402091, -16716212}, + FieldElement{-12165896, 9166947, 33491384, 13673479, 29787085, 13096535, 6280834, 14587357, -22338025, 13987525}, + }, + { + FieldElement{-24349909, 7778775, 21116000, 15572597, -4833266, -5357778, -4300898, -5124639, -7469781, -2858068}, + FieldElement{9681908, -6737123, -31951644, 13591838, -6883821, 386950, 31622781, 6439245, -14581012, 4091397}, + FieldElement{-8426427, 1470727, -28109679, -1596990, 3978627, -5123623, -19622683, 12092163, 29077877, -14741988}, + }, + { + FieldElement{5269168, -6859726, -13230211, -8020715, 25932563, 1763552, -5606110, -5505881, -20017847, 2357889}, + FieldElement{32264008, -15407652, -5387735, -1160093, -2091322, -3946900, 23104804, -12869908, 5727338, 189038}, + FieldElement{14609123, -8954470, -6000566, -16622781, -14577387, -7743898, -26745169, 10942115, -25888931, -14884697}, + }, + { + FieldElement{20513500, 5557931, -15604613, 7829531, 26413943, -2019404, -21378968, 7471781, 13913677, -5137875}, + FieldElement{-25574376, 11967826, 29233242, 12948236, -6754465, 4713227, -8940970, 14059180, 12878652, 8511905}, + FieldElement{-25656801, 3393631, -2955415, -7075526, -2250709, 9366908, -30223418, 6812974, 5568676, -3127656}, + }, + { + FieldElement{11630004, 12144454, 2116339, 13606037, 27378885, 15676917, -17408753, -13504373, -14395196, 8070818}, + FieldElement{27117696, -10007378, -31282771, -5570088, 1127282, 12772488, -29845906, 10483306, -11552749, -1028714}, + FieldElement{10637467, -5688064, 5674781, 1072708, -26343588, -6982302, -1683975, 9177853, -27493162, 15431203}, + }, + { + FieldElement{20525145, 10892566, -12742472, 12779443, -29493034, 16150075, -28240519, 14943142, -15056790, -7935931}, + FieldElement{-30024462, 5626926, -551567, -9981087, 753598, 11981191, 25244767, -3239766, -3356550, 9594024}, + FieldElement{-23752644, 2636870, -5163910, -10103818, 585134, 7877383, 11345683, -6492290, 13352335, -10977084}, + }, + { + FieldElement{-1931799, -5407458, 3304649, -12884869, 17015806, -4877091, -29783850, -7752482, -13215537, -319204}, + FieldElement{20239939, 6607058, 6203985, 3483793, -18386976, -779229, -20723742, 15077870, -22750759, 14523817}, + FieldElement{27406042, -6041657, 27423596, -4497394, 4996214, 10002360, -28842031, -4545494, -30172742, -4805667}, + }, + }, + { + { + FieldElement{11374242, 12660715, 17861383, -12540833, 10935568, 1099227, -13886076, -9091740, -27727044, 11358504}, + FieldElement{-12730809, 10311867, 1510375, 10778093, -2119455, -9145702, 32676003, 11149336, -26123651, 4985768}, + FieldElement{-19096303, 341147, -6197485, -239033, 15756973, -8796662, -983043, 13794114, -19414307, -15621255}, + }, + { + FieldElement{6490081, 11940286, 25495923, -7726360, 8668373, -8751316, 3367603, 6970005, -1691065, -9004790}, + FieldElement{1656497, 13457317, 15370807, 6364910, 13605745, 8362338, -19174622, -5475723, -16796596, -5031438}, + FieldElement{-22273315, -13524424, -64685, -4334223, -18605636, -10921968, -20571065, -7007978, -99853, -10237333}, + }, + { + FieldElement{17747465, 10039260, 19368299, -4050591, -20630635, -16041286, 31992683, -15857976, -29260363, -5511971}, + FieldElement{31932027, -4986141, -19612382, 16366580, 22023614, 88450, 11371999, -3744247, 4882242, -10626905}, + FieldElement{29796507, 37186, 19818052, 10115756, -11829032, 3352736, 18551198, 3272828, -5190932, -4162409}, + }, + { + FieldElement{12501286, 4044383, -8612957, -13392385, -32430052, 5136599, -19230378, -3529697, 330070, -3659409}, + FieldElement{6384877, 2899513, 17807477, 7663917, -2358888, 12363165, 25366522, -8573892, -271295, 12071499}, + FieldElement{-8365515, -4042521, 25133448, -4517355, -6211027, 2265927, -32769618, 1936675, -5159697, 3829363}, + }, + { + FieldElement{28425966, -5835433, -577090, -4697198, -14217555, 6870930, 7921550, -6567787, 26333140, 14267664}, + FieldElement{-11067219, 11871231, 27385719, -10559544, -4585914, -11189312, 10004786, -8709488, -21761224, 8930324}, + FieldElement{-21197785, -16396035, 25654216, -1725397, 12282012, 11008919, 1541940, 4757911, -26491501, -16408940}, + }, + { + FieldElement{13537262, -7759490, -20604840, 10961927, -5922820, -13218065, -13156584, 6217254, -15943699, 13814990}, + FieldElement{-17422573, 15157790, 18705543, 29619, 24409717, -260476, 27361681, 9257833, -1956526, -1776914}, + FieldElement{-25045300, -10191966, 15366585, 15166509, -13105086, 8423556, -29171540, 12361135, -18685978, 4578290}, + }, + { + FieldElement{24579768, 3711570, 1342322, -11180126, -27005135, 14124956, -22544529, 14074919, 21964432, 8235257}, + FieldElement{-6528613, -2411497, 9442966, -5925588, 12025640, -1487420, -2981514, -1669206, 13006806, 2355433}, + FieldElement{-16304899, -13605259, -6632427, -5142349, 16974359, -10911083, 27202044, 1719366, 1141648, -12796236}, + }, + { + FieldElement{-12863944, -13219986, -8318266, -11018091, -6810145, -4843894, 13475066, -3133972, 32674895, 13715045}, + FieldElement{11423335, -5468059, 32344216, 8962751, 24989809, 9241752, -13265253, 16086212, -28740881, -15642093}, + FieldElement{-1409668, 12530728, -6368726, 10847387, 19531186, -14132160, -11709148, 7791794, -27245943, 4383347}, + }, + }, + { + { + FieldElement{-28970898, 5271447, -1266009, -9736989, -12455236, 16732599, -4862407, -4906449, 27193557, 6245191}, + FieldElement{-15193956, 5362278, -1783893, 2695834, 4960227, 12840725, 23061898, 3260492, 22510453, 8577507}, + FieldElement{-12632451, 11257346, -32692994, 13548177, -721004, 10879011, 31168030, 13952092, -29571492, -3635906}, + }, + { + FieldElement{3877321, -9572739, 32416692, 5405324, -11004407, -13656635, 3759769, 11935320, 5611860, 8164018}, + FieldElement{-16275802, 14667797, 15906460, 12155291, -22111149, -9039718, 32003002, -8832289, 5773085, -8422109}, + FieldElement{-23788118, -8254300, 1950875, 8937633, 18686727, 16459170, -905725, 12376320, 31632953, 190926}, + }, + { + FieldElement{-24593607, -16138885, -8423991, 13378746, 14162407, 6901328, -8288749, 4508564, -25341555, -3627528}, + FieldElement{8884438, -5884009, 6023974, 10104341, -6881569, -4941533, 18722941, -14786005, -1672488, 827625}, + FieldElement{-32720583, -16289296, -32503547, 7101210, 13354605, 2659080, -1800575, -14108036, -24878478, 1541286}, + }, + { + FieldElement{2901347, -1117687, 3880376, -10059388, -17620940, -3612781, -21802117, -3567481, 20456845, -1885033}, + FieldElement{27019610, 12299467, -13658288, -1603234, -12861660, -4861471, -19540150, -5016058, 29439641, 15138866}, + FieldElement{21536104, -6626420, -32447818, -10690208, -22408077, 5175814, -5420040, -16361163, 7779328, 109896}, + }, + { + FieldElement{30279744, 14648750, -8044871, 6425558, 13639621, -743509, 28698390, 12180118, 23177719, -554075}, + FieldElement{26572847, 3405927, -31701700, 12890905, -19265668, 5335866, -6493768, 2378492, 4439158, -13279347}, + FieldElement{-22716706, 3489070, -9225266, -332753, 18875722, -1140095, 14819434, -12731527, -17717757, -5461437}, + }, + { + FieldElement{-5056483, 16566551, 15953661, 3767752, -10436499, 15627060, -820954, 2177225, 8550082, -15114165}, + FieldElement{-18473302, 16596775, -381660, 15663611, 22860960, 15585581, -27844109, -3582739, -23260460, -8428588}, + FieldElement{-32480551, 15707275, -8205912, -5652081, 29464558, 2713815, -22725137, 15860482, -21902570, 1494193}, + }, + { + FieldElement{-19562091, -14087393, -25583872, -9299552, 13127842, 759709, 21923482, 16529112, 8742704, 12967017}, + FieldElement{-28464899, 1553205, 32536856, -10473729, -24691605, -406174, -8914625, -2933896, -29903758, 15553883}, + FieldElement{21877909, 3230008, 9881174, 10539357, -4797115, 2841332, 11543572, 14513274, 19375923, -12647961}, + }, + { + FieldElement{8832269, -14495485, 13253511, 5137575, 5037871, 4078777, 24880818, -6222716, 2862653, 9455043}, + FieldElement{29306751, 5123106, 20245049, -14149889, 9592566, 8447059, -2077124, -2990080, 15511449, 4789663}, + FieldElement{-20679756, 7004547, 8824831, -9434977, -4045704, -3750736, -5754762, 108893, 23513200, 16652362}, + }, + }, + { + { + FieldElement{-33256173, 4144782, -4476029, -6579123, 10770039, -7155542, -6650416, -12936300, -18319198, 10212860}, + FieldElement{2756081, 8598110, 7383731, -6859892, 22312759, -1105012, 21179801, 2600940, -9988298, -12506466}, + FieldElement{-24645692, 13317462, -30449259, -15653928, 21365574, -10869657, 11344424, 864440, -2499677, -16710063}, + }, + { + FieldElement{-26432803, 6148329, -17184412, -14474154, 18782929, -275997, -22561534, 211300, 2719757, 4940997}, + FieldElement{-1323882, 3911313, -6948744, 14759765, -30027150, 7851207, 21690126, 8518463, 26699843, 5276295}, + FieldElement{-13149873, -6429067, 9396249, 365013, 24703301, -10488939, 1321586, 149635, -15452774, 7159369}, + }, + { + FieldElement{9987780, -3404759, 17507962, 9505530, 9731535, -2165514, 22356009, 8312176, 22477218, -8403385}, + FieldElement{18155857, -16504990, 19744716, 9006923, 15154154, -10538976, 24256460, -4864995, -22548173, 9334109}, + FieldElement{2986088, -4911893, 10776628, -3473844, 10620590, -7083203, -21413845, 14253545, -22587149, 536906}, + }, + { + FieldElement{4377756, 8115836, 24567078, 15495314, 11625074, 13064599, 7390551, 10589625, 10838060, -15420424}, + FieldElement{-19342404, 867880, 9277171, -3218459, -14431572, -1986443, 19295826, -15796950, 6378260, 699185}, + FieldElement{7895026, 4057113, -7081772, -13077756, -17886831, -323126, -716039, 15693155, -5045064, -13373962}, + }, + { + FieldElement{-7737563, -5869402, -14566319, -7406919, 11385654, 13201616, 31730678, -10962840, -3918636, -9669325}, + FieldElement{10188286, -15770834, -7336361, 13427543, 22223443, 14896287, 30743455, 7116568, -21786507, 5427593}, + FieldElement{696102, 13206899, 27047647, -10632082, 15285305, -9853179, 10798490, -4578720, 19236243, 12477404}, + }, + { + FieldElement{-11229439, 11243796, -17054270, -8040865, -788228, -8167967, -3897669, 11180504, -23169516, 7733644}, + FieldElement{17800790, -14036179, -27000429, -11766671, 23887827, 3149671, 23466177, -10538171, 10322027, 15313801}, + FieldElement{26246234, 11968874, 32263343, -5468728, 6830755, -13323031, -15794704, -101982, -24449242, 10890804}, + }, + { + FieldElement{-31365647, 10271363, -12660625, -6267268, 16690207, -13062544, -14982212, 16484931, 25180797, -5334884}, + FieldElement{-586574, 10376444, -32586414, -11286356, 19801893, 10997610, 2276632, 9482883, 316878, 13820577}, + FieldElement{-9882808, -4510367, -2115506, 16457136, -11100081, 11674996, 30756178, -7515054, 30696930, -3712849}, + }, + { + FieldElement{32988917, -9603412, 12499366, 7910787, -10617257, -11931514, -7342816, -9985397, -32349517, 7392473}, + FieldElement{-8855661, 15927861, 9866406, -3649411, -2396914, -16655781, -30409476, -9134995, 25112947, -2926644}, + FieldElement{-2504044, -436966, 25621774, -5678772, 15085042, -5479877, -24884878, -13526194, 5537438, -13914319}, + }, + }, + { + { + FieldElement{-11225584, 2320285, -9584280, 10149187, -33444663, 5808648, -14876251, -1729667, 31234590, 6090599}, + FieldElement{-9633316, 116426, 26083934, 2897444, -6364437, -2688086, 609721, 15878753, -6970405, -9034768}, + FieldElement{-27757857, 247744, -15194774, -9002551, 23288161, -10011936, -23869595, 6503646, 20650474, 1804084}, + }, + { + FieldElement{-27589786, 15456424, 8972517, 8469608, 15640622, 4439847, 3121995, -10329713, 27842616, -202328}, + FieldElement{-15306973, 2839644, 22530074, 10026331, 4602058, 5048462, 28248656, 5031932, -11375082, 12714369}, + FieldElement{20807691, -7270825, 29286141, 11421711, -27876523, -13868230, -21227475, 1035546, -19733229, 12796920}, + }, + { + FieldElement{12076899, -14301286, -8785001, -11848922, -25012791, 16400684, -17591495, -12899438, 3480665, -15182815}, + FieldElement{-32361549, 5457597, 28548107, 7833186, 7303070, -11953545, -24363064, -15921875, -33374054, 2771025}, + FieldElement{-21389266, 421932, 26597266, 6860826, 22486084, -6737172, -17137485, -4210226, -24552282, 15673397}, + }, + { + FieldElement{-20184622, 2338216, 19788685, -9620956, -4001265, -8740893, -20271184, 4733254, 3727144, -12934448}, + FieldElement{6120119, 814863, -11794402, -622716, 6812205, -15747771, 2019594, 7975683, 31123697, -10958981}, + FieldElement{30069250, -11435332, 30434654, 2958439, 18399564, -976289, 12296869, 9204260, -16432438, 9648165}, + }, + { + FieldElement{32705432, -1550977, 30705658, 7451065, -11805606, 9631813, 3305266, 5248604, -26008332, -11377501}, + FieldElement{17219865, 2375039, -31570947, -5575615, -19459679, 9219903, 294711, 15298639, 2662509, -16297073}, + FieldElement{-1172927, -7558695, -4366770, -4287744, -21346413, -8434326, 32087529, -1222777, 32247248, -14389861}, + }, + { + FieldElement{14312628, 1221556, 17395390, -8700143, -4945741, -8684635, -28197744, -9637817, -16027623, -13378845}, + FieldElement{-1428825, -9678990, -9235681, 6549687, -7383069, -468664, 23046502, 9803137, 17597934, 2346211}, + FieldElement{18510800, 15337574, 26171504, 981392, -22241552, 7827556, -23491134, -11323352, 3059833, -11782870}, + }, + { + FieldElement{10141598, 6082907, 17829293, -1947643, 9830092, 13613136, -25556636, -5544586, -33502212, 3592096}, + FieldElement{33114168, -15889352, -26525686, -13343397, 33076705, 8716171, 1151462, 1521897, -982665, -6837803}, + FieldElement{-32939165, -4255815, 23947181, -324178, -33072974, -12305637, -16637686, 3891704, 26353178, 693168}, + }, + { + FieldElement{30374239, 1595580, -16884039, 13186931, 4600344, 406904, 9585294, -400668, 31375464, 14369965}, + FieldElement{-14370654, -7772529, 1510301, 6434173, -18784789, -6262728, 32732230, -13108839, 17901441, 16011505}, + FieldElement{18171223, -11934626, -12500402, 15197122, -11038147, -15230035, -19172240, -16046376, 8764035, 12309598}, + }, + }, + { + { + FieldElement{5975908, -5243188, -19459362, -9681747, -11541277, 14015782, -23665757, 1228319, 17544096, -10593782}, + FieldElement{5811932, -1715293, 3442887, -2269310, -18367348, -8359541, -18044043, -15410127, -5565381, 12348900}, + FieldElement{-31399660, 11407555, 25755363, 6891399, -3256938, 14872274, -24849353, 8141295, -10632534, -585479}, + }, + { + FieldElement{-12675304, 694026, -5076145, 13300344, 14015258, -14451394, -9698672, -11329050, 30944593, 1130208}, + FieldElement{8247766, -6710942, -26562381, -7709309, -14401939, -14648910, 4652152, 2488540, 23550156, -271232}, + FieldElement{17294316, -3788438, 7026748, 15626851, 22990044, 113481, 2267737, -5908146, -408818, -137719}, + }, + { + FieldElement{16091085, -16253926, 18599252, 7340678, 2137637, -1221657, -3364161, 14550936, 3260525, -7166271}, + FieldElement{-4910104, -13332887, 18550887, 10864893, -16459325, -7291596, -23028869, -13204905, -12748722, 2701326}, + FieldElement{-8574695, 16099415, 4629974, -16340524, -20786213, -6005432, -10018363, 9276971, 11329923, 1862132}, + }, + { + FieldElement{14763076, -15903608, -30918270, 3689867, 3511892, 10313526, -21951088, 12219231, -9037963, -940300}, + FieldElement{8894987, -3446094, 6150753, 3013931, 301220, 15693451, -31981216, -2909717, -15438168, 11595570}, + FieldElement{15214962, 3537601, -26238722, -14058872, 4418657, -15230761, 13947276, 10730794, -13489462, -4363670}, + }, + { + FieldElement{-2538306, 7682793, 32759013, 263109, -29984731, -7955452, -22332124, -10188635, 977108, 699994}, + FieldElement{-12466472, 4195084, -9211532, 550904, -15565337, 12917920, 19118110, -439841, -30534533, -14337913}, + FieldElement{31788461, -14507657, 4799989, 7372237, 8808585, -14747943, 9408237, -10051775, 12493932, -5409317}, + }, + { + FieldElement{-25680606, 5260744, -19235809, -6284470, -3695942, 16566087, 27218280, 2607121, 29375955, 6024730}, + FieldElement{842132, -2794693, -4763381, -8722815, 26332018, -12405641, 11831880, 6985184, -9940361, 2854096}, + FieldElement{-4847262, -7969331, 2516242, -5847713, 9695691, -7221186, 16512645, 960770, 12121869, 16648078}, + }, + { + FieldElement{-15218652, 14667096, -13336229, 2013717, 30598287, -464137, -31504922, -7882064, 20237806, 2838411}, + FieldElement{-19288047, 4453152, 15298546, -16178388, 22115043, -15972604, 12544294, -13470457, 1068881, -12499905}, + FieldElement{-9558883, -16518835, 33238498, 13506958, 30505848, -1114596, -8486907, -2630053, 12521378, 4845654}, + }, + { + FieldElement{-28198521, 10744108, -2958380, 10199664, 7759311, -13088600, 3409348, -873400, -6482306, -12885870}, + FieldElement{-23561822, 6230156, -20382013, 10655314, -24040585, -11621172, 10477734, -1240216, -3113227, 13974498}, + FieldElement{12966261, 15550616, -32038948, -1615346, 21025980, -629444, 5642325, 7188737, 18895762, 12629579}, + }, + }, + { + { + FieldElement{14741879, -14946887, 22177208, -11721237, 1279741, 8058600, 11758140, 789443, 32195181, 3895677}, + FieldElement{10758205, 15755439, -4509950, 9243698, -4879422, 6879879, -2204575, -3566119, -8982069, 4429647}, + FieldElement{-2453894, 15725973, -20436342, -10410672, -5803908, -11040220, -7135870, -11642895, 18047436, -15281743}, + }, + { + FieldElement{-25173001, -11307165, 29759956, 11776784, -22262383, -15820455, 10993114, -12850837, -17620701, -9408468}, + FieldElement{21987233, 700364, -24505048, 14972008, -7774265, -5718395, 32155026, 2581431, -29958985, 8773375}, + FieldElement{-25568350, 454463, -13211935, 16126715, 25240068, 8594567, 20656846, 12017935, -7874389, -13920155}, + }, + { + FieldElement{6028182, 6263078, -31011806, -11301710, -818919, 2461772, -31841174, -5468042, -1721788, -2776725}, + FieldElement{-12278994, 16624277, 987579, -5922598, 32908203, 1248608, 7719845, -4166698, 28408820, 6816612}, + FieldElement{-10358094, -8237829, 19549651, -12169222, 22082623, 16147817, 20613181, 13982702, -10339570, 5067943}, + }, + { + FieldElement{-30505967, -3821767, 12074681, 13582412, -19877972, 2443951, -19719286, 12746132, 5331210, -10105944}, + FieldElement{30528811, 3601899, -1957090, 4619785, -27361822, -15436388, 24180793, -12570394, 27679908, -1648928}, + FieldElement{9402404, -13957065, 32834043, 10838634, -26580150, -13237195, 26653274, -8685565, 22611444, -12715406}, + }, + { + FieldElement{22190590, 1118029, 22736441, 15130463, -30460692, -5991321, 19189625, -4648942, 4854859, 6622139}, + FieldElement{-8310738, -2953450, -8262579, -3388049, -10401731, -271929, 13424426, -3567227, 26404409, 13001963}, + FieldElement{-31241838, -15415700, -2994250, 8939346, 11562230, -12840670, -26064365, -11621720, -15405155, 11020693}, + }, + { + FieldElement{1866042, -7949489, -7898649, -10301010, 12483315, 13477547, 3175636, -12424163, 28761762, 1406734}, + FieldElement{-448555, -1777666, 13018551, 3194501, -9580420, -11161737, 24760585, -4347088, 25577411, -13378680}, + FieldElement{-24290378, 4759345, -690653, -1852816, 2066747, 10693769, -29595790, 9884936, -9368926, 4745410}, + }, + { + FieldElement{-9141284, 6049714, -19531061, -4341411, -31260798, 9944276, -15462008, -11311852, 10931924, -11931931}, + FieldElement{-16561513, 14112680, -8012645, 4817318, -8040464, -11414606, -22853429, 10856641, -20470770, 13434654}, + FieldElement{22759489, -10073434, -16766264, -1871422, 13637442, -10168091, 1765144, -12654326, 28445307, -5364710}, + }, + { + FieldElement{29875063, 12493613, 2795536, -3786330, 1710620, 15181182, -10195717, -8788675, 9074234, 1167180}, + FieldElement{-26205683, 11014233, -9842651, -2635485, -26908120, 7532294, -18716888, -9535498, 3843903, 9367684}, + FieldElement{-10969595, -6403711, 9591134, 9582310, 11349256, 108879, 16235123, 8601684, -139197, 4242895}, + }, + }, + { + { + FieldElement{22092954, -13191123, -2042793, -11968512, 32186753, -11517388, -6574341, 2470660, -27417366, 16625501}, + FieldElement{-11057722, 3042016, 13770083, -9257922, 584236, -544855, -7770857, 2602725, -27351616, 14247413}, + FieldElement{6314175, -10264892, -32772502, 15957557, -10157730, 168750, -8618807, 14290061, 27108877, -1180880}, + }, + { + FieldElement{-8586597, -7170966, 13241782, 10960156, -32991015, -13794596, 33547976, -11058889, -27148451, 981874}, + FieldElement{22833440, 9293594, -32649448, -13618667, -9136966, 14756819, -22928859, -13970780, -10479804, -16197962}, + FieldElement{-7768587, 3326786, -28111797, 10783824, 19178761, 14905060, 22680049, 13906969, -15933690, 3797899}, + }, + { + FieldElement{21721356, -4212746, -12206123, 9310182, -3882239, -13653110, 23740224, -2709232, 20491983, -8042152}, + FieldElement{9209270, -15135055, -13256557, -6167798, -731016, 15289673, 25947805, 15286587, 30997318, -6703063}, + FieldElement{7392032, 16618386, 23946583, -8039892, -13265164, -1533858, -14197445, -2321576, 17649998, -250080}, + }, + { + FieldElement{-9301088, -14193827, 30609526, -3049543, -25175069, -1283752, -15241566, -9525724, -2233253, 7662146}, + FieldElement{-17558673, 1763594, -33114336, 15908610, -30040870, -12174295, 7335080, -8472199, -3174674, 3440183}, + FieldElement{-19889700, -5977008, -24111293, -9688870, 10799743, -16571957, 40450, -4431835, 4862400, 1133}, + }, + { + FieldElement{-32856209, -7873957, -5422389, 14860950, -16319031, 7956142, 7258061, 311861, -30594991, -7379421}, + FieldElement{-3773428, -1565936, 28985340, 7499440, 24445838, 9325937, 29727763, 16527196, 18278453, 15405622}, + FieldElement{-4381906, 8508652, -19898366, -3674424, -5984453, 15149970, -13313598, 843523, -21875062, 13626197}, + }, + { + FieldElement{2281448, -13487055, -10915418, -2609910, 1879358, 16164207, -10783882, 3953792, 13340839, 15928663}, + FieldElement{31727126, -7179855, -18437503, -8283652, 2875793, -16390330, -25269894, -7014826, -23452306, 5964753}, + FieldElement{4100420, -5959452, -17179337, 6017714, -18705837, 12227141, -26684835, 11344144, 2538215, -7570755}, + }, + { + FieldElement{-9433605, 6123113, 11159803, -2156608, 30016280, 14966241, -20474983, 1485421, -629256, -15958862}, + FieldElement{-26804558, 4260919, 11851389, 9658551, -32017107, 16367492, -20205425, -13191288, 11659922, -11115118}, + FieldElement{26180396, 10015009, -30844224, -8581293, 5418197, 9480663, 2231568, -10170080, 33100372, -1306171}, + }, + { + FieldElement{15121113, -5201871, -10389905, 15427821, -27509937, -15992507, 21670947, 4486675, -5931810, -14466380}, + FieldElement{16166486, -9483733, -11104130, 6023908, -31926798, -1364923, 2340060, -16254968, -10735770, -10039824}, + FieldElement{28042865, -3557089, -12126526, 12259706, -3717498, -6945899, 6766453, -8689599, 18036436, 5803270}, + }, + }, + { + { + FieldElement{-817581, 6763912, 11803561, 1585585, 10958447, -2671165, 23855391, 4598332, -6159431, -14117438}, + FieldElement{-31031306, -14256194, 17332029, -2383520, 31312682, -5967183, 696309, 50292, -20095739, 11763584}, + FieldElement{-594563, -2514283, -32234153, 12643980, 12650761, 14811489, 665117, -12613632, -19773211, -10713562}, + }, + { + FieldElement{30464590, -11262872, -4127476, -12734478, 19835327, -7105613, -24396175, 2075773, -17020157, 992471}, + FieldElement{18357185, -6994433, 7766382, 16342475, -29324918, 411174, 14578841, 8080033, -11574335, -10601610}, + FieldElement{19598397, 10334610, 12555054, 2555664, 18821899, -10339780, 21873263, 16014234, 26224780, 16452269}, + }, + { + FieldElement{-30223925, 5145196, 5944548, 16385966, 3976735, 2009897, -11377804, -7618186, -20533829, 3698650}, + FieldElement{14187449, 3448569, -10636236, -10810935, -22663880, -3433596, 7268410, -10890444, 27394301, 12015369}, + FieldElement{19695761, 16087646, 28032085, 12999827, 6817792, 11427614, 20244189, -1312777, -13259127, -3402461}, + }, + { + FieldElement{30860103, 12735208, -1888245, -4699734, -16974906, 2256940, -8166013, 12298312, -8550524, -10393462}, + FieldElement{-5719826, -11245325, -1910649, 15569035, 26642876, -7587760, -5789354, -15118654, -4976164, 12651793}, + FieldElement{-2848395, 9953421, 11531313, -5282879, 26895123, -12697089, -13118820, -16517902, 9768698, -2533218}, + }, + { + FieldElement{-24719459, 1894651, -287698, -4704085, 15348719, -8156530, 32767513, 12765450, 4940095, 10678226}, + FieldElement{18860224, 15980149, -18987240, -1562570, -26233012, -11071856, -7843882, 13944024, -24372348, 16582019}, + FieldElement{-15504260, 4970268, -29893044, 4175593, -20993212, -2199756, -11704054, 15444560, -11003761, 7989037}, + }, + { + FieldElement{31490452, 5568061, -2412803, 2182383, -32336847, 4531686, -32078269, 6200206, -19686113, -14800171}, + FieldElement{-17308668, -15879940, -31522777, -2831, -32887382, 16375549, 8680158, -16371713, 28550068, -6857132}, + FieldElement{-28126887, -5688091, 16837845, -1820458, -6850681, 12700016, -30039981, 4364038, 1155602, 5988841}, + }, + { + FieldElement{21890435, -13272907, -12624011, 12154349, -7831873, 15300496, 23148983, -4470481, 24618407, 8283181}, + FieldElement{-33136107, -10512751, 9975416, 6841041, -31559793, 16356536, 3070187, -7025928, 1466169, 10740210}, + FieldElement{-1509399, -15488185, -13503385, -10655916, 32799044, 909394, -13938903, -5779719, -32164649, -15327040}, + }, + { + FieldElement{3960823, -14267803, -28026090, -15918051, -19404858, 13146868, 15567327, 951507, -3260321, -573935}, + FieldElement{24740841, 5052253, -30094131, 8961361, 25877428, 6165135, -24368180, 14397372, -7380369, -6144105}, + FieldElement{-28888365, 3510803, -28103278, -1158478, -11238128, -10631454, -15441463, -14453128, -1625486, -6494814}, + }, + }, + { + { + FieldElement{793299, -9230478, 8836302, -6235707, -27360908, -2369593, 33152843, -4885251, -9906200, -621852}, + FieldElement{5666233, 525582, 20782575, -8038419, -24538499, 14657740, 16099374, 1468826, -6171428, -15186581}, + FieldElement{-4859255, -3779343, -2917758, -6748019, 7778750, 11688288, -30404353, -9871238, -1558923, -9863646}, + }, + { + FieldElement{10896332, -7719704, 824275, 472601, -19460308, 3009587, 25248958, 14783338, -30581476, -15757844}, + FieldElement{10566929, 12612572, -31944212, 11118703, -12633376, 12362879, 21752402, 8822496, 24003793, 14264025}, + FieldElement{27713862, -7355973, -11008240, 9227530, 27050101, 2504721, 23886875, -13117525, 13958495, -5732453}, + }, + { + FieldElement{-23481610, 4867226, -27247128, 3900521, 29838369, -8212291, -31889399, -10041781, 7340521, -15410068}, + FieldElement{4646514, -8011124, -22766023, -11532654, 23184553, 8566613, 31366726, -1381061, -15066784, -10375192}, + FieldElement{-17270517, 12723032, -16993061, 14878794, 21619651, -6197576, 27584817, 3093888, -8843694, 3849921}, + }, + { + FieldElement{-9064912, 2103172, 25561640, -15125738, -5239824, 9582958, 32477045, -9017955, 5002294, -15550259}, + FieldElement{-12057553, -11177906, 21115585, -13365155, 8808712, -12030708, 16489530, 13378448, -25845716, 12741426}, + FieldElement{-5946367, 10645103, -30911586, 15390284, -3286982, -7118677, 24306472, 15852464, 28834118, -7646072}, + }, + { + FieldElement{-17335748, -9107057, -24531279, 9434953, -8472084, -583362, -13090771, 455841, 20461858, 5491305}, + FieldElement{13669248, -16095482, -12481974, -10203039, -14569770, -11893198, -24995986, 11293807, -28588204, -9421832}, + FieldElement{28497928, 6272777, -33022994, 14470570, 8906179, -1225630, 18504674, -14165166, 29867745, -8795943}, + }, + { + FieldElement{-16207023, 13517196, -27799630, -13697798, 24009064, -6373891, -6367600, -13175392, 22853429, -4012011}, + FieldElement{24191378, 16712145, -13931797, 15217831, 14542237, 1646131, 18603514, -11037887, 12876623, -2112447}, + FieldElement{17902668, 4518229, -411702, -2829247, 26878217, 5258055, -12860753, 608397, 16031844, 3723494}, + }, + { + FieldElement{-28632773, 12763728, -20446446, 7577504, 33001348, -13017745, 17558842, -7872890, 23896954, -4314245}, + FieldElement{-20005381, -12011952, 31520464, 605201, 2543521, 5991821, -2945064, 7229064, -9919646, -8826859}, + FieldElement{28816045, 298879, -28165016, -15920938, 19000928, -1665890, -12680833, -2949325, -18051778, -2082915}, + }, + { + FieldElement{16000882, -344896, 3493092, -11447198, -29504595, -13159789, 12577740, 16041268, -19715240, 7847707}, + FieldElement{10151868, 10572098, 27312476, 7922682, 14825339, 4723128, -32855931, -6519018, -10020567, 3852848}, + FieldElement{-11430470, 15697596, -21121557, -4420647, 5386314, 15063598, 16514493, -15932110, 29330899, -15076224}, + }, + }, + { + { + FieldElement{-25499735, -4378794, -15222908, -6901211, 16615731, 2051784, 3303702, 15490, -27548796, 12314391}, + FieldElement{15683520, -6003043, 18109120, -9980648, 15337968, -5997823, -16717435, 15921866, 16103996, -3731215}, + FieldElement{-23169824, -10781249, 13588192, -1628807, -3798557, -1074929, -19273607, 5402699, -29815713, -9841101}, + }, + { + FieldElement{23190676, 2384583, -32714340, 3462154, -29903655, -1529132, -11266856, 8911517, -25205859, 2739713}, + FieldElement{21374101, -3554250, -33524649, 9874411, 15377179, 11831242, -33529904, 6134907, 4931255, 11987849}, + FieldElement{-7732, -2978858, -16223486, 7277597, 105524, -322051, -31480539, 13861388, -30076310, 10117930}, + }, + { + FieldElement{-29501170, -10744872, -26163768, 13051539, -25625564, 5089643, -6325503, 6704079, 12890019, 15728940}, + FieldElement{-21972360, -11771379, -951059, -4418840, 14704840, 2695116, 903376, -10428139, 12885167, 8311031}, + FieldElement{-17516482, 5352194, 10384213, -13811658, 7506451, 13453191, 26423267, 4384730, 1888765, -5435404}, + }, + { + FieldElement{-25817338, -3107312, -13494599, -3182506, 30896459, -13921729, -32251644, -12707869, -19464434, -3340243}, + FieldElement{-23607977, -2665774, -526091, 4651136, 5765089, 4618330, 6092245, 14845197, 17151279, -9854116}, + FieldElement{-24830458, -12733720, -15165978, 10367250, -29530908, -265356, 22825805, -7087279, -16866484, 16176525}, + }, + { + FieldElement{-23583256, 6564961, 20063689, 3798228, -4740178, 7359225, 2006182, -10363426, -28746253, -10197509}, + FieldElement{-10626600, -4486402, -13320562, -5125317, 3432136, -6393229, 23632037, -1940610, 32808310, 1099883}, + FieldElement{15030977, 5768825, -27451236, -2887299, -6427378, -15361371, -15277896, -6809350, 2051441, -15225865}, + }, + { + FieldElement{-3362323, -7239372, 7517890, 9824992, 23555850, 295369, 5148398, -14154188, -22686354, 16633660}, + FieldElement{4577086, -16752288, 13249841, -15304328, 19958763, -14537274, 18559670, -10759549, 8402478, -9864273}, + FieldElement{-28406330, -1051581, -26790155, -907698, -17212414, -11030789, 9453451, -14980072, 17983010, 9967138}, + }, + { + FieldElement{-25762494, 6524722, 26585488, 9969270, 24709298, 1220360, -1677990, 7806337, 17507396, 3651560}, + FieldElement{-10420457, -4118111, 14584639, 15971087, -15768321, 8861010, 26556809, -5574557, -18553322, -11357135}, + FieldElement{2839101, 14284142, 4029895, 3472686, 14402957, 12689363, -26642121, 8459447, -5605463, -7621941}, + }, + { + FieldElement{-4839289, -3535444, 9744961, 2871048, 25113978, 3187018, -25110813, -849066, 17258084, -7977739}, + FieldElement{18164541, -10595176, -17154882, -1542417, 19237078, -9745295, 23357533, -15217008, 26908270, 12150756}, + FieldElement{-30264870, -7647865, 5112249, -7036672, -1499807, -6974257, 43168, -5537701, -32302074, 16215819}, + }, + }, + { + { + FieldElement{-6898905, 9824394, -12304779, -4401089, -31397141, -6276835, 32574489, 12532905, -7503072, -8675347}, + FieldElement{-27343522, -16515468, -27151524, -10722951, 946346, 16291093, 254968, 7168080, 21676107, -1943028}, + FieldElement{21260961, -8424752, -16831886, -11920822, -23677961, 3968121, -3651949, -6215466, -3556191, -7913075}, + }, + { + FieldElement{16544754, 13250366, -16804428, 15546242, -4583003, 12757258, -2462308, -8680336, -18907032, -9662799}, + FieldElement{-2415239, -15577728, 18312303, 4964443, -15272530, -12653564, 26820651, 16690659, 25459437, -4564609}, + FieldElement{-25144690, 11425020, 28423002, -11020557, -6144921, -15826224, 9142795, -2391602, -6432418, -1644817}, + }, + { + FieldElement{-23104652, 6253476, 16964147, -3768872, -25113972, -12296437, -27457225, -16344658, 6335692, 7249989}, + FieldElement{-30333227, 13979675, 7503222, -12368314, -11956721, -4621693, -30272269, 2682242, 25993170, -12478523}, + FieldElement{4364628, 5930691, 32304656, -10044554, -8054781, 15091131, 22857016, -10598955, 31820368, 15075278}, + }, + { + FieldElement{31879134, -8918693, 17258761, 90626, -8041836, -4917709, 24162788, -9650886, -17970238, 12833045}, + FieldElement{19073683, 14851414, -24403169, -11860168, 7625278, 11091125, -19619190, 2074449, -9413939, 14905377}, + FieldElement{24483667, -11935567, -2518866, -11547418, -1553130, 15355506, -25282080, 9253129, 27628530, -7555480}, + }, + { + FieldElement{17597607, 8340603, 19355617, 552187, 26198470, -3176583, 4593324, -9157582, -14110875, 15297016}, + FieldElement{510886, 14337390, -31785257, 16638632, 6328095, 2713355, -20217417, -11864220, 8683221, 2921426}, + FieldElement{18606791, 11874196, 27155355, -5281482, -24031742, 6265446, -25178240, -1278924, 4674690, 13890525}, + }, + { + FieldElement{13609624, 13069022, -27372361, -13055908, 24360586, 9592974, 14977157, 9835105, 4389687, 288396}, + FieldElement{9922506, -519394, 13613107, 5883594, -18758345, -434263, -12304062, 8317628, 23388070, 16052080}, + FieldElement{12720016, 11937594, -31970060, -5028689, 26900120, 8561328, -20155687, -11632979, -14754271, -10812892}, + }, + { + FieldElement{15961858, 14150409, 26716931, -665832, -22794328, 13603569, 11829573, 7467844, -28822128, 929275}, + FieldElement{11038231, -11582396, -27310482, -7316562, -10498527, -16307831, -23479533, -9371869, -21393143, 2465074}, + FieldElement{20017163, -4323226, 27915242, 1529148, 12396362, 15675764, 13817261, -9658066, 2463391, -4622140}, + }, + { + FieldElement{-16358878, -12663911, -12065183, 4996454, -1256422, 1073572, 9583558, 12851107, 4003896, 12673717}, + FieldElement{-1731589, -15155870, -3262930, 16143082, 19294135, 13385325, 14741514, -9103726, 7903886, 2348101}, + FieldElement{24536016, -16515207, 12715592, -3862155, 1511293, 10047386, -3842346, -7129159, -28377538, 10048127}, + }, + }, + { + { + FieldElement{-12622226, -6204820, 30718825, 2591312, -10617028, 12192840, 18873298, -7297090, -32297756, 15221632}, + FieldElement{-26478122, -11103864, 11546244, -1852483, 9180880, 7656409, -21343950, 2095755, 29769758, 6593415}, + FieldElement{-31994208, -2907461, 4176912, 3264766, 12538965, -868111, 26312345, -6118678, 30958054, 8292160}, + }, + { + FieldElement{31429822, -13959116, 29173532, 15632448, 12174511, -2760094, 32808831, 3977186, 26143136, -3148876}, + FieldElement{22648901, 1402143, -22799984, 13746059, 7936347, 365344, -8668633, -1674433, -3758243, -2304625}, + FieldElement{-15491917, 8012313, -2514730, -12702462, -23965846, -10254029, -1612713, -1535569, -16664475, 8194478}, + }, + { + FieldElement{27338066, -7507420, -7414224, 10140405, -19026427, -6589889, 27277191, 8855376, 28572286, 3005164}, + FieldElement{26287124, 4821776, 25476601, -4145903, -3764513, -15788984, -18008582, 1182479, -26094821, -13079595}, + FieldElement{-7171154, 3178080, 23970071, 6201893, -17195577, -4489192, -21876275, -13982627, 32208683, -1198248}, + }, + { + FieldElement{-16657702, 2817643, -10286362, 14811298, 6024667, 13349505, -27315504, -10497842, -27672585, -11539858}, + FieldElement{15941029, -9405932, -21367050, 8062055, 31876073, -238629, -15278393, -1444429, 15397331, -4130193}, + FieldElement{8934485, -13485467, -23286397, -13423241, -32446090, 14047986, 31170398, -1441021, -27505566, 15087184}, + }, + { + FieldElement{-18357243, -2156491, 24524913, -16677868, 15520427, -6360776, -15502406, 11461896, 16788528, -5868942}, + FieldElement{-1947386, 16013773, 21750665, 3714552, -17401782, -16055433, -3770287, -10323320, 31322514, -11615635}, + FieldElement{21426655, -5650218, -13648287, -5347537, -28812189, -4920970, -18275391, -14621414, 13040862, -12112948}, + }, + { + FieldElement{11293895, 12478086, -27136401, 15083750, -29307421, 14748872, 14555558, -13417103, 1613711, 4896935}, + FieldElement{-25894883, 15323294, -8489791, -8057900, 25967126, -13425460, 2825960, -4897045, -23971776, -11267415}, + FieldElement{-15924766, -5229880, -17443532, 6410664, 3622847, 10243618, 20615400, 12405433, -23753030, -8436416}, + }, + { + FieldElement{-7091295, 12556208, -20191352, 9025187, -17072479, 4333801, 4378436, 2432030, 23097949, -566018}, + FieldElement{4565804, -16025654, 20084412, -7842817, 1724999, 189254, 24767264, 10103221, -18512313, 2424778}, + FieldElement{366633, -11976806, 8173090, -6890119, 30788634, 5745705, -7168678, 1344109, -3642553, 12412659}, + }, + { + FieldElement{-24001791, 7690286, 14929416, -168257, -32210835, -13412986, 24162697, -15326504, -3141501, 11179385}, + FieldElement{18289522, -14724954, 8056945, 16430056, -21729724, 7842514, -6001441, -1486897, -18684645, -11443503}, + FieldElement{476239, 6601091, -6152790, -9723375, 17503545, -4863900, 27672959, 13403813, 11052904, 5219329}, + }, + }, + { + { + FieldElement{20678546, -8375738, -32671898, 8849123, -5009758, 14574752, 31186971, -3973730, 9014762, -8579056}, + FieldElement{-13644050, -10350239, -15962508, 5075808, -1514661, -11534600, -33102500, 9160280, 8473550, -3256838}, + FieldElement{24900749, 14435722, 17209120, -15292541, -22592275, 9878983, -7689309, -16335821, -24568481, 11788948}, + }, + { + FieldElement{-3118155, -11395194, -13802089, 14797441, 9652448, -6845904, -20037437, 10410733, -24568470, -1458691}, + FieldElement{-15659161, 16736706, -22467150, 10215878, -9097177, 7563911, 11871841, -12505194, -18513325, 8464118}, + FieldElement{-23400612, 8348507, -14585951, -861714, -3950205, -6373419, 14325289, 8628612, 33313881, -8370517}, + }, + { + FieldElement{-20186973, -4967935, 22367356, 5271547, -1097117, -4788838, -24805667, -10236854, -8940735, -5818269}, + FieldElement{-6948785, -1795212, -32625683, -16021179, 32635414, -7374245, 15989197, -12838188, 28358192, -4253904}, + FieldElement{-23561781, -2799059, -32351682, -1661963, -9147719, 10429267, -16637684, 4072016, -5351664, 5596589}, + }, + { + FieldElement{-28236598, -3390048, 12312896, 6213178, 3117142, 16078565, 29266239, 2557221, 1768301, 15373193}, + FieldElement{-7243358, -3246960, -4593467, -7553353, -127927, -912245, -1090902, -4504991, -24660491, 3442910}, + FieldElement{-30210571, 5124043, 14181784, 8197961, 18964734, -11939093, 22597931, 7176455, -18585478, 13365930}, + }, + { + FieldElement{-7877390, -1499958, 8324673, 4690079, 6261860, 890446, 24538107, -8570186, -9689599, -3031667}, + FieldElement{25008904, -10771599, -4305031, -9638010, 16265036, 15721635, 683793, -11823784, 15723479, -15163481}, + FieldElement{-9660625, 12374379, -27006999, -7026148, -7724114, -12314514, 11879682, 5400171, 519526, -1235876}, + }, + { + FieldElement{22258397, -16332233, -7869817, 14613016, -22520255, -2950923, -20353881, 7315967, 16648397, 7605640}, + FieldElement{-8081308, -8464597, -8223311, 9719710, 19259459, -15348212, 23994942, -5281555, -9468848, 4763278}, + FieldElement{-21699244, 9220969, -15730624, 1084137, -25476107, -2852390, 31088447, -7764523, -11356529, 728112}, + }, + { + FieldElement{26047220, -11751471, -6900323, -16521798, 24092068, 9158119, -4273545, -12555558, -29365436, -5498272}, + FieldElement{17510331, -322857, 5854289, 8403524, 17133918, -3112612, -28111007, 12327945, 10750447, 10014012}, + FieldElement{-10312768, 3936952, 9156313, -8897683, 16498692, -994647, -27481051, -666732, 3424691, 7540221}, + }, + { + FieldElement{30322361, -6964110, 11361005, -4143317, 7433304, 4989748, -7071422, -16317219, -9244265, 15258046}, + FieldElement{13054562, -2779497, 19155474, 469045, -12482797, 4566042, 5631406, 2711395, 1062915, -5136345}, + FieldElement{-19240248, -11254599, -29509029, -7499965, -5835763, 13005411, -6066489, 12194497, 32960380, 1459310}, + }, + }, + { + { + FieldElement{19852034, 7027924, 23669353, 10020366, 8586503, -6657907, 394197, -6101885, 18638003, -11174937}, + FieldElement{31395534, 15098109, 26581030, 8030562, -16527914, -5007134, 9012486, -7584354, -6643087, -5442636}, + FieldElement{-9192165, -2347377, -1997099, 4529534, 25766844, 607986, -13222, 9677543, -32294889, -6456008}, + }, + { + FieldElement{-2444496, -149937, 29348902, 8186665, 1873760, 12489863, -30934579, -7839692, -7852844, -8138429}, + FieldElement{-15236356, -15433509, 7766470, 746860, 26346930, -10221762, -27333451, 10754588, -9431476, 5203576}, + FieldElement{31834314, 14135496, -770007, 5159118, 20917671, -16768096, -7467973, -7337524, 31809243, 7347066}, + }, + { + FieldElement{-9606723, -11874240, 20414459, 13033986, 13716524, -11691881, 19797970, -12211255, 15192876, -2087490}, + FieldElement{-12663563, -2181719, 1168162, -3804809, 26747877, -14138091, 10609330, 12694420, 33473243, -13382104}, + FieldElement{33184999, 11180355, 15832085, -11385430, -1633671, 225884, 15089336, -11023903, -6135662, 14480053}, + }, + { + FieldElement{31308717, -5619998, 31030840, -1897099, 15674547, -6582883, 5496208, 13685227, 27595050, 8737275}, + FieldElement{-20318852, -15150239, 10933843, -16178022, 8335352, -7546022, -31008351, -12610604, 26498114, 66511}, + FieldElement{22644454, -8761729, -16671776, 4884562, -3105614, -13559366, 30540766, -4286747, -13327787, -7515095}, + }, + { + FieldElement{-28017847, 9834845, 18617207, -2681312, -3401956, -13307506, 8205540, 13585437, -17127465, 15115439}, + FieldElement{23711543, -672915, 31206561, -8362711, 6164647, -9709987, -33535882, -1426096, 8236921, 16492939}, + FieldElement{-23910559, -13515526, -26299483, -4503841, 25005590, -7687270, 19574902, 10071562, 6708380, -6222424}, + }, + { + FieldElement{2101391, -4930054, 19702731, 2367575, -15427167, 1047675, 5301017, 9328700, 29955601, -11678310}, + FieldElement{3096359, 9271816, -21620864, -15521844, -14847996, -7592937, -25892142, -12635595, -9917575, 6216608}, + FieldElement{-32615849, 338663, -25195611, 2510422, -29213566, -13820213, 24822830, -6146567, -26767480, 7525079}, + }, + { + FieldElement{-23066649, -13985623, 16133487, -7896178, -3389565, 778788, -910336, -2782495, -19386633, 11994101}, + FieldElement{21691500, -13624626, -641331, -14367021, 3285881, -3483596, -25064666, 9718258, -7477437, 13381418}, + FieldElement{18445390, -4202236, 14979846, 11622458, -1727110, -3582980, 23111648, -6375247, 28535282, 15779576}, + }, + { + FieldElement{30098053, 3089662, -9234387, 16662135, -21306940, 11308411, -14068454, 12021730, 9955285, -16303356}, + FieldElement{9734894, -14576830, -7473633, -9138735, 2060392, 11313496, -18426029, 9924399, 20194861, 13380996}, + FieldElement{-26378102, -7965207, -22167821, 15789297, -18055342, -6168792, -1984914, 15707771, 26342023, 10146099}, + }, + }, + { + { + FieldElement{-26016874, -219943, 21339191, -41388, 19745256, -2878700, -29637280, 2227040, 21612326, -545728}, + FieldElement{-13077387, 1184228, 23562814, -5970442, -20351244, -6348714, 25764461, 12243797, -20856566, 11649658}, + FieldElement{-10031494, 11262626, 27384172, 2271902, 26947504, -15997771, 39944, 6114064, 33514190, 2333242}, + }, + { + FieldElement{-21433588, -12421821, 8119782, 7219913, -21830522, -9016134, -6679750, -12670638, 24350578, -13450001}, + FieldElement{-4116307, -11271533, -23886186, 4843615, -30088339, 690623, -31536088, -10406836, 8317860, 12352766}, + FieldElement{18200138, -14475911, -33087759, -2696619, -23702521, -9102511, -23552096, -2287550, 20712163, 6719373}, + }, + { + FieldElement{26656208, 6075253, -7858556, 1886072, -28344043, 4262326, 11117530, -3763210, 26224235, -3297458}, + FieldElement{-17168938, -14854097, -3395676, -16369877, -19954045, 14050420, 21728352, 9493610, 18620611, -16428628}, + FieldElement{-13323321, 13325349, 11432106, 5964811, 18609221, 6062965, -5269471, -9725556, -30701573, -16479657}, + }, + { + FieldElement{-23860538, -11233159, 26961357, 1640861, -32413112, -16737940, 12248509, -5240639, 13735342, 1934062}, + FieldElement{25089769, 6742589, 17081145, -13406266, 21909293, -16067981, -15136294, -3765346, -21277997, 5473616}, + FieldElement{31883677, -7961101, 1083432, -11572403, 22828471, 13290673, -7125085, 12469656, 29111212, -5451014}, + }, + { + FieldElement{24244947, -15050407, -26262976, 2791540, -14997599, 16666678, 24367466, 6388839, -10295587, 452383}, + FieldElement{-25640782, -3417841, 5217916, 16224624, 19987036, -4082269, -24236251, -5915248, 15766062, 8407814}, + FieldElement{-20406999, 13990231, 15495425, 16395525, 5377168, 15166495, -8917023, -4388953, -8067909, 2276718}, + }, + { + FieldElement{30157918, 12924066, -17712050, 9245753, 19895028, 3368142, -23827587, 5096219, 22740376, -7303417}, + FieldElement{2041139, -14256350, 7783687, 13876377, -25946985, -13352459, 24051124, 13742383, -15637599, 13295222}, + FieldElement{33338237, -8505733, 12532113, 7977527, 9106186, -1715251, -17720195, -4612972, -4451357, -14669444}, + }, + { + FieldElement{-20045281, 5454097, -14346548, 6447146, 28862071, 1883651, -2469266, -4141880, 7770569, 9620597}, + FieldElement{23208068, 7979712, 33071466, 8149229, 1758231, -10834995, 30945528, -1694323, -33502340, -14767970}, + FieldElement{1439958, -16270480, -1079989, -793782, 4625402, 10647766, -5043801, 1220118, 30494170, -11440799}, + }, + { + FieldElement{-5037580, -13028295, -2970559, -3061767, 15640974, -6701666, -26739026, 926050, -1684339, -13333647}, + FieldElement{13908495, -3549272, 30919928, -6273825, -21521863, 7989039, 9021034, 9078865, 3353509, 4033511}, + FieldElement{-29663431, -15113610, 32259991, -344482, 24295849, -12912123, 23161163, 8839127, 27485041, 7356032}, + }, + }, + { + { + FieldElement{9661027, 705443, 11980065, -5370154, -1628543, 14661173, -6346142, 2625015, 28431036, -16771834}, + FieldElement{-23839233, -8311415, -25945511, 7480958, -17681669, -8354183, -22545972, 14150565, 15970762, 4099461}, + FieldElement{29262576, 16756590, 26350592, -8793563, 8529671, -11208050, 13617293, -9937143, 11465739, 8317062}, + }, + { + FieldElement{-25493081, -6962928, 32500200, -9419051, -23038724, -2302222, 14898637, 3848455, 20969334, -5157516}, + FieldElement{-20384450, -14347713, -18336405, 13884722, -33039454, 2842114, -21610826, -3649888, 11177095, 14989547}, + FieldElement{-24496721, -11716016, 16959896, 2278463, 12066309, 10137771, 13515641, 2581286, -28487508, 9930240}, + }, + { + FieldElement{-17751622, -2097826, 16544300, -13009300, -15914807, -14949081, 18345767, -13403753, 16291481, -5314038}, + FieldElement{-33229194, 2553288, 32678213, 9875984, 8534129, 6889387, -9676774, 6957617, 4368891, 9788741}, + FieldElement{16660756, 7281060, -10830758, 12911820, 20108584, -8101676, -21722536, -8613148, 16250552, -11111103}, + }, + { + FieldElement{-19765507, 2390526, -16551031, 14161980, 1905286, 6414907, 4689584, 10604807, -30190403, 4782747}, + FieldElement{-1354539, 14736941, -7367442, -13292886, 7710542, -14155590, -9981571, 4383045, 22546403, 437323}, + FieldElement{31665577, -12180464, -16186830, 1491339, -18368625, 3294682, 27343084, 2786261, -30633590, -14097016}, + }, + { + FieldElement{-14467279, -683715, -33374107, 7448552, 19294360, 14334329, -19690631, 2355319, -19284671, -6114373}, + FieldElement{15121312, -15796162, 6377020, -6031361, -10798111, -12957845, 18952177, 15496498, -29380133, 11754228}, + FieldElement{-2637277, -13483075, 8488727, -14303896, 12728761, -1622493, 7141596, 11724556, 22761615, -10134141}, + }, + { + FieldElement{16918416, 11729663, -18083579, 3022987, -31015732, -13339659, -28741185, -12227393, 32851222, 11717399}, + FieldElement{11166634, 7338049, -6722523, 4531520, -29468672, -7302055, 31474879, 3483633, -1193175, -4030831}, + FieldElement{-185635, 9921305, 31456609, -13536438, -12013818, 13348923, 33142652, 6546660, -19985279, -3948376}, + }, + { + FieldElement{-32460596, 11266712, -11197107, -7899103, 31703694, 3855903, -8537131, -12833048, -30772034, -15486313}, + FieldElement{-18006477, 12709068, 3991746, -6479188, -21491523, -10550425, -31135347, -16049879, 10928917, 3011958}, + FieldElement{-6957757, -15594337, 31696059, 334240, 29576716, 14796075, -30831056, -12805180, 18008031, 10258577}, + }, + { + FieldElement{-22448644, 15655569, 7018479, -4410003, -30314266, -1201591, -1853465, 1367120, 25127874, 6671743}, + FieldElement{29701166, -14373934, -10878120, 9279288, -17568, 13127210, 21382910, 11042292, 25838796, 4642684}, + FieldElement{-20430234, 14955537, -24126347, 8124619, -5369288, -5990470, 30468147, -13900640, 18423289, 4177476}, + }, + }, +} diff --git a/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go new file mode 100644 index 0000000..fd03c25 --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go @@ -0,0 +1,1793 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package edwards25519 + +import "encoding/binary" + +// This code is a port of the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +// FieldElement represents an element of the field GF(2^255 - 19). An element +// t, entries t[0]...t[9], represents the integer t[0]+2^26 t[1]+2^51 t[2]+2^77 +// t[3]+2^102 t[4]+...+2^230 t[9]. Bounds on each t[i] vary depending on +// context. +type FieldElement [10]int32 + +var zero FieldElement + +func FeZero(fe *FieldElement) { + copy(fe[:], zero[:]) +} + +func FeOne(fe *FieldElement) { + FeZero(fe) + fe[0] = 1 +} + +func FeAdd(dst, a, b *FieldElement) { + dst[0] = a[0] + b[0] + dst[1] = a[1] + b[1] + dst[2] = a[2] + b[2] + dst[3] = a[3] + b[3] + dst[4] = a[4] + b[4] + dst[5] = a[5] + b[5] + dst[6] = a[6] + b[6] + dst[7] = a[7] + b[7] + dst[8] = a[8] + b[8] + dst[9] = a[9] + b[9] +} + +func FeSub(dst, a, b *FieldElement) { + dst[0] = a[0] - b[0] + dst[1] = a[1] - b[1] + dst[2] = a[2] - b[2] + dst[3] = a[3] - b[3] + dst[4] = a[4] - b[4] + dst[5] = a[5] - b[5] + dst[6] = a[6] - b[6] + dst[7] = a[7] - b[7] + dst[8] = a[8] - b[8] + dst[9] = a[9] - b[9] +} + +func FeCopy(dst, src *FieldElement) { + copy(dst[:], src[:]) +} + +// Replace (f,g) with (g,g) if b == 1; +// replace (f,g) with (f,g) if b == 0. +// +// Preconditions: b in {0,1}. +func FeCMove(f, g *FieldElement, b int32) { + b = -b + f[0] ^= b & (f[0] ^ g[0]) + f[1] ^= b & (f[1] ^ g[1]) + f[2] ^= b & (f[2] ^ g[2]) + f[3] ^= b & (f[3] ^ g[3]) + f[4] ^= b & (f[4] ^ g[4]) + f[5] ^= b & (f[5] ^ g[5]) + f[6] ^= b & (f[6] ^ g[6]) + f[7] ^= b & (f[7] ^ g[7]) + f[8] ^= b & (f[8] ^ g[8]) + f[9] ^= b & (f[9] ^ g[9]) +} + +func load3(in []byte) int64 { + var r int64 + r = int64(in[0]) + r |= int64(in[1]) << 8 + r |= int64(in[2]) << 16 + return r +} + +func load4(in []byte) int64 { + var r int64 + r = int64(in[0]) + r |= int64(in[1]) << 8 + r |= int64(in[2]) << 16 + r |= int64(in[3]) << 24 + return r +} + +func FeFromBytes(dst *FieldElement, src *[32]byte) { + h0 := load4(src[:]) + h1 := load3(src[4:]) << 6 + h2 := load3(src[7:]) << 5 + h3 := load3(src[10:]) << 3 + h4 := load3(src[13:]) << 2 + h5 := load4(src[16:]) + h6 := load3(src[20:]) << 7 + h7 := load3(src[23:]) << 5 + h8 := load3(src[26:]) << 4 + h9 := (load3(src[29:]) & 8388607) << 2 + + FeCombine(dst, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +// FeToBytes marshals h to s. +// Preconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Write p=2^255-19; q=floor(h/p). +// Basic claim: q = floor(2^(-255)(h + 19 2^(-25)h9 + 2^(-1))). +// +// Proof: +// Have |h|<=p so |q|<=1 so |19^2 2^(-255) q|<1/4. +// Also have |h-2^230 h9|<2^230 so |19 2^(-255)(h-2^230 h9)|<1/4. +// +// Write y=2^(-1)-19^2 2^(-255)q-19 2^(-255)(h-2^230 h9). +// Then 0> 25 + q = (h[0] + q) >> 26 + q = (h[1] + q) >> 25 + q = (h[2] + q) >> 26 + q = (h[3] + q) >> 25 + q = (h[4] + q) >> 26 + q = (h[5] + q) >> 25 + q = (h[6] + q) >> 26 + q = (h[7] + q) >> 25 + q = (h[8] + q) >> 26 + q = (h[9] + q) >> 25 + + // Goal: Output h-(2^255-19)q, which is between 0 and 2^255-20. + h[0] += 19 * q + // Goal: Output h-2^255 q, which is between 0 and 2^255-20. + + carry[0] = h[0] >> 26 + h[1] += carry[0] + h[0] -= carry[0] << 26 + carry[1] = h[1] >> 25 + h[2] += carry[1] + h[1] -= carry[1] << 25 + carry[2] = h[2] >> 26 + h[3] += carry[2] + h[2] -= carry[2] << 26 + carry[3] = h[3] >> 25 + h[4] += carry[3] + h[3] -= carry[3] << 25 + carry[4] = h[4] >> 26 + h[5] += carry[4] + h[4] -= carry[4] << 26 + carry[5] = h[5] >> 25 + h[6] += carry[5] + h[5] -= carry[5] << 25 + carry[6] = h[6] >> 26 + h[7] += carry[6] + h[6] -= carry[6] << 26 + carry[7] = h[7] >> 25 + h[8] += carry[7] + h[7] -= carry[7] << 25 + carry[8] = h[8] >> 26 + h[9] += carry[8] + h[8] -= carry[8] << 26 + carry[9] = h[9] >> 25 + h[9] -= carry[9] << 25 + // h10 = carry9 + + // Goal: Output h[0]+...+2^255 h10-2^255 q, which is between 0 and 2^255-20. + // Have h[0]+...+2^230 h[9] between 0 and 2^255-1; + // evidently 2^255 h10-2^255 q = 0. + // Goal: Output h[0]+...+2^230 h[9]. + + s[0] = byte(h[0] >> 0) + s[1] = byte(h[0] >> 8) + s[2] = byte(h[0] >> 16) + s[3] = byte((h[0] >> 24) | (h[1] << 2)) + s[4] = byte(h[1] >> 6) + s[5] = byte(h[1] >> 14) + s[6] = byte((h[1] >> 22) | (h[2] << 3)) + s[7] = byte(h[2] >> 5) + s[8] = byte(h[2] >> 13) + s[9] = byte((h[2] >> 21) | (h[3] << 5)) + s[10] = byte(h[3] >> 3) + s[11] = byte(h[3] >> 11) + s[12] = byte((h[3] >> 19) | (h[4] << 6)) + s[13] = byte(h[4] >> 2) + s[14] = byte(h[4] >> 10) + s[15] = byte(h[4] >> 18) + s[16] = byte(h[5] >> 0) + s[17] = byte(h[5] >> 8) + s[18] = byte(h[5] >> 16) + s[19] = byte((h[5] >> 24) | (h[6] << 1)) + s[20] = byte(h[6] >> 7) + s[21] = byte(h[6] >> 15) + s[22] = byte((h[6] >> 23) | (h[7] << 3)) + s[23] = byte(h[7] >> 5) + s[24] = byte(h[7] >> 13) + s[25] = byte((h[7] >> 21) | (h[8] << 4)) + s[26] = byte(h[8] >> 4) + s[27] = byte(h[8] >> 12) + s[28] = byte((h[8] >> 20) | (h[9] << 6)) + s[29] = byte(h[9] >> 2) + s[30] = byte(h[9] >> 10) + s[31] = byte(h[9] >> 18) +} + +func FeIsNegative(f *FieldElement) byte { + var s [32]byte + FeToBytes(&s, f) + return s[0] & 1 +} + +func FeIsNonZero(f *FieldElement) int32 { + var s [32]byte + FeToBytes(&s, f) + var x uint8 + for _, b := range s { + x |= b + } + x |= x >> 4 + x |= x >> 2 + x |= x >> 1 + return int32(x & 1) +} + +// FeNeg sets h = -f +// +// Preconditions: +// |f| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func FeNeg(h, f *FieldElement) { + h[0] = -f[0] + h[1] = -f[1] + h[2] = -f[2] + h[3] = -f[3] + h[4] = -f[4] + h[5] = -f[5] + h[6] = -f[6] + h[7] = -f[7] + h[8] = -f[8] + h[9] = -f[9] +} + +func FeCombine(h *FieldElement, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 int64) { + var c0, c1, c2, c3, c4, c5, c6, c7, c8, c9 int64 + + /* + |h0| <= (1.1*1.1*2^52*(1+19+19+19+19)+1.1*1.1*2^50*(38+38+38+38+38)) + i.e. |h0| <= 1.2*2^59; narrower ranges for h2, h4, h6, h8 + |h1| <= (1.1*1.1*2^51*(1+1+19+19+19+19+19+19+19+19)) + i.e. |h1| <= 1.5*2^58; narrower ranges for h3, h5, h7, h9 + */ + + c0 = (h0 + (1 << 25)) >> 26 + h1 += c0 + h0 -= c0 << 26 + c4 = (h4 + (1 << 25)) >> 26 + h5 += c4 + h4 -= c4 << 26 + /* |h0| <= 2^25 */ + /* |h4| <= 2^25 */ + /* |h1| <= 1.51*2^58 */ + /* |h5| <= 1.51*2^58 */ + + c1 = (h1 + (1 << 24)) >> 25 + h2 += c1 + h1 -= c1 << 25 + c5 = (h5 + (1 << 24)) >> 25 + h6 += c5 + h5 -= c5 << 25 + /* |h1| <= 2^24; from now on fits into int32 */ + /* |h5| <= 2^24; from now on fits into int32 */ + /* |h2| <= 1.21*2^59 */ + /* |h6| <= 1.21*2^59 */ + + c2 = (h2 + (1 << 25)) >> 26 + h3 += c2 + h2 -= c2 << 26 + c6 = (h6 + (1 << 25)) >> 26 + h7 += c6 + h6 -= c6 << 26 + /* |h2| <= 2^25; from now on fits into int32 unchanged */ + /* |h6| <= 2^25; from now on fits into int32 unchanged */ + /* |h3| <= 1.51*2^58 */ + /* |h7| <= 1.51*2^58 */ + + c3 = (h3 + (1 << 24)) >> 25 + h4 += c3 + h3 -= c3 << 25 + c7 = (h7 + (1 << 24)) >> 25 + h8 += c7 + h7 -= c7 << 25 + /* |h3| <= 2^24; from now on fits into int32 unchanged */ + /* |h7| <= 2^24; from now on fits into int32 unchanged */ + /* |h4| <= 1.52*2^33 */ + /* |h8| <= 1.52*2^33 */ + + c4 = (h4 + (1 << 25)) >> 26 + h5 += c4 + h4 -= c4 << 26 + c8 = (h8 + (1 << 25)) >> 26 + h9 += c8 + h8 -= c8 << 26 + /* |h4| <= 2^25; from now on fits into int32 unchanged */ + /* |h8| <= 2^25; from now on fits into int32 unchanged */ + /* |h5| <= 1.01*2^24 */ + /* |h9| <= 1.51*2^58 */ + + c9 = (h9 + (1 << 24)) >> 25 + h0 += c9 * 19 + h9 -= c9 << 25 + /* |h9| <= 2^24; from now on fits into int32 unchanged */ + /* |h0| <= 1.8*2^37 */ + + c0 = (h0 + (1 << 25)) >> 26 + h1 += c0 + h0 -= c0 << 26 + /* |h0| <= 2^25; from now on fits into int32 unchanged */ + /* |h1| <= 1.01*2^24 */ + + h[0] = int32(h0) + h[1] = int32(h1) + h[2] = int32(h2) + h[3] = int32(h3) + h[4] = int32(h4) + h[5] = int32(h5) + h[6] = int32(h6) + h[7] = int32(h7) + h[8] = int32(h8) + h[9] = int32(h9) +} + +// FeMul calculates h = f * g +// Can overlap h with f or g. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// |g| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Notes on implementation strategy: +// +// Using schoolbook multiplication. +// Karatsuba would save a little in some cost models. +// +// Most multiplications by 2 and 19 are 32-bit precomputations; +// cheaper than 64-bit postcomputations. +// +// There is one remaining multiplication by 19 in the carry chain; +// one *19 precomputation can be merged into this, +// but the resulting data flow is considerably less clean. +// +// There are 12 carries below. +// 10 of them are 2-way parallelizable and vectorizable. +// Can get away with 11 carries, but then data flow is much deeper. +// +// With tighter constraints on inputs, can squeeze carries into int32. +func FeMul(h, f, g *FieldElement) { + f0 := int64(f[0]) + f1 := int64(f[1]) + f2 := int64(f[2]) + f3 := int64(f[3]) + f4 := int64(f[4]) + f5 := int64(f[5]) + f6 := int64(f[6]) + f7 := int64(f[7]) + f8 := int64(f[8]) + f9 := int64(f[9]) + + f1_2 := int64(2 * f[1]) + f3_2 := int64(2 * f[3]) + f5_2 := int64(2 * f[5]) + f7_2 := int64(2 * f[7]) + f9_2 := int64(2 * f[9]) + + g0 := int64(g[0]) + g1 := int64(g[1]) + g2 := int64(g[2]) + g3 := int64(g[3]) + g4 := int64(g[4]) + g5 := int64(g[5]) + g6 := int64(g[6]) + g7 := int64(g[7]) + g8 := int64(g[8]) + g9 := int64(g[9]) + + g1_19 := int64(19 * g[1]) /* 1.4*2^29 */ + g2_19 := int64(19 * g[2]) /* 1.4*2^30; still ok */ + g3_19 := int64(19 * g[3]) + g4_19 := int64(19 * g[4]) + g5_19 := int64(19 * g[5]) + g6_19 := int64(19 * g[6]) + g7_19 := int64(19 * g[7]) + g8_19 := int64(19 * g[8]) + g9_19 := int64(19 * g[9]) + + h0 := f0*g0 + f1_2*g9_19 + f2*g8_19 + f3_2*g7_19 + f4*g6_19 + f5_2*g5_19 + f6*g4_19 + f7_2*g3_19 + f8*g2_19 + f9_2*g1_19 + h1 := f0*g1 + f1*g0 + f2*g9_19 + f3*g8_19 + f4*g7_19 + f5*g6_19 + f6*g5_19 + f7*g4_19 + f8*g3_19 + f9*g2_19 + h2 := f0*g2 + f1_2*g1 + f2*g0 + f3_2*g9_19 + f4*g8_19 + f5_2*g7_19 + f6*g6_19 + f7_2*g5_19 + f8*g4_19 + f9_2*g3_19 + h3 := f0*g3 + f1*g2 + f2*g1 + f3*g0 + f4*g9_19 + f5*g8_19 + f6*g7_19 + f7*g6_19 + f8*g5_19 + f9*g4_19 + h4 := f0*g4 + f1_2*g3 + f2*g2 + f3_2*g1 + f4*g0 + f5_2*g9_19 + f6*g8_19 + f7_2*g7_19 + f8*g6_19 + f9_2*g5_19 + h5 := f0*g5 + f1*g4 + f2*g3 + f3*g2 + f4*g1 + f5*g0 + f6*g9_19 + f7*g8_19 + f8*g7_19 + f9*g6_19 + h6 := f0*g6 + f1_2*g5 + f2*g4 + f3_2*g3 + f4*g2 + f5_2*g1 + f6*g0 + f7_2*g9_19 + f8*g8_19 + f9_2*g7_19 + h7 := f0*g7 + f1*g6 + f2*g5 + f3*g4 + f4*g3 + f5*g2 + f6*g1 + f7*g0 + f8*g9_19 + f9*g8_19 + h8 := f0*g8 + f1_2*g7 + f2*g6 + f3_2*g5 + f4*g4 + f5_2*g3 + f6*g2 + f7_2*g1 + f8*g0 + f9_2*g9_19 + h9 := f0*g9 + f1*g8 + f2*g7 + f3*g6 + f4*g5 + f5*g4 + f6*g3 + f7*g2 + f8*g1 + f9*g0 + + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +func feSquare(f *FieldElement) (h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 int64) { + f0 := int64(f[0]) + f1 := int64(f[1]) + f2 := int64(f[2]) + f3 := int64(f[3]) + f4 := int64(f[4]) + f5 := int64(f[5]) + f6 := int64(f[6]) + f7 := int64(f[7]) + f8 := int64(f[8]) + f9 := int64(f[9]) + f0_2 := int64(2 * f[0]) + f1_2 := int64(2 * f[1]) + f2_2 := int64(2 * f[2]) + f3_2 := int64(2 * f[3]) + f4_2 := int64(2 * f[4]) + f5_2 := int64(2 * f[5]) + f6_2 := int64(2 * f[6]) + f7_2 := int64(2 * f[7]) + f5_38 := 38 * f5 // 1.31*2^30 + f6_19 := 19 * f6 // 1.31*2^30 + f7_38 := 38 * f7 // 1.31*2^30 + f8_19 := 19 * f8 // 1.31*2^30 + f9_38 := 38 * f9 // 1.31*2^30 + + h0 = f0*f0 + f1_2*f9_38 + f2_2*f8_19 + f3_2*f7_38 + f4_2*f6_19 + f5*f5_38 + h1 = f0_2*f1 + f2*f9_38 + f3_2*f8_19 + f4*f7_38 + f5_2*f6_19 + h2 = f0_2*f2 + f1_2*f1 + f3_2*f9_38 + f4_2*f8_19 + f5_2*f7_38 + f6*f6_19 + h3 = f0_2*f3 + f1_2*f2 + f4*f9_38 + f5_2*f8_19 + f6*f7_38 + h4 = f0_2*f4 + f1_2*f3_2 + f2*f2 + f5_2*f9_38 + f6_2*f8_19 + f7*f7_38 + h5 = f0_2*f5 + f1_2*f4 + f2_2*f3 + f6*f9_38 + f7_2*f8_19 + h6 = f0_2*f6 + f1_2*f5_2 + f2_2*f4 + f3_2*f3 + f7_2*f9_38 + f8*f8_19 + h7 = f0_2*f7 + f1_2*f6 + f2_2*f5 + f3_2*f4 + f8*f9_38 + h8 = f0_2*f8 + f1_2*f7_2 + f2_2*f6 + f3_2*f5_2 + f4*f4 + f9*f9_38 + h9 = f0_2*f9 + f1_2*f8 + f2_2*f7 + f3_2*f6 + f4_2*f5 + + return +} + +// FeSquare calculates h = f*f. Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func FeSquare(h, f *FieldElement) { + h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 := feSquare(f) + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +// FeSquare2 sets h = 2 * f * f +// +// Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.65*2^26,1.65*2^25,1.65*2^26,1.65*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.01*2^25,1.01*2^24,1.01*2^25,1.01*2^24,etc. +// See fe_mul.c for discussion of implementation strategy. +func FeSquare2(h, f *FieldElement) { + h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 := feSquare(f) + + h0 += h0 + h1 += h1 + h2 += h2 + h3 += h3 + h4 += h4 + h5 += h5 + h6 += h6 + h7 += h7 + h8 += h8 + h9 += h9 + + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +func FeInvert(out, z *FieldElement) { + var t0, t1, t2, t3 FieldElement + var i int + + FeSquare(&t0, z) // 2^1 + FeSquare(&t1, &t0) // 2^2 + for i = 1; i < 2; i++ { // 2^3 + FeSquare(&t1, &t1) + } + FeMul(&t1, z, &t1) // 2^3 + 2^0 + FeMul(&t0, &t0, &t1) // 2^3 + 2^1 + 2^0 + FeSquare(&t2, &t0) // 2^4 + 2^2 + 2^1 + FeMul(&t1, &t1, &t2) // 2^4 + 2^3 + 2^2 + 2^1 + 2^0 + FeSquare(&t2, &t1) // 5,4,3,2,1 + for i = 1; i < 5; i++ { // 9,8,7,6,5 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 9,8,7,6,5,4,3,2,1,0 + FeSquare(&t2, &t1) // 10..1 + for i = 1; i < 10; i++ { // 19..10 + FeSquare(&t2, &t2) + } + FeMul(&t2, &t2, &t1) // 19..0 + FeSquare(&t3, &t2) // 20..1 + for i = 1; i < 20; i++ { // 39..20 + FeSquare(&t3, &t3) + } + FeMul(&t2, &t3, &t2) // 39..0 + FeSquare(&t2, &t2) // 40..1 + for i = 1; i < 10; i++ { // 49..10 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 49..0 + FeSquare(&t2, &t1) // 50..1 + for i = 1; i < 50; i++ { // 99..50 + FeSquare(&t2, &t2) + } + FeMul(&t2, &t2, &t1) // 99..0 + FeSquare(&t3, &t2) // 100..1 + for i = 1; i < 100; i++ { // 199..100 + FeSquare(&t3, &t3) + } + FeMul(&t2, &t3, &t2) // 199..0 + FeSquare(&t2, &t2) // 200..1 + for i = 1; i < 50; i++ { // 249..50 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 249..0 + FeSquare(&t1, &t1) // 250..1 + for i = 1; i < 5; i++ { // 254..5 + FeSquare(&t1, &t1) + } + FeMul(out, &t1, &t0) // 254..5,3,1,0 +} + +func fePow22523(out, z *FieldElement) { + var t0, t1, t2 FieldElement + var i int + + FeSquare(&t0, z) + for i = 1; i < 1; i++ { + FeSquare(&t0, &t0) + } + FeSquare(&t1, &t0) + for i = 1; i < 2; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, z, &t1) + FeMul(&t0, &t0, &t1) + FeSquare(&t0, &t0) + for i = 1; i < 1; i++ { + FeSquare(&t0, &t0) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 5; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 10; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, &t1, &t0) + FeSquare(&t2, &t1) + for i = 1; i < 20; i++ { + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) + FeSquare(&t1, &t1) + for i = 1; i < 10; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 50; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, &t1, &t0) + FeSquare(&t2, &t1) + for i = 1; i < 100; i++ { + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) + FeSquare(&t1, &t1) + for i = 1; i < 50; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t0, &t0) + for i = 1; i < 2; i++ { + FeSquare(&t0, &t0) + } + FeMul(out, &t0, z) +} + +// Group elements are members of the elliptic curve -x^2 + y^2 = 1 + d * x^2 * +// y^2 where d = -121665/121666. +// +// Several representations are used: +// ProjectiveGroupElement: (X:Y:Z) satisfying x=X/Z, y=Y/Z +// ExtendedGroupElement: (X:Y:Z:T) satisfying x=X/Z, y=Y/Z, XY=ZT +// CompletedGroupElement: ((X:Z),(Y:T)) satisfying x=X/Z, y=Y/T +// PreComputedGroupElement: (y+x,y-x,2dxy) + +type ProjectiveGroupElement struct { + X, Y, Z FieldElement +} + +type ExtendedGroupElement struct { + X, Y, Z, T FieldElement +} + +type CompletedGroupElement struct { + X, Y, Z, T FieldElement +} + +type PreComputedGroupElement struct { + yPlusX, yMinusX, xy2d FieldElement +} + +type CachedGroupElement struct { + yPlusX, yMinusX, Z, T2d FieldElement +} + +func (p *ProjectiveGroupElement) Zero() { + FeZero(&p.X) + FeOne(&p.Y) + FeOne(&p.Z) +} + +func (p *ProjectiveGroupElement) Double(r *CompletedGroupElement) { + var t0 FieldElement + + FeSquare(&r.X, &p.X) + FeSquare(&r.Z, &p.Y) + FeSquare2(&r.T, &p.Z) + FeAdd(&r.Y, &p.X, &p.Y) + FeSquare(&t0, &r.Y) + FeAdd(&r.Y, &r.Z, &r.X) + FeSub(&r.Z, &r.Z, &r.X) + FeSub(&r.X, &t0, &r.Y) + FeSub(&r.T, &r.T, &r.Z) +} + +func (p *ProjectiveGroupElement) ToBytes(s *[32]byte) { + var recip, x, y FieldElement + + FeInvert(&recip, &p.Z) + FeMul(&x, &p.X, &recip) + FeMul(&y, &p.Y, &recip) + FeToBytes(s, &y) + s[31] ^= FeIsNegative(&x) << 7 +} + +func (p *ExtendedGroupElement) Zero() { + FeZero(&p.X) + FeOne(&p.Y) + FeOne(&p.Z) + FeZero(&p.T) +} + +func (p *ExtendedGroupElement) Double(r *CompletedGroupElement) { + var q ProjectiveGroupElement + p.ToProjective(&q) + q.Double(r) +} + +func (p *ExtendedGroupElement) ToCached(r *CachedGroupElement) { + FeAdd(&r.yPlusX, &p.Y, &p.X) + FeSub(&r.yMinusX, &p.Y, &p.X) + FeCopy(&r.Z, &p.Z) + FeMul(&r.T2d, &p.T, &d2) +} + +func (p *ExtendedGroupElement) ToProjective(r *ProjectiveGroupElement) { + FeCopy(&r.X, &p.X) + FeCopy(&r.Y, &p.Y) + FeCopy(&r.Z, &p.Z) +} + +func (p *ExtendedGroupElement) ToBytes(s *[32]byte) { + var recip, x, y FieldElement + + FeInvert(&recip, &p.Z) + FeMul(&x, &p.X, &recip) + FeMul(&y, &p.Y, &recip) + FeToBytes(s, &y) + s[31] ^= FeIsNegative(&x) << 7 +} + +func (p *ExtendedGroupElement) FromBytes(s *[32]byte) bool { + var u, v, v3, vxx, check FieldElement + + FeFromBytes(&p.Y, s) + FeOne(&p.Z) + FeSquare(&u, &p.Y) + FeMul(&v, &u, &d) + FeSub(&u, &u, &p.Z) // y = y^2-1 + FeAdd(&v, &v, &p.Z) // v = dy^2+1 + + FeSquare(&v3, &v) + FeMul(&v3, &v3, &v) // v3 = v^3 + FeSquare(&p.X, &v3) + FeMul(&p.X, &p.X, &v) + FeMul(&p.X, &p.X, &u) // x = uv^7 + + fePow22523(&p.X, &p.X) // x = (uv^7)^((q-5)/8) + FeMul(&p.X, &p.X, &v3) + FeMul(&p.X, &p.X, &u) // x = uv^3(uv^7)^((q-5)/8) + + var tmpX, tmp2 [32]byte + + FeSquare(&vxx, &p.X) + FeMul(&vxx, &vxx, &v) + FeSub(&check, &vxx, &u) // vx^2-u + if FeIsNonZero(&check) == 1 { + FeAdd(&check, &vxx, &u) // vx^2+u + if FeIsNonZero(&check) == 1 { + return false + } + FeMul(&p.X, &p.X, &SqrtM1) + + FeToBytes(&tmpX, &p.X) + for i, v := range tmpX { + tmp2[31-i] = v + } + } + + if FeIsNegative(&p.X) != (s[31] >> 7) { + FeNeg(&p.X, &p.X) + } + + FeMul(&p.T, &p.X, &p.Y) + return true +} + +func (p *CompletedGroupElement) ToProjective(r *ProjectiveGroupElement) { + FeMul(&r.X, &p.X, &p.T) + FeMul(&r.Y, &p.Y, &p.Z) + FeMul(&r.Z, &p.Z, &p.T) +} + +func (p *CompletedGroupElement) ToExtended(r *ExtendedGroupElement) { + FeMul(&r.X, &p.X, &p.T) + FeMul(&r.Y, &p.Y, &p.Z) + FeMul(&r.Z, &p.Z, &p.T) + FeMul(&r.T, &p.X, &p.Y) +} + +func (p *PreComputedGroupElement) Zero() { + FeOne(&p.yPlusX) + FeOne(&p.yMinusX) + FeZero(&p.xy2d) +} + +func geAdd(r *CompletedGroupElement, p *ExtendedGroupElement, q *CachedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yPlusX) + FeMul(&r.Y, &r.Y, &q.yMinusX) + FeMul(&r.T, &q.T2d, &p.T) + FeMul(&r.X, &p.Z, &q.Z) + FeAdd(&t0, &r.X, &r.X) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeAdd(&r.Z, &t0, &r.T) + FeSub(&r.T, &t0, &r.T) +} + +func geSub(r *CompletedGroupElement, p *ExtendedGroupElement, q *CachedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yMinusX) + FeMul(&r.Y, &r.Y, &q.yPlusX) + FeMul(&r.T, &q.T2d, &p.T) + FeMul(&r.X, &p.Z, &q.Z) + FeAdd(&t0, &r.X, &r.X) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeSub(&r.Z, &t0, &r.T) + FeAdd(&r.T, &t0, &r.T) +} + +func geMixedAdd(r *CompletedGroupElement, p *ExtendedGroupElement, q *PreComputedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yPlusX) + FeMul(&r.Y, &r.Y, &q.yMinusX) + FeMul(&r.T, &q.xy2d, &p.T) + FeAdd(&t0, &p.Z, &p.Z) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeAdd(&r.Z, &t0, &r.T) + FeSub(&r.T, &t0, &r.T) +} + +func geMixedSub(r *CompletedGroupElement, p *ExtendedGroupElement, q *PreComputedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yMinusX) + FeMul(&r.Y, &r.Y, &q.yPlusX) + FeMul(&r.T, &q.xy2d, &p.T) + FeAdd(&t0, &p.Z, &p.Z) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeSub(&r.Z, &t0, &r.T) + FeAdd(&r.T, &t0, &r.T) +} + +func slide(r *[256]int8, a *[32]byte) { + for i := range r { + r[i] = int8(1 & (a[i>>3] >> uint(i&7))) + } + + for i := range r { + if r[i] != 0 { + for b := 1; b <= 6 && i+b < 256; b++ { + if r[i+b] != 0 { + if r[i]+(r[i+b]<= -15 { + r[i] -= r[i+b] << uint(b) + for k := i + b; k < 256; k++ { + if r[k] == 0 { + r[k] = 1 + break + } + r[k] = 0 + } + } else { + break + } + } + } + } + } +} + +// GeDoubleScalarMultVartime sets r = a*A + b*B +// where a = a[0]+256*a[1]+...+256^31 a[31]. +// and b = b[0]+256*b[1]+...+256^31 b[31]. +// B is the Ed25519 base point (x,4/5) with x positive. +func GeDoubleScalarMultVartime(r *ProjectiveGroupElement, a *[32]byte, A *ExtendedGroupElement, b *[32]byte) { + var aSlide, bSlide [256]int8 + var Ai [8]CachedGroupElement // A,3A,5A,7A,9A,11A,13A,15A + var t CompletedGroupElement + var u, A2 ExtendedGroupElement + var i int + + slide(&aSlide, a) + slide(&bSlide, b) + + A.ToCached(&Ai[0]) + A.Double(&t) + t.ToExtended(&A2) + + for i := 0; i < 7; i++ { + geAdd(&t, &A2, &Ai[i]) + t.ToExtended(&u) + u.ToCached(&Ai[i+1]) + } + + r.Zero() + + for i = 255; i >= 0; i-- { + if aSlide[i] != 0 || bSlide[i] != 0 { + break + } + } + + for ; i >= 0; i-- { + r.Double(&t) + + if aSlide[i] > 0 { + t.ToExtended(&u) + geAdd(&t, &u, &Ai[aSlide[i]/2]) + } else if aSlide[i] < 0 { + t.ToExtended(&u) + geSub(&t, &u, &Ai[(-aSlide[i])/2]) + } + + if bSlide[i] > 0 { + t.ToExtended(&u) + geMixedAdd(&t, &u, &bi[bSlide[i]/2]) + } else if bSlide[i] < 0 { + t.ToExtended(&u) + geMixedSub(&t, &u, &bi[(-bSlide[i])/2]) + } + + t.ToProjective(r) + } +} + +// equal returns 1 if b == c and 0 otherwise, assuming that b and c are +// non-negative. +func equal(b, c int32) int32 { + x := uint32(b ^ c) + x-- + return int32(x >> 31) +} + +// negative returns 1 if b < 0 and 0 otherwise. +func negative(b int32) int32 { + return (b >> 31) & 1 +} + +func PreComputedGroupElementCMove(t, u *PreComputedGroupElement, b int32) { + FeCMove(&t.yPlusX, &u.yPlusX, b) + FeCMove(&t.yMinusX, &u.yMinusX, b) + FeCMove(&t.xy2d, &u.xy2d, b) +} + +func selectPoint(t *PreComputedGroupElement, pos int32, b int32) { + var minusT PreComputedGroupElement + bNegative := negative(b) + bAbs := b - (((-bNegative) & b) << 1) + + t.Zero() + for i := int32(0); i < 8; i++ { + PreComputedGroupElementCMove(t, &base[pos][i], equal(bAbs, i+1)) + } + FeCopy(&minusT.yPlusX, &t.yMinusX) + FeCopy(&minusT.yMinusX, &t.yPlusX) + FeNeg(&minusT.xy2d, &t.xy2d) + PreComputedGroupElementCMove(t, &minusT, bNegative) +} + +// GeScalarMultBase computes h = a*B, where +// a = a[0]+256*a[1]+...+256^31 a[31] +// B is the Ed25519 base point (x,4/5) with x positive. +// +// Preconditions: +// a[31] <= 127 +func GeScalarMultBase(h *ExtendedGroupElement, a *[32]byte) { + var e [64]int8 + + for i, v := range a { + e[2*i] = int8(v & 15) + e[2*i+1] = int8((v >> 4) & 15) + } + + // each e[i] is between 0 and 15 and e[63] is between 0 and 7. + + carry := int8(0) + for i := 0; i < 63; i++ { + e[i] += carry + carry = (e[i] + 8) >> 4 + e[i] -= carry << 4 + } + e[63] += carry + // each e[i] is between -8 and 8. + + h.Zero() + var t PreComputedGroupElement + var r CompletedGroupElement + for i := int32(1); i < 64; i += 2 { + selectPoint(&t, i/2, int32(e[i])) + geMixedAdd(&r, h, &t) + r.ToExtended(h) + } + + var s ProjectiveGroupElement + + h.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToExtended(h) + + for i := int32(0); i < 64; i += 2 { + selectPoint(&t, i/2, int32(e[i])) + geMixedAdd(&r, h, &t) + r.ToExtended(h) + } +} + +// The scalars are GF(2^252 + 27742317777372353535851937790883648493). + +// Input: +// a[0]+256*a[1]+...+256^31*a[31] = a +// b[0]+256*b[1]+...+256^31*b[31] = b +// c[0]+256*c[1]+...+256^31*c[31] = c +// +// Output: +// s[0]+256*s[1]+...+256^31*s[31] = (ab+c) mod l +// where l = 2^252 + 27742317777372353535851937790883648493. +func ScMulAdd(s, a, b, c *[32]byte) { + a0 := 2097151 & load3(a[:]) + a1 := 2097151 & (load4(a[2:]) >> 5) + a2 := 2097151 & (load3(a[5:]) >> 2) + a3 := 2097151 & (load4(a[7:]) >> 7) + a4 := 2097151 & (load4(a[10:]) >> 4) + a5 := 2097151 & (load3(a[13:]) >> 1) + a6 := 2097151 & (load4(a[15:]) >> 6) + a7 := 2097151 & (load3(a[18:]) >> 3) + a8 := 2097151 & load3(a[21:]) + a9 := 2097151 & (load4(a[23:]) >> 5) + a10 := 2097151 & (load3(a[26:]) >> 2) + a11 := (load4(a[28:]) >> 7) + b0 := 2097151 & load3(b[:]) + b1 := 2097151 & (load4(b[2:]) >> 5) + b2 := 2097151 & (load3(b[5:]) >> 2) + b3 := 2097151 & (load4(b[7:]) >> 7) + b4 := 2097151 & (load4(b[10:]) >> 4) + b5 := 2097151 & (load3(b[13:]) >> 1) + b6 := 2097151 & (load4(b[15:]) >> 6) + b7 := 2097151 & (load3(b[18:]) >> 3) + b8 := 2097151 & load3(b[21:]) + b9 := 2097151 & (load4(b[23:]) >> 5) + b10 := 2097151 & (load3(b[26:]) >> 2) + b11 := (load4(b[28:]) >> 7) + c0 := 2097151 & load3(c[:]) + c1 := 2097151 & (load4(c[2:]) >> 5) + c2 := 2097151 & (load3(c[5:]) >> 2) + c3 := 2097151 & (load4(c[7:]) >> 7) + c4 := 2097151 & (load4(c[10:]) >> 4) + c5 := 2097151 & (load3(c[13:]) >> 1) + c6 := 2097151 & (load4(c[15:]) >> 6) + c7 := 2097151 & (load3(c[18:]) >> 3) + c8 := 2097151 & load3(c[21:]) + c9 := 2097151 & (load4(c[23:]) >> 5) + c10 := 2097151 & (load3(c[26:]) >> 2) + c11 := (load4(c[28:]) >> 7) + var carry [23]int64 + + s0 := c0 + a0*b0 + s1 := c1 + a0*b1 + a1*b0 + s2 := c2 + a0*b2 + a1*b1 + a2*b0 + s3 := c3 + a0*b3 + a1*b2 + a2*b1 + a3*b0 + s4 := c4 + a0*b4 + a1*b3 + a2*b2 + a3*b1 + a4*b0 + s5 := c5 + a0*b5 + a1*b4 + a2*b3 + a3*b2 + a4*b1 + a5*b0 + s6 := c6 + a0*b6 + a1*b5 + a2*b4 + a3*b3 + a4*b2 + a5*b1 + a6*b0 + s7 := c7 + a0*b7 + a1*b6 + a2*b5 + a3*b4 + a4*b3 + a5*b2 + a6*b1 + a7*b0 + s8 := c8 + a0*b8 + a1*b7 + a2*b6 + a3*b5 + a4*b4 + a5*b3 + a6*b2 + a7*b1 + a8*b0 + s9 := c9 + a0*b9 + a1*b8 + a2*b7 + a3*b6 + a4*b5 + a5*b4 + a6*b3 + a7*b2 + a8*b1 + a9*b0 + s10 := c10 + a0*b10 + a1*b9 + a2*b8 + a3*b7 + a4*b6 + a5*b5 + a6*b4 + a7*b3 + a8*b2 + a9*b1 + a10*b0 + s11 := c11 + a0*b11 + a1*b10 + a2*b9 + a3*b8 + a4*b7 + a5*b6 + a6*b5 + a7*b4 + a8*b3 + a9*b2 + a10*b1 + a11*b0 + s12 := a1*b11 + a2*b10 + a3*b9 + a4*b8 + a5*b7 + a6*b6 + a7*b5 + a8*b4 + a9*b3 + a10*b2 + a11*b1 + s13 := a2*b11 + a3*b10 + a4*b9 + a5*b8 + a6*b7 + a7*b6 + a8*b5 + a9*b4 + a10*b3 + a11*b2 + s14 := a3*b11 + a4*b10 + a5*b9 + a6*b8 + a7*b7 + a8*b6 + a9*b5 + a10*b4 + a11*b3 + s15 := a4*b11 + a5*b10 + a6*b9 + a7*b8 + a8*b7 + a9*b6 + a10*b5 + a11*b4 + s16 := a5*b11 + a6*b10 + a7*b9 + a8*b8 + a9*b7 + a10*b6 + a11*b5 + s17 := a6*b11 + a7*b10 + a8*b9 + a9*b8 + a10*b7 + a11*b6 + s18 := a7*b11 + a8*b10 + a9*b9 + a10*b8 + a11*b7 + s19 := a8*b11 + a9*b10 + a10*b9 + a11*b8 + s20 := a9*b11 + a10*b10 + a11*b9 + s21 := a10*b11 + a11*b10 + s22 := a11 * b11 + s23 := int64(0) + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + carry[18] = (s18 + (1 << 20)) >> 21 + s19 += carry[18] + s18 -= carry[18] << 21 + carry[20] = (s20 + (1 << 20)) >> 21 + s21 += carry[20] + s20 -= carry[20] << 21 + carry[22] = (s22 + (1 << 20)) >> 21 + s23 += carry[22] + s22 -= carry[22] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + carry[17] = (s17 + (1 << 20)) >> 21 + s18 += carry[17] + s17 -= carry[17] << 21 + carry[19] = (s19 + (1 << 20)) >> 21 + s20 += carry[19] + s19 -= carry[19] << 21 + carry[21] = (s21 + (1 << 20)) >> 21 + s22 += carry[21] + s21 -= carry[21] << 21 + + s11 += s23 * 666643 + s12 += s23 * 470296 + s13 += s23 * 654183 + s14 -= s23 * 997805 + s15 += s23 * 136657 + s16 -= s23 * 683901 + s23 = 0 + + s10 += s22 * 666643 + s11 += s22 * 470296 + s12 += s22 * 654183 + s13 -= s22 * 997805 + s14 += s22 * 136657 + s15 -= s22 * 683901 + s22 = 0 + + s9 += s21 * 666643 + s10 += s21 * 470296 + s11 += s21 * 654183 + s12 -= s21 * 997805 + s13 += s21 * 136657 + s14 -= s21 * 683901 + s21 = 0 + + s8 += s20 * 666643 + s9 += s20 * 470296 + s10 += s20 * 654183 + s11 -= s20 * 997805 + s12 += s20 * 136657 + s13 -= s20 * 683901 + s20 = 0 + + s7 += s19 * 666643 + s8 += s19 * 470296 + s9 += s19 * 654183 + s10 -= s19 * 997805 + s11 += s19 * 136657 + s12 -= s19 * 683901 + s19 = 0 + + s6 += s18 * 666643 + s7 += s18 * 470296 + s8 += s18 * 654183 + s9 -= s18 * 997805 + s10 += s18 * 136657 + s11 -= s18 * 683901 + s18 = 0 + + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + + s5 += s17 * 666643 + s6 += s17 * 470296 + s7 += s17 * 654183 + s8 -= s17 * 997805 + s9 += s17 * 136657 + s10 -= s17 * 683901 + s17 = 0 + + s4 += s16 * 666643 + s5 += s16 * 470296 + s6 += s16 * 654183 + s7 -= s16 * 997805 + s8 += s16 * 136657 + s9 -= s16 * 683901 + s16 = 0 + + s3 += s15 * 666643 + s4 += s15 * 470296 + s5 += s15 * 654183 + s6 -= s15 * 997805 + s7 += s15 * 136657 + s8 -= s15 * 683901 + s15 = 0 + + s2 += s14 * 666643 + s3 += s14 * 470296 + s4 += s14 * 654183 + s5 -= s14 * 997805 + s6 += s14 * 136657 + s7 -= s14 * 683901 + s14 = 0 + + s1 += s13 * 666643 + s2 += s13 * 470296 + s3 += s13 * 654183 + s4 -= s13 * 997805 + s5 += s13 * 136657 + s6 -= s13 * 683901 + s13 = 0 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[11] = s11 >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + s[0] = byte(s0 >> 0) + s[1] = byte(s0 >> 8) + s[2] = byte((s0 >> 16) | (s1 << 5)) + s[3] = byte(s1 >> 3) + s[4] = byte(s1 >> 11) + s[5] = byte((s1 >> 19) | (s2 << 2)) + s[6] = byte(s2 >> 6) + s[7] = byte((s2 >> 14) | (s3 << 7)) + s[8] = byte(s3 >> 1) + s[9] = byte(s3 >> 9) + s[10] = byte((s3 >> 17) | (s4 << 4)) + s[11] = byte(s4 >> 4) + s[12] = byte(s4 >> 12) + s[13] = byte((s4 >> 20) | (s5 << 1)) + s[14] = byte(s5 >> 7) + s[15] = byte((s5 >> 15) | (s6 << 6)) + s[16] = byte(s6 >> 2) + s[17] = byte(s6 >> 10) + s[18] = byte((s6 >> 18) | (s7 << 3)) + s[19] = byte(s7 >> 5) + s[20] = byte(s7 >> 13) + s[21] = byte(s8 >> 0) + s[22] = byte(s8 >> 8) + s[23] = byte((s8 >> 16) | (s9 << 5)) + s[24] = byte(s9 >> 3) + s[25] = byte(s9 >> 11) + s[26] = byte((s9 >> 19) | (s10 << 2)) + s[27] = byte(s10 >> 6) + s[28] = byte((s10 >> 14) | (s11 << 7)) + s[29] = byte(s11 >> 1) + s[30] = byte(s11 >> 9) + s[31] = byte(s11 >> 17) +} + +// Input: +// s[0]+256*s[1]+...+256^63*s[63] = s +// +// Output: +// s[0]+256*s[1]+...+256^31*s[31] = s mod l +// where l = 2^252 + 27742317777372353535851937790883648493. +func ScReduce(out *[32]byte, s *[64]byte) { + s0 := 2097151 & load3(s[:]) + s1 := 2097151 & (load4(s[2:]) >> 5) + s2 := 2097151 & (load3(s[5:]) >> 2) + s3 := 2097151 & (load4(s[7:]) >> 7) + s4 := 2097151 & (load4(s[10:]) >> 4) + s5 := 2097151 & (load3(s[13:]) >> 1) + s6 := 2097151 & (load4(s[15:]) >> 6) + s7 := 2097151 & (load3(s[18:]) >> 3) + s8 := 2097151 & load3(s[21:]) + s9 := 2097151 & (load4(s[23:]) >> 5) + s10 := 2097151 & (load3(s[26:]) >> 2) + s11 := 2097151 & (load4(s[28:]) >> 7) + s12 := 2097151 & (load4(s[31:]) >> 4) + s13 := 2097151 & (load3(s[34:]) >> 1) + s14 := 2097151 & (load4(s[36:]) >> 6) + s15 := 2097151 & (load3(s[39:]) >> 3) + s16 := 2097151 & load3(s[42:]) + s17 := 2097151 & (load4(s[44:]) >> 5) + s18 := 2097151 & (load3(s[47:]) >> 2) + s19 := 2097151 & (load4(s[49:]) >> 7) + s20 := 2097151 & (load4(s[52:]) >> 4) + s21 := 2097151 & (load3(s[55:]) >> 1) + s22 := 2097151 & (load4(s[57:]) >> 6) + s23 := (load4(s[60:]) >> 3) + + s11 += s23 * 666643 + s12 += s23 * 470296 + s13 += s23 * 654183 + s14 -= s23 * 997805 + s15 += s23 * 136657 + s16 -= s23 * 683901 + s23 = 0 + + s10 += s22 * 666643 + s11 += s22 * 470296 + s12 += s22 * 654183 + s13 -= s22 * 997805 + s14 += s22 * 136657 + s15 -= s22 * 683901 + s22 = 0 + + s9 += s21 * 666643 + s10 += s21 * 470296 + s11 += s21 * 654183 + s12 -= s21 * 997805 + s13 += s21 * 136657 + s14 -= s21 * 683901 + s21 = 0 + + s8 += s20 * 666643 + s9 += s20 * 470296 + s10 += s20 * 654183 + s11 -= s20 * 997805 + s12 += s20 * 136657 + s13 -= s20 * 683901 + s20 = 0 + + s7 += s19 * 666643 + s8 += s19 * 470296 + s9 += s19 * 654183 + s10 -= s19 * 997805 + s11 += s19 * 136657 + s12 -= s19 * 683901 + s19 = 0 + + s6 += s18 * 666643 + s7 += s18 * 470296 + s8 += s18 * 654183 + s9 -= s18 * 997805 + s10 += s18 * 136657 + s11 -= s18 * 683901 + s18 = 0 + + var carry [17]int64 + + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + + s5 += s17 * 666643 + s6 += s17 * 470296 + s7 += s17 * 654183 + s8 -= s17 * 997805 + s9 += s17 * 136657 + s10 -= s17 * 683901 + s17 = 0 + + s4 += s16 * 666643 + s5 += s16 * 470296 + s6 += s16 * 654183 + s7 -= s16 * 997805 + s8 += s16 * 136657 + s9 -= s16 * 683901 + s16 = 0 + + s3 += s15 * 666643 + s4 += s15 * 470296 + s5 += s15 * 654183 + s6 -= s15 * 997805 + s7 += s15 * 136657 + s8 -= s15 * 683901 + s15 = 0 + + s2 += s14 * 666643 + s3 += s14 * 470296 + s4 += s14 * 654183 + s5 -= s14 * 997805 + s6 += s14 * 136657 + s7 -= s14 * 683901 + s14 = 0 + + s1 += s13 * 666643 + s2 += s13 * 470296 + s3 += s13 * 654183 + s4 -= s13 * 997805 + s5 += s13 * 136657 + s6 -= s13 * 683901 + s13 = 0 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[11] = s11 >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + out[0] = byte(s0 >> 0) + out[1] = byte(s0 >> 8) + out[2] = byte((s0 >> 16) | (s1 << 5)) + out[3] = byte(s1 >> 3) + out[4] = byte(s1 >> 11) + out[5] = byte((s1 >> 19) | (s2 << 2)) + out[6] = byte(s2 >> 6) + out[7] = byte((s2 >> 14) | (s3 << 7)) + out[8] = byte(s3 >> 1) + out[9] = byte(s3 >> 9) + out[10] = byte((s3 >> 17) | (s4 << 4)) + out[11] = byte(s4 >> 4) + out[12] = byte(s4 >> 12) + out[13] = byte((s4 >> 20) | (s5 << 1)) + out[14] = byte(s5 >> 7) + out[15] = byte((s5 >> 15) | (s6 << 6)) + out[16] = byte(s6 >> 2) + out[17] = byte(s6 >> 10) + out[18] = byte((s6 >> 18) | (s7 << 3)) + out[19] = byte(s7 >> 5) + out[20] = byte(s7 >> 13) + out[21] = byte(s8 >> 0) + out[22] = byte(s8 >> 8) + out[23] = byte((s8 >> 16) | (s9 << 5)) + out[24] = byte(s9 >> 3) + out[25] = byte(s9 >> 11) + out[26] = byte((s9 >> 19) | (s10 << 2)) + out[27] = byte(s10 >> 6) + out[28] = byte((s10 >> 14) | (s11 << 7)) + out[29] = byte(s11 >> 1) + out[30] = byte(s11 >> 9) + out[31] = byte(s11 >> 17) +} + +// order is the order of Curve25519 in little-endian form. +var order = [4]uint64{0x5812631a5cf5d3ed, 0x14def9dea2f79cd6, 0, 0x1000000000000000} + +// ScMinimal returns true if the given scalar is less than the order of the +// curve. +func ScMinimal(scalar *[32]byte) bool { + for i := 3; ; i-- { + v := binary.LittleEndian.Uint64(scalar[i*8:]) + if v > order[i] { + return false + } else if v < order[i] { + break + } else if i == 0 { + return false + } + } + + return true +} diff --git a/vendor/gopkg.in/yaml.v2/.travis.yml b/vendor/gopkg.in/yaml.v2/.travis.yml new file mode 100644 index 0000000..9f55693 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/.travis.yml @@ -0,0 +1,12 @@ +language: go + +go: + - 1.4 + - 1.5 + - 1.6 + - 1.7 + - 1.8 + - 1.9 + - tip + +go_import_path: gopkg.in/yaml.v2 diff --git a/vendor/gopkg.in/yaml.v2/LICENSE b/vendor/gopkg.in/yaml.v2/LICENSE new file mode 100644 index 0000000..8dada3e --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright {yyyy} {name of copyright owner} + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/vendor/gopkg.in/yaml.v2/LICENSE.libyaml b/vendor/gopkg.in/yaml.v2/LICENSE.libyaml new file mode 100644 index 0000000..8da58fb --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/LICENSE.libyaml @@ -0,0 +1,31 @@ +The following files were ported to Go from C files of libyaml, and thus +are still covered by their original copyright and license: + + apic.go + emitterc.go + parserc.go + readerc.go + scannerc.go + writerc.go + yamlh.go + yamlprivateh.go + +Copyright (c) 2006 Kirill Simonov + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/gopkg.in/yaml.v2/NOTICE b/vendor/gopkg.in/yaml.v2/NOTICE new file mode 100644 index 0000000..866d74a --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/NOTICE @@ -0,0 +1,13 @@ +Copyright 2011-2016 Canonical Ltd. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. diff --git a/vendor/gopkg.in/yaml.v2/README.md b/vendor/gopkg.in/yaml.v2/README.md new file mode 100644 index 0000000..b50c6e8 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/README.md @@ -0,0 +1,133 @@ +# YAML support for the Go language + +Introduction +------------ + +The yaml package enables Go programs to comfortably encode and decode YAML +values. It was developed within [Canonical](https://www.canonical.com) as +part of the [juju](https://juju.ubuntu.com) project, and is based on a +pure Go port of the well-known [libyaml](http://pyyaml.org/wiki/LibYAML) +C library to parse and generate YAML data quickly and reliably. + +Compatibility +------------- + +The yaml package supports most of YAML 1.1 and 1.2, including support for +anchors, tags, map merging, etc. Multi-document unmarshalling is not yet +implemented, and base-60 floats from YAML 1.1 are purposefully not +supported since they're a poor design and are gone in YAML 1.2. + +Installation and usage +---------------------- + +The import path for the package is *gopkg.in/yaml.v2*. + +To install it, run: + + go get gopkg.in/yaml.v2 + +API documentation +----------------- + +If opened in a browser, the import path itself leads to the API documentation: + + * [https://gopkg.in/yaml.v2](https://gopkg.in/yaml.v2) + +API stability +------------- + +The package API for yaml v2 will remain stable as described in [gopkg.in](https://gopkg.in). + + +License +------- + +The yaml package is licensed under the Apache License 2.0. Please see the LICENSE file for details. + + +Example +------- + +```Go +package main + +import ( + "fmt" + "log" + + "gopkg.in/yaml.v2" +) + +var data = ` +a: Easy! +b: + c: 2 + d: [3, 4] +` + +// Note: struct fields must be public in order for unmarshal to +// correctly populate the data. +type T struct { + A string + B struct { + RenamedC int `yaml:"c"` + D []int `yaml:",flow"` + } +} + +func main() { + t := T{} + + err := yaml.Unmarshal([]byte(data), &t) + if err != nil { + log.Fatalf("error: %v", err) + } + fmt.Printf("--- t:\n%v\n\n", t) + + d, err := yaml.Marshal(&t) + if err != nil { + log.Fatalf("error: %v", err) + } + fmt.Printf("--- t dump:\n%s\n\n", string(d)) + + m := make(map[interface{}]interface{}) + + err = yaml.Unmarshal([]byte(data), &m) + if err != nil { + log.Fatalf("error: %v", err) + } + fmt.Printf("--- m:\n%v\n\n", m) + + d, err = yaml.Marshal(&m) + if err != nil { + log.Fatalf("error: %v", err) + } + fmt.Printf("--- m dump:\n%s\n\n", string(d)) +} +``` + +This example will generate the following output: + +``` +--- t: +{Easy! {2 [3 4]}} + +--- t dump: +a: Easy! +b: + c: 2 + d: [3, 4] + + +--- m: +map[a:Easy! b:map[c:2 d:[3 4]]] + +--- m dump: +a: Easy! +b: + c: 2 + d: + - 3 + - 4 +``` + diff --git a/vendor/gopkg.in/yaml.v2/apic.go b/vendor/gopkg.in/yaml.v2/apic.go new file mode 100644 index 0000000..1f7e87e --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/apic.go @@ -0,0 +1,739 @@ +package yaml + +import ( + "io" +) + +func yaml_insert_token(parser *yaml_parser_t, pos int, token *yaml_token_t) { + //fmt.Println("yaml_insert_token", "pos:", pos, "typ:", token.typ, "head:", parser.tokens_head, "len:", len(parser.tokens)) + + // Check if we can move the queue at the beginning of the buffer. + if parser.tokens_head > 0 && len(parser.tokens) == cap(parser.tokens) { + if parser.tokens_head != len(parser.tokens) { + copy(parser.tokens, parser.tokens[parser.tokens_head:]) + } + parser.tokens = parser.tokens[:len(parser.tokens)-parser.tokens_head] + parser.tokens_head = 0 + } + parser.tokens = append(parser.tokens, *token) + if pos < 0 { + return + } + copy(parser.tokens[parser.tokens_head+pos+1:], parser.tokens[parser.tokens_head+pos:]) + parser.tokens[parser.tokens_head+pos] = *token +} + +// Create a new parser object. +func yaml_parser_initialize(parser *yaml_parser_t) bool { + *parser = yaml_parser_t{ + raw_buffer: make([]byte, 0, input_raw_buffer_size), + buffer: make([]byte, 0, input_buffer_size), + } + return true +} + +// Destroy a parser object. +func yaml_parser_delete(parser *yaml_parser_t) { + *parser = yaml_parser_t{} +} + +// String read handler. +func yaml_string_read_handler(parser *yaml_parser_t, buffer []byte) (n int, err error) { + if parser.input_pos == len(parser.input) { + return 0, io.EOF + } + n = copy(buffer, parser.input[parser.input_pos:]) + parser.input_pos += n + return n, nil +} + +// Reader read handler. +func yaml_reader_read_handler(parser *yaml_parser_t, buffer []byte) (n int, err error) { + return parser.input_reader.Read(buffer) +} + +// Set a string input. +func yaml_parser_set_input_string(parser *yaml_parser_t, input []byte) { + if parser.read_handler != nil { + panic("must set the input source only once") + } + parser.read_handler = yaml_string_read_handler + parser.input = input + parser.input_pos = 0 +} + +// Set a file input. +func yaml_parser_set_input_reader(parser *yaml_parser_t, r io.Reader) { + if parser.read_handler != nil { + panic("must set the input source only once") + } + parser.read_handler = yaml_reader_read_handler + parser.input_reader = r +} + +// Set the source encoding. +func yaml_parser_set_encoding(parser *yaml_parser_t, encoding yaml_encoding_t) { + if parser.encoding != yaml_ANY_ENCODING { + panic("must set the encoding only once") + } + parser.encoding = encoding +} + +// Create a new emitter object. +func yaml_emitter_initialize(emitter *yaml_emitter_t) { + *emitter = yaml_emitter_t{ + buffer: make([]byte, output_buffer_size), + raw_buffer: make([]byte, 0, output_raw_buffer_size), + states: make([]yaml_emitter_state_t, 0, initial_stack_size), + events: make([]yaml_event_t, 0, initial_queue_size), + } +} + +// Destroy an emitter object. +func yaml_emitter_delete(emitter *yaml_emitter_t) { + *emitter = yaml_emitter_t{} +} + +// String write handler. +func yaml_string_write_handler(emitter *yaml_emitter_t, buffer []byte) error { + *emitter.output_buffer = append(*emitter.output_buffer, buffer...) + return nil +} + +// yaml_writer_write_handler uses emitter.output_writer to write the +// emitted text. +func yaml_writer_write_handler(emitter *yaml_emitter_t, buffer []byte) error { + _, err := emitter.output_writer.Write(buffer) + return err +} + +// Set a string output. +func yaml_emitter_set_output_string(emitter *yaml_emitter_t, output_buffer *[]byte) { + if emitter.write_handler != nil { + panic("must set the output target only once") + } + emitter.write_handler = yaml_string_write_handler + emitter.output_buffer = output_buffer +} + +// Set a file output. +func yaml_emitter_set_output_writer(emitter *yaml_emitter_t, w io.Writer) { + if emitter.write_handler != nil { + panic("must set the output target only once") + } + emitter.write_handler = yaml_writer_write_handler + emitter.output_writer = w +} + +// Set the output encoding. +func yaml_emitter_set_encoding(emitter *yaml_emitter_t, encoding yaml_encoding_t) { + if emitter.encoding != yaml_ANY_ENCODING { + panic("must set the output encoding only once") + } + emitter.encoding = encoding +} + +// Set the canonical output style. +func yaml_emitter_set_canonical(emitter *yaml_emitter_t, canonical bool) { + emitter.canonical = canonical +} + +//// Set the indentation increment. +func yaml_emitter_set_indent(emitter *yaml_emitter_t, indent int) { + if indent < 2 || indent > 9 { + indent = 2 + } + emitter.best_indent = indent +} + +// Set the preferred line width. +func yaml_emitter_set_width(emitter *yaml_emitter_t, width int) { + if width < 0 { + width = -1 + } + emitter.best_width = width +} + +// Set if unescaped non-ASCII characters are allowed. +func yaml_emitter_set_unicode(emitter *yaml_emitter_t, unicode bool) { + emitter.unicode = unicode +} + +// Set the preferred line break character. +func yaml_emitter_set_break(emitter *yaml_emitter_t, line_break yaml_break_t) { + emitter.line_break = line_break +} + +///* +// * Destroy a token object. +// */ +// +//YAML_DECLARE(void) +//yaml_token_delete(yaml_token_t *token) +//{ +// assert(token); // Non-NULL token object expected. +// +// switch (token.type) +// { +// case YAML_TAG_DIRECTIVE_TOKEN: +// yaml_free(token.data.tag_directive.handle); +// yaml_free(token.data.tag_directive.prefix); +// break; +// +// case YAML_ALIAS_TOKEN: +// yaml_free(token.data.alias.value); +// break; +// +// case YAML_ANCHOR_TOKEN: +// yaml_free(token.data.anchor.value); +// break; +// +// case YAML_TAG_TOKEN: +// yaml_free(token.data.tag.handle); +// yaml_free(token.data.tag.suffix); +// break; +// +// case YAML_SCALAR_TOKEN: +// yaml_free(token.data.scalar.value); +// break; +// +// default: +// break; +// } +// +// memset(token, 0, sizeof(yaml_token_t)); +//} +// +///* +// * Check if a string is a valid UTF-8 sequence. +// * +// * Check 'reader.c' for more details on UTF-8 encoding. +// */ +// +//static int +//yaml_check_utf8(yaml_char_t *start, size_t length) +//{ +// yaml_char_t *end = start+length; +// yaml_char_t *pointer = start; +// +// while (pointer < end) { +// unsigned char octet; +// unsigned int width; +// unsigned int value; +// size_t k; +// +// octet = pointer[0]; +// width = (octet & 0x80) == 0x00 ? 1 : +// (octet & 0xE0) == 0xC0 ? 2 : +// (octet & 0xF0) == 0xE0 ? 3 : +// (octet & 0xF8) == 0xF0 ? 4 : 0; +// value = (octet & 0x80) == 0x00 ? octet & 0x7F : +// (octet & 0xE0) == 0xC0 ? octet & 0x1F : +// (octet & 0xF0) == 0xE0 ? octet & 0x0F : +// (octet & 0xF8) == 0xF0 ? octet & 0x07 : 0; +// if (!width) return 0; +// if (pointer+width > end) return 0; +// for (k = 1; k < width; k ++) { +// octet = pointer[k]; +// if ((octet & 0xC0) != 0x80) return 0; +// value = (value << 6) + (octet & 0x3F); +// } +// if (!((width == 1) || +// (width == 2 && value >= 0x80) || +// (width == 3 && value >= 0x800) || +// (width == 4 && value >= 0x10000))) return 0; +// +// pointer += width; +// } +// +// return 1; +//} +// + +// Create STREAM-START. +func yaml_stream_start_event_initialize(event *yaml_event_t, encoding yaml_encoding_t) { + *event = yaml_event_t{ + typ: yaml_STREAM_START_EVENT, + encoding: encoding, + } +} + +// Create STREAM-END. +func yaml_stream_end_event_initialize(event *yaml_event_t) { + *event = yaml_event_t{ + typ: yaml_STREAM_END_EVENT, + } +} + +// Create DOCUMENT-START. +func yaml_document_start_event_initialize( + event *yaml_event_t, + version_directive *yaml_version_directive_t, + tag_directives []yaml_tag_directive_t, + implicit bool, +) { + *event = yaml_event_t{ + typ: yaml_DOCUMENT_START_EVENT, + version_directive: version_directive, + tag_directives: tag_directives, + implicit: implicit, + } +} + +// Create DOCUMENT-END. +func yaml_document_end_event_initialize(event *yaml_event_t, implicit bool) { + *event = yaml_event_t{ + typ: yaml_DOCUMENT_END_EVENT, + implicit: implicit, + } +} + +///* +// * Create ALIAS. +// */ +// +//YAML_DECLARE(int) +//yaml_alias_event_initialize(event *yaml_event_t, anchor *yaml_char_t) +//{ +// mark yaml_mark_t = { 0, 0, 0 } +// anchor_copy *yaml_char_t = NULL +// +// assert(event) // Non-NULL event object is expected. +// assert(anchor) // Non-NULL anchor is expected. +// +// if (!yaml_check_utf8(anchor, strlen((char *)anchor))) return 0 +// +// anchor_copy = yaml_strdup(anchor) +// if (!anchor_copy) +// return 0 +// +// ALIAS_EVENT_INIT(*event, anchor_copy, mark, mark) +// +// return 1 +//} + +// Create SCALAR. +func yaml_scalar_event_initialize(event *yaml_event_t, anchor, tag, value []byte, plain_implicit, quoted_implicit bool, style yaml_scalar_style_t) bool { + *event = yaml_event_t{ + typ: yaml_SCALAR_EVENT, + anchor: anchor, + tag: tag, + value: value, + implicit: plain_implicit, + quoted_implicit: quoted_implicit, + style: yaml_style_t(style), + } + return true +} + +// Create SEQUENCE-START. +func yaml_sequence_start_event_initialize(event *yaml_event_t, anchor, tag []byte, implicit bool, style yaml_sequence_style_t) bool { + *event = yaml_event_t{ + typ: yaml_SEQUENCE_START_EVENT, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(style), + } + return true +} + +// Create SEQUENCE-END. +func yaml_sequence_end_event_initialize(event *yaml_event_t) bool { + *event = yaml_event_t{ + typ: yaml_SEQUENCE_END_EVENT, + } + return true +} + +// Create MAPPING-START. +func yaml_mapping_start_event_initialize(event *yaml_event_t, anchor, tag []byte, implicit bool, style yaml_mapping_style_t) { + *event = yaml_event_t{ + typ: yaml_MAPPING_START_EVENT, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(style), + } +} + +// Create MAPPING-END. +func yaml_mapping_end_event_initialize(event *yaml_event_t) { + *event = yaml_event_t{ + typ: yaml_MAPPING_END_EVENT, + } +} + +// Destroy an event object. +func yaml_event_delete(event *yaml_event_t) { + *event = yaml_event_t{} +} + +///* +// * Create a document object. +// */ +// +//YAML_DECLARE(int) +//yaml_document_initialize(document *yaml_document_t, +// version_directive *yaml_version_directive_t, +// tag_directives_start *yaml_tag_directive_t, +// tag_directives_end *yaml_tag_directive_t, +// start_implicit int, end_implicit int) +//{ +// struct { +// error yaml_error_type_t +// } context +// struct { +// start *yaml_node_t +// end *yaml_node_t +// top *yaml_node_t +// } nodes = { NULL, NULL, NULL } +// version_directive_copy *yaml_version_directive_t = NULL +// struct { +// start *yaml_tag_directive_t +// end *yaml_tag_directive_t +// top *yaml_tag_directive_t +// } tag_directives_copy = { NULL, NULL, NULL } +// value yaml_tag_directive_t = { NULL, NULL } +// mark yaml_mark_t = { 0, 0, 0 } +// +// assert(document) // Non-NULL document object is expected. +// assert((tag_directives_start && tag_directives_end) || +// (tag_directives_start == tag_directives_end)) +// // Valid tag directives are expected. +// +// if (!STACK_INIT(&context, nodes, INITIAL_STACK_SIZE)) goto error +// +// if (version_directive) { +// version_directive_copy = yaml_malloc(sizeof(yaml_version_directive_t)) +// if (!version_directive_copy) goto error +// version_directive_copy.major = version_directive.major +// version_directive_copy.minor = version_directive.minor +// } +// +// if (tag_directives_start != tag_directives_end) { +// tag_directive *yaml_tag_directive_t +// if (!STACK_INIT(&context, tag_directives_copy, INITIAL_STACK_SIZE)) +// goto error +// for (tag_directive = tag_directives_start +// tag_directive != tag_directives_end; tag_directive ++) { +// assert(tag_directive.handle) +// assert(tag_directive.prefix) +// if (!yaml_check_utf8(tag_directive.handle, +// strlen((char *)tag_directive.handle))) +// goto error +// if (!yaml_check_utf8(tag_directive.prefix, +// strlen((char *)tag_directive.prefix))) +// goto error +// value.handle = yaml_strdup(tag_directive.handle) +// value.prefix = yaml_strdup(tag_directive.prefix) +// if (!value.handle || !value.prefix) goto error +// if (!PUSH(&context, tag_directives_copy, value)) +// goto error +// value.handle = NULL +// value.prefix = NULL +// } +// } +// +// DOCUMENT_INIT(*document, nodes.start, nodes.end, version_directive_copy, +// tag_directives_copy.start, tag_directives_copy.top, +// start_implicit, end_implicit, mark, mark) +// +// return 1 +// +//error: +// STACK_DEL(&context, nodes) +// yaml_free(version_directive_copy) +// while (!STACK_EMPTY(&context, tag_directives_copy)) { +// value yaml_tag_directive_t = POP(&context, tag_directives_copy) +// yaml_free(value.handle) +// yaml_free(value.prefix) +// } +// STACK_DEL(&context, tag_directives_copy) +// yaml_free(value.handle) +// yaml_free(value.prefix) +// +// return 0 +//} +// +///* +// * Destroy a document object. +// */ +// +//YAML_DECLARE(void) +//yaml_document_delete(document *yaml_document_t) +//{ +// struct { +// error yaml_error_type_t +// } context +// tag_directive *yaml_tag_directive_t +// +// context.error = YAML_NO_ERROR // Eliminate a compiler warning. +// +// assert(document) // Non-NULL document object is expected. +// +// while (!STACK_EMPTY(&context, document.nodes)) { +// node yaml_node_t = POP(&context, document.nodes) +// yaml_free(node.tag) +// switch (node.type) { +// case YAML_SCALAR_NODE: +// yaml_free(node.data.scalar.value) +// break +// case YAML_SEQUENCE_NODE: +// STACK_DEL(&context, node.data.sequence.items) +// break +// case YAML_MAPPING_NODE: +// STACK_DEL(&context, node.data.mapping.pairs) +// break +// default: +// assert(0) // Should not happen. +// } +// } +// STACK_DEL(&context, document.nodes) +// +// yaml_free(document.version_directive) +// for (tag_directive = document.tag_directives.start +// tag_directive != document.tag_directives.end +// tag_directive++) { +// yaml_free(tag_directive.handle) +// yaml_free(tag_directive.prefix) +// } +// yaml_free(document.tag_directives.start) +// +// memset(document, 0, sizeof(yaml_document_t)) +//} +// +///** +// * Get a document node. +// */ +// +//YAML_DECLARE(yaml_node_t *) +//yaml_document_get_node(document *yaml_document_t, index int) +//{ +// assert(document) // Non-NULL document object is expected. +// +// if (index > 0 && document.nodes.start + index <= document.nodes.top) { +// return document.nodes.start + index - 1 +// } +// return NULL +//} +// +///** +// * Get the root object. +// */ +// +//YAML_DECLARE(yaml_node_t *) +//yaml_document_get_root_node(document *yaml_document_t) +//{ +// assert(document) // Non-NULL document object is expected. +// +// if (document.nodes.top != document.nodes.start) { +// return document.nodes.start +// } +// return NULL +//} +// +///* +// * Add a scalar node to a document. +// */ +// +//YAML_DECLARE(int) +//yaml_document_add_scalar(document *yaml_document_t, +// tag *yaml_char_t, value *yaml_char_t, length int, +// style yaml_scalar_style_t) +//{ +// struct { +// error yaml_error_type_t +// } context +// mark yaml_mark_t = { 0, 0, 0 } +// tag_copy *yaml_char_t = NULL +// value_copy *yaml_char_t = NULL +// node yaml_node_t +// +// assert(document) // Non-NULL document object is expected. +// assert(value) // Non-NULL value is expected. +// +// if (!tag) { +// tag = (yaml_char_t *)YAML_DEFAULT_SCALAR_TAG +// } +// +// if (!yaml_check_utf8(tag, strlen((char *)tag))) goto error +// tag_copy = yaml_strdup(tag) +// if (!tag_copy) goto error +// +// if (length < 0) { +// length = strlen((char *)value) +// } +// +// if (!yaml_check_utf8(value, length)) goto error +// value_copy = yaml_malloc(length+1) +// if (!value_copy) goto error +// memcpy(value_copy, value, length) +// value_copy[length] = '\0' +// +// SCALAR_NODE_INIT(node, tag_copy, value_copy, length, style, mark, mark) +// if (!PUSH(&context, document.nodes, node)) goto error +// +// return document.nodes.top - document.nodes.start +// +//error: +// yaml_free(tag_copy) +// yaml_free(value_copy) +// +// return 0 +//} +// +///* +// * Add a sequence node to a document. +// */ +// +//YAML_DECLARE(int) +//yaml_document_add_sequence(document *yaml_document_t, +// tag *yaml_char_t, style yaml_sequence_style_t) +//{ +// struct { +// error yaml_error_type_t +// } context +// mark yaml_mark_t = { 0, 0, 0 } +// tag_copy *yaml_char_t = NULL +// struct { +// start *yaml_node_item_t +// end *yaml_node_item_t +// top *yaml_node_item_t +// } items = { NULL, NULL, NULL } +// node yaml_node_t +// +// assert(document) // Non-NULL document object is expected. +// +// if (!tag) { +// tag = (yaml_char_t *)YAML_DEFAULT_SEQUENCE_TAG +// } +// +// if (!yaml_check_utf8(tag, strlen((char *)tag))) goto error +// tag_copy = yaml_strdup(tag) +// if (!tag_copy) goto error +// +// if (!STACK_INIT(&context, items, INITIAL_STACK_SIZE)) goto error +// +// SEQUENCE_NODE_INIT(node, tag_copy, items.start, items.end, +// style, mark, mark) +// if (!PUSH(&context, document.nodes, node)) goto error +// +// return document.nodes.top - document.nodes.start +// +//error: +// STACK_DEL(&context, items) +// yaml_free(tag_copy) +// +// return 0 +//} +// +///* +// * Add a mapping node to a document. +// */ +// +//YAML_DECLARE(int) +//yaml_document_add_mapping(document *yaml_document_t, +// tag *yaml_char_t, style yaml_mapping_style_t) +//{ +// struct { +// error yaml_error_type_t +// } context +// mark yaml_mark_t = { 0, 0, 0 } +// tag_copy *yaml_char_t = NULL +// struct { +// start *yaml_node_pair_t +// end *yaml_node_pair_t +// top *yaml_node_pair_t +// } pairs = { NULL, NULL, NULL } +// node yaml_node_t +// +// assert(document) // Non-NULL document object is expected. +// +// if (!tag) { +// tag = (yaml_char_t *)YAML_DEFAULT_MAPPING_TAG +// } +// +// if (!yaml_check_utf8(tag, strlen((char *)tag))) goto error +// tag_copy = yaml_strdup(tag) +// if (!tag_copy) goto error +// +// if (!STACK_INIT(&context, pairs, INITIAL_STACK_SIZE)) goto error +// +// MAPPING_NODE_INIT(node, tag_copy, pairs.start, pairs.end, +// style, mark, mark) +// if (!PUSH(&context, document.nodes, node)) goto error +// +// return document.nodes.top - document.nodes.start +// +//error: +// STACK_DEL(&context, pairs) +// yaml_free(tag_copy) +// +// return 0 +//} +// +///* +// * Append an item to a sequence node. +// */ +// +//YAML_DECLARE(int) +//yaml_document_append_sequence_item(document *yaml_document_t, +// sequence int, item int) +//{ +// struct { +// error yaml_error_type_t +// } context +// +// assert(document) // Non-NULL document is required. +// assert(sequence > 0 +// && document.nodes.start + sequence <= document.nodes.top) +// // Valid sequence id is required. +// assert(document.nodes.start[sequence-1].type == YAML_SEQUENCE_NODE) +// // A sequence node is required. +// assert(item > 0 && document.nodes.start + item <= document.nodes.top) +// // Valid item id is required. +// +// if (!PUSH(&context, +// document.nodes.start[sequence-1].data.sequence.items, item)) +// return 0 +// +// return 1 +//} +// +///* +// * Append a pair of a key and a value to a mapping node. +// */ +// +//YAML_DECLARE(int) +//yaml_document_append_mapping_pair(document *yaml_document_t, +// mapping int, key int, value int) +//{ +// struct { +// error yaml_error_type_t +// } context +// +// pair yaml_node_pair_t +// +// assert(document) // Non-NULL document is required. +// assert(mapping > 0 +// && document.nodes.start + mapping <= document.nodes.top) +// // Valid mapping id is required. +// assert(document.nodes.start[mapping-1].type == YAML_MAPPING_NODE) +// // A mapping node is required. +// assert(key > 0 && document.nodes.start + key <= document.nodes.top) +// // Valid key id is required. +// assert(value > 0 && document.nodes.start + value <= document.nodes.top) +// // Valid value id is required. +// +// pair.key = key +// pair.value = value +// +// if (!PUSH(&context, +// document.nodes.start[mapping-1].data.mapping.pairs, pair)) +// return 0 +// +// return 1 +//} +// +// diff --git a/vendor/gopkg.in/yaml.v2/decode.go b/vendor/gopkg.in/yaml.v2/decode.go new file mode 100644 index 0000000..e4e56e2 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/decode.go @@ -0,0 +1,775 @@ +package yaml + +import ( + "encoding" + "encoding/base64" + "fmt" + "io" + "math" + "reflect" + "strconv" + "time" +) + +const ( + documentNode = 1 << iota + mappingNode + sequenceNode + scalarNode + aliasNode +) + +type node struct { + kind int + line, column int + tag string + // For an alias node, alias holds the resolved alias. + alias *node + value string + implicit bool + children []*node + anchors map[string]*node +} + +// ---------------------------------------------------------------------------- +// Parser, produces a node tree out of a libyaml event stream. + +type parser struct { + parser yaml_parser_t + event yaml_event_t + doc *node + doneInit bool +} + +func newParser(b []byte) *parser { + p := parser{} + if !yaml_parser_initialize(&p.parser) { + panic("failed to initialize YAML emitter") + } + if len(b) == 0 { + b = []byte{'\n'} + } + yaml_parser_set_input_string(&p.parser, b) + return &p +} + +func newParserFromReader(r io.Reader) *parser { + p := parser{} + if !yaml_parser_initialize(&p.parser) { + panic("failed to initialize YAML emitter") + } + yaml_parser_set_input_reader(&p.parser, r) + return &p +} + +func (p *parser) init() { + if p.doneInit { + return + } + p.expect(yaml_STREAM_START_EVENT) + p.doneInit = true +} + +func (p *parser) destroy() { + if p.event.typ != yaml_NO_EVENT { + yaml_event_delete(&p.event) + } + yaml_parser_delete(&p.parser) +} + +// expect consumes an event from the event stream and +// checks that it's of the expected type. +func (p *parser) expect(e yaml_event_type_t) { + if p.event.typ == yaml_NO_EVENT { + if !yaml_parser_parse(&p.parser, &p.event) { + p.fail() + } + } + if p.event.typ == yaml_STREAM_END_EVENT { + failf("attempted to go past the end of stream; corrupted value?") + } + if p.event.typ != e { + p.parser.problem = fmt.Sprintf("expected %s event but got %s", e, p.event.typ) + p.fail() + } + yaml_event_delete(&p.event) + p.event.typ = yaml_NO_EVENT +} + +// peek peeks at the next event in the event stream, +// puts the results into p.event and returns the event type. +func (p *parser) peek() yaml_event_type_t { + if p.event.typ != yaml_NO_EVENT { + return p.event.typ + } + if !yaml_parser_parse(&p.parser, &p.event) { + p.fail() + } + return p.event.typ +} + +func (p *parser) fail() { + var where string + var line int + if p.parser.problem_mark.line != 0 { + line = p.parser.problem_mark.line + // Scanner errors don't iterate line before returning error + if p.parser.error == yaml_SCANNER_ERROR { + line++ + } + } else if p.parser.context_mark.line != 0 { + line = p.parser.context_mark.line + } + if line != 0 { + where = "line " + strconv.Itoa(line) + ": " + } + var msg string + if len(p.parser.problem) > 0 { + msg = p.parser.problem + } else { + msg = "unknown problem parsing YAML content" + } + failf("%s%s", where, msg) +} + +func (p *parser) anchor(n *node, anchor []byte) { + if anchor != nil { + p.doc.anchors[string(anchor)] = n + } +} + +func (p *parser) parse() *node { + p.init() + switch p.peek() { + case yaml_SCALAR_EVENT: + return p.scalar() + case yaml_ALIAS_EVENT: + return p.alias() + case yaml_MAPPING_START_EVENT: + return p.mapping() + case yaml_SEQUENCE_START_EVENT: + return p.sequence() + case yaml_DOCUMENT_START_EVENT: + return p.document() + case yaml_STREAM_END_EVENT: + // Happens when attempting to decode an empty buffer. + return nil + default: + panic("attempted to parse unknown event: " + p.event.typ.String()) + } +} + +func (p *parser) node(kind int) *node { + return &node{ + kind: kind, + line: p.event.start_mark.line, + column: p.event.start_mark.column, + } +} + +func (p *parser) document() *node { + n := p.node(documentNode) + n.anchors = make(map[string]*node) + p.doc = n + p.expect(yaml_DOCUMENT_START_EVENT) + n.children = append(n.children, p.parse()) + p.expect(yaml_DOCUMENT_END_EVENT) + return n +} + +func (p *parser) alias() *node { + n := p.node(aliasNode) + n.value = string(p.event.anchor) + n.alias = p.doc.anchors[n.value] + if n.alias == nil { + failf("unknown anchor '%s' referenced", n.value) + } + p.expect(yaml_ALIAS_EVENT) + return n +} + +func (p *parser) scalar() *node { + n := p.node(scalarNode) + n.value = string(p.event.value) + n.tag = string(p.event.tag) + n.implicit = p.event.implicit + p.anchor(n, p.event.anchor) + p.expect(yaml_SCALAR_EVENT) + return n +} + +func (p *parser) sequence() *node { + n := p.node(sequenceNode) + p.anchor(n, p.event.anchor) + p.expect(yaml_SEQUENCE_START_EVENT) + for p.peek() != yaml_SEQUENCE_END_EVENT { + n.children = append(n.children, p.parse()) + } + p.expect(yaml_SEQUENCE_END_EVENT) + return n +} + +func (p *parser) mapping() *node { + n := p.node(mappingNode) + p.anchor(n, p.event.anchor) + p.expect(yaml_MAPPING_START_EVENT) + for p.peek() != yaml_MAPPING_END_EVENT { + n.children = append(n.children, p.parse(), p.parse()) + } + p.expect(yaml_MAPPING_END_EVENT) + return n +} + +// ---------------------------------------------------------------------------- +// Decoder, unmarshals a node into a provided value. + +type decoder struct { + doc *node + aliases map[*node]bool + mapType reflect.Type + terrors []string + strict bool +} + +var ( + mapItemType = reflect.TypeOf(MapItem{}) + durationType = reflect.TypeOf(time.Duration(0)) + defaultMapType = reflect.TypeOf(map[interface{}]interface{}{}) + ifaceType = defaultMapType.Elem() + timeType = reflect.TypeOf(time.Time{}) + ptrTimeType = reflect.TypeOf(&time.Time{}) +) + +func newDecoder(strict bool) *decoder { + d := &decoder{mapType: defaultMapType, strict: strict} + d.aliases = make(map[*node]bool) + return d +} + +func (d *decoder) terror(n *node, tag string, out reflect.Value) { + if n.tag != "" { + tag = n.tag + } + value := n.value + if tag != yaml_SEQ_TAG && tag != yaml_MAP_TAG { + if len(value) > 10 { + value = " `" + value[:7] + "...`" + } else { + value = " `" + value + "`" + } + } + d.terrors = append(d.terrors, fmt.Sprintf("line %d: cannot unmarshal %s%s into %s", n.line+1, shortTag(tag), value, out.Type())) +} + +func (d *decoder) callUnmarshaler(n *node, u Unmarshaler) (good bool) { + terrlen := len(d.terrors) + err := u.UnmarshalYAML(func(v interface{}) (err error) { + defer handleErr(&err) + d.unmarshal(n, reflect.ValueOf(v)) + if len(d.terrors) > terrlen { + issues := d.terrors[terrlen:] + d.terrors = d.terrors[:terrlen] + return &TypeError{issues} + } + return nil + }) + if e, ok := err.(*TypeError); ok { + d.terrors = append(d.terrors, e.Errors...) + return false + } + if err != nil { + fail(err) + } + return true +} + +// d.prepare initializes and dereferences pointers and calls UnmarshalYAML +// if a value is found to implement it. +// It returns the initialized and dereferenced out value, whether +// unmarshalling was already done by UnmarshalYAML, and if so whether +// its types unmarshalled appropriately. +// +// If n holds a null value, prepare returns before doing anything. +func (d *decoder) prepare(n *node, out reflect.Value) (newout reflect.Value, unmarshaled, good bool) { + if n.tag == yaml_NULL_TAG || n.kind == scalarNode && n.tag == "" && (n.value == "null" || n.value == "~" || n.value == "" && n.implicit) { + return out, false, false + } + again := true + for again { + again = false + if out.Kind() == reflect.Ptr { + if out.IsNil() { + out.Set(reflect.New(out.Type().Elem())) + } + out = out.Elem() + again = true + } + if out.CanAddr() { + if u, ok := out.Addr().Interface().(Unmarshaler); ok { + good = d.callUnmarshaler(n, u) + return out, true, good + } + } + } + return out, false, false +} + +func (d *decoder) unmarshal(n *node, out reflect.Value) (good bool) { + switch n.kind { + case documentNode: + return d.document(n, out) + case aliasNode: + return d.alias(n, out) + } + out, unmarshaled, good := d.prepare(n, out) + if unmarshaled { + return good + } + switch n.kind { + case scalarNode: + good = d.scalar(n, out) + case mappingNode: + good = d.mapping(n, out) + case sequenceNode: + good = d.sequence(n, out) + default: + panic("internal error: unknown node kind: " + strconv.Itoa(n.kind)) + } + return good +} + +func (d *decoder) document(n *node, out reflect.Value) (good bool) { + if len(n.children) == 1 { + d.doc = n + d.unmarshal(n.children[0], out) + return true + } + return false +} + +func (d *decoder) alias(n *node, out reflect.Value) (good bool) { + if d.aliases[n] { + // TODO this could actually be allowed in some circumstances. + failf("anchor '%s' value contains itself", n.value) + } + d.aliases[n] = true + good = d.unmarshal(n.alias, out) + delete(d.aliases, n) + return good +} + +var zeroValue reflect.Value + +func resetMap(out reflect.Value) { + for _, k := range out.MapKeys() { + out.SetMapIndex(k, zeroValue) + } +} + +func (d *decoder) scalar(n *node, out reflect.Value) bool { + var tag string + var resolved interface{} + if n.tag == "" && !n.implicit { + tag = yaml_STR_TAG + resolved = n.value + } else { + tag, resolved = resolve(n.tag, n.value) + if tag == yaml_BINARY_TAG { + data, err := base64.StdEncoding.DecodeString(resolved.(string)) + if err != nil { + failf("!!binary value contains invalid base64 data") + } + resolved = string(data) + } + } + if resolved == nil { + if out.Kind() == reflect.Map && !out.CanAddr() { + resetMap(out) + } else { + out.Set(reflect.Zero(out.Type())) + } + return true + } + if resolvedv := reflect.ValueOf(resolved); out.Type() == resolvedv.Type() { + // We've resolved to exactly the type we want, so use that. + out.Set(resolvedv) + return true + } + // Perhaps we can use the value as a TextUnmarshaler to + // set its value. + if out.CanAddr() { + u, ok := out.Addr().Interface().(encoding.TextUnmarshaler) + if ok { + var text []byte + if tag == yaml_BINARY_TAG { + text = []byte(resolved.(string)) + } else { + // We let any value be unmarshaled into TextUnmarshaler. + // That might be more lax than we'd like, but the + // TextUnmarshaler itself should bowl out any dubious values. + text = []byte(n.value) + } + err := u.UnmarshalText(text) + if err != nil { + fail(err) + } + return true + } + } + switch out.Kind() { + case reflect.String: + if tag == yaml_BINARY_TAG { + out.SetString(resolved.(string)) + return true + } + if resolved != nil { + out.SetString(n.value) + return true + } + case reflect.Interface: + if resolved == nil { + out.Set(reflect.Zero(out.Type())) + } else if tag == yaml_TIMESTAMP_TAG { + // It looks like a timestamp but for backward compatibility + // reasons we set it as a string, so that code that unmarshals + // timestamp-like values into interface{} will continue to + // see a string and not a time.Time. + // TODO(v3) Drop this. + out.Set(reflect.ValueOf(n.value)) + } else { + out.Set(reflect.ValueOf(resolved)) + } + return true + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + switch resolved := resolved.(type) { + case int: + if !out.OverflowInt(int64(resolved)) { + out.SetInt(int64(resolved)) + return true + } + case int64: + if !out.OverflowInt(resolved) { + out.SetInt(resolved) + return true + } + case uint64: + if resolved <= math.MaxInt64 && !out.OverflowInt(int64(resolved)) { + out.SetInt(int64(resolved)) + return true + } + case float64: + if resolved <= math.MaxInt64 && !out.OverflowInt(int64(resolved)) { + out.SetInt(int64(resolved)) + return true + } + case string: + if out.Type() == durationType { + d, err := time.ParseDuration(resolved) + if err == nil { + out.SetInt(int64(d)) + return true + } + } + } + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + switch resolved := resolved.(type) { + case int: + if resolved >= 0 && !out.OverflowUint(uint64(resolved)) { + out.SetUint(uint64(resolved)) + return true + } + case int64: + if resolved >= 0 && !out.OverflowUint(uint64(resolved)) { + out.SetUint(uint64(resolved)) + return true + } + case uint64: + if !out.OverflowUint(uint64(resolved)) { + out.SetUint(uint64(resolved)) + return true + } + case float64: + if resolved <= math.MaxUint64 && !out.OverflowUint(uint64(resolved)) { + out.SetUint(uint64(resolved)) + return true + } + } + case reflect.Bool: + switch resolved := resolved.(type) { + case bool: + out.SetBool(resolved) + return true + } + case reflect.Float32, reflect.Float64: + switch resolved := resolved.(type) { + case int: + out.SetFloat(float64(resolved)) + return true + case int64: + out.SetFloat(float64(resolved)) + return true + case uint64: + out.SetFloat(float64(resolved)) + return true + case float64: + out.SetFloat(resolved) + return true + } + case reflect.Struct: + if resolvedv := reflect.ValueOf(resolved); out.Type() == resolvedv.Type() { + out.Set(resolvedv) + return true + } + case reflect.Ptr: + if out.Type().Elem() == reflect.TypeOf(resolved) { + // TODO DOes this make sense? When is out a Ptr except when decoding a nil value? + elem := reflect.New(out.Type().Elem()) + elem.Elem().Set(reflect.ValueOf(resolved)) + out.Set(elem) + return true + } + } + d.terror(n, tag, out) + return false +} + +func settableValueOf(i interface{}) reflect.Value { + v := reflect.ValueOf(i) + sv := reflect.New(v.Type()).Elem() + sv.Set(v) + return sv +} + +func (d *decoder) sequence(n *node, out reflect.Value) (good bool) { + l := len(n.children) + + var iface reflect.Value + switch out.Kind() { + case reflect.Slice: + out.Set(reflect.MakeSlice(out.Type(), l, l)) + case reflect.Array: + if l != out.Len() { + failf("invalid array: want %d elements but got %d", out.Len(), l) + } + case reflect.Interface: + // No type hints. Will have to use a generic sequence. + iface = out + out = settableValueOf(make([]interface{}, l)) + default: + d.terror(n, yaml_SEQ_TAG, out) + return false + } + et := out.Type().Elem() + + j := 0 + for i := 0; i < l; i++ { + e := reflect.New(et).Elem() + if ok := d.unmarshal(n.children[i], e); ok { + out.Index(j).Set(e) + j++ + } + } + if out.Kind() != reflect.Array { + out.Set(out.Slice(0, j)) + } + if iface.IsValid() { + iface.Set(out) + } + return true +} + +func (d *decoder) mapping(n *node, out reflect.Value) (good bool) { + switch out.Kind() { + case reflect.Struct: + return d.mappingStruct(n, out) + case reflect.Slice: + return d.mappingSlice(n, out) + case reflect.Map: + // okay + case reflect.Interface: + if d.mapType.Kind() == reflect.Map { + iface := out + out = reflect.MakeMap(d.mapType) + iface.Set(out) + } else { + slicev := reflect.New(d.mapType).Elem() + if !d.mappingSlice(n, slicev) { + return false + } + out.Set(slicev) + return true + } + default: + d.terror(n, yaml_MAP_TAG, out) + return false + } + outt := out.Type() + kt := outt.Key() + et := outt.Elem() + + mapType := d.mapType + if outt.Key() == ifaceType && outt.Elem() == ifaceType { + d.mapType = outt + } + + if out.IsNil() { + out.Set(reflect.MakeMap(outt)) + } + l := len(n.children) + for i := 0; i < l; i += 2 { + if isMerge(n.children[i]) { + d.merge(n.children[i+1], out) + continue + } + k := reflect.New(kt).Elem() + if d.unmarshal(n.children[i], k) { + kkind := k.Kind() + if kkind == reflect.Interface { + kkind = k.Elem().Kind() + } + if kkind == reflect.Map || kkind == reflect.Slice { + failf("invalid map key: %#v", k.Interface()) + } + e := reflect.New(et).Elem() + if d.unmarshal(n.children[i+1], e) { + d.setMapIndex(n.children[i+1], out, k, e) + } + } + } + d.mapType = mapType + return true +} + +func (d *decoder) setMapIndex(n *node, out, k, v reflect.Value) { + if d.strict && out.MapIndex(k) != zeroValue { + d.terrors = append(d.terrors, fmt.Sprintf("line %d: key %#v already set in map", n.line+1, k.Interface())) + return + } + out.SetMapIndex(k, v) +} + +func (d *decoder) mappingSlice(n *node, out reflect.Value) (good bool) { + outt := out.Type() + if outt.Elem() != mapItemType { + d.terror(n, yaml_MAP_TAG, out) + return false + } + + mapType := d.mapType + d.mapType = outt + + var slice []MapItem + var l = len(n.children) + for i := 0; i < l; i += 2 { + if isMerge(n.children[i]) { + d.merge(n.children[i+1], out) + continue + } + item := MapItem{} + k := reflect.ValueOf(&item.Key).Elem() + if d.unmarshal(n.children[i], k) { + v := reflect.ValueOf(&item.Value).Elem() + if d.unmarshal(n.children[i+1], v) { + slice = append(slice, item) + } + } + } + out.Set(reflect.ValueOf(slice)) + d.mapType = mapType + return true +} + +func (d *decoder) mappingStruct(n *node, out reflect.Value) (good bool) { + sinfo, err := getStructInfo(out.Type()) + if err != nil { + panic(err) + } + name := settableValueOf("") + l := len(n.children) + + var inlineMap reflect.Value + var elemType reflect.Type + if sinfo.InlineMap != -1 { + inlineMap = out.Field(sinfo.InlineMap) + inlineMap.Set(reflect.New(inlineMap.Type()).Elem()) + elemType = inlineMap.Type().Elem() + } + + var doneFields []bool + if d.strict { + doneFields = make([]bool, len(sinfo.FieldsList)) + } + for i := 0; i < l; i += 2 { + ni := n.children[i] + if isMerge(ni) { + d.merge(n.children[i+1], out) + continue + } + if !d.unmarshal(ni, name) { + continue + } + if info, ok := sinfo.FieldsMap[name.String()]; ok { + if d.strict { + if doneFields[info.Id] { + d.terrors = append(d.terrors, fmt.Sprintf("line %d: field %s already set in type %s", ni.line+1, name.String(), out.Type())) + continue + } + doneFields[info.Id] = true + } + var field reflect.Value + if info.Inline == nil { + field = out.Field(info.Num) + } else { + field = out.FieldByIndex(info.Inline) + } + d.unmarshal(n.children[i+1], field) + } else if sinfo.InlineMap != -1 { + if inlineMap.IsNil() { + inlineMap.Set(reflect.MakeMap(inlineMap.Type())) + } + value := reflect.New(elemType).Elem() + d.unmarshal(n.children[i+1], value) + d.setMapIndex(n.children[i+1], inlineMap, name, value) + } else if d.strict { + d.terrors = append(d.terrors, fmt.Sprintf("line %d: field %s not found in type %s", ni.line+1, name.String(), out.Type())) + } + } + return true +} + +func failWantMap() { + failf("map merge requires map or sequence of maps as the value") +} + +func (d *decoder) merge(n *node, out reflect.Value) { + switch n.kind { + case mappingNode: + d.unmarshal(n, out) + case aliasNode: + an, ok := d.doc.anchors[n.value] + if ok && an.kind != mappingNode { + failWantMap() + } + d.unmarshal(n, out) + case sequenceNode: + // Step backwards as earlier nodes take precedence. + for i := len(n.children) - 1; i >= 0; i-- { + ni := n.children[i] + if ni.kind == aliasNode { + an, ok := d.doc.anchors[ni.value] + if ok && an.kind != mappingNode { + failWantMap() + } + } else if ni.kind != mappingNode { + failWantMap() + } + d.unmarshal(ni, out) + } + default: + failWantMap() + } +} + +func isMerge(n *node) bool { + return n.kind == scalarNode && n.value == "<<" && (n.implicit == true || n.tag == yaml_MERGE_TAG) +} diff --git a/vendor/gopkg.in/yaml.v2/emitterc.go b/vendor/gopkg.in/yaml.v2/emitterc.go new file mode 100644 index 0000000..a1c2cc5 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/emitterc.go @@ -0,0 +1,1685 @@ +package yaml + +import ( + "bytes" + "fmt" +) + +// Flush the buffer if needed. +func flush(emitter *yaml_emitter_t) bool { + if emitter.buffer_pos+5 >= len(emitter.buffer) { + return yaml_emitter_flush(emitter) + } + return true +} + +// Put a character to the output buffer. +func put(emitter *yaml_emitter_t, value byte) bool { + if emitter.buffer_pos+5 >= len(emitter.buffer) && !yaml_emitter_flush(emitter) { + return false + } + emitter.buffer[emitter.buffer_pos] = value + emitter.buffer_pos++ + emitter.column++ + return true +} + +// Put a line break to the output buffer. +func put_break(emitter *yaml_emitter_t) bool { + if emitter.buffer_pos+5 >= len(emitter.buffer) && !yaml_emitter_flush(emitter) { + return false + } + switch emitter.line_break { + case yaml_CR_BREAK: + emitter.buffer[emitter.buffer_pos] = '\r' + emitter.buffer_pos += 1 + case yaml_LN_BREAK: + emitter.buffer[emitter.buffer_pos] = '\n' + emitter.buffer_pos += 1 + case yaml_CRLN_BREAK: + emitter.buffer[emitter.buffer_pos+0] = '\r' + emitter.buffer[emitter.buffer_pos+1] = '\n' + emitter.buffer_pos += 2 + default: + panic("unknown line break setting") + } + emitter.column = 0 + emitter.line++ + return true +} + +// Copy a character from a string into buffer. +func write(emitter *yaml_emitter_t, s []byte, i *int) bool { + if emitter.buffer_pos+5 >= len(emitter.buffer) && !yaml_emitter_flush(emitter) { + return false + } + p := emitter.buffer_pos + w := width(s[*i]) + switch w { + case 4: + emitter.buffer[p+3] = s[*i+3] + fallthrough + case 3: + emitter.buffer[p+2] = s[*i+2] + fallthrough + case 2: + emitter.buffer[p+1] = s[*i+1] + fallthrough + case 1: + emitter.buffer[p+0] = s[*i+0] + default: + panic("unknown character width") + } + emitter.column++ + emitter.buffer_pos += w + *i += w + return true +} + +// Write a whole string into buffer. +func write_all(emitter *yaml_emitter_t, s []byte) bool { + for i := 0; i < len(s); { + if !write(emitter, s, &i) { + return false + } + } + return true +} + +// Copy a line break character from a string into buffer. +func write_break(emitter *yaml_emitter_t, s []byte, i *int) bool { + if s[*i] == '\n' { + if !put_break(emitter) { + return false + } + *i++ + } else { + if !write(emitter, s, i) { + return false + } + emitter.column = 0 + emitter.line++ + } + return true +} + +// Set an emitter error and return false. +func yaml_emitter_set_emitter_error(emitter *yaml_emitter_t, problem string) bool { + emitter.error = yaml_EMITTER_ERROR + emitter.problem = problem + return false +} + +// Emit an event. +func yaml_emitter_emit(emitter *yaml_emitter_t, event *yaml_event_t) bool { + emitter.events = append(emitter.events, *event) + for !yaml_emitter_need_more_events(emitter) { + event := &emitter.events[emitter.events_head] + if !yaml_emitter_analyze_event(emitter, event) { + return false + } + if !yaml_emitter_state_machine(emitter, event) { + return false + } + yaml_event_delete(event) + emitter.events_head++ + } + return true +} + +// Check if we need to accumulate more events before emitting. +// +// We accumulate extra +// - 1 event for DOCUMENT-START +// - 2 events for SEQUENCE-START +// - 3 events for MAPPING-START +// +func yaml_emitter_need_more_events(emitter *yaml_emitter_t) bool { + if emitter.events_head == len(emitter.events) { + return true + } + var accumulate int + switch emitter.events[emitter.events_head].typ { + case yaml_DOCUMENT_START_EVENT: + accumulate = 1 + break + case yaml_SEQUENCE_START_EVENT: + accumulate = 2 + break + case yaml_MAPPING_START_EVENT: + accumulate = 3 + break + default: + return false + } + if len(emitter.events)-emitter.events_head > accumulate { + return false + } + var level int + for i := emitter.events_head; i < len(emitter.events); i++ { + switch emitter.events[i].typ { + case yaml_STREAM_START_EVENT, yaml_DOCUMENT_START_EVENT, yaml_SEQUENCE_START_EVENT, yaml_MAPPING_START_EVENT: + level++ + case yaml_STREAM_END_EVENT, yaml_DOCUMENT_END_EVENT, yaml_SEQUENCE_END_EVENT, yaml_MAPPING_END_EVENT: + level-- + } + if level == 0 { + return false + } + } + return true +} + +// Append a directive to the directives stack. +func yaml_emitter_append_tag_directive(emitter *yaml_emitter_t, value *yaml_tag_directive_t, allow_duplicates bool) bool { + for i := 0; i < len(emitter.tag_directives); i++ { + if bytes.Equal(value.handle, emitter.tag_directives[i].handle) { + if allow_duplicates { + return true + } + return yaml_emitter_set_emitter_error(emitter, "duplicate %TAG directive") + } + } + + // [Go] Do we actually need to copy this given garbage collection + // and the lack of deallocating destructors? + tag_copy := yaml_tag_directive_t{ + handle: make([]byte, len(value.handle)), + prefix: make([]byte, len(value.prefix)), + } + copy(tag_copy.handle, value.handle) + copy(tag_copy.prefix, value.prefix) + emitter.tag_directives = append(emitter.tag_directives, tag_copy) + return true +} + +// Increase the indentation level. +func yaml_emitter_increase_indent(emitter *yaml_emitter_t, flow, indentless bool) bool { + emitter.indents = append(emitter.indents, emitter.indent) + if emitter.indent < 0 { + if flow { + emitter.indent = emitter.best_indent + } else { + emitter.indent = 0 + } + } else if !indentless { + emitter.indent += emitter.best_indent + } + return true +} + +// State dispatcher. +func yaml_emitter_state_machine(emitter *yaml_emitter_t, event *yaml_event_t) bool { + switch emitter.state { + default: + case yaml_EMIT_STREAM_START_STATE: + return yaml_emitter_emit_stream_start(emitter, event) + + case yaml_EMIT_FIRST_DOCUMENT_START_STATE: + return yaml_emitter_emit_document_start(emitter, event, true) + + case yaml_EMIT_DOCUMENT_START_STATE: + return yaml_emitter_emit_document_start(emitter, event, false) + + case yaml_EMIT_DOCUMENT_CONTENT_STATE: + return yaml_emitter_emit_document_content(emitter, event) + + case yaml_EMIT_DOCUMENT_END_STATE: + return yaml_emitter_emit_document_end(emitter, event) + + case yaml_EMIT_FLOW_SEQUENCE_FIRST_ITEM_STATE: + return yaml_emitter_emit_flow_sequence_item(emitter, event, true) + + case yaml_EMIT_FLOW_SEQUENCE_ITEM_STATE: + return yaml_emitter_emit_flow_sequence_item(emitter, event, false) + + case yaml_EMIT_FLOW_MAPPING_FIRST_KEY_STATE: + return yaml_emitter_emit_flow_mapping_key(emitter, event, true) + + case yaml_EMIT_FLOW_MAPPING_KEY_STATE: + return yaml_emitter_emit_flow_mapping_key(emitter, event, false) + + case yaml_EMIT_FLOW_MAPPING_SIMPLE_VALUE_STATE: + return yaml_emitter_emit_flow_mapping_value(emitter, event, true) + + case yaml_EMIT_FLOW_MAPPING_VALUE_STATE: + return yaml_emitter_emit_flow_mapping_value(emitter, event, false) + + case yaml_EMIT_BLOCK_SEQUENCE_FIRST_ITEM_STATE: + return yaml_emitter_emit_block_sequence_item(emitter, event, true) + + case yaml_EMIT_BLOCK_SEQUENCE_ITEM_STATE: + return yaml_emitter_emit_block_sequence_item(emitter, event, false) + + case yaml_EMIT_BLOCK_MAPPING_FIRST_KEY_STATE: + return yaml_emitter_emit_block_mapping_key(emitter, event, true) + + case yaml_EMIT_BLOCK_MAPPING_KEY_STATE: + return yaml_emitter_emit_block_mapping_key(emitter, event, false) + + case yaml_EMIT_BLOCK_MAPPING_SIMPLE_VALUE_STATE: + return yaml_emitter_emit_block_mapping_value(emitter, event, true) + + case yaml_EMIT_BLOCK_MAPPING_VALUE_STATE: + return yaml_emitter_emit_block_mapping_value(emitter, event, false) + + case yaml_EMIT_END_STATE: + return yaml_emitter_set_emitter_error(emitter, "expected nothing after STREAM-END") + } + panic("invalid emitter state") +} + +// Expect STREAM-START. +func yaml_emitter_emit_stream_start(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if event.typ != yaml_STREAM_START_EVENT { + return yaml_emitter_set_emitter_error(emitter, "expected STREAM-START") + } + if emitter.encoding == yaml_ANY_ENCODING { + emitter.encoding = event.encoding + if emitter.encoding == yaml_ANY_ENCODING { + emitter.encoding = yaml_UTF8_ENCODING + } + } + if emitter.best_indent < 2 || emitter.best_indent > 9 { + emitter.best_indent = 2 + } + if emitter.best_width >= 0 && emitter.best_width <= emitter.best_indent*2 { + emitter.best_width = 80 + } + if emitter.best_width < 0 { + emitter.best_width = 1<<31 - 1 + } + if emitter.line_break == yaml_ANY_BREAK { + emitter.line_break = yaml_LN_BREAK + } + + emitter.indent = -1 + emitter.line = 0 + emitter.column = 0 + emitter.whitespace = true + emitter.indention = true + + if emitter.encoding != yaml_UTF8_ENCODING { + if !yaml_emitter_write_bom(emitter) { + return false + } + } + emitter.state = yaml_EMIT_FIRST_DOCUMENT_START_STATE + return true +} + +// Expect DOCUMENT-START or STREAM-END. +func yaml_emitter_emit_document_start(emitter *yaml_emitter_t, event *yaml_event_t, first bool) bool { + + if event.typ == yaml_DOCUMENT_START_EVENT { + + if event.version_directive != nil { + if !yaml_emitter_analyze_version_directive(emitter, event.version_directive) { + return false + } + } + + for i := 0; i < len(event.tag_directives); i++ { + tag_directive := &event.tag_directives[i] + if !yaml_emitter_analyze_tag_directive(emitter, tag_directive) { + return false + } + if !yaml_emitter_append_tag_directive(emitter, tag_directive, false) { + return false + } + } + + for i := 0; i < len(default_tag_directives); i++ { + tag_directive := &default_tag_directives[i] + if !yaml_emitter_append_tag_directive(emitter, tag_directive, true) { + return false + } + } + + implicit := event.implicit + if !first || emitter.canonical { + implicit = false + } + + if emitter.open_ended && (event.version_directive != nil || len(event.tag_directives) > 0) { + if !yaml_emitter_write_indicator(emitter, []byte("..."), true, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + + if event.version_directive != nil { + implicit = false + if !yaml_emitter_write_indicator(emitter, []byte("%YAML"), true, false, false) { + return false + } + if !yaml_emitter_write_indicator(emitter, []byte("1.1"), true, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + + if len(event.tag_directives) > 0 { + implicit = false + for i := 0; i < len(event.tag_directives); i++ { + tag_directive := &event.tag_directives[i] + if !yaml_emitter_write_indicator(emitter, []byte("%TAG"), true, false, false) { + return false + } + if !yaml_emitter_write_tag_handle(emitter, tag_directive.handle) { + return false + } + if !yaml_emitter_write_tag_content(emitter, tag_directive.prefix, true) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + } + + if yaml_emitter_check_empty_document(emitter) { + implicit = false + } + if !implicit { + if !yaml_emitter_write_indent(emitter) { + return false + } + if !yaml_emitter_write_indicator(emitter, []byte("---"), true, false, false) { + return false + } + if emitter.canonical { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + } + + emitter.state = yaml_EMIT_DOCUMENT_CONTENT_STATE + return true + } + + if event.typ == yaml_STREAM_END_EVENT { + if emitter.open_ended { + if !yaml_emitter_write_indicator(emitter, []byte("..."), true, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !yaml_emitter_flush(emitter) { + return false + } + emitter.state = yaml_EMIT_END_STATE + return true + } + + return yaml_emitter_set_emitter_error(emitter, "expected DOCUMENT-START or STREAM-END") +} + +// Expect the root node. +func yaml_emitter_emit_document_content(emitter *yaml_emitter_t, event *yaml_event_t) bool { + emitter.states = append(emitter.states, yaml_EMIT_DOCUMENT_END_STATE) + return yaml_emitter_emit_node(emitter, event, true, false, false, false) +} + +// Expect DOCUMENT-END. +func yaml_emitter_emit_document_end(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if event.typ != yaml_DOCUMENT_END_EVENT { + return yaml_emitter_set_emitter_error(emitter, "expected DOCUMENT-END") + } + if !yaml_emitter_write_indent(emitter) { + return false + } + if !event.implicit { + // [Go] Allocate the slice elsewhere. + if !yaml_emitter_write_indicator(emitter, []byte("..."), true, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !yaml_emitter_flush(emitter) { + return false + } + emitter.state = yaml_EMIT_DOCUMENT_START_STATE + emitter.tag_directives = emitter.tag_directives[:0] + return true +} + +// Expect a flow item node. +func yaml_emitter_emit_flow_sequence_item(emitter *yaml_emitter_t, event *yaml_event_t, first bool) bool { + if first { + if !yaml_emitter_write_indicator(emitter, []byte{'['}, true, true, false) { + return false + } + if !yaml_emitter_increase_indent(emitter, true, false) { + return false + } + emitter.flow_level++ + } + + if event.typ == yaml_SEQUENCE_END_EVENT { + emitter.flow_level-- + emitter.indent = emitter.indents[len(emitter.indents)-1] + emitter.indents = emitter.indents[:len(emitter.indents)-1] + if emitter.canonical && !first { + if !yaml_emitter_write_indicator(emitter, []byte{','}, false, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !yaml_emitter_write_indicator(emitter, []byte{']'}, false, false, false) { + return false + } + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + + return true + } + + if !first { + if !yaml_emitter_write_indicator(emitter, []byte{','}, false, false, false) { + return false + } + } + + if emitter.canonical || emitter.column > emitter.best_width { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + emitter.states = append(emitter.states, yaml_EMIT_FLOW_SEQUENCE_ITEM_STATE) + return yaml_emitter_emit_node(emitter, event, false, true, false, false) +} + +// Expect a flow key node. +func yaml_emitter_emit_flow_mapping_key(emitter *yaml_emitter_t, event *yaml_event_t, first bool) bool { + if first { + if !yaml_emitter_write_indicator(emitter, []byte{'{'}, true, true, false) { + return false + } + if !yaml_emitter_increase_indent(emitter, true, false) { + return false + } + emitter.flow_level++ + } + + if event.typ == yaml_MAPPING_END_EVENT { + emitter.flow_level-- + emitter.indent = emitter.indents[len(emitter.indents)-1] + emitter.indents = emitter.indents[:len(emitter.indents)-1] + if emitter.canonical && !first { + if !yaml_emitter_write_indicator(emitter, []byte{','}, false, false, false) { + return false + } + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !yaml_emitter_write_indicator(emitter, []byte{'}'}, false, false, false) { + return false + } + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + return true + } + + if !first { + if !yaml_emitter_write_indicator(emitter, []byte{','}, false, false, false) { + return false + } + } + if emitter.canonical || emitter.column > emitter.best_width { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + + if !emitter.canonical && yaml_emitter_check_simple_key(emitter) { + emitter.states = append(emitter.states, yaml_EMIT_FLOW_MAPPING_SIMPLE_VALUE_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, true) + } + if !yaml_emitter_write_indicator(emitter, []byte{'?'}, true, false, false) { + return false + } + emitter.states = append(emitter.states, yaml_EMIT_FLOW_MAPPING_VALUE_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, false) +} + +// Expect a flow value node. +func yaml_emitter_emit_flow_mapping_value(emitter *yaml_emitter_t, event *yaml_event_t, simple bool) bool { + if simple { + if !yaml_emitter_write_indicator(emitter, []byte{':'}, false, false, false) { + return false + } + } else { + if emitter.canonical || emitter.column > emitter.best_width { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !yaml_emitter_write_indicator(emitter, []byte{':'}, true, false, false) { + return false + } + } + emitter.states = append(emitter.states, yaml_EMIT_FLOW_MAPPING_KEY_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, false) +} + +// Expect a block item node. +func yaml_emitter_emit_block_sequence_item(emitter *yaml_emitter_t, event *yaml_event_t, first bool) bool { + if first { + if !yaml_emitter_increase_indent(emitter, false, emitter.mapping_context && !emitter.indention) { + return false + } + } + if event.typ == yaml_SEQUENCE_END_EVENT { + emitter.indent = emitter.indents[len(emitter.indents)-1] + emitter.indents = emitter.indents[:len(emitter.indents)-1] + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + return true + } + if !yaml_emitter_write_indent(emitter) { + return false + } + if !yaml_emitter_write_indicator(emitter, []byte{'-'}, true, false, true) { + return false + } + emitter.states = append(emitter.states, yaml_EMIT_BLOCK_SEQUENCE_ITEM_STATE) + return yaml_emitter_emit_node(emitter, event, false, true, false, false) +} + +// Expect a block key node. +func yaml_emitter_emit_block_mapping_key(emitter *yaml_emitter_t, event *yaml_event_t, first bool) bool { + if first { + if !yaml_emitter_increase_indent(emitter, false, false) { + return false + } + } + if event.typ == yaml_MAPPING_END_EVENT { + emitter.indent = emitter.indents[len(emitter.indents)-1] + emitter.indents = emitter.indents[:len(emitter.indents)-1] + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + return true + } + if !yaml_emitter_write_indent(emitter) { + return false + } + if yaml_emitter_check_simple_key(emitter) { + emitter.states = append(emitter.states, yaml_EMIT_BLOCK_MAPPING_SIMPLE_VALUE_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, true) + } + if !yaml_emitter_write_indicator(emitter, []byte{'?'}, true, false, true) { + return false + } + emitter.states = append(emitter.states, yaml_EMIT_BLOCK_MAPPING_VALUE_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, false) +} + +// Expect a block value node. +func yaml_emitter_emit_block_mapping_value(emitter *yaml_emitter_t, event *yaml_event_t, simple bool) bool { + if simple { + if !yaml_emitter_write_indicator(emitter, []byte{':'}, false, false, false) { + return false + } + } else { + if !yaml_emitter_write_indent(emitter) { + return false + } + if !yaml_emitter_write_indicator(emitter, []byte{':'}, true, false, true) { + return false + } + } + emitter.states = append(emitter.states, yaml_EMIT_BLOCK_MAPPING_KEY_STATE) + return yaml_emitter_emit_node(emitter, event, false, false, true, false) +} + +// Expect a node. +func yaml_emitter_emit_node(emitter *yaml_emitter_t, event *yaml_event_t, + root bool, sequence bool, mapping bool, simple_key bool) bool { + + emitter.root_context = root + emitter.sequence_context = sequence + emitter.mapping_context = mapping + emitter.simple_key_context = simple_key + + switch event.typ { + case yaml_ALIAS_EVENT: + return yaml_emitter_emit_alias(emitter, event) + case yaml_SCALAR_EVENT: + return yaml_emitter_emit_scalar(emitter, event) + case yaml_SEQUENCE_START_EVENT: + return yaml_emitter_emit_sequence_start(emitter, event) + case yaml_MAPPING_START_EVENT: + return yaml_emitter_emit_mapping_start(emitter, event) + default: + return yaml_emitter_set_emitter_error(emitter, + fmt.Sprintf("expected SCALAR, SEQUENCE-START, MAPPING-START, or ALIAS, but got %v", event.typ)) + } +} + +// Expect ALIAS. +func yaml_emitter_emit_alias(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if !yaml_emitter_process_anchor(emitter) { + return false + } + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + return true +} + +// Expect SCALAR. +func yaml_emitter_emit_scalar(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if !yaml_emitter_select_scalar_style(emitter, event) { + return false + } + if !yaml_emitter_process_anchor(emitter) { + return false + } + if !yaml_emitter_process_tag(emitter) { + return false + } + if !yaml_emitter_increase_indent(emitter, true, false) { + return false + } + if !yaml_emitter_process_scalar(emitter) { + return false + } + emitter.indent = emitter.indents[len(emitter.indents)-1] + emitter.indents = emitter.indents[:len(emitter.indents)-1] + emitter.state = emitter.states[len(emitter.states)-1] + emitter.states = emitter.states[:len(emitter.states)-1] + return true +} + +// Expect SEQUENCE-START. +func yaml_emitter_emit_sequence_start(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if !yaml_emitter_process_anchor(emitter) { + return false + } + if !yaml_emitter_process_tag(emitter) { + return false + } + if emitter.flow_level > 0 || emitter.canonical || event.sequence_style() == yaml_FLOW_SEQUENCE_STYLE || + yaml_emitter_check_empty_sequence(emitter) { + emitter.state = yaml_EMIT_FLOW_SEQUENCE_FIRST_ITEM_STATE + } else { + emitter.state = yaml_EMIT_BLOCK_SEQUENCE_FIRST_ITEM_STATE + } + return true +} + +// Expect MAPPING-START. +func yaml_emitter_emit_mapping_start(emitter *yaml_emitter_t, event *yaml_event_t) bool { + if !yaml_emitter_process_anchor(emitter) { + return false + } + if !yaml_emitter_process_tag(emitter) { + return false + } + if emitter.flow_level > 0 || emitter.canonical || event.mapping_style() == yaml_FLOW_MAPPING_STYLE || + yaml_emitter_check_empty_mapping(emitter) { + emitter.state = yaml_EMIT_FLOW_MAPPING_FIRST_KEY_STATE + } else { + emitter.state = yaml_EMIT_BLOCK_MAPPING_FIRST_KEY_STATE + } + return true +} + +// Check if the document content is an empty scalar. +func yaml_emitter_check_empty_document(emitter *yaml_emitter_t) bool { + return false // [Go] Huh? +} + +// Check if the next events represent an empty sequence. +func yaml_emitter_check_empty_sequence(emitter *yaml_emitter_t) bool { + if len(emitter.events)-emitter.events_head < 2 { + return false + } + return emitter.events[emitter.events_head].typ == yaml_SEQUENCE_START_EVENT && + emitter.events[emitter.events_head+1].typ == yaml_SEQUENCE_END_EVENT +} + +// Check if the next events represent an empty mapping. +func yaml_emitter_check_empty_mapping(emitter *yaml_emitter_t) bool { + if len(emitter.events)-emitter.events_head < 2 { + return false + } + return emitter.events[emitter.events_head].typ == yaml_MAPPING_START_EVENT && + emitter.events[emitter.events_head+1].typ == yaml_MAPPING_END_EVENT +} + +// Check if the next node can be expressed as a simple key. +func yaml_emitter_check_simple_key(emitter *yaml_emitter_t) bool { + length := 0 + switch emitter.events[emitter.events_head].typ { + case yaml_ALIAS_EVENT: + length += len(emitter.anchor_data.anchor) + case yaml_SCALAR_EVENT: + if emitter.scalar_data.multiline { + return false + } + length += len(emitter.anchor_data.anchor) + + len(emitter.tag_data.handle) + + len(emitter.tag_data.suffix) + + len(emitter.scalar_data.value) + case yaml_SEQUENCE_START_EVENT: + if !yaml_emitter_check_empty_sequence(emitter) { + return false + } + length += len(emitter.anchor_data.anchor) + + len(emitter.tag_data.handle) + + len(emitter.tag_data.suffix) + case yaml_MAPPING_START_EVENT: + if !yaml_emitter_check_empty_mapping(emitter) { + return false + } + length += len(emitter.anchor_data.anchor) + + len(emitter.tag_data.handle) + + len(emitter.tag_data.suffix) + default: + return false + } + return length <= 128 +} + +// Determine an acceptable scalar style. +func yaml_emitter_select_scalar_style(emitter *yaml_emitter_t, event *yaml_event_t) bool { + + no_tag := len(emitter.tag_data.handle) == 0 && len(emitter.tag_data.suffix) == 0 + if no_tag && !event.implicit && !event.quoted_implicit { + return yaml_emitter_set_emitter_error(emitter, "neither tag nor implicit flags are specified") + } + + style := event.scalar_style() + if style == yaml_ANY_SCALAR_STYLE { + style = yaml_PLAIN_SCALAR_STYLE + } + if emitter.canonical { + style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + if emitter.simple_key_context && emitter.scalar_data.multiline { + style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + + if style == yaml_PLAIN_SCALAR_STYLE { + if emitter.flow_level > 0 && !emitter.scalar_data.flow_plain_allowed || + emitter.flow_level == 0 && !emitter.scalar_data.block_plain_allowed { + style = yaml_SINGLE_QUOTED_SCALAR_STYLE + } + if len(emitter.scalar_data.value) == 0 && (emitter.flow_level > 0 || emitter.simple_key_context) { + style = yaml_SINGLE_QUOTED_SCALAR_STYLE + } + if no_tag && !event.implicit { + style = yaml_SINGLE_QUOTED_SCALAR_STYLE + } + } + if style == yaml_SINGLE_QUOTED_SCALAR_STYLE { + if !emitter.scalar_data.single_quoted_allowed { + style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + } + if style == yaml_LITERAL_SCALAR_STYLE || style == yaml_FOLDED_SCALAR_STYLE { + if !emitter.scalar_data.block_allowed || emitter.flow_level > 0 || emitter.simple_key_context { + style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + } + + if no_tag && !event.quoted_implicit && style != yaml_PLAIN_SCALAR_STYLE { + emitter.tag_data.handle = []byte{'!'} + } + emitter.scalar_data.style = style + return true +} + +// Write an anchor. +func yaml_emitter_process_anchor(emitter *yaml_emitter_t) bool { + if emitter.anchor_data.anchor == nil { + return true + } + c := []byte{'&'} + if emitter.anchor_data.alias { + c[0] = '*' + } + if !yaml_emitter_write_indicator(emitter, c, true, false, false) { + return false + } + return yaml_emitter_write_anchor(emitter, emitter.anchor_data.anchor) +} + +// Write a tag. +func yaml_emitter_process_tag(emitter *yaml_emitter_t) bool { + if len(emitter.tag_data.handle) == 0 && len(emitter.tag_data.suffix) == 0 { + return true + } + if len(emitter.tag_data.handle) > 0 { + if !yaml_emitter_write_tag_handle(emitter, emitter.tag_data.handle) { + return false + } + if len(emitter.tag_data.suffix) > 0 { + if !yaml_emitter_write_tag_content(emitter, emitter.tag_data.suffix, false) { + return false + } + } + } else { + // [Go] Allocate these slices elsewhere. + if !yaml_emitter_write_indicator(emitter, []byte("!<"), true, false, false) { + return false + } + if !yaml_emitter_write_tag_content(emitter, emitter.tag_data.suffix, false) { + return false + } + if !yaml_emitter_write_indicator(emitter, []byte{'>'}, false, false, false) { + return false + } + } + return true +} + +// Write a scalar. +func yaml_emitter_process_scalar(emitter *yaml_emitter_t) bool { + switch emitter.scalar_data.style { + case yaml_PLAIN_SCALAR_STYLE: + return yaml_emitter_write_plain_scalar(emitter, emitter.scalar_data.value, !emitter.simple_key_context) + + case yaml_SINGLE_QUOTED_SCALAR_STYLE: + return yaml_emitter_write_single_quoted_scalar(emitter, emitter.scalar_data.value, !emitter.simple_key_context) + + case yaml_DOUBLE_QUOTED_SCALAR_STYLE: + return yaml_emitter_write_double_quoted_scalar(emitter, emitter.scalar_data.value, !emitter.simple_key_context) + + case yaml_LITERAL_SCALAR_STYLE: + return yaml_emitter_write_literal_scalar(emitter, emitter.scalar_data.value) + + case yaml_FOLDED_SCALAR_STYLE: + return yaml_emitter_write_folded_scalar(emitter, emitter.scalar_data.value) + } + panic("unknown scalar style") +} + +// Check if a %YAML directive is valid. +func yaml_emitter_analyze_version_directive(emitter *yaml_emitter_t, version_directive *yaml_version_directive_t) bool { + if version_directive.major != 1 || version_directive.minor != 1 { + return yaml_emitter_set_emitter_error(emitter, "incompatible %YAML directive") + } + return true +} + +// Check if a %TAG directive is valid. +func yaml_emitter_analyze_tag_directive(emitter *yaml_emitter_t, tag_directive *yaml_tag_directive_t) bool { + handle := tag_directive.handle + prefix := tag_directive.prefix + if len(handle) == 0 { + return yaml_emitter_set_emitter_error(emitter, "tag handle must not be empty") + } + if handle[0] != '!' { + return yaml_emitter_set_emitter_error(emitter, "tag handle must start with '!'") + } + if handle[len(handle)-1] != '!' { + return yaml_emitter_set_emitter_error(emitter, "tag handle must end with '!'") + } + for i := 1; i < len(handle)-1; i += width(handle[i]) { + if !is_alpha(handle, i) { + return yaml_emitter_set_emitter_error(emitter, "tag handle must contain alphanumerical characters only") + } + } + if len(prefix) == 0 { + return yaml_emitter_set_emitter_error(emitter, "tag prefix must not be empty") + } + return true +} + +// Check if an anchor is valid. +func yaml_emitter_analyze_anchor(emitter *yaml_emitter_t, anchor []byte, alias bool) bool { + if len(anchor) == 0 { + problem := "anchor value must not be empty" + if alias { + problem = "alias value must not be empty" + } + return yaml_emitter_set_emitter_error(emitter, problem) + } + for i := 0; i < len(anchor); i += width(anchor[i]) { + if !is_alpha(anchor, i) { + problem := "anchor value must contain alphanumerical characters only" + if alias { + problem = "alias value must contain alphanumerical characters only" + } + return yaml_emitter_set_emitter_error(emitter, problem) + } + } + emitter.anchor_data.anchor = anchor + emitter.anchor_data.alias = alias + return true +} + +// Check if a tag is valid. +func yaml_emitter_analyze_tag(emitter *yaml_emitter_t, tag []byte) bool { + if len(tag) == 0 { + return yaml_emitter_set_emitter_error(emitter, "tag value must not be empty") + } + for i := 0; i < len(emitter.tag_directives); i++ { + tag_directive := &emitter.tag_directives[i] + if bytes.HasPrefix(tag, tag_directive.prefix) { + emitter.tag_data.handle = tag_directive.handle + emitter.tag_data.suffix = tag[len(tag_directive.prefix):] + return true + } + } + emitter.tag_data.suffix = tag + return true +} + +// Check if a scalar is valid. +func yaml_emitter_analyze_scalar(emitter *yaml_emitter_t, value []byte) bool { + var ( + block_indicators = false + flow_indicators = false + line_breaks = false + special_characters = false + + leading_space = false + leading_break = false + trailing_space = false + trailing_break = false + break_space = false + space_break = false + + preceded_by_whitespace = false + followed_by_whitespace = false + previous_space = false + previous_break = false + ) + + emitter.scalar_data.value = value + + if len(value) == 0 { + emitter.scalar_data.multiline = false + emitter.scalar_data.flow_plain_allowed = false + emitter.scalar_data.block_plain_allowed = true + emitter.scalar_data.single_quoted_allowed = true + emitter.scalar_data.block_allowed = false + return true + } + + if len(value) >= 3 && ((value[0] == '-' && value[1] == '-' && value[2] == '-') || (value[0] == '.' && value[1] == '.' && value[2] == '.')) { + block_indicators = true + flow_indicators = true + } + + preceded_by_whitespace = true + for i, w := 0, 0; i < len(value); i += w { + w = width(value[i]) + followed_by_whitespace = i+w >= len(value) || is_blank(value, i+w) + + if i == 0 { + switch value[i] { + case '#', ',', '[', ']', '{', '}', '&', '*', '!', '|', '>', '\'', '"', '%', '@', '`': + flow_indicators = true + block_indicators = true + case '?', ':': + flow_indicators = true + if followed_by_whitespace { + block_indicators = true + } + case '-': + if followed_by_whitespace { + flow_indicators = true + block_indicators = true + } + } + } else { + switch value[i] { + case ',', '?', '[', ']', '{', '}': + flow_indicators = true + case ':': + flow_indicators = true + if followed_by_whitespace { + block_indicators = true + } + case '#': + if preceded_by_whitespace { + flow_indicators = true + block_indicators = true + } + } + } + + if !is_printable(value, i) || !is_ascii(value, i) && !emitter.unicode { + special_characters = true + } + if is_space(value, i) { + if i == 0 { + leading_space = true + } + if i+width(value[i]) == len(value) { + trailing_space = true + } + if previous_break { + break_space = true + } + previous_space = true + previous_break = false + } else if is_break(value, i) { + line_breaks = true + if i == 0 { + leading_break = true + } + if i+width(value[i]) == len(value) { + trailing_break = true + } + if previous_space { + space_break = true + } + previous_space = false + previous_break = true + } else { + previous_space = false + previous_break = false + } + + // [Go]: Why 'z'? Couldn't be the end of the string as that's the loop condition. + preceded_by_whitespace = is_blankz(value, i) + } + + emitter.scalar_data.multiline = line_breaks + emitter.scalar_data.flow_plain_allowed = true + emitter.scalar_data.block_plain_allowed = true + emitter.scalar_data.single_quoted_allowed = true + emitter.scalar_data.block_allowed = true + + if leading_space || leading_break || trailing_space || trailing_break { + emitter.scalar_data.flow_plain_allowed = false + emitter.scalar_data.block_plain_allowed = false + } + if trailing_space { + emitter.scalar_data.block_allowed = false + } + if break_space { + emitter.scalar_data.flow_plain_allowed = false + emitter.scalar_data.block_plain_allowed = false + emitter.scalar_data.single_quoted_allowed = false + } + if space_break || special_characters { + emitter.scalar_data.flow_plain_allowed = false + emitter.scalar_data.block_plain_allowed = false + emitter.scalar_data.single_quoted_allowed = false + emitter.scalar_data.block_allowed = false + } + if line_breaks { + emitter.scalar_data.flow_plain_allowed = false + emitter.scalar_data.block_plain_allowed = false + } + if flow_indicators { + emitter.scalar_data.flow_plain_allowed = false + } + if block_indicators { + emitter.scalar_data.block_plain_allowed = false + } + return true +} + +// Check if the event data is valid. +func yaml_emitter_analyze_event(emitter *yaml_emitter_t, event *yaml_event_t) bool { + + emitter.anchor_data.anchor = nil + emitter.tag_data.handle = nil + emitter.tag_data.suffix = nil + emitter.scalar_data.value = nil + + switch event.typ { + case yaml_ALIAS_EVENT: + if !yaml_emitter_analyze_anchor(emitter, event.anchor, true) { + return false + } + + case yaml_SCALAR_EVENT: + if len(event.anchor) > 0 { + if !yaml_emitter_analyze_anchor(emitter, event.anchor, false) { + return false + } + } + if len(event.tag) > 0 && (emitter.canonical || (!event.implicit && !event.quoted_implicit)) { + if !yaml_emitter_analyze_tag(emitter, event.tag) { + return false + } + } + if !yaml_emitter_analyze_scalar(emitter, event.value) { + return false + } + + case yaml_SEQUENCE_START_EVENT: + if len(event.anchor) > 0 { + if !yaml_emitter_analyze_anchor(emitter, event.anchor, false) { + return false + } + } + if len(event.tag) > 0 && (emitter.canonical || !event.implicit) { + if !yaml_emitter_analyze_tag(emitter, event.tag) { + return false + } + } + + case yaml_MAPPING_START_EVENT: + if len(event.anchor) > 0 { + if !yaml_emitter_analyze_anchor(emitter, event.anchor, false) { + return false + } + } + if len(event.tag) > 0 && (emitter.canonical || !event.implicit) { + if !yaml_emitter_analyze_tag(emitter, event.tag) { + return false + } + } + } + return true +} + +// Write the BOM character. +func yaml_emitter_write_bom(emitter *yaml_emitter_t) bool { + if !flush(emitter) { + return false + } + pos := emitter.buffer_pos + emitter.buffer[pos+0] = '\xEF' + emitter.buffer[pos+1] = '\xBB' + emitter.buffer[pos+2] = '\xBF' + emitter.buffer_pos += 3 + return true +} + +func yaml_emitter_write_indent(emitter *yaml_emitter_t) bool { + indent := emitter.indent + if indent < 0 { + indent = 0 + } + if !emitter.indention || emitter.column > indent || (emitter.column == indent && !emitter.whitespace) { + if !put_break(emitter) { + return false + } + } + for emitter.column < indent { + if !put(emitter, ' ') { + return false + } + } + emitter.whitespace = true + emitter.indention = true + return true +} + +func yaml_emitter_write_indicator(emitter *yaml_emitter_t, indicator []byte, need_whitespace, is_whitespace, is_indention bool) bool { + if need_whitespace && !emitter.whitespace { + if !put(emitter, ' ') { + return false + } + } + if !write_all(emitter, indicator) { + return false + } + emitter.whitespace = is_whitespace + emitter.indention = (emitter.indention && is_indention) + emitter.open_ended = false + return true +} + +func yaml_emitter_write_anchor(emitter *yaml_emitter_t, value []byte) bool { + if !write_all(emitter, value) { + return false + } + emitter.whitespace = false + emitter.indention = false + return true +} + +func yaml_emitter_write_tag_handle(emitter *yaml_emitter_t, value []byte) bool { + if !emitter.whitespace { + if !put(emitter, ' ') { + return false + } + } + if !write_all(emitter, value) { + return false + } + emitter.whitespace = false + emitter.indention = false + return true +} + +func yaml_emitter_write_tag_content(emitter *yaml_emitter_t, value []byte, need_whitespace bool) bool { + if need_whitespace && !emitter.whitespace { + if !put(emitter, ' ') { + return false + } + } + for i := 0; i < len(value); { + var must_write bool + switch value[i] { + case ';', '/', '?', ':', '@', '&', '=', '+', '$', ',', '_', '.', '~', '*', '\'', '(', ')', '[', ']': + must_write = true + default: + must_write = is_alpha(value, i) + } + if must_write { + if !write(emitter, value, &i) { + return false + } + } else { + w := width(value[i]) + for k := 0; k < w; k++ { + octet := value[i] + i++ + if !put(emitter, '%') { + return false + } + + c := octet >> 4 + if c < 10 { + c += '0' + } else { + c += 'A' - 10 + } + if !put(emitter, c) { + return false + } + + c = octet & 0x0f + if c < 10 { + c += '0' + } else { + c += 'A' - 10 + } + if !put(emitter, c) { + return false + } + } + } + } + emitter.whitespace = false + emitter.indention = false + return true +} + +func yaml_emitter_write_plain_scalar(emitter *yaml_emitter_t, value []byte, allow_breaks bool) bool { + if !emitter.whitespace { + if !put(emitter, ' ') { + return false + } + } + + spaces := false + breaks := false + for i := 0; i < len(value); { + if is_space(value, i) { + if allow_breaks && !spaces && emitter.column > emitter.best_width && !is_space(value, i+1) { + if !yaml_emitter_write_indent(emitter) { + return false + } + i += width(value[i]) + } else { + if !write(emitter, value, &i) { + return false + } + } + spaces = true + } else if is_break(value, i) { + if !breaks && value[i] == '\n' { + if !put_break(emitter) { + return false + } + } + if !write_break(emitter, value, &i) { + return false + } + emitter.indention = true + breaks = true + } else { + if breaks { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !write(emitter, value, &i) { + return false + } + emitter.indention = false + spaces = false + breaks = false + } + } + + emitter.whitespace = false + emitter.indention = false + if emitter.root_context { + emitter.open_ended = true + } + + return true +} + +func yaml_emitter_write_single_quoted_scalar(emitter *yaml_emitter_t, value []byte, allow_breaks bool) bool { + + if !yaml_emitter_write_indicator(emitter, []byte{'\''}, true, false, false) { + return false + } + + spaces := false + breaks := false + for i := 0; i < len(value); { + if is_space(value, i) { + if allow_breaks && !spaces && emitter.column > emitter.best_width && i > 0 && i < len(value)-1 && !is_space(value, i+1) { + if !yaml_emitter_write_indent(emitter) { + return false + } + i += width(value[i]) + } else { + if !write(emitter, value, &i) { + return false + } + } + spaces = true + } else if is_break(value, i) { + if !breaks && value[i] == '\n' { + if !put_break(emitter) { + return false + } + } + if !write_break(emitter, value, &i) { + return false + } + emitter.indention = true + breaks = true + } else { + if breaks { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if value[i] == '\'' { + if !put(emitter, '\'') { + return false + } + } + if !write(emitter, value, &i) { + return false + } + emitter.indention = false + spaces = false + breaks = false + } + } + if !yaml_emitter_write_indicator(emitter, []byte{'\''}, false, false, false) { + return false + } + emitter.whitespace = false + emitter.indention = false + return true +} + +func yaml_emitter_write_double_quoted_scalar(emitter *yaml_emitter_t, value []byte, allow_breaks bool) bool { + spaces := false + if !yaml_emitter_write_indicator(emitter, []byte{'"'}, true, false, false) { + return false + } + + for i := 0; i < len(value); { + if !is_printable(value, i) || (!emitter.unicode && !is_ascii(value, i)) || + is_bom(value, i) || is_break(value, i) || + value[i] == '"' || value[i] == '\\' { + + octet := value[i] + + var w int + var v rune + switch { + case octet&0x80 == 0x00: + w, v = 1, rune(octet&0x7F) + case octet&0xE0 == 0xC0: + w, v = 2, rune(octet&0x1F) + case octet&0xF0 == 0xE0: + w, v = 3, rune(octet&0x0F) + case octet&0xF8 == 0xF0: + w, v = 4, rune(octet&0x07) + } + for k := 1; k < w; k++ { + octet = value[i+k] + v = (v << 6) + (rune(octet) & 0x3F) + } + i += w + + if !put(emitter, '\\') { + return false + } + + var ok bool + switch v { + case 0x00: + ok = put(emitter, '0') + case 0x07: + ok = put(emitter, 'a') + case 0x08: + ok = put(emitter, 'b') + case 0x09: + ok = put(emitter, 't') + case 0x0A: + ok = put(emitter, 'n') + case 0x0b: + ok = put(emitter, 'v') + case 0x0c: + ok = put(emitter, 'f') + case 0x0d: + ok = put(emitter, 'r') + case 0x1b: + ok = put(emitter, 'e') + case 0x22: + ok = put(emitter, '"') + case 0x5c: + ok = put(emitter, '\\') + case 0x85: + ok = put(emitter, 'N') + case 0xA0: + ok = put(emitter, '_') + case 0x2028: + ok = put(emitter, 'L') + case 0x2029: + ok = put(emitter, 'P') + default: + if v <= 0xFF { + ok = put(emitter, 'x') + w = 2 + } else if v <= 0xFFFF { + ok = put(emitter, 'u') + w = 4 + } else { + ok = put(emitter, 'U') + w = 8 + } + for k := (w - 1) * 4; ok && k >= 0; k -= 4 { + digit := byte((v >> uint(k)) & 0x0F) + if digit < 10 { + ok = put(emitter, digit+'0') + } else { + ok = put(emitter, digit+'A'-10) + } + } + } + if !ok { + return false + } + spaces = false + } else if is_space(value, i) { + if allow_breaks && !spaces && emitter.column > emitter.best_width && i > 0 && i < len(value)-1 { + if !yaml_emitter_write_indent(emitter) { + return false + } + if is_space(value, i+1) { + if !put(emitter, '\\') { + return false + } + } + i += width(value[i]) + } else if !write(emitter, value, &i) { + return false + } + spaces = true + } else { + if !write(emitter, value, &i) { + return false + } + spaces = false + } + } + if !yaml_emitter_write_indicator(emitter, []byte{'"'}, false, false, false) { + return false + } + emitter.whitespace = false + emitter.indention = false + return true +} + +func yaml_emitter_write_block_scalar_hints(emitter *yaml_emitter_t, value []byte) bool { + if is_space(value, 0) || is_break(value, 0) { + indent_hint := []byte{'0' + byte(emitter.best_indent)} + if !yaml_emitter_write_indicator(emitter, indent_hint, false, false, false) { + return false + } + } + + emitter.open_ended = false + + var chomp_hint [1]byte + if len(value) == 0 { + chomp_hint[0] = '-' + } else { + i := len(value) - 1 + for value[i]&0xC0 == 0x80 { + i-- + } + if !is_break(value, i) { + chomp_hint[0] = '-' + } else if i == 0 { + chomp_hint[0] = '+' + emitter.open_ended = true + } else { + i-- + for value[i]&0xC0 == 0x80 { + i-- + } + if is_break(value, i) { + chomp_hint[0] = '+' + emitter.open_ended = true + } + } + } + if chomp_hint[0] != 0 { + if !yaml_emitter_write_indicator(emitter, chomp_hint[:], false, false, false) { + return false + } + } + return true +} + +func yaml_emitter_write_literal_scalar(emitter *yaml_emitter_t, value []byte) bool { + if !yaml_emitter_write_indicator(emitter, []byte{'|'}, true, false, false) { + return false + } + if !yaml_emitter_write_block_scalar_hints(emitter, value) { + return false + } + if !put_break(emitter) { + return false + } + emitter.indention = true + emitter.whitespace = true + breaks := true + for i := 0; i < len(value); { + if is_break(value, i) { + if !write_break(emitter, value, &i) { + return false + } + emitter.indention = true + breaks = true + } else { + if breaks { + if !yaml_emitter_write_indent(emitter) { + return false + } + } + if !write(emitter, value, &i) { + return false + } + emitter.indention = false + breaks = false + } + } + + return true +} + +func yaml_emitter_write_folded_scalar(emitter *yaml_emitter_t, value []byte) bool { + if !yaml_emitter_write_indicator(emitter, []byte{'>'}, true, false, false) { + return false + } + if !yaml_emitter_write_block_scalar_hints(emitter, value) { + return false + } + + if !put_break(emitter) { + return false + } + emitter.indention = true + emitter.whitespace = true + + breaks := true + leading_spaces := true + for i := 0; i < len(value); { + if is_break(value, i) { + if !breaks && !leading_spaces && value[i] == '\n' { + k := 0 + for is_break(value, k) { + k += width(value[k]) + } + if !is_blankz(value, k) { + if !put_break(emitter) { + return false + } + } + } + if !write_break(emitter, value, &i) { + return false + } + emitter.indention = true + breaks = true + } else { + if breaks { + if !yaml_emitter_write_indent(emitter) { + return false + } + leading_spaces = is_blank(value, i) + } + if !breaks && is_space(value, i) && !is_space(value, i+1) && emitter.column > emitter.best_width { + if !yaml_emitter_write_indent(emitter) { + return false + } + i += width(value[i]) + } else { + if !write(emitter, value, &i) { + return false + } + } + emitter.indention = false + breaks = false + } + } + return true +} diff --git a/vendor/gopkg.in/yaml.v2/encode.go b/vendor/gopkg.in/yaml.v2/encode.go new file mode 100644 index 0000000..0ee738e --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/encode.go @@ -0,0 +1,390 @@ +package yaml + +import ( + "encoding" + "fmt" + "io" + "reflect" + "regexp" + "sort" + "strconv" + "strings" + "time" + "unicode/utf8" +) + +// jsonNumber is the interface of the encoding/json.Number datatype. +// Repeating the interface here avoids a dependency on encoding/json, and also +// supports other libraries like jsoniter, which use a similar datatype with +// the same interface. Detecting this interface is useful when dealing with +// structures containing json.Number, which is a string under the hood. The +// encoder should prefer the use of Int64(), Float64() and string(), in that +// order, when encoding this type. +type jsonNumber interface { + Float64() (float64, error) + Int64() (int64, error) + String() string +} + +type encoder struct { + emitter yaml_emitter_t + event yaml_event_t + out []byte + flow bool + // doneInit holds whether the initial stream_start_event has been + // emitted. + doneInit bool +} + +func newEncoder() *encoder { + e := &encoder{} + yaml_emitter_initialize(&e.emitter) + yaml_emitter_set_output_string(&e.emitter, &e.out) + yaml_emitter_set_unicode(&e.emitter, true) + return e +} + +func newEncoderWithWriter(w io.Writer) *encoder { + e := &encoder{} + yaml_emitter_initialize(&e.emitter) + yaml_emitter_set_output_writer(&e.emitter, w) + yaml_emitter_set_unicode(&e.emitter, true) + return e +} + +func (e *encoder) init() { + if e.doneInit { + return + } + yaml_stream_start_event_initialize(&e.event, yaml_UTF8_ENCODING) + e.emit() + e.doneInit = true +} + +func (e *encoder) finish() { + e.emitter.open_ended = false + yaml_stream_end_event_initialize(&e.event) + e.emit() +} + +func (e *encoder) destroy() { + yaml_emitter_delete(&e.emitter) +} + +func (e *encoder) emit() { + // This will internally delete the e.event value. + e.must(yaml_emitter_emit(&e.emitter, &e.event)) +} + +func (e *encoder) must(ok bool) { + if !ok { + msg := e.emitter.problem + if msg == "" { + msg = "unknown problem generating YAML content" + } + failf("%s", msg) + } +} + +func (e *encoder) marshalDoc(tag string, in reflect.Value) { + e.init() + yaml_document_start_event_initialize(&e.event, nil, nil, true) + e.emit() + e.marshal(tag, in) + yaml_document_end_event_initialize(&e.event, true) + e.emit() +} + +func (e *encoder) marshal(tag string, in reflect.Value) { + if !in.IsValid() || in.Kind() == reflect.Ptr && in.IsNil() { + e.nilv() + return + } + iface := in.Interface() + switch m := iface.(type) { + case jsonNumber: + integer, err := m.Int64() + if err == nil { + // In this case the json.Number is a valid int64 + in = reflect.ValueOf(integer) + break + } + float, err := m.Float64() + if err == nil { + // In this case the json.Number is a valid float64 + in = reflect.ValueOf(float) + break + } + // fallback case - no number could be obtained + in = reflect.ValueOf(m.String()) + case time.Time, *time.Time: + // Although time.Time implements TextMarshaler, + // we don't want to treat it as a string for YAML + // purposes because YAML has special support for + // timestamps. + case Marshaler: + v, err := m.MarshalYAML() + if err != nil { + fail(err) + } + if v == nil { + e.nilv() + return + } + in = reflect.ValueOf(v) + case encoding.TextMarshaler: + text, err := m.MarshalText() + if err != nil { + fail(err) + } + in = reflect.ValueOf(string(text)) + case nil: + e.nilv() + return + } + switch in.Kind() { + case reflect.Interface: + e.marshal(tag, in.Elem()) + case reflect.Map: + e.mapv(tag, in) + case reflect.Ptr: + if in.Type() == ptrTimeType { + e.timev(tag, in.Elem()) + } else { + e.marshal(tag, in.Elem()) + } + case reflect.Struct: + if in.Type() == timeType { + e.timev(tag, in) + } else { + e.structv(tag, in) + } + case reflect.Slice, reflect.Array: + if in.Type().Elem() == mapItemType { + e.itemsv(tag, in) + } else { + e.slicev(tag, in) + } + case reflect.String: + e.stringv(tag, in) + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + if in.Type() == durationType { + e.stringv(tag, reflect.ValueOf(iface.(time.Duration).String())) + } else { + e.intv(tag, in) + } + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + e.uintv(tag, in) + case reflect.Float32, reflect.Float64: + e.floatv(tag, in) + case reflect.Bool: + e.boolv(tag, in) + default: + panic("cannot marshal type: " + in.Type().String()) + } +} + +func (e *encoder) mapv(tag string, in reflect.Value) { + e.mappingv(tag, func() { + keys := keyList(in.MapKeys()) + sort.Sort(keys) + for _, k := range keys { + e.marshal("", k) + e.marshal("", in.MapIndex(k)) + } + }) +} + +func (e *encoder) itemsv(tag string, in reflect.Value) { + e.mappingv(tag, func() { + slice := in.Convert(reflect.TypeOf([]MapItem{})).Interface().([]MapItem) + for _, item := range slice { + e.marshal("", reflect.ValueOf(item.Key)) + e.marshal("", reflect.ValueOf(item.Value)) + } + }) +} + +func (e *encoder) structv(tag string, in reflect.Value) { + sinfo, err := getStructInfo(in.Type()) + if err != nil { + panic(err) + } + e.mappingv(tag, func() { + for _, info := range sinfo.FieldsList { + var value reflect.Value + if info.Inline == nil { + value = in.Field(info.Num) + } else { + value = in.FieldByIndex(info.Inline) + } + if info.OmitEmpty && isZero(value) { + continue + } + e.marshal("", reflect.ValueOf(info.Key)) + e.flow = info.Flow + e.marshal("", value) + } + if sinfo.InlineMap >= 0 { + m := in.Field(sinfo.InlineMap) + if m.Len() > 0 { + e.flow = false + keys := keyList(m.MapKeys()) + sort.Sort(keys) + for _, k := range keys { + if _, found := sinfo.FieldsMap[k.String()]; found { + panic(fmt.Sprintf("Can't have key %q in inlined map; conflicts with struct field", k.String())) + } + e.marshal("", k) + e.flow = false + e.marshal("", m.MapIndex(k)) + } + } + } + }) +} + +func (e *encoder) mappingv(tag string, f func()) { + implicit := tag == "" + style := yaml_BLOCK_MAPPING_STYLE + if e.flow { + e.flow = false + style = yaml_FLOW_MAPPING_STYLE + } + yaml_mapping_start_event_initialize(&e.event, nil, []byte(tag), implicit, style) + e.emit() + f() + yaml_mapping_end_event_initialize(&e.event) + e.emit() +} + +func (e *encoder) slicev(tag string, in reflect.Value) { + implicit := tag == "" + style := yaml_BLOCK_SEQUENCE_STYLE + if e.flow { + e.flow = false + style = yaml_FLOW_SEQUENCE_STYLE + } + e.must(yaml_sequence_start_event_initialize(&e.event, nil, []byte(tag), implicit, style)) + e.emit() + n := in.Len() + for i := 0; i < n; i++ { + e.marshal("", in.Index(i)) + } + e.must(yaml_sequence_end_event_initialize(&e.event)) + e.emit() +} + +// isBase60 returns whether s is in base 60 notation as defined in YAML 1.1. +// +// The base 60 float notation in YAML 1.1 is a terrible idea and is unsupported +// in YAML 1.2 and by this package, but these should be marshalled quoted for +// the time being for compatibility with other parsers. +func isBase60Float(s string) (result bool) { + // Fast path. + if s == "" { + return false + } + c := s[0] + if !(c == '+' || c == '-' || c >= '0' && c <= '9') || strings.IndexByte(s, ':') < 0 { + return false + } + // Do the full match. + return base60float.MatchString(s) +} + +// From http://yaml.org/type/float.html, except the regular expression there +// is bogus. In practice parsers do not enforce the "\.[0-9_]*" suffix. +var base60float = regexp.MustCompile(`^[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+(?:\.[0-9_]*)?$`) + +func (e *encoder) stringv(tag string, in reflect.Value) { + var style yaml_scalar_style_t + s := in.String() + canUsePlain := true + switch { + case !utf8.ValidString(s): + if tag == yaml_BINARY_TAG { + failf("explicitly tagged !!binary data must be base64-encoded") + } + if tag != "" { + failf("cannot marshal invalid UTF-8 data as %s", shortTag(tag)) + } + // It can't be encoded directly as YAML so use a binary tag + // and encode it as base64. + tag = yaml_BINARY_TAG + s = encodeBase64(s) + case tag == "": + // Check to see if it would resolve to a specific + // tag when encoded unquoted. If it doesn't, + // there's no need to quote it. + rtag, _ := resolve("", s) + canUsePlain = rtag == yaml_STR_TAG && !isBase60Float(s) + } + // Note: it's possible for user code to emit invalid YAML + // if they explicitly specify a tag and a string containing + // text that's incompatible with that tag. + switch { + case strings.Contains(s, "\n"): + style = yaml_LITERAL_SCALAR_STYLE + case canUsePlain: + style = yaml_PLAIN_SCALAR_STYLE + default: + style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + e.emitScalar(s, "", tag, style) +} + +func (e *encoder) boolv(tag string, in reflect.Value) { + var s string + if in.Bool() { + s = "true" + } else { + s = "false" + } + e.emitScalar(s, "", tag, yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) intv(tag string, in reflect.Value) { + s := strconv.FormatInt(in.Int(), 10) + e.emitScalar(s, "", tag, yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) uintv(tag string, in reflect.Value) { + s := strconv.FormatUint(in.Uint(), 10) + e.emitScalar(s, "", tag, yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) timev(tag string, in reflect.Value) { + t := in.Interface().(time.Time) + s := t.Format(time.RFC3339Nano) + e.emitScalar(s, "", tag, yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) floatv(tag string, in reflect.Value) { + // Issue #352: When formatting, use the precision of the underlying value + precision := 64 + if in.Kind() == reflect.Float32 { + precision = 32 + } + + s := strconv.FormatFloat(in.Float(), 'g', -1, precision) + switch s { + case "+Inf": + s = ".inf" + case "-Inf": + s = "-.inf" + case "NaN": + s = ".nan" + } + e.emitScalar(s, "", tag, yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) nilv() { + e.emitScalar("null", "", "", yaml_PLAIN_SCALAR_STYLE) +} + +func (e *encoder) emitScalar(value, anchor, tag string, style yaml_scalar_style_t) { + implicit := tag == "" + e.must(yaml_scalar_event_initialize(&e.event, []byte(anchor), []byte(tag), []byte(value), implicit, implicit, style)) + e.emit() +} diff --git a/vendor/gopkg.in/yaml.v2/go.mod b/vendor/gopkg.in/yaml.v2/go.mod new file mode 100644 index 0000000..1934e87 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/go.mod @@ -0,0 +1,5 @@ +module "gopkg.in/yaml.v2" + +require ( + "gopkg.in/check.v1" v0.0.0-20161208181325-20d25e280405 +) diff --git a/vendor/gopkg.in/yaml.v2/parserc.go b/vendor/gopkg.in/yaml.v2/parserc.go new file mode 100644 index 0000000..81d05df --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/parserc.go @@ -0,0 +1,1095 @@ +package yaml + +import ( + "bytes" +) + +// The parser implements the following grammar: +// +// stream ::= STREAM-START implicit_document? explicit_document* STREAM-END +// implicit_document ::= block_node DOCUMENT-END* +// explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* +// block_node_or_indentless_sequence ::= +// ALIAS +// | properties (block_content | indentless_block_sequence)? +// | block_content +// | indentless_block_sequence +// block_node ::= ALIAS +// | properties block_content? +// | block_content +// flow_node ::= ALIAS +// | properties flow_content? +// | flow_content +// properties ::= TAG ANCHOR? | ANCHOR TAG? +// block_content ::= block_collection | flow_collection | SCALAR +// flow_content ::= flow_collection | SCALAR +// block_collection ::= block_sequence | block_mapping +// flow_collection ::= flow_sequence | flow_mapping +// block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END +// indentless_sequence ::= (BLOCK-ENTRY block_node?)+ +// block_mapping ::= BLOCK-MAPPING_START +// ((KEY block_node_or_indentless_sequence?)? +// (VALUE block_node_or_indentless_sequence?)?)* +// BLOCK-END +// flow_sequence ::= FLOW-SEQUENCE-START +// (flow_sequence_entry FLOW-ENTRY)* +// flow_sequence_entry? +// FLOW-SEQUENCE-END +// flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// flow_mapping ::= FLOW-MAPPING-START +// (flow_mapping_entry FLOW-ENTRY)* +// flow_mapping_entry? +// FLOW-MAPPING-END +// flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? + +// Peek the next token in the token queue. +func peek_token(parser *yaml_parser_t) *yaml_token_t { + if parser.token_available || yaml_parser_fetch_more_tokens(parser) { + return &parser.tokens[parser.tokens_head] + } + return nil +} + +// Remove the next token from the queue (must be called after peek_token). +func skip_token(parser *yaml_parser_t) { + parser.token_available = false + parser.tokens_parsed++ + parser.stream_end_produced = parser.tokens[parser.tokens_head].typ == yaml_STREAM_END_TOKEN + parser.tokens_head++ +} + +// Get the next event. +func yaml_parser_parse(parser *yaml_parser_t, event *yaml_event_t) bool { + // Erase the event object. + *event = yaml_event_t{} + + // No events after the end of the stream or error. + if parser.stream_end_produced || parser.error != yaml_NO_ERROR || parser.state == yaml_PARSE_END_STATE { + return true + } + + // Generate the next event. + return yaml_parser_state_machine(parser, event) +} + +// Set parser error. +func yaml_parser_set_parser_error(parser *yaml_parser_t, problem string, problem_mark yaml_mark_t) bool { + parser.error = yaml_PARSER_ERROR + parser.problem = problem + parser.problem_mark = problem_mark + return false +} + +func yaml_parser_set_parser_error_context(parser *yaml_parser_t, context string, context_mark yaml_mark_t, problem string, problem_mark yaml_mark_t) bool { + parser.error = yaml_PARSER_ERROR + parser.context = context + parser.context_mark = context_mark + parser.problem = problem + parser.problem_mark = problem_mark + return false +} + +// State dispatcher. +func yaml_parser_state_machine(parser *yaml_parser_t, event *yaml_event_t) bool { + //trace("yaml_parser_state_machine", "state:", parser.state.String()) + + switch parser.state { + case yaml_PARSE_STREAM_START_STATE: + return yaml_parser_parse_stream_start(parser, event) + + case yaml_PARSE_IMPLICIT_DOCUMENT_START_STATE: + return yaml_parser_parse_document_start(parser, event, true) + + case yaml_PARSE_DOCUMENT_START_STATE: + return yaml_parser_parse_document_start(parser, event, false) + + case yaml_PARSE_DOCUMENT_CONTENT_STATE: + return yaml_parser_parse_document_content(parser, event) + + case yaml_PARSE_DOCUMENT_END_STATE: + return yaml_parser_parse_document_end(parser, event) + + case yaml_PARSE_BLOCK_NODE_STATE: + return yaml_parser_parse_node(parser, event, true, false) + + case yaml_PARSE_BLOCK_NODE_OR_INDENTLESS_SEQUENCE_STATE: + return yaml_parser_parse_node(parser, event, true, true) + + case yaml_PARSE_FLOW_NODE_STATE: + return yaml_parser_parse_node(parser, event, false, false) + + case yaml_PARSE_BLOCK_SEQUENCE_FIRST_ENTRY_STATE: + return yaml_parser_parse_block_sequence_entry(parser, event, true) + + case yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE: + return yaml_parser_parse_block_sequence_entry(parser, event, false) + + case yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE: + return yaml_parser_parse_indentless_sequence_entry(parser, event) + + case yaml_PARSE_BLOCK_MAPPING_FIRST_KEY_STATE: + return yaml_parser_parse_block_mapping_key(parser, event, true) + + case yaml_PARSE_BLOCK_MAPPING_KEY_STATE: + return yaml_parser_parse_block_mapping_key(parser, event, false) + + case yaml_PARSE_BLOCK_MAPPING_VALUE_STATE: + return yaml_parser_parse_block_mapping_value(parser, event) + + case yaml_PARSE_FLOW_SEQUENCE_FIRST_ENTRY_STATE: + return yaml_parser_parse_flow_sequence_entry(parser, event, true) + + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE: + return yaml_parser_parse_flow_sequence_entry(parser, event, false) + + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_KEY_STATE: + return yaml_parser_parse_flow_sequence_entry_mapping_key(parser, event) + + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE: + return yaml_parser_parse_flow_sequence_entry_mapping_value(parser, event) + + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE: + return yaml_parser_parse_flow_sequence_entry_mapping_end(parser, event) + + case yaml_PARSE_FLOW_MAPPING_FIRST_KEY_STATE: + return yaml_parser_parse_flow_mapping_key(parser, event, true) + + case yaml_PARSE_FLOW_MAPPING_KEY_STATE: + return yaml_parser_parse_flow_mapping_key(parser, event, false) + + case yaml_PARSE_FLOW_MAPPING_VALUE_STATE: + return yaml_parser_parse_flow_mapping_value(parser, event, false) + + case yaml_PARSE_FLOW_MAPPING_EMPTY_VALUE_STATE: + return yaml_parser_parse_flow_mapping_value(parser, event, true) + + default: + panic("invalid parser state") + } +} + +// Parse the production: +// stream ::= STREAM-START implicit_document? explicit_document* STREAM-END +// ************ +func yaml_parser_parse_stream_start(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_STREAM_START_TOKEN { + return yaml_parser_set_parser_error(parser, "did not find expected ", token.start_mark) + } + parser.state = yaml_PARSE_IMPLICIT_DOCUMENT_START_STATE + *event = yaml_event_t{ + typ: yaml_STREAM_START_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + encoding: token.encoding, + } + skip_token(parser) + return true +} + +// Parse the productions: +// implicit_document ::= block_node DOCUMENT-END* +// * +// explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* +// ************************* +func yaml_parser_parse_document_start(parser *yaml_parser_t, event *yaml_event_t, implicit bool) bool { + + token := peek_token(parser) + if token == nil { + return false + } + + // Parse extra document end indicators. + if !implicit { + for token.typ == yaml_DOCUMENT_END_TOKEN { + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } + } + + if implicit && token.typ != yaml_VERSION_DIRECTIVE_TOKEN && + token.typ != yaml_TAG_DIRECTIVE_TOKEN && + token.typ != yaml_DOCUMENT_START_TOKEN && + token.typ != yaml_STREAM_END_TOKEN { + // Parse an implicit document. + if !yaml_parser_process_directives(parser, nil, nil) { + return false + } + parser.states = append(parser.states, yaml_PARSE_DOCUMENT_END_STATE) + parser.state = yaml_PARSE_BLOCK_NODE_STATE + + *event = yaml_event_t{ + typ: yaml_DOCUMENT_START_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + + } else if token.typ != yaml_STREAM_END_TOKEN { + // Parse an explicit document. + var version_directive *yaml_version_directive_t + var tag_directives []yaml_tag_directive_t + start_mark := token.start_mark + if !yaml_parser_process_directives(parser, &version_directive, &tag_directives) { + return false + } + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_DOCUMENT_START_TOKEN { + yaml_parser_set_parser_error(parser, + "did not find expected ", token.start_mark) + return false + } + parser.states = append(parser.states, yaml_PARSE_DOCUMENT_END_STATE) + parser.state = yaml_PARSE_DOCUMENT_CONTENT_STATE + end_mark := token.end_mark + + *event = yaml_event_t{ + typ: yaml_DOCUMENT_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + version_directive: version_directive, + tag_directives: tag_directives, + implicit: false, + } + skip_token(parser) + + } else { + // Parse the stream end. + parser.state = yaml_PARSE_END_STATE + *event = yaml_event_t{ + typ: yaml_STREAM_END_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + skip_token(parser) + } + + return true +} + +// Parse the productions: +// explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* +// *********** +// +func yaml_parser_parse_document_content(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + if token.typ == yaml_VERSION_DIRECTIVE_TOKEN || + token.typ == yaml_TAG_DIRECTIVE_TOKEN || + token.typ == yaml_DOCUMENT_START_TOKEN || + token.typ == yaml_DOCUMENT_END_TOKEN || + token.typ == yaml_STREAM_END_TOKEN { + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + return yaml_parser_process_empty_scalar(parser, event, + token.start_mark) + } + return yaml_parser_parse_node(parser, event, true, false) +} + +// Parse the productions: +// implicit_document ::= block_node DOCUMENT-END* +// ************* +// explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* +// +func yaml_parser_parse_document_end(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + + start_mark := token.start_mark + end_mark := token.start_mark + + implicit := true + if token.typ == yaml_DOCUMENT_END_TOKEN { + end_mark = token.end_mark + skip_token(parser) + implicit = false + } + + parser.tag_directives = parser.tag_directives[:0] + + parser.state = yaml_PARSE_DOCUMENT_START_STATE + *event = yaml_event_t{ + typ: yaml_DOCUMENT_END_EVENT, + start_mark: start_mark, + end_mark: end_mark, + implicit: implicit, + } + return true +} + +// Parse the productions: +// block_node_or_indentless_sequence ::= +// ALIAS +// ***** +// | properties (block_content | indentless_block_sequence)? +// ********** * +// | block_content | indentless_block_sequence +// * +// block_node ::= ALIAS +// ***** +// | properties block_content? +// ********** * +// | block_content +// * +// flow_node ::= ALIAS +// ***** +// | properties flow_content? +// ********** * +// | flow_content +// * +// properties ::= TAG ANCHOR? | ANCHOR TAG? +// ************************* +// block_content ::= block_collection | flow_collection | SCALAR +// ****** +// flow_content ::= flow_collection | SCALAR +// ****** +func yaml_parser_parse_node(parser *yaml_parser_t, event *yaml_event_t, block, indentless_sequence bool) bool { + //defer trace("yaml_parser_parse_node", "block:", block, "indentless_sequence:", indentless_sequence)() + + token := peek_token(parser) + if token == nil { + return false + } + + if token.typ == yaml_ALIAS_TOKEN { + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + *event = yaml_event_t{ + typ: yaml_ALIAS_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + anchor: token.value, + } + skip_token(parser) + return true + } + + start_mark := token.start_mark + end_mark := token.start_mark + + var tag_token bool + var tag_handle, tag_suffix, anchor []byte + var tag_mark yaml_mark_t + if token.typ == yaml_ANCHOR_TOKEN { + anchor = token.value + start_mark = token.start_mark + end_mark = token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ == yaml_TAG_TOKEN { + tag_token = true + tag_handle = token.value + tag_suffix = token.suffix + tag_mark = token.start_mark + end_mark = token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } + } else if token.typ == yaml_TAG_TOKEN { + tag_token = true + tag_handle = token.value + tag_suffix = token.suffix + start_mark = token.start_mark + tag_mark = token.start_mark + end_mark = token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ == yaml_ANCHOR_TOKEN { + anchor = token.value + end_mark = token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } + } + + var tag []byte + if tag_token { + if len(tag_handle) == 0 { + tag = tag_suffix + tag_suffix = nil + } else { + for i := range parser.tag_directives { + if bytes.Equal(parser.tag_directives[i].handle, tag_handle) { + tag = append([]byte(nil), parser.tag_directives[i].prefix...) + tag = append(tag, tag_suffix...) + break + } + } + if len(tag) == 0 { + yaml_parser_set_parser_error_context(parser, + "while parsing a node", start_mark, + "found undefined tag handle", tag_mark) + return false + } + } + } + + implicit := len(tag) == 0 + if indentless_sequence && token.typ == yaml_BLOCK_ENTRY_TOKEN { + end_mark = token.end_mark + parser.state = yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE + *event = yaml_event_t{ + typ: yaml_SEQUENCE_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(yaml_BLOCK_SEQUENCE_STYLE), + } + return true + } + if token.typ == yaml_SCALAR_TOKEN { + var plain_implicit, quoted_implicit bool + end_mark = token.end_mark + if (len(tag) == 0 && token.style == yaml_PLAIN_SCALAR_STYLE) || (len(tag) == 1 && tag[0] == '!') { + plain_implicit = true + } else if len(tag) == 0 { + quoted_implicit = true + } + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + + *event = yaml_event_t{ + typ: yaml_SCALAR_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + value: token.value, + implicit: plain_implicit, + quoted_implicit: quoted_implicit, + style: yaml_style_t(token.style), + } + skip_token(parser) + return true + } + if token.typ == yaml_FLOW_SEQUENCE_START_TOKEN { + // [Go] Some of the events below can be merged as they differ only on style. + end_mark = token.end_mark + parser.state = yaml_PARSE_FLOW_SEQUENCE_FIRST_ENTRY_STATE + *event = yaml_event_t{ + typ: yaml_SEQUENCE_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(yaml_FLOW_SEQUENCE_STYLE), + } + return true + } + if token.typ == yaml_FLOW_MAPPING_START_TOKEN { + end_mark = token.end_mark + parser.state = yaml_PARSE_FLOW_MAPPING_FIRST_KEY_STATE + *event = yaml_event_t{ + typ: yaml_MAPPING_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(yaml_FLOW_MAPPING_STYLE), + } + return true + } + if block && token.typ == yaml_BLOCK_SEQUENCE_START_TOKEN { + end_mark = token.end_mark + parser.state = yaml_PARSE_BLOCK_SEQUENCE_FIRST_ENTRY_STATE + *event = yaml_event_t{ + typ: yaml_SEQUENCE_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(yaml_BLOCK_SEQUENCE_STYLE), + } + return true + } + if block && token.typ == yaml_BLOCK_MAPPING_START_TOKEN { + end_mark = token.end_mark + parser.state = yaml_PARSE_BLOCK_MAPPING_FIRST_KEY_STATE + *event = yaml_event_t{ + typ: yaml_MAPPING_START_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + style: yaml_style_t(yaml_BLOCK_MAPPING_STYLE), + } + return true + } + if len(anchor) > 0 || len(tag) > 0 { + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + + *event = yaml_event_t{ + typ: yaml_SCALAR_EVENT, + start_mark: start_mark, + end_mark: end_mark, + anchor: anchor, + tag: tag, + implicit: implicit, + quoted_implicit: false, + style: yaml_style_t(yaml_PLAIN_SCALAR_STYLE), + } + return true + } + + context := "while parsing a flow node" + if block { + context = "while parsing a block node" + } + yaml_parser_set_parser_error_context(parser, context, start_mark, + "did not find expected node content", token.start_mark) + return false +} + +// Parse the productions: +// block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END +// ******************** *********** * ********* +// +func yaml_parser_parse_block_sequence_entry(parser *yaml_parser_t, event *yaml_event_t, first bool) bool { + if first { + token := peek_token(parser) + parser.marks = append(parser.marks, token.start_mark) + skip_token(parser) + } + + token := peek_token(parser) + if token == nil { + return false + } + + if token.typ == yaml_BLOCK_ENTRY_TOKEN { + mark := token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_BLOCK_ENTRY_TOKEN && token.typ != yaml_BLOCK_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE) + return yaml_parser_parse_node(parser, event, true, false) + } else { + parser.state = yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE + return yaml_parser_process_empty_scalar(parser, event, mark) + } + } + if token.typ == yaml_BLOCK_END_TOKEN { + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + + *event = yaml_event_t{ + typ: yaml_SEQUENCE_END_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + + skip_token(parser) + return true + } + + context_mark := parser.marks[len(parser.marks)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + return yaml_parser_set_parser_error_context(parser, + "while parsing a block collection", context_mark, + "did not find expected '-' indicator", token.start_mark) +} + +// Parse the productions: +// indentless_sequence ::= (BLOCK-ENTRY block_node?)+ +// *********** * +func yaml_parser_parse_indentless_sequence_entry(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + + if token.typ == yaml_BLOCK_ENTRY_TOKEN { + mark := token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_BLOCK_ENTRY_TOKEN && + token.typ != yaml_KEY_TOKEN && + token.typ != yaml_VALUE_TOKEN && + token.typ != yaml_BLOCK_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE) + return yaml_parser_parse_node(parser, event, true, false) + } + parser.state = yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE + return yaml_parser_process_empty_scalar(parser, event, mark) + } + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + + *event = yaml_event_t{ + typ: yaml_SEQUENCE_END_EVENT, + start_mark: token.start_mark, + end_mark: token.start_mark, // [Go] Shouldn't this be token.end_mark? + } + return true +} + +// Parse the productions: +// block_mapping ::= BLOCK-MAPPING_START +// ******************* +// ((KEY block_node_or_indentless_sequence?)? +// *** * +// (VALUE block_node_or_indentless_sequence?)?)* +// +// BLOCK-END +// ********* +// +func yaml_parser_parse_block_mapping_key(parser *yaml_parser_t, event *yaml_event_t, first bool) bool { + if first { + token := peek_token(parser) + parser.marks = append(parser.marks, token.start_mark) + skip_token(parser) + } + + token := peek_token(parser) + if token == nil { + return false + } + + if token.typ == yaml_KEY_TOKEN { + mark := token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_KEY_TOKEN && + token.typ != yaml_VALUE_TOKEN && + token.typ != yaml_BLOCK_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_BLOCK_MAPPING_VALUE_STATE) + return yaml_parser_parse_node(parser, event, true, true) + } else { + parser.state = yaml_PARSE_BLOCK_MAPPING_VALUE_STATE + return yaml_parser_process_empty_scalar(parser, event, mark) + } + } else if token.typ == yaml_BLOCK_END_TOKEN { + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + *event = yaml_event_t{ + typ: yaml_MAPPING_END_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + skip_token(parser) + return true + } + + context_mark := parser.marks[len(parser.marks)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + return yaml_parser_set_parser_error_context(parser, + "while parsing a block mapping", context_mark, + "did not find expected key", token.start_mark) +} + +// Parse the productions: +// block_mapping ::= BLOCK-MAPPING_START +// +// ((KEY block_node_or_indentless_sequence?)? +// +// (VALUE block_node_or_indentless_sequence?)?)* +// ***** * +// BLOCK-END +// +// +func yaml_parser_parse_block_mapping_value(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + if token.typ == yaml_VALUE_TOKEN { + mark := token.end_mark + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_KEY_TOKEN && + token.typ != yaml_VALUE_TOKEN && + token.typ != yaml_BLOCK_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_BLOCK_MAPPING_KEY_STATE) + return yaml_parser_parse_node(parser, event, true, true) + } + parser.state = yaml_PARSE_BLOCK_MAPPING_KEY_STATE + return yaml_parser_process_empty_scalar(parser, event, mark) + } + parser.state = yaml_PARSE_BLOCK_MAPPING_KEY_STATE + return yaml_parser_process_empty_scalar(parser, event, token.start_mark) +} + +// Parse the productions: +// flow_sequence ::= FLOW-SEQUENCE-START +// ******************* +// (flow_sequence_entry FLOW-ENTRY)* +// * ********** +// flow_sequence_entry? +// * +// FLOW-SEQUENCE-END +// ***************** +// flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// * +// +func yaml_parser_parse_flow_sequence_entry(parser *yaml_parser_t, event *yaml_event_t, first bool) bool { + if first { + token := peek_token(parser) + parser.marks = append(parser.marks, token.start_mark) + skip_token(parser) + } + token := peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_FLOW_SEQUENCE_END_TOKEN { + if !first { + if token.typ == yaml_FLOW_ENTRY_TOKEN { + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } else { + context_mark := parser.marks[len(parser.marks)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + return yaml_parser_set_parser_error_context(parser, + "while parsing a flow sequence", context_mark, + "did not find expected ',' or ']'", token.start_mark) + } + } + + if token.typ == yaml_KEY_TOKEN { + parser.state = yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_KEY_STATE + *event = yaml_event_t{ + typ: yaml_MAPPING_START_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + implicit: true, + style: yaml_style_t(yaml_FLOW_MAPPING_STYLE), + } + skip_token(parser) + return true + } else if token.typ != yaml_FLOW_SEQUENCE_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } + } + + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + + *event = yaml_event_t{ + typ: yaml_SEQUENCE_END_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + + skip_token(parser) + return true +} + +// +// Parse the productions: +// flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// *** * +// +func yaml_parser_parse_flow_sequence_entry_mapping_key(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_VALUE_TOKEN && + token.typ != yaml_FLOW_ENTRY_TOKEN && + token.typ != yaml_FLOW_SEQUENCE_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } + mark := token.end_mark + skip_token(parser) + parser.state = yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE + return yaml_parser_process_empty_scalar(parser, event, mark) +} + +// Parse the productions: +// flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// ***** * +// +func yaml_parser_parse_flow_sequence_entry_mapping_value(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + if token.typ == yaml_VALUE_TOKEN { + skip_token(parser) + token := peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_FLOW_ENTRY_TOKEN && token.typ != yaml_FLOW_SEQUENCE_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } + } + parser.state = yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE + return yaml_parser_process_empty_scalar(parser, event, token.start_mark) +} + +// Parse the productions: +// flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// * +// +func yaml_parser_parse_flow_sequence_entry_mapping_end(parser *yaml_parser_t, event *yaml_event_t) bool { + token := peek_token(parser) + if token == nil { + return false + } + parser.state = yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE + *event = yaml_event_t{ + typ: yaml_MAPPING_END_EVENT, + start_mark: token.start_mark, + end_mark: token.start_mark, // [Go] Shouldn't this be end_mark? + } + return true +} + +// Parse the productions: +// flow_mapping ::= FLOW-MAPPING-START +// ****************** +// (flow_mapping_entry FLOW-ENTRY)* +// * ********** +// flow_mapping_entry? +// ****************** +// FLOW-MAPPING-END +// **************** +// flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// * *** * +// +func yaml_parser_parse_flow_mapping_key(parser *yaml_parser_t, event *yaml_event_t, first bool) bool { + if first { + token := peek_token(parser) + parser.marks = append(parser.marks, token.start_mark) + skip_token(parser) + } + + token := peek_token(parser) + if token == nil { + return false + } + + if token.typ != yaml_FLOW_MAPPING_END_TOKEN { + if !first { + if token.typ == yaml_FLOW_ENTRY_TOKEN { + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } else { + context_mark := parser.marks[len(parser.marks)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + return yaml_parser_set_parser_error_context(parser, + "while parsing a flow mapping", context_mark, + "did not find expected ',' or '}'", token.start_mark) + } + } + + if token.typ == yaml_KEY_TOKEN { + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_VALUE_TOKEN && + token.typ != yaml_FLOW_ENTRY_TOKEN && + token.typ != yaml_FLOW_MAPPING_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_MAPPING_VALUE_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } else { + parser.state = yaml_PARSE_FLOW_MAPPING_VALUE_STATE + return yaml_parser_process_empty_scalar(parser, event, token.start_mark) + } + } else if token.typ != yaml_FLOW_MAPPING_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_MAPPING_EMPTY_VALUE_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } + } + + parser.state = parser.states[len(parser.states)-1] + parser.states = parser.states[:len(parser.states)-1] + parser.marks = parser.marks[:len(parser.marks)-1] + *event = yaml_event_t{ + typ: yaml_MAPPING_END_EVENT, + start_mark: token.start_mark, + end_mark: token.end_mark, + } + skip_token(parser) + return true +} + +// Parse the productions: +// flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? +// * ***** * +// +func yaml_parser_parse_flow_mapping_value(parser *yaml_parser_t, event *yaml_event_t, empty bool) bool { + token := peek_token(parser) + if token == nil { + return false + } + if empty { + parser.state = yaml_PARSE_FLOW_MAPPING_KEY_STATE + return yaml_parser_process_empty_scalar(parser, event, token.start_mark) + } + if token.typ == yaml_VALUE_TOKEN { + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + if token.typ != yaml_FLOW_ENTRY_TOKEN && token.typ != yaml_FLOW_MAPPING_END_TOKEN { + parser.states = append(parser.states, yaml_PARSE_FLOW_MAPPING_KEY_STATE) + return yaml_parser_parse_node(parser, event, false, false) + } + } + parser.state = yaml_PARSE_FLOW_MAPPING_KEY_STATE + return yaml_parser_process_empty_scalar(parser, event, token.start_mark) +} + +// Generate an empty scalar event. +func yaml_parser_process_empty_scalar(parser *yaml_parser_t, event *yaml_event_t, mark yaml_mark_t) bool { + *event = yaml_event_t{ + typ: yaml_SCALAR_EVENT, + start_mark: mark, + end_mark: mark, + value: nil, // Empty + implicit: true, + style: yaml_style_t(yaml_PLAIN_SCALAR_STYLE), + } + return true +} + +var default_tag_directives = []yaml_tag_directive_t{ + {[]byte("!"), []byte("!")}, + {[]byte("!!"), []byte("tag:yaml.org,2002:")}, +} + +// Parse directives. +func yaml_parser_process_directives(parser *yaml_parser_t, + version_directive_ref **yaml_version_directive_t, + tag_directives_ref *[]yaml_tag_directive_t) bool { + + var version_directive *yaml_version_directive_t + var tag_directives []yaml_tag_directive_t + + token := peek_token(parser) + if token == nil { + return false + } + + for token.typ == yaml_VERSION_DIRECTIVE_TOKEN || token.typ == yaml_TAG_DIRECTIVE_TOKEN { + if token.typ == yaml_VERSION_DIRECTIVE_TOKEN { + if version_directive != nil { + yaml_parser_set_parser_error(parser, + "found duplicate %YAML directive", token.start_mark) + return false + } + if token.major != 1 || token.minor != 1 { + yaml_parser_set_parser_error(parser, + "found incompatible YAML document", token.start_mark) + return false + } + version_directive = &yaml_version_directive_t{ + major: token.major, + minor: token.minor, + } + } else if token.typ == yaml_TAG_DIRECTIVE_TOKEN { + value := yaml_tag_directive_t{ + handle: token.value, + prefix: token.prefix, + } + if !yaml_parser_append_tag_directive(parser, value, false, token.start_mark) { + return false + } + tag_directives = append(tag_directives, value) + } + + skip_token(parser) + token = peek_token(parser) + if token == nil { + return false + } + } + + for i := range default_tag_directives { + if !yaml_parser_append_tag_directive(parser, default_tag_directives[i], true, token.start_mark) { + return false + } + } + + if version_directive_ref != nil { + *version_directive_ref = version_directive + } + if tag_directives_ref != nil { + *tag_directives_ref = tag_directives + } + return true +} + +// Append a tag directive to the directives stack. +func yaml_parser_append_tag_directive(parser *yaml_parser_t, value yaml_tag_directive_t, allow_duplicates bool, mark yaml_mark_t) bool { + for i := range parser.tag_directives { + if bytes.Equal(value.handle, parser.tag_directives[i].handle) { + if allow_duplicates { + return true + } + return yaml_parser_set_parser_error(parser, "found duplicate %TAG directive", mark) + } + } + + // [Go] I suspect the copy is unnecessary. This was likely done + // because there was no way to track ownership of the data. + value_copy := yaml_tag_directive_t{ + handle: make([]byte, len(value.handle)), + prefix: make([]byte, len(value.prefix)), + } + copy(value_copy.handle, value.handle) + copy(value_copy.prefix, value.prefix) + parser.tag_directives = append(parser.tag_directives, value_copy) + return true +} diff --git a/vendor/gopkg.in/yaml.v2/readerc.go b/vendor/gopkg.in/yaml.v2/readerc.go new file mode 100644 index 0000000..7c1f5fa --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/readerc.go @@ -0,0 +1,412 @@ +package yaml + +import ( + "io" +) + +// Set the reader error and return 0. +func yaml_parser_set_reader_error(parser *yaml_parser_t, problem string, offset int, value int) bool { + parser.error = yaml_READER_ERROR + parser.problem = problem + parser.problem_offset = offset + parser.problem_value = value + return false +} + +// Byte order marks. +const ( + bom_UTF8 = "\xef\xbb\xbf" + bom_UTF16LE = "\xff\xfe" + bom_UTF16BE = "\xfe\xff" +) + +// Determine the input stream encoding by checking the BOM symbol. If no BOM is +// found, the UTF-8 encoding is assumed. Return 1 on success, 0 on failure. +func yaml_parser_determine_encoding(parser *yaml_parser_t) bool { + // Ensure that we had enough bytes in the raw buffer. + for !parser.eof && len(parser.raw_buffer)-parser.raw_buffer_pos < 3 { + if !yaml_parser_update_raw_buffer(parser) { + return false + } + } + + // Determine the encoding. + buf := parser.raw_buffer + pos := parser.raw_buffer_pos + avail := len(buf) - pos + if avail >= 2 && buf[pos] == bom_UTF16LE[0] && buf[pos+1] == bom_UTF16LE[1] { + parser.encoding = yaml_UTF16LE_ENCODING + parser.raw_buffer_pos += 2 + parser.offset += 2 + } else if avail >= 2 && buf[pos] == bom_UTF16BE[0] && buf[pos+1] == bom_UTF16BE[1] { + parser.encoding = yaml_UTF16BE_ENCODING + parser.raw_buffer_pos += 2 + parser.offset += 2 + } else if avail >= 3 && buf[pos] == bom_UTF8[0] && buf[pos+1] == bom_UTF8[1] && buf[pos+2] == bom_UTF8[2] { + parser.encoding = yaml_UTF8_ENCODING + parser.raw_buffer_pos += 3 + parser.offset += 3 + } else { + parser.encoding = yaml_UTF8_ENCODING + } + return true +} + +// Update the raw buffer. +func yaml_parser_update_raw_buffer(parser *yaml_parser_t) bool { + size_read := 0 + + // Return if the raw buffer is full. + if parser.raw_buffer_pos == 0 && len(parser.raw_buffer) == cap(parser.raw_buffer) { + return true + } + + // Return on EOF. + if parser.eof { + return true + } + + // Move the remaining bytes in the raw buffer to the beginning. + if parser.raw_buffer_pos > 0 && parser.raw_buffer_pos < len(parser.raw_buffer) { + copy(parser.raw_buffer, parser.raw_buffer[parser.raw_buffer_pos:]) + } + parser.raw_buffer = parser.raw_buffer[:len(parser.raw_buffer)-parser.raw_buffer_pos] + parser.raw_buffer_pos = 0 + + // Call the read handler to fill the buffer. + size_read, err := parser.read_handler(parser, parser.raw_buffer[len(parser.raw_buffer):cap(parser.raw_buffer)]) + parser.raw_buffer = parser.raw_buffer[:len(parser.raw_buffer)+size_read] + if err == io.EOF { + parser.eof = true + } else if err != nil { + return yaml_parser_set_reader_error(parser, "input error: "+err.Error(), parser.offset, -1) + } + return true +} + +// Ensure that the buffer contains at least `length` characters. +// Return true on success, false on failure. +// +// The length is supposed to be significantly less that the buffer size. +func yaml_parser_update_buffer(parser *yaml_parser_t, length int) bool { + if parser.read_handler == nil { + panic("read handler must be set") + } + + // [Go] This function was changed to guarantee the requested length size at EOF. + // The fact we need to do this is pretty awful, but the description above implies + // for that to be the case, and there are tests + + // If the EOF flag is set and the raw buffer is empty, do nothing. + if parser.eof && parser.raw_buffer_pos == len(parser.raw_buffer) { + // [Go] ACTUALLY! Read the documentation of this function above. + // This is just broken. To return true, we need to have the + // given length in the buffer. Not doing that means every single + // check that calls this function to make sure the buffer has a + // given length is Go) panicking; or C) accessing invalid memory. + //return true + } + + // Return if the buffer contains enough characters. + if parser.unread >= length { + return true + } + + // Determine the input encoding if it is not known yet. + if parser.encoding == yaml_ANY_ENCODING { + if !yaml_parser_determine_encoding(parser) { + return false + } + } + + // Move the unread characters to the beginning of the buffer. + buffer_len := len(parser.buffer) + if parser.buffer_pos > 0 && parser.buffer_pos < buffer_len { + copy(parser.buffer, parser.buffer[parser.buffer_pos:]) + buffer_len -= parser.buffer_pos + parser.buffer_pos = 0 + } else if parser.buffer_pos == buffer_len { + buffer_len = 0 + parser.buffer_pos = 0 + } + + // Open the whole buffer for writing, and cut it before returning. + parser.buffer = parser.buffer[:cap(parser.buffer)] + + // Fill the buffer until it has enough characters. + first := true + for parser.unread < length { + + // Fill the raw buffer if necessary. + if !first || parser.raw_buffer_pos == len(parser.raw_buffer) { + if !yaml_parser_update_raw_buffer(parser) { + parser.buffer = parser.buffer[:buffer_len] + return false + } + } + first = false + + // Decode the raw buffer. + inner: + for parser.raw_buffer_pos != len(parser.raw_buffer) { + var value rune + var width int + + raw_unread := len(parser.raw_buffer) - parser.raw_buffer_pos + + // Decode the next character. + switch parser.encoding { + case yaml_UTF8_ENCODING: + // Decode a UTF-8 character. Check RFC 3629 + // (http://www.ietf.org/rfc/rfc3629.txt) for more details. + // + // The following table (taken from the RFC) is used for + // decoding. + // + // Char. number range | UTF-8 octet sequence + // (hexadecimal) | (binary) + // --------------------+------------------------------------ + // 0000 0000-0000 007F | 0xxxxxxx + // 0000 0080-0000 07FF | 110xxxxx 10xxxxxx + // 0000 0800-0000 FFFF | 1110xxxx 10xxxxxx 10xxxxxx + // 0001 0000-0010 FFFF | 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx + // + // Additionally, the characters in the range 0xD800-0xDFFF + // are prohibited as they are reserved for use with UTF-16 + // surrogate pairs. + + // Determine the length of the UTF-8 sequence. + octet := parser.raw_buffer[parser.raw_buffer_pos] + switch { + case octet&0x80 == 0x00: + width = 1 + case octet&0xE0 == 0xC0: + width = 2 + case octet&0xF0 == 0xE0: + width = 3 + case octet&0xF8 == 0xF0: + width = 4 + default: + // The leading octet is invalid. + return yaml_parser_set_reader_error(parser, + "invalid leading UTF-8 octet", + parser.offset, int(octet)) + } + + // Check if the raw buffer contains an incomplete character. + if width > raw_unread { + if parser.eof { + return yaml_parser_set_reader_error(parser, + "incomplete UTF-8 octet sequence", + parser.offset, -1) + } + break inner + } + + // Decode the leading octet. + switch { + case octet&0x80 == 0x00: + value = rune(octet & 0x7F) + case octet&0xE0 == 0xC0: + value = rune(octet & 0x1F) + case octet&0xF0 == 0xE0: + value = rune(octet & 0x0F) + case octet&0xF8 == 0xF0: + value = rune(octet & 0x07) + default: + value = 0 + } + + // Check and decode the trailing octets. + for k := 1; k < width; k++ { + octet = parser.raw_buffer[parser.raw_buffer_pos+k] + + // Check if the octet is valid. + if (octet & 0xC0) != 0x80 { + return yaml_parser_set_reader_error(parser, + "invalid trailing UTF-8 octet", + parser.offset+k, int(octet)) + } + + // Decode the octet. + value = (value << 6) + rune(octet&0x3F) + } + + // Check the length of the sequence against the value. + switch { + case width == 1: + case width == 2 && value >= 0x80: + case width == 3 && value >= 0x800: + case width == 4 && value >= 0x10000: + default: + return yaml_parser_set_reader_error(parser, + "invalid length of a UTF-8 sequence", + parser.offset, -1) + } + + // Check the range of the value. + if value >= 0xD800 && value <= 0xDFFF || value > 0x10FFFF { + return yaml_parser_set_reader_error(parser, + "invalid Unicode character", + parser.offset, int(value)) + } + + case yaml_UTF16LE_ENCODING, yaml_UTF16BE_ENCODING: + var low, high int + if parser.encoding == yaml_UTF16LE_ENCODING { + low, high = 0, 1 + } else { + low, high = 1, 0 + } + + // The UTF-16 encoding is not as simple as one might + // naively think. Check RFC 2781 + // (http://www.ietf.org/rfc/rfc2781.txt). + // + // Normally, two subsequent bytes describe a Unicode + // character. However a special technique (called a + // surrogate pair) is used for specifying character + // values larger than 0xFFFF. + // + // A surrogate pair consists of two pseudo-characters: + // high surrogate area (0xD800-0xDBFF) + // low surrogate area (0xDC00-0xDFFF) + // + // The following formulas are used for decoding + // and encoding characters using surrogate pairs: + // + // U = U' + 0x10000 (0x01 00 00 <= U <= 0x10 FF FF) + // U' = yyyyyyyyyyxxxxxxxxxx (0 <= U' <= 0x0F FF FF) + // W1 = 110110yyyyyyyyyy + // W2 = 110111xxxxxxxxxx + // + // where U is the character value, W1 is the high surrogate + // area, W2 is the low surrogate area. + + // Check for incomplete UTF-16 character. + if raw_unread < 2 { + if parser.eof { + return yaml_parser_set_reader_error(parser, + "incomplete UTF-16 character", + parser.offset, -1) + } + break inner + } + + // Get the character. + value = rune(parser.raw_buffer[parser.raw_buffer_pos+low]) + + (rune(parser.raw_buffer[parser.raw_buffer_pos+high]) << 8) + + // Check for unexpected low surrogate area. + if value&0xFC00 == 0xDC00 { + return yaml_parser_set_reader_error(parser, + "unexpected low surrogate area", + parser.offset, int(value)) + } + + // Check for a high surrogate area. + if value&0xFC00 == 0xD800 { + width = 4 + + // Check for incomplete surrogate pair. + if raw_unread < 4 { + if parser.eof { + return yaml_parser_set_reader_error(parser, + "incomplete UTF-16 surrogate pair", + parser.offset, -1) + } + break inner + } + + // Get the next character. + value2 := rune(parser.raw_buffer[parser.raw_buffer_pos+low+2]) + + (rune(parser.raw_buffer[parser.raw_buffer_pos+high+2]) << 8) + + // Check for a low surrogate area. + if value2&0xFC00 != 0xDC00 { + return yaml_parser_set_reader_error(parser, + "expected low surrogate area", + parser.offset+2, int(value2)) + } + + // Generate the value of the surrogate pair. + value = 0x10000 + ((value & 0x3FF) << 10) + (value2 & 0x3FF) + } else { + width = 2 + } + + default: + panic("impossible") + } + + // Check if the character is in the allowed range: + // #x9 | #xA | #xD | [#x20-#x7E] (8 bit) + // | #x85 | [#xA0-#xD7FF] | [#xE000-#xFFFD] (16 bit) + // | [#x10000-#x10FFFF] (32 bit) + switch { + case value == 0x09: + case value == 0x0A: + case value == 0x0D: + case value >= 0x20 && value <= 0x7E: + case value == 0x85: + case value >= 0xA0 && value <= 0xD7FF: + case value >= 0xE000 && value <= 0xFFFD: + case value >= 0x10000 && value <= 0x10FFFF: + default: + return yaml_parser_set_reader_error(parser, + "control characters are not allowed", + parser.offset, int(value)) + } + + // Move the raw pointers. + parser.raw_buffer_pos += width + parser.offset += width + + // Finally put the character into the buffer. + if value <= 0x7F { + // 0000 0000-0000 007F . 0xxxxxxx + parser.buffer[buffer_len+0] = byte(value) + buffer_len += 1 + } else if value <= 0x7FF { + // 0000 0080-0000 07FF . 110xxxxx 10xxxxxx + parser.buffer[buffer_len+0] = byte(0xC0 + (value >> 6)) + parser.buffer[buffer_len+1] = byte(0x80 + (value & 0x3F)) + buffer_len += 2 + } else if value <= 0xFFFF { + // 0000 0800-0000 FFFF . 1110xxxx 10xxxxxx 10xxxxxx + parser.buffer[buffer_len+0] = byte(0xE0 + (value >> 12)) + parser.buffer[buffer_len+1] = byte(0x80 + ((value >> 6) & 0x3F)) + parser.buffer[buffer_len+2] = byte(0x80 + (value & 0x3F)) + buffer_len += 3 + } else { + // 0001 0000-0010 FFFF . 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx + parser.buffer[buffer_len+0] = byte(0xF0 + (value >> 18)) + parser.buffer[buffer_len+1] = byte(0x80 + ((value >> 12) & 0x3F)) + parser.buffer[buffer_len+2] = byte(0x80 + ((value >> 6) & 0x3F)) + parser.buffer[buffer_len+3] = byte(0x80 + (value & 0x3F)) + buffer_len += 4 + } + + parser.unread++ + } + + // On EOF, put NUL into the buffer and return. + if parser.eof { + parser.buffer[buffer_len] = 0 + buffer_len++ + parser.unread++ + break + } + } + // [Go] Read the documentation of this function above. To return true, + // we need to have the given length in the buffer. Not doing that means + // every single check that calls this function to make sure the buffer + // has a given length is Go) panicking; or C) accessing invalid memory. + // This happens here due to the EOF above breaking early. + for buffer_len < length { + parser.buffer[buffer_len] = 0 + buffer_len++ + } + parser.buffer = parser.buffer[:buffer_len] + return true +} diff --git a/vendor/gopkg.in/yaml.v2/resolve.go b/vendor/gopkg.in/yaml.v2/resolve.go new file mode 100644 index 0000000..6c151db --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/resolve.go @@ -0,0 +1,258 @@ +package yaml + +import ( + "encoding/base64" + "math" + "regexp" + "strconv" + "strings" + "time" +) + +type resolveMapItem struct { + value interface{} + tag string +} + +var resolveTable = make([]byte, 256) +var resolveMap = make(map[string]resolveMapItem) + +func init() { + t := resolveTable + t[int('+')] = 'S' // Sign + t[int('-')] = 'S' + for _, c := range "0123456789" { + t[int(c)] = 'D' // Digit + } + for _, c := range "yYnNtTfFoO~" { + t[int(c)] = 'M' // In map + } + t[int('.')] = '.' // Float (potentially in map) + + var resolveMapList = []struct { + v interface{} + tag string + l []string + }{ + {true, yaml_BOOL_TAG, []string{"y", "Y", "yes", "Yes", "YES"}}, + {true, yaml_BOOL_TAG, []string{"true", "True", "TRUE"}}, + {true, yaml_BOOL_TAG, []string{"on", "On", "ON"}}, + {false, yaml_BOOL_TAG, []string{"n", "N", "no", "No", "NO"}}, + {false, yaml_BOOL_TAG, []string{"false", "False", "FALSE"}}, + {false, yaml_BOOL_TAG, []string{"off", "Off", "OFF"}}, + {nil, yaml_NULL_TAG, []string{"", "~", "null", "Null", "NULL"}}, + {math.NaN(), yaml_FLOAT_TAG, []string{".nan", ".NaN", ".NAN"}}, + {math.Inf(+1), yaml_FLOAT_TAG, []string{".inf", ".Inf", ".INF"}}, + {math.Inf(+1), yaml_FLOAT_TAG, []string{"+.inf", "+.Inf", "+.INF"}}, + {math.Inf(-1), yaml_FLOAT_TAG, []string{"-.inf", "-.Inf", "-.INF"}}, + {"<<", yaml_MERGE_TAG, []string{"<<"}}, + } + + m := resolveMap + for _, item := range resolveMapList { + for _, s := range item.l { + m[s] = resolveMapItem{item.v, item.tag} + } + } +} + +const longTagPrefix = "tag:yaml.org,2002:" + +func shortTag(tag string) string { + // TODO This can easily be made faster and produce less garbage. + if strings.HasPrefix(tag, longTagPrefix) { + return "!!" + tag[len(longTagPrefix):] + } + return tag +} + +func longTag(tag string) string { + if strings.HasPrefix(tag, "!!") { + return longTagPrefix + tag[2:] + } + return tag +} + +func resolvableTag(tag string) bool { + switch tag { + case "", yaml_STR_TAG, yaml_BOOL_TAG, yaml_INT_TAG, yaml_FLOAT_TAG, yaml_NULL_TAG, yaml_TIMESTAMP_TAG: + return true + } + return false +} + +var yamlStyleFloat = regexp.MustCompile(`^[-+]?[0-9]*\.?[0-9]+([eE][-+][0-9]+)?$`) + +func resolve(tag string, in string) (rtag string, out interface{}) { + if !resolvableTag(tag) { + return tag, in + } + + defer func() { + switch tag { + case "", rtag, yaml_STR_TAG, yaml_BINARY_TAG: + return + case yaml_FLOAT_TAG: + if rtag == yaml_INT_TAG { + switch v := out.(type) { + case int64: + rtag = yaml_FLOAT_TAG + out = float64(v) + return + case int: + rtag = yaml_FLOAT_TAG + out = float64(v) + return + } + } + } + failf("cannot decode %s `%s` as a %s", shortTag(rtag), in, shortTag(tag)) + }() + + // Any data is accepted as a !!str or !!binary. + // Otherwise, the prefix is enough of a hint about what it might be. + hint := byte('N') + if in != "" { + hint = resolveTable[in[0]] + } + if hint != 0 && tag != yaml_STR_TAG && tag != yaml_BINARY_TAG { + // Handle things we can lookup in a map. + if item, ok := resolveMap[in]; ok { + return item.tag, item.value + } + + // Base 60 floats are a bad idea, were dropped in YAML 1.2, and + // are purposefully unsupported here. They're still quoted on + // the way out for compatibility with other parser, though. + + switch hint { + case 'M': + // We've already checked the map above. + + case '.': + // Not in the map, so maybe a normal float. + floatv, err := strconv.ParseFloat(in, 64) + if err == nil { + return yaml_FLOAT_TAG, floatv + } + + case 'D', 'S': + // Int, float, or timestamp. + // Only try values as a timestamp if the value is unquoted or there's an explicit + // !!timestamp tag. + if tag == "" || tag == yaml_TIMESTAMP_TAG { + t, ok := parseTimestamp(in) + if ok { + return yaml_TIMESTAMP_TAG, t + } + } + + plain := strings.Replace(in, "_", "", -1) + intv, err := strconv.ParseInt(plain, 0, 64) + if err == nil { + if intv == int64(int(intv)) { + return yaml_INT_TAG, int(intv) + } else { + return yaml_INT_TAG, intv + } + } + uintv, err := strconv.ParseUint(plain, 0, 64) + if err == nil { + return yaml_INT_TAG, uintv + } + if yamlStyleFloat.MatchString(plain) { + floatv, err := strconv.ParseFloat(plain, 64) + if err == nil { + return yaml_FLOAT_TAG, floatv + } + } + if strings.HasPrefix(plain, "0b") { + intv, err := strconv.ParseInt(plain[2:], 2, 64) + if err == nil { + if intv == int64(int(intv)) { + return yaml_INT_TAG, int(intv) + } else { + return yaml_INT_TAG, intv + } + } + uintv, err := strconv.ParseUint(plain[2:], 2, 64) + if err == nil { + return yaml_INT_TAG, uintv + } + } else if strings.HasPrefix(plain, "-0b") { + intv, err := strconv.ParseInt("-" + plain[3:], 2, 64) + if err == nil { + if true || intv == int64(int(intv)) { + return yaml_INT_TAG, int(intv) + } else { + return yaml_INT_TAG, intv + } + } + } + default: + panic("resolveTable item not yet handled: " + string(rune(hint)) + " (with " + in + ")") + } + } + return yaml_STR_TAG, in +} + +// encodeBase64 encodes s as base64 that is broken up into multiple lines +// as appropriate for the resulting length. +func encodeBase64(s string) string { + const lineLen = 70 + encLen := base64.StdEncoding.EncodedLen(len(s)) + lines := encLen/lineLen + 1 + buf := make([]byte, encLen*2+lines) + in := buf[0:encLen] + out := buf[encLen:] + base64.StdEncoding.Encode(in, []byte(s)) + k := 0 + for i := 0; i < len(in); i += lineLen { + j := i + lineLen + if j > len(in) { + j = len(in) + } + k += copy(out[k:], in[i:j]) + if lines > 1 { + out[k] = '\n' + k++ + } + } + return string(out[:k]) +} + +// This is a subset of the formats allowed by the regular expression +// defined at http://yaml.org/type/timestamp.html. +var allowedTimestampFormats = []string{ + "2006-1-2T15:4:5.999999999Z07:00", // RCF3339Nano with short date fields. + "2006-1-2t15:4:5.999999999Z07:00", // RFC3339Nano with short date fields and lower-case "t". + "2006-1-2 15:4:5.999999999", // space separated with no time zone + "2006-1-2", // date only + // Notable exception: time.Parse cannot handle: "2001-12-14 21:59:43.10 -5" + // from the set of examples. +} + +// parseTimestamp parses s as a timestamp string and +// returns the timestamp and reports whether it succeeded. +// Timestamp formats are defined at http://yaml.org/type/timestamp.html +func parseTimestamp(s string) (time.Time, bool) { + // TODO write code to check all the formats supported by + // http://yaml.org/type/timestamp.html instead of using time.Parse. + + // Quick check: all date formats start with YYYY-. + i := 0 + for ; i < len(s); i++ { + if c := s[i]; c < '0' || c > '9' { + break + } + } + if i != 4 || i == len(s) || s[i] != '-' { + return time.Time{}, false + } + for _, format := range allowedTimestampFormats { + if t, err := time.Parse(format, s); err == nil { + return t, true + } + } + return time.Time{}, false +} diff --git a/vendor/gopkg.in/yaml.v2/scannerc.go b/vendor/gopkg.in/yaml.v2/scannerc.go new file mode 100644 index 0000000..077fd1d --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/scannerc.go @@ -0,0 +1,2696 @@ +package yaml + +import ( + "bytes" + "fmt" +) + +// Introduction +// ************ +// +// The following notes assume that you are familiar with the YAML specification +// (http://yaml.org/spec/1.2/spec.html). We mostly follow it, although in +// some cases we are less restrictive that it requires. +// +// The process of transforming a YAML stream into a sequence of events is +// divided on two steps: Scanning and Parsing. +// +// The Scanner transforms the input stream into a sequence of tokens, while the +// parser transform the sequence of tokens produced by the Scanner into a +// sequence of parsing events. +// +// The Scanner is rather clever and complicated. The Parser, on the contrary, +// is a straightforward implementation of a recursive-descendant parser (or, +// LL(1) parser, as it is usually called). +// +// Actually there are two issues of Scanning that might be called "clever", the +// rest is quite straightforward. The issues are "block collection start" and +// "simple keys". Both issues are explained below in details. +// +// Here the Scanning step is explained and implemented. We start with the list +// of all the tokens produced by the Scanner together with short descriptions. +// +// Now, tokens: +// +// STREAM-START(encoding) # The stream start. +// STREAM-END # The stream end. +// VERSION-DIRECTIVE(major,minor) # The '%YAML' directive. +// TAG-DIRECTIVE(handle,prefix) # The '%TAG' directive. +// DOCUMENT-START # '---' +// DOCUMENT-END # '...' +// BLOCK-SEQUENCE-START # Indentation increase denoting a block +// BLOCK-MAPPING-START # sequence or a block mapping. +// BLOCK-END # Indentation decrease. +// FLOW-SEQUENCE-START # '[' +// FLOW-SEQUENCE-END # ']' +// BLOCK-SEQUENCE-START # '{' +// BLOCK-SEQUENCE-END # '}' +// BLOCK-ENTRY # '-' +// FLOW-ENTRY # ',' +// KEY # '?' or nothing (simple keys). +// VALUE # ':' +// ALIAS(anchor) # '*anchor' +// ANCHOR(anchor) # '&anchor' +// TAG(handle,suffix) # '!handle!suffix' +// SCALAR(value,style) # A scalar. +// +// The following two tokens are "virtual" tokens denoting the beginning and the +// end of the stream: +// +// STREAM-START(encoding) +// STREAM-END +// +// We pass the information about the input stream encoding with the +// STREAM-START token. +// +// The next two tokens are responsible for tags: +// +// VERSION-DIRECTIVE(major,minor) +// TAG-DIRECTIVE(handle,prefix) +// +// Example: +// +// %YAML 1.1 +// %TAG ! !foo +// %TAG !yaml! tag:yaml.org,2002: +// --- +// +// The correspoding sequence of tokens: +// +// STREAM-START(utf-8) +// VERSION-DIRECTIVE(1,1) +// TAG-DIRECTIVE("!","!foo") +// TAG-DIRECTIVE("!yaml","tag:yaml.org,2002:") +// DOCUMENT-START +// STREAM-END +// +// Note that the VERSION-DIRECTIVE and TAG-DIRECTIVE tokens occupy a whole +// line. +// +// The document start and end indicators are represented by: +// +// DOCUMENT-START +// DOCUMENT-END +// +// Note that if a YAML stream contains an implicit document (without '---' +// and '...' indicators), no DOCUMENT-START and DOCUMENT-END tokens will be +// produced. +// +// In the following examples, we present whole documents together with the +// produced tokens. +// +// 1. An implicit document: +// +// 'a scalar' +// +// Tokens: +// +// STREAM-START(utf-8) +// SCALAR("a scalar",single-quoted) +// STREAM-END +// +// 2. An explicit document: +// +// --- +// 'a scalar' +// ... +// +// Tokens: +// +// STREAM-START(utf-8) +// DOCUMENT-START +// SCALAR("a scalar",single-quoted) +// DOCUMENT-END +// STREAM-END +// +// 3. Several documents in a stream: +// +// 'a scalar' +// --- +// 'another scalar' +// --- +// 'yet another scalar' +// +// Tokens: +// +// STREAM-START(utf-8) +// SCALAR("a scalar",single-quoted) +// DOCUMENT-START +// SCALAR("another scalar",single-quoted) +// DOCUMENT-START +// SCALAR("yet another scalar",single-quoted) +// STREAM-END +// +// We have already introduced the SCALAR token above. The following tokens are +// used to describe aliases, anchors, tag, and scalars: +// +// ALIAS(anchor) +// ANCHOR(anchor) +// TAG(handle,suffix) +// SCALAR(value,style) +// +// The following series of examples illustrate the usage of these tokens: +// +// 1. A recursive sequence: +// +// &A [ *A ] +// +// Tokens: +// +// STREAM-START(utf-8) +// ANCHOR("A") +// FLOW-SEQUENCE-START +// ALIAS("A") +// FLOW-SEQUENCE-END +// STREAM-END +// +// 2. A tagged scalar: +// +// !!float "3.14" # A good approximation. +// +// Tokens: +// +// STREAM-START(utf-8) +// TAG("!!","float") +// SCALAR("3.14",double-quoted) +// STREAM-END +// +// 3. Various scalar styles: +// +// --- # Implicit empty plain scalars do not produce tokens. +// --- a plain scalar +// --- 'a single-quoted scalar' +// --- "a double-quoted scalar" +// --- |- +// a literal scalar +// --- >- +// a folded +// scalar +// +// Tokens: +// +// STREAM-START(utf-8) +// DOCUMENT-START +// DOCUMENT-START +// SCALAR("a plain scalar",plain) +// DOCUMENT-START +// SCALAR("a single-quoted scalar",single-quoted) +// DOCUMENT-START +// SCALAR("a double-quoted scalar",double-quoted) +// DOCUMENT-START +// SCALAR("a literal scalar",literal) +// DOCUMENT-START +// SCALAR("a folded scalar",folded) +// STREAM-END +// +// Now it's time to review collection-related tokens. We will start with +// flow collections: +// +// FLOW-SEQUENCE-START +// FLOW-SEQUENCE-END +// FLOW-MAPPING-START +// FLOW-MAPPING-END +// FLOW-ENTRY +// KEY +// VALUE +// +// The tokens FLOW-SEQUENCE-START, FLOW-SEQUENCE-END, FLOW-MAPPING-START, and +// FLOW-MAPPING-END represent the indicators '[', ']', '{', and '}' +// correspondingly. FLOW-ENTRY represent the ',' indicator. Finally the +// indicators '?' and ':', which are used for denoting mapping keys and values, +// are represented by the KEY and VALUE tokens. +// +// The following examples show flow collections: +// +// 1. A flow sequence: +// +// [item 1, item 2, item 3] +// +// Tokens: +// +// STREAM-START(utf-8) +// FLOW-SEQUENCE-START +// SCALAR("item 1",plain) +// FLOW-ENTRY +// SCALAR("item 2",plain) +// FLOW-ENTRY +// SCALAR("item 3",plain) +// FLOW-SEQUENCE-END +// STREAM-END +// +// 2. A flow mapping: +// +// { +// a simple key: a value, # Note that the KEY token is produced. +// ? a complex key: another value, +// } +// +// Tokens: +// +// STREAM-START(utf-8) +// FLOW-MAPPING-START +// KEY +// SCALAR("a simple key",plain) +// VALUE +// SCALAR("a value",plain) +// FLOW-ENTRY +// KEY +// SCALAR("a complex key",plain) +// VALUE +// SCALAR("another value",plain) +// FLOW-ENTRY +// FLOW-MAPPING-END +// STREAM-END +// +// A simple key is a key which is not denoted by the '?' indicator. Note that +// the Scanner still produce the KEY token whenever it encounters a simple key. +// +// For scanning block collections, the following tokens are used (note that we +// repeat KEY and VALUE here): +// +// BLOCK-SEQUENCE-START +// BLOCK-MAPPING-START +// BLOCK-END +// BLOCK-ENTRY +// KEY +// VALUE +// +// The tokens BLOCK-SEQUENCE-START and BLOCK-MAPPING-START denote indentation +// increase that precedes a block collection (cf. the INDENT token in Python). +// The token BLOCK-END denote indentation decrease that ends a block collection +// (cf. the DEDENT token in Python). However YAML has some syntax pecularities +// that makes detections of these tokens more complex. +// +// The tokens BLOCK-ENTRY, KEY, and VALUE are used to represent the indicators +// '-', '?', and ':' correspondingly. +// +// The following examples show how the tokens BLOCK-SEQUENCE-START, +// BLOCK-MAPPING-START, and BLOCK-END are emitted by the Scanner: +// +// 1. Block sequences: +// +// - item 1 +// - item 2 +// - +// - item 3.1 +// - item 3.2 +// - +// key 1: value 1 +// key 2: value 2 +// +// Tokens: +// +// STREAM-START(utf-8) +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// SCALAR("item 1",plain) +// BLOCK-ENTRY +// SCALAR("item 2",plain) +// BLOCK-ENTRY +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// SCALAR("item 3.1",plain) +// BLOCK-ENTRY +// SCALAR("item 3.2",plain) +// BLOCK-END +// BLOCK-ENTRY +// BLOCK-MAPPING-START +// KEY +// SCALAR("key 1",plain) +// VALUE +// SCALAR("value 1",plain) +// KEY +// SCALAR("key 2",plain) +// VALUE +// SCALAR("value 2",plain) +// BLOCK-END +// BLOCK-END +// STREAM-END +// +// 2. Block mappings: +// +// a simple key: a value # The KEY token is produced here. +// ? a complex key +// : another value +// a mapping: +// key 1: value 1 +// key 2: value 2 +// a sequence: +// - item 1 +// - item 2 +// +// Tokens: +// +// STREAM-START(utf-8) +// BLOCK-MAPPING-START +// KEY +// SCALAR("a simple key",plain) +// VALUE +// SCALAR("a value",plain) +// KEY +// SCALAR("a complex key",plain) +// VALUE +// SCALAR("another value",plain) +// KEY +// SCALAR("a mapping",plain) +// BLOCK-MAPPING-START +// KEY +// SCALAR("key 1",plain) +// VALUE +// SCALAR("value 1",plain) +// KEY +// SCALAR("key 2",plain) +// VALUE +// SCALAR("value 2",plain) +// BLOCK-END +// KEY +// SCALAR("a sequence",plain) +// VALUE +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// SCALAR("item 1",plain) +// BLOCK-ENTRY +// SCALAR("item 2",plain) +// BLOCK-END +// BLOCK-END +// STREAM-END +// +// YAML does not always require to start a new block collection from a new +// line. If the current line contains only '-', '?', and ':' indicators, a new +// block collection may start at the current line. The following examples +// illustrate this case: +// +// 1. Collections in a sequence: +// +// - - item 1 +// - item 2 +// - key 1: value 1 +// key 2: value 2 +// - ? complex key +// : complex value +// +// Tokens: +// +// STREAM-START(utf-8) +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// SCALAR("item 1",plain) +// BLOCK-ENTRY +// SCALAR("item 2",plain) +// BLOCK-END +// BLOCK-ENTRY +// BLOCK-MAPPING-START +// KEY +// SCALAR("key 1",plain) +// VALUE +// SCALAR("value 1",plain) +// KEY +// SCALAR("key 2",plain) +// VALUE +// SCALAR("value 2",plain) +// BLOCK-END +// BLOCK-ENTRY +// BLOCK-MAPPING-START +// KEY +// SCALAR("complex key") +// VALUE +// SCALAR("complex value") +// BLOCK-END +// BLOCK-END +// STREAM-END +// +// 2. Collections in a mapping: +// +// ? a sequence +// : - item 1 +// - item 2 +// ? a mapping +// : key 1: value 1 +// key 2: value 2 +// +// Tokens: +// +// STREAM-START(utf-8) +// BLOCK-MAPPING-START +// KEY +// SCALAR("a sequence",plain) +// VALUE +// BLOCK-SEQUENCE-START +// BLOCK-ENTRY +// SCALAR("item 1",plain) +// BLOCK-ENTRY +// SCALAR("item 2",plain) +// BLOCK-END +// KEY +// SCALAR("a mapping",plain) +// VALUE +// BLOCK-MAPPING-START +// KEY +// SCALAR("key 1",plain) +// VALUE +// SCALAR("value 1",plain) +// KEY +// SCALAR("key 2",plain) +// VALUE +// SCALAR("value 2",plain) +// BLOCK-END +// BLOCK-END +// STREAM-END +// +// YAML also permits non-indented sequences if they are included into a block +// mapping. In this case, the token BLOCK-SEQUENCE-START is not produced: +// +// key: +// - item 1 # BLOCK-SEQUENCE-START is NOT produced here. +// - item 2 +// +// Tokens: +// +// STREAM-START(utf-8) +// BLOCK-MAPPING-START +// KEY +// SCALAR("key",plain) +// VALUE +// BLOCK-ENTRY +// SCALAR("item 1",plain) +// BLOCK-ENTRY +// SCALAR("item 2",plain) +// BLOCK-END +// + +// Ensure that the buffer contains the required number of characters. +// Return true on success, false on failure (reader error or memory error). +func cache(parser *yaml_parser_t, length int) bool { + // [Go] This was inlined: !cache(A, B) -> unread < B && !update(A, B) + return parser.unread >= length || yaml_parser_update_buffer(parser, length) +} + +// Advance the buffer pointer. +func skip(parser *yaml_parser_t) { + parser.mark.index++ + parser.mark.column++ + parser.unread-- + parser.buffer_pos += width(parser.buffer[parser.buffer_pos]) +} + +func skip_line(parser *yaml_parser_t) { + if is_crlf(parser.buffer, parser.buffer_pos) { + parser.mark.index += 2 + parser.mark.column = 0 + parser.mark.line++ + parser.unread -= 2 + parser.buffer_pos += 2 + } else if is_break(parser.buffer, parser.buffer_pos) { + parser.mark.index++ + parser.mark.column = 0 + parser.mark.line++ + parser.unread-- + parser.buffer_pos += width(parser.buffer[parser.buffer_pos]) + } +} + +// Copy a character to a string buffer and advance pointers. +func read(parser *yaml_parser_t, s []byte) []byte { + w := width(parser.buffer[parser.buffer_pos]) + if w == 0 { + panic("invalid character sequence") + } + if len(s) == 0 { + s = make([]byte, 0, 32) + } + if w == 1 && len(s)+w <= cap(s) { + s = s[:len(s)+1] + s[len(s)-1] = parser.buffer[parser.buffer_pos] + parser.buffer_pos++ + } else { + s = append(s, parser.buffer[parser.buffer_pos:parser.buffer_pos+w]...) + parser.buffer_pos += w + } + parser.mark.index++ + parser.mark.column++ + parser.unread-- + return s +} + +// Copy a line break character to a string buffer and advance pointers. +func read_line(parser *yaml_parser_t, s []byte) []byte { + buf := parser.buffer + pos := parser.buffer_pos + switch { + case buf[pos] == '\r' && buf[pos+1] == '\n': + // CR LF . LF + s = append(s, '\n') + parser.buffer_pos += 2 + parser.mark.index++ + parser.unread-- + case buf[pos] == '\r' || buf[pos] == '\n': + // CR|LF . LF + s = append(s, '\n') + parser.buffer_pos += 1 + case buf[pos] == '\xC2' && buf[pos+1] == '\x85': + // NEL . LF + s = append(s, '\n') + parser.buffer_pos += 2 + case buf[pos] == '\xE2' && buf[pos+1] == '\x80' && (buf[pos+2] == '\xA8' || buf[pos+2] == '\xA9'): + // LS|PS . LS|PS + s = append(s, buf[parser.buffer_pos:pos+3]...) + parser.buffer_pos += 3 + default: + return s + } + parser.mark.index++ + parser.mark.column = 0 + parser.mark.line++ + parser.unread-- + return s +} + +// Get the next token. +func yaml_parser_scan(parser *yaml_parser_t, token *yaml_token_t) bool { + // Erase the token object. + *token = yaml_token_t{} // [Go] Is this necessary? + + // No tokens after STREAM-END or error. + if parser.stream_end_produced || parser.error != yaml_NO_ERROR { + return true + } + + // Ensure that the tokens queue contains enough tokens. + if !parser.token_available { + if !yaml_parser_fetch_more_tokens(parser) { + return false + } + } + + // Fetch the next token from the queue. + *token = parser.tokens[parser.tokens_head] + parser.tokens_head++ + parser.tokens_parsed++ + parser.token_available = false + + if token.typ == yaml_STREAM_END_TOKEN { + parser.stream_end_produced = true + } + return true +} + +// Set the scanner error and return false. +func yaml_parser_set_scanner_error(parser *yaml_parser_t, context string, context_mark yaml_mark_t, problem string) bool { + parser.error = yaml_SCANNER_ERROR + parser.context = context + parser.context_mark = context_mark + parser.problem = problem + parser.problem_mark = parser.mark + return false +} + +func yaml_parser_set_scanner_tag_error(parser *yaml_parser_t, directive bool, context_mark yaml_mark_t, problem string) bool { + context := "while parsing a tag" + if directive { + context = "while parsing a %TAG directive" + } + return yaml_parser_set_scanner_error(parser, context, context_mark, problem) +} + +func trace(args ...interface{}) func() { + pargs := append([]interface{}{"+++"}, args...) + fmt.Println(pargs...) + pargs = append([]interface{}{"---"}, args...) + return func() { fmt.Println(pargs...) } +} + +// Ensure that the tokens queue contains at least one token which can be +// returned to the Parser. +func yaml_parser_fetch_more_tokens(parser *yaml_parser_t) bool { + // While we need more tokens to fetch, do it. + for { + // Check if we really need to fetch more tokens. + need_more_tokens := false + + if parser.tokens_head == len(parser.tokens) { + // Queue is empty. + need_more_tokens = true + } else { + // Check if any potential simple key may occupy the head position. + if !yaml_parser_stale_simple_keys(parser) { + return false + } + + for i := range parser.simple_keys { + simple_key := &parser.simple_keys[i] + if simple_key.possible && simple_key.token_number == parser.tokens_parsed { + need_more_tokens = true + break + } + } + } + + // We are finished. + if !need_more_tokens { + break + } + // Fetch the next token. + if !yaml_parser_fetch_next_token(parser) { + return false + } + } + + parser.token_available = true + return true +} + +// The dispatcher for token fetchers. +func yaml_parser_fetch_next_token(parser *yaml_parser_t) bool { + // Ensure that the buffer is initialized. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + // Check if we just started scanning. Fetch STREAM-START then. + if !parser.stream_start_produced { + return yaml_parser_fetch_stream_start(parser) + } + + // Eat whitespaces and comments until we reach the next token. + if !yaml_parser_scan_to_next_token(parser) { + return false + } + + // Remove obsolete potential simple keys. + if !yaml_parser_stale_simple_keys(parser) { + return false + } + + // Check the indentation level against the current column. + if !yaml_parser_unroll_indent(parser, parser.mark.column) { + return false + } + + // Ensure that the buffer contains at least 4 characters. 4 is the length + // of the longest indicators ('--- ' and '... '). + if parser.unread < 4 && !yaml_parser_update_buffer(parser, 4) { + return false + } + + // Is it the end of the stream? + if is_z(parser.buffer, parser.buffer_pos) { + return yaml_parser_fetch_stream_end(parser) + } + + // Is it a directive? + if parser.mark.column == 0 && parser.buffer[parser.buffer_pos] == '%' { + return yaml_parser_fetch_directive(parser) + } + + buf := parser.buffer + pos := parser.buffer_pos + + // Is it the document start indicator? + if parser.mark.column == 0 && buf[pos] == '-' && buf[pos+1] == '-' && buf[pos+2] == '-' && is_blankz(buf, pos+3) { + return yaml_parser_fetch_document_indicator(parser, yaml_DOCUMENT_START_TOKEN) + } + + // Is it the document end indicator? + if parser.mark.column == 0 && buf[pos] == '.' && buf[pos+1] == '.' && buf[pos+2] == '.' && is_blankz(buf, pos+3) { + return yaml_parser_fetch_document_indicator(parser, yaml_DOCUMENT_END_TOKEN) + } + + // Is it the flow sequence start indicator? + if buf[pos] == '[' { + return yaml_parser_fetch_flow_collection_start(parser, yaml_FLOW_SEQUENCE_START_TOKEN) + } + + // Is it the flow mapping start indicator? + if parser.buffer[parser.buffer_pos] == '{' { + return yaml_parser_fetch_flow_collection_start(parser, yaml_FLOW_MAPPING_START_TOKEN) + } + + // Is it the flow sequence end indicator? + if parser.buffer[parser.buffer_pos] == ']' { + return yaml_parser_fetch_flow_collection_end(parser, + yaml_FLOW_SEQUENCE_END_TOKEN) + } + + // Is it the flow mapping end indicator? + if parser.buffer[parser.buffer_pos] == '}' { + return yaml_parser_fetch_flow_collection_end(parser, + yaml_FLOW_MAPPING_END_TOKEN) + } + + // Is it the flow entry indicator? + if parser.buffer[parser.buffer_pos] == ',' { + return yaml_parser_fetch_flow_entry(parser) + } + + // Is it the block entry indicator? + if parser.buffer[parser.buffer_pos] == '-' && is_blankz(parser.buffer, parser.buffer_pos+1) { + return yaml_parser_fetch_block_entry(parser) + } + + // Is it the key indicator? + if parser.buffer[parser.buffer_pos] == '?' && (parser.flow_level > 0 || is_blankz(parser.buffer, parser.buffer_pos+1)) { + return yaml_parser_fetch_key(parser) + } + + // Is it the value indicator? + if parser.buffer[parser.buffer_pos] == ':' && (parser.flow_level > 0 || is_blankz(parser.buffer, parser.buffer_pos+1)) { + return yaml_parser_fetch_value(parser) + } + + // Is it an alias? + if parser.buffer[parser.buffer_pos] == '*' { + return yaml_parser_fetch_anchor(parser, yaml_ALIAS_TOKEN) + } + + // Is it an anchor? + if parser.buffer[parser.buffer_pos] == '&' { + return yaml_parser_fetch_anchor(parser, yaml_ANCHOR_TOKEN) + } + + // Is it a tag? + if parser.buffer[parser.buffer_pos] == '!' { + return yaml_parser_fetch_tag(parser) + } + + // Is it a literal scalar? + if parser.buffer[parser.buffer_pos] == '|' && parser.flow_level == 0 { + return yaml_parser_fetch_block_scalar(parser, true) + } + + // Is it a folded scalar? + if parser.buffer[parser.buffer_pos] == '>' && parser.flow_level == 0 { + return yaml_parser_fetch_block_scalar(parser, false) + } + + // Is it a single-quoted scalar? + if parser.buffer[parser.buffer_pos] == '\'' { + return yaml_parser_fetch_flow_scalar(parser, true) + } + + // Is it a double-quoted scalar? + if parser.buffer[parser.buffer_pos] == '"' { + return yaml_parser_fetch_flow_scalar(parser, false) + } + + // Is it a plain scalar? + // + // A plain scalar may start with any non-blank characters except + // + // '-', '?', ':', ',', '[', ']', '{', '}', + // '#', '&', '*', '!', '|', '>', '\'', '\"', + // '%', '@', '`'. + // + // In the block context (and, for the '-' indicator, in the flow context + // too), it may also start with the characters + // + // '-', '?', ':' + // + // if it is followed by a non-space character. + // + // The last rule is more restrictive than the specification requires. + // [Go] Make this logic more reasonable. + //switch parser.buffer[parser.buffer_pos] { + //case '-', '?', ':', ',', '?', '-', ',', ':', ']', '[', '}', '{', '&', '#', '!', '*', '>', '|', '"', '\'', '@', '%', '-', '`': + //} + if !(is_blankz(parser.buffer, parser.buffer_pos) || parser.buffer[parser.buffer_pos] == '-' || + parser.buffer[parser.buffer_pos] == '?' || parser.buffer[parser.buffer_pos] == ':' || + parser.buffer[parser.buffer_pos] == ',' || parser.buffer[parser.buffer_pos] == '[' || + parser.buffer[parser.buffer_pos] == ']' || parser.buffer[parser.buffer_pos] == '{' || + parser.buffer[parser.buffer_pos] == '}' || parser.buffer[parser.buffer_pos] == '#' || + parser.buffer[parser.buffer_pos] == '&' || parser.buffer[parser.buffer_pos] == '*' || + parser.buffer[parser.buffer_pos] == '!' || parser.buffer[parser.buffer_pos] == '|' || + parser.buffer[parser.buffer_pos] == '>' || parser.buffer[parser.buffer_pos] == '\'' || + parser.buffer[parser.buffer_pos] == '"' || parser.buffer[parser.buffer_pos] == '%' || + parser.buffer[parser.buffer_pos] == '@' || parser.buffer[parser.buffer_pos] == '`') || + (parser.buffer[parser.buffer_pos] == '-' && !is_blank(parser.buffer, parser.buffer_pos+1)) || + (parser.flow_level == 0 && + (parser.buffer[parser.buffer_pos] == '?' || parser.buffer[parser.buffer_pos] == ':') && + !is_blankz(parser.buffer, parser.buffer_pos+1)) { + return yaml_parser_fetch_plain_scalar(parser) + } + + // If we don't determine the token type so far, it is an error. + return yaml_parser_set_scanner_error(parser, + "while scanning for the next token", parser.mark, + "found character that cannot start any token") +} + +// Check the list of potential simple keys and remove the positions that +// cannot contain simple keys anymore. +func yaml_parser_stale_simple_keys(parser *yaml_parser_t) bool { + // Check for a potential simple key for each flow level. + for i := range parser.simple_keys { + simple_key := &parser.simple_keys[i] + + // The specification requires that a simple key + // + // - is limited to a single line, + // - is shorter than 1024 characters. + if simple_key.possible && (simple_key.mark.line < parser.mark.line || simple_key.mark.index+1024 < parser.mark.index) { + + // Check if the potential simple key to be removed is required. + if simple_key.required { + return yaml_parser_set_scanner_error(parser, + "while scanning a simple key", simple_key.mark, + "could not find expected ':'") + } + simple_key.possible = false + } + } + return true +} + +// Check if a simple key may start at the current position and add it if +// needed. +func yaml_parser_save_simple_key(parser *yaml_parser_t) bool { + // A simple key is required at the current position if the scanner is in + // the block context and the current column coincides with the indentation + // level. + + required := parser.flow_level == 0 && parser.indent == parser.mark.column + + // + // If the current position may start a simple key, save it. + // + if parser.simple_key_allowed { + simple_key := yaml_simple_key_t{ + possible: true, + required: required, + token_number: parser.tokens_parsed + (len(parser.tokens) - parser.tokens_head), + } + simple_key.mark = parser.mark + + if !yaml_parser_remove_simple_key(parser) { + return false + } + parser.simple_keys[len(parser.simple_keys)-1] = simple_key + } + return true +} + +// Remove a potential simple key at the current flow level. +func yaml_parser_remove_simple_key(parser *yaml_parser_t) bool { + i := len(parser.simple_keys) - 1 + if parser.simple_keys[i].possible { + // If the key is required, it is an error. + if parser.simple_keys[i].required { + return yaml_parser_set_scanner_error(parser, + "while scanning a simple key", parser.simple_keys[i].mark, + "could not find expected ':'") + } + } + // Remove the key from the stack. + parser.simple_keys[i].possible = false + return true +} + +// Increase the flow level and resize the simple key list if needed. +func yaml_parser_increase_flow_level(parser *yaml_parser_t) bool { + // Reset the simple key on the next level. + parser.simple_keys = append(parser.simple_keys, yaml_simple_key_t{}) + + // Increase the flow level. + parser.flow_level++ + return true +} + +// Decrease the flow level. +func yaml_parser_decrease_flow_level(parser *yaml_parser_t) bool { + if parser.flow_level > 0 { + parser.flow_level-- + parser.simple_keys = parser.simple_keys[:len(parser.simple_keys)-1] + } + return true +} + +// Push the current indentation level to the stack and set the new level +// the current column is greater than the indentation level. In this case, +// append or insert the specified token into the token queue. +func yaml_parser_roll_indent(parser *yaml_parser_t, column, number int, typ yaml_token_type_t, mark yaml_mark_t) bool { + // In the flow context, do nothing. + if parser.flow_level > 0 { + return true + } + + if parser.indent < column { + // Push the current indentation level to the stack and set the new + // indentation level. + parser.indents = append(parser.indents, parser.indent) + parser.indent = column + + // Create a token and insert it into the queue. + token := yaml_token_t{ + typ: typ, + start_mark: mark, + end_mark: mark, + } + if number > -1 { + number -= parser.tokens_parsed + } + yaml_insert_token(parser, number, &token) + } + return true +} + +// Pop indentation levels from the indents stack until the current level +// becomes less or equal to the column. For each indentation level, append +// the BLOCK-END token. +func yaml_parser_unroll_indent(parser *yaml_parser_t, column int) bool { + // In the flow context, do nothing. + if parser.flow_level > 0 { + return true + } + + // Loop through the indentation levels in the stack. + for parser.indent > column { + // Create a token and append it to the queue. + token := yaml_token_t{ + typ: yaml_BLOCK_END_TOKEN, + start_mark: parser.mark, + end_mark: parser.mark, + } + yaml_insert_token(parser, -1, &token) + + // Pop the indentation level. + parser.indent = parser.indents[len(parser.indents)-1] + parser.indents = parser.indents[:len(parser.indents)-1] + } + return true +} + +// Initialize the scanner and produce the STREAM-START token. +func yaml_parser_fetch_stream_start(parser *yaml_parser_t) bool { + + // Set the initial indentation. + parser.indent = -1 + + // Initialize the simple key stack. + parser.simple_keys = append(parser.simple_keys, yaml_simple_key_t{}) + + // A simple key is allowed at the beginning of the stream. + parser.simple_key_allowed = true + + // We have started. + parser.stream_start_produced = true + + // Create the STREAM-START token and append it to the queue. + token := yaml_token_t{ + typ: yaml_STREAM_START_TOKEN, + start_mark: parser.mark, + end_mark: parser.mark, + encoding: parser.encoding, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the STREAM-END token and shut down the scanner. +func yaml_parser_fetch_stream_end(parser *yaml_parser_t) bool { + + // Force new line. + if parser.mark.column != 0 { + parser.mark.column = 0 + parser.mark.line++ + } + + // Reset the indentation level. + if !yaml_parser_unroll_indent(parser, -1) { + return false + } + + // Reset simple keys. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + parser.simple_key_allowed = false + + // Create the STREAM-END token and append it to the queue. + token := yaml_token_t{ + typ: yaml_STREAM_END_TOKEN, + start_mark: parser.mark, + end_mark: parser.mark, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce a VERSION-DIRECTIVE or TAG-DIRECTIVE token. +func yaml_parser_fetch_directive(parser *yaml_parser_t) bool { + // Reset the indentation level. + if !yaml_parser_unroll_indent(parser, -1) { + return false + } + + // Reset simple keys. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + parser.simple_key_allowed = false + + // Create the YAML-DIRECTIVE or TAG-DIRECTIVE token. + token := yaml_token_t{} + if !yaml_parser_scan_directive(parser, &token) { + return false + } + // Append the token to the queue. + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the DOCUMENT-START or DOCUMENT-END token. +func yaml_parser_fetch_document_indicator(parser *yaml_parser_t, typ yaml_token_type_t) bool { + // Reset the indentation level. + if !yaml_parser_unroll_indent(parser, -1) { + return false + } + + // Reset simple keys. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + parser.simple_key_allowed = false + + // Consume the token. + start_mark := parser.mark + + skip(parser) + skip(parser) + skip(parser) + + end_mark := parser.mark + + // Create the DOCUMENT-START or DOCUMENT-END token. + token := yaml_token_t{ + typ: typ, + start_mark: start_mark, + end_mark: end_mark, + } + // Append the token to the queue. + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the FLOW-SEQUENCE-START or FLOW-MAPPING-START token. +func yaml_parser_fetch_flow_collection_start(parser *yaml_parser_t, typ yaml_token_type_t) bool { + // The indicators '[' and '{' may start a simple key. + if !yaml_parser_save_simple_key(parser) { + return false + } + + // Increase the flow level. + if !yaml_parser_increase_flow_level(parser) { + return false + } + + // A simple key may follow the indicators '[' and '{'. + parser.simple_key_allowed = true + + // Consume the token. + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the FLOW-SEQUENCE-START of FLOW-MAPPING-START token. + token := yaml_token_t{ + typ: typ, + start_mark: start_mark, + end_mark: end_mark, + } + // Append the token to the queue. + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the FLOW-SEQUENCE-END or FLOW-MAPPING-END token. +func yaml_parser_fetch_flow_collection_end(parser *yaml_parser_t, typ yaml_token_type_t) bool { + // Reset any potential simple key on the current flow level. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + // Decrease the flow level. + if !yaml_parser_decrease_flow_level(parser) { + return false + } + + // No simple keys after the indicators ']' and '}'. + parser.simple_key_allowed = false + + // Consume the token. + + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the FLOW-SEQUENCE-END of FLOW-MAPPING-END token. + token := yaml_token_t{ + typ: typ, + start_mark: start_mark, + end_mark: end_mark, + } + // Append the token to the queue. + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the FLOW-ENTRY token. +func yaml_parser_fetch_flow_entry(parser *yaml_parser_t) bool { + // Reset any potential simple keys on the current flow level. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + // Simple keys are allowed after ','. + parser.simple_key_allowed = true + + // Consume the token. + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the FLOW-ENTRY token and append it to the queue. + token := yaml_token_t{ + typ: yaml_FLOW_ENTRY_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the BLOCK-ENTRY token. +func yaml_parser_fetch_block_entry(parser *yaml_parser_t) bool { + // Check if the scanner is in the block context. + if parser.flow_level == 0 { + // Check if we are allowed to start a new entry. + if !parser.simple_key_allowed { + return yaml_parser_set_scanner_error(parser, "", parser.mark, + "block sequence entries are not allowed in this context") + } + // Add the BLOCK-SEQUENCE-START token if needed. + if !yaml_parser_roll_indent(parser, parser.mark.column, -1, yaml_BLOCK_SEQUENCE_START_TOKEN, parser.mark) { + return false + } + } else { + // It is an error for the '-' indicator to occur in the flow context, + // but we let the Parser detect and report about it because the Parser + // is able to point to the context. + } + + // Reset any potential simple keys on the current flow level. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + // Simple keys are allowed after '-'. + parser.simple_key_allowed = true + + // Consume the token. + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the BLOCK-ENTRY token and append it to the queue. + token := yaml_token_t{ + typ: yaml_BLOCK_ENTRY_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the KEY token. +func yaml_parser_fetch_key(parser *yaml_parser_t) bool { + + // In the block context, additional checks are required. + if parser.flow_level == 0 { + // Check if we are allowed to start a new key (not nessesary simple). + if !parser.simple_key_allowed { + return yaml_parser_set_scanner_error(parser, "", parser.mark, + "mapping keys are not allowed in this context") + } + // Add the BLOCK-MAPPING-START token if needed. + if !yaml_parser_roll_indent(parser, parser.mark.column, -1, yaml_BLOCK_MAPPING_START_TOKEN, parser.mark) { + return false + } + } + + // Reset any potential simple keys on the current flow level. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + // Simple keys are allowed after '?' in the block context. + parser.simple_key_allowed = parser.flow_level == 0 + + // Consume the token. + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the KEY token and append it to the queue. + token := yaml_token_t{ + typ: yaml_KEY_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the VALUE token. +func yaml_parser_fetch_value(parser *yaml_parser_t) bool { + + simple_key := &parser.simple_keys[len(parser.simple_keys)-1] + + // Have we found a simple key? + if simple_key.possible { + // Create the KEY token and insert it into the queue. + token := yaml_token_t{ + typ: yaml_KEY_TOKEN, + start_mark: simple_key.mark, + end_mark: simple_key.mark, + } + yaml_insert_token(parser, simple_key.token_number-parser.tokens_parsed, &token) + + // In the block context, we may need to add the BLOCK-MAPPING-START token. + if !yaml_parser_roll_indent(parser, simple_key.mark.column, + simple_key.token_number, + yaml_BLOCK_MAPPING_START_TOKEN, simple_key.mark) { + return false + } + + // Remove the simple key. + simple_key.possible = false + + // A simple key cannot follow another simple key. + parser.simple_key_allowed = false + + } else { + // The ':' indicator follows a complex key. + + // In the block context, extra checks are required. + if parser.flow_level == 0 { + + // Check if we are allowed to start a complex value. + if !parser.simple_key_allowed { + return yaml_parser_set_scanner_error(parser, "", parser.mark, + "mapping values are not allowed in this context") + } + + // Add the BLOCK-MAPPING-START token if needed. + if !yaml_parser_roll_indent(parser, parser.mark.column, -1, yaml_BLOCK_MAPPING_START_TOKEN, parser.mark) { + return false + } + } + + // Simple keys after ':' are allowed in the block context. + parser.simple_key_allowed = parser.flow_level == 0 + } + + // Consume the token. + start_mark := parser.mark + skip(parser) + end_mark := parser.mark + + // Create the VALUE token and append it to the queue. + token := yaml_token_t{ + typ: yaml_VALUE_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the ALIAS or ANCHOR token. +func yaml_parser_fetch_anchor(parser *yaml_parser_t, typ yaml_token_type_t) bool { + // An anchor or an alias could be a simple key. + if !yaml_parser_save_simple_key(parser) { + return false + } + + // A simple key cannot follow an anchor or an alias. + parser.simple_key_allowed = false + + // Create the ALIAS or ANCHOR token and append it to the queue. + var token yaml_token_t + if !yaml_parser_scan_anchor(parser, &token, typ) { + return false + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the TAG token. +func yaml_parser_fetch_tag(parser *yaml_parser_t) bool { + // A tag could be a simple key. + if !yaml_parser_save_simple_key(parser) { + return false + } + + // A simple key cannot follow a tag. + parser.simple_key_allowed = false + + // Create the TAG token and append it to the queue. + var token yaml_token_t + if !yaml_parser_scan_tag(parser, &token) { + return false + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the SCALAR(...,literal) or SCALAR(...,folded) tokens. +func yaml_parser_fetch_block_scalar(parser *yaml_parser_t, literal bool) bool { + // Remove any potential simple keys. + if !yaml_parser_remove_simple_key(parser) { + return false + } + + // A simple key may follow a block scalar. + parser.simple_key_allowed = true + + // Create the SCALAR token and append it to the queue. + var token yaml_token_t + if !yaml_parser_scan_block_scalar(parser, &token, literal) { + return false + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the SCALAR(...,single-quoted) or SCALAR(...,double-quoted) tokens. +func yaml_parser_fetch_flow_scalar(parser *yaml_parser_t, single bool) bool { + // A plain scalar could be a simple key. + if !yaml_parser_save_simple_key(parser) { + return false + } + + // A simple key cannot follow a flow scalar. + parser.simple_key_allowed = false + + // Create the SCALAR token and append it to the queue. + var token yaml_token_t + if !yaml_parser_scan_flow_scalar(parser, &token, single) { + return false + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Produce the SCALAR(...,plain) token. +func yaml_parser_fetch_plain_scalar(parser *yaml_parser_t) bool { + // A plain scalar could be a simple key. + if !yaml_parser_save_simple_key(parser) { + return false + } + + // A simple key cannot follow a flow scalar. + parser.simple_key_allowed = false + + // Create the SCALAR token and append it to the queue. + var token yaml_token_t + if !yaml_parser_scan_plain_scalar(parser, &token) { + return false + } + yaml_insert_token(parser, -1, &token) + return true +} + +// Eat whitespaces and comments until the next token is found. +func yaml_parser_scan_to_next_token(parser *yaml_parser_t) bool { + + // Until the next token is not found. + for { + // Allow the BOM mark to start a line. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if parser.mark.column == 0 && is_bom(parser.buffer, parser.buffer_pos) { + skip(parser) + } + + // Eat whitespaces. + // Tabs are allowed: + // - in the flow context + // - in the block context, but not at the beginning of the line or + // after '-', '?', or ':' (complex value). + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + for parser.buffer[parser.buffer_pos] == ' ' || ((parser.flow_level > 0 || !parser.simple_key_allowed) && parser.buffer[parser.buffer_pos] == '\t') { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Eat a comment until a line break. + if parser.buffer[parser.buffer_pos] == '#' { + for !is_breakz(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + } + + // If it is a line break, eat it. + if is_break(parser.buffer, parser.buffer_pos) { + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + skip_line(parser) + + // In the block context, a new line may start a simple key. + if parser.flow_level == 0 { + parser.simple_key_allowed = true + } + } else { + break // We have found a token. + } + } + + return true +} + +// Scan a YAML-DIRECTIVE or TAG-DIRECTIVE token. +// +// Scope: +// %YAML 1.1 # a comment \n +// ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +// %TAG !yaml! tag:yaml.org,2002: \n +// ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +// +func yaml_parser_scan_directive(parser *yaml_parser_t, token *yaml_token_t) bool { + // Eat '%'. + start_mark := parser.mark + skip(parser) + + // Scan the directive name. + var name []byte + if !yaml_parser_scan_directive_name(parser, start_mark, &name) { + return false + } + + // Is it a YAML directive? + if bytes.Equal(name, []byte("YAML")) { + // Scan the VERSION directive value. + var major, minor int8 + if !yaml_parser_scan_version_directive_value(parser, start_mark, &major, &minor) { + return false + } + end_mark := parser.mark + + // Create a VERSION-DIRECTIVE token. + *token = yaml_token_t{ + typ: yaml_VERSION_DIRECTIVE_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + major: major, + minor: minor, + } + + // Is it a TAG directive? + } else if bytes.Equal(name, []byte("TAG")) { + // Scan the TAG directive value. + var handle, prefix []byte + if !yaml_parser_scan_tag_directive_value(parser, start_mark, &handle, &prefix) { + return false + } + end_mark := parser.mark + + // Create a TAG-DIRECTIVE token. + *token = yaml_token_t{ + typ: yaml_TAG_DIRECTIVE_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + value: handle, + prefix: prefix, + } + + // Unknown directive. + } else { + yaml_parser_set_scanner_error(parser, "while scanning a directive", + start_mark, "found unknown directive name") + return false + } + + // Eat the rest of the line including any comments. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + for is_blank(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + if parser.buffer[parser.buffer_pos] == '#' { + for !is_breakz(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + } + + // Check if we are at the end of the line. + if !is_breakz(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a directive", + start_mark, "did not find expected comment or line break") + return false + } + + // Eat a line break. + if is_break(parser.buffer, parser.buffer_pos) { + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + skip_line(parser) + } + + return true +} + +// Scan the directive name. +// +// Scope: +// %YAML 1.1 # a comment \n +// ^^^^ +// %TAG !yaml! tag:yaml.org,2002: \n +// ^^^ +// +func yaml_parser_scan_directive_name(parser *yaml_parser_t, start_mark yaml_mark_t, name *[]byte) bool { + // Consume the directive name. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + var s []byte + for is_alpha(parser.buffer, parser.buffer_pos) { + s = read(parser, s) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Check if the name is empty. + if len(s) == 0 { + yaml_parser_set_scanner_error(parser, "while scanning a directive", + start_mark, "could not find expected directive name") + return false + } + + // Check for an blank character after the name. + if !is_blankz(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a directive", + start_mark, "found unexpected non-alphabetical character") + return false + } + *name = s + return true +} + +// Scan the value of VERSION-DIRECTIVE. +// +// Scope: +// %YAML 1.1 # a comment \n +// ^^^^^^ +func yaml_parser_scan_version_directive_value(parser *yaml_parser_t, start_mark yaml_mark_t, major, minor *int8) bool { + // Eat whitespaces. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + for is_blank(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Consume the major version number. + if !yaml_parser_scan_version_directive_number(parser, start_mark, major) { + return false + } + + // Eat '.'. + if parser.buffer[parser.buffer_pos] != '.' { + return yaml_parser_set_scanner_error(parser, "while scanning a %YAML directive", + start_mark, "did not find expected digit or '.' character") + } + + skip(parser) + + // Consume the minor version number. + if !yaml_parser_scan_version_directive_number(parser, start_mark, minor) { + return false + } + return true +} + +const max_number_length = 2 + +// Scan the version number of VERSION-DIRECTIVE. +// +// Scope: +// %YAML 1.1 # a comment \n +// ^ +// %YAML 1.1 # a comment \n +// ^ +func yaml_parser_scan_version_directive_number(parser *yaml_parser_t, start_mark yaml_mark_t, number *int8) bool { + + // Repeat while the next character is digit. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + var value, length int8 + for is_digit(parser.buffer, parser.buffer_pos) { + // Check if the number is too long. + length++ + if length > max_number_length { + return yaml_parser_set_scanner_error(parser, "while scanning a %YAML directive", + start_mark, "found extremely long version number") + } + value = value*10 + int8(as_digit(parser.buffer, parser.buffer_pos)) + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Check if the number was present. + if length == 0 { + return yaml_parser_set_scanner_error(parser, "while scanning a %YAML directive", + start_mark, "did not find expected version number") + } + *number = value + return true +} + +// Scan the value of a TAG-DIRECTIVE token. +// +// Scope: +// %TAG !yaml! tag:yaml.org,2002: \n +// ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +// +func yaml_parser_scan_tag_directive_value(parser *yaml_parser_t, start_mark yaml_mark_t, handle, prefix *[]byte) bool { + var handle_value, prefix_value []byte + + // Eat whitespaces. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + for is_blank(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Scan a handle. + if !yaml_parser_scan_tag_handle(parser, true, start_mark, &handle_value) { + return false + } + + // Expect a whitespace. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if !is_blank(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a %TAG directive", + start_mark, "did not find expected whitespace") + return false + } + + // Eat whitespaces. + for is_blank(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Scan a prefix. + if !yaml_parser_scan_tag_uri(parser, true, nil, start_mark, &prefix_value) { + return false + } + + // Expect a whitespace or line break. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if !is_blankz(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a %TAG directive", + start_mark, "did not find expected whitespace or line break") + return false + } + + *handle = handle_value + *prefix = prefix_value + return true +} + +func yaml_parser_scan_anchor(parser *yaml_parser_t, token *yaml_token_t, typ yaml_token_type_t) bool { + var s []byte + + // Eat the indicator character. + start_mark := parser.mark + skip(parser) + + // Consume the value. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + for is_alpha(parser.buffer, parser.buffer_pos) { + s = read(parser, s) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + end_mark := parser.mark + + /* + * Check if length of the anchor is greater than 0 and it is followed by + * a whitespace character or one of the indicators: + * + * '?', ':', ',', ']', '}', '%', '@', '`'. + */ + + if len(s) == 0 || + !(is_blankz(parser.buffer, parser.buffer_pos) || parser.buffer[parser.buffer_pos] == '?' || + parser.buffer[parser.buffer_pos] == ':' || parser.buffer[parser.buffer_pos] == ',' || + parser.buffer[parser.buffer_pos] == ']' || parser.buffer[parser.buffer_pos] == '}' || + parser.buffer[parser.buffer_pos] == '%' || parser.buffer[parser.buffer_pos] == '@' || + parser.buffer[parser.buffer_pos] == '`') { + context := "while scanning an alias" + if typ == yaml_ANCHOR_TOKEN { + context = "while scanning an anchor" + } + yaml_parser_set_scanner_error(parser, context, start_mark, + "did not find expected alphabetic or numeric character") + return false + } + + // Create a token. + *token = yaml_token_t{ + typ: typ, + start_mark: start_mark, + end_mark: end_mark, + value: s, + } + + return true +} + +/* + * Scan a TAG token. + */ + +func yaml_parser_scan_tag(parser *yaml_parser_t, token *yaml_token_t) bool { + var handle, suffix []byte + + start_mark := parser.mark + + // Check if the tag is in the canonical form. + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + + if parser.buffer[parser.buffer_pos+1] == '<' { + // Keep the handle as '' + + // Eat '!<' + skip(parser) + skip(parser) + + // Consume the tag value. + if !yaml_parser_scan_tag_uri(parser, false, nil, start_mark, &suffix) { + return false + } + + // Check for '>' and eat it. + if parser.buffer[parser.buffer_pos] != '>' { + yaml_parser_set_scanner_error(parser, "while scanning a tag", + start_mark, "did not find the expected '>'") + return false + } + + skip(parser) + } else { + // The tag has either the '!suffix' or the '!handle!suffix' form. + + // First, try to scan a handle. + if !yaml_parser_scan_tag_handle(parser, false, start_mark, &handle) { + return false + } + + // Check if it is, indeed, handle. + if handle[0] == '!' && len(handle) > 1 && handle[len(handle)-1] == '!' { + // Scan the suffix now. + if !yaml_parser_scan_tag_uri(parser, false, nil, start_mark, &suffix) { + return false + } + } else { + // It wasn't a handle after all. Scan the rest of the tag. + if !yaml_parser_scan_tag_uri(parser, false, handle, start_mark, &suffix) { + return false + } + + // Set the handle to '!'. + handle = []byte{'!'} + + // A special case: the '!' tag. Set the handle to '' and the + // suffix to '!'. + if len(suffix) == 0 { + handle, suffix = suffix, handle + } + } + } + + // Check the character which ends the tag. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if !is_blankz(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a tag", + start_mark, "did not find expected whitespace or line break") + return false + } + + end_mark := parser.mark + + // Create a token. + *token = yaml_token_t{ + typ: yaml_TAG_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + value: handle, + suffix: suffix, + } + return true +} + +// Scan a tag handle. +func yaml_parser_scan_tag_handle(parser *yaml_parser_t, directive bool, start_mark yaml_mark_t, handle *[]byte) bool { + // Check the initial '!' character. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if parser.buffer[parser.buffer_pos] != '!' { + yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "did not find expected '!'") + return false + } + + var s []byte + + // Copy the '!' character. + s = read(parser, s) + + // Copy all subsequent alphabetical and numerical characters. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + for is_alpha(parser.buffer, parser.buffer_pos) { + s = read(parser, s) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Check if the trailing character is '!' and copy it. + if parser.buffer[parser.buffer_pos] == '!' { + s = read(parser, s) + } else { + // It's either the '!' tag or not really a tag handle. If it's a %TAG + // directive, it's an error. If it's a tag token, it must be a part of URI. + if directive && string(s) != "!" { + yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "did not find expected '!'") + return false + } + } + + *handle = s + return true +} + +// Scan a tag. +func yaml_parser_scan_tag_uri(parser *yaml_parser_t, directive bool, head []byte, start_mark yaml_mark_t, uri *[]byte) bool { + //size_t length = head ? strlen((char *)head) : 0 + var s []byte + hasTag := len(head) > 0 + + // Copy the head if needed. + // + // Note that we don't copy the leading '!' character. + if len(head) > 1 { + s = append(s, head[1:]...) + } + + // Scan the tag. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + // The set of characters that may appear in URI is as follows: + // + // '0'-'9', 'A'-'Z', 'a'-'z', '_', '-', ';', '/', '?', ':', '@', '&', + // '=', '+', '$', ',', '.', '!', '~', '*', '\'', '(', ')', '[', ']', + // '%'. + // [Go] Convert this into more reasonable logic. + for is_alpha(parser.buffer, parser.buffer_pos) || parser.buffer[parser.buffer_pos] == ';' || + parser.buffer[parser.buffer_pos] == '/' || parser.buffer[parser.buffer_pos] == '?' || + parser.buffer[parser.buffer_pos] == ':' || parser.buffer[parser.buffer_pos] == '@' || + parser.buffer[parser.buffer_pos] == '&' || parser.buffer[parser.buffer_pos] == '=' || + parser.buffer[parser.buffer_pos] == '+' || parser.buffer[parser.buffer_pos] == '$' || + parser.buffer[parser.buffer_pos] == ',' || parser.buffer[parser.buffer_pos] == '.' || + parser.buffer[parser.buffer_pos] == '!' || parser.buffer[parser.buffer_pos] == '~' || + parser.buffer[parser.buffer_pos] == '*' || parser.buffer[parser.buffer_pos] == '\'' || + parser.buffer[parser.buffer_pos] == '(' || parser.buffer[parser.buffer_pos] == ')' || + parser.buffer[parser.buffer_pos] == '[' || parser.buffer[parser.buffer_pos] == ']' || + parser.buffer[parser.buffer_pos] == '%' { + // Check if it is a URI-escape sequence. + if parser.buffer[parser.buffer_pos] == '%' { + if !yaml_parser_scan_uri_escapes(parser, directive, start_mark, &s) { + return false + } + } else { + s = read(parser, s) + } + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + hasTag = true + } + + if !hasTag { + yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "did not find expected tag URI") + return false + } + *uri = s + return true +} + +// Decode an URI-escape sequence corresponding to a single UTF-8 character. +func yaml_parser_scan_uri_escapes(parser *yaml_parser_t, directive bool, start_mark yaml_mark_t, s *[]byte) bool { + + // Decode the required number of characters. + w := 1024 + for w > 0 { + // Check for a URI-escaped octet. + if parser.unread < 3 && !yaml_parser_update_buffer(parser, 3) { + return false + } + + if !(parser.buffer[parser.buffer_pos] == '%' && + is_hex(parser.buffer, parser.buffer_pos+1) && + is_hex(parser.buffer, parser.buffer_pos+2)) { + return yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "did not find URI escaped octet") + } + + // Get the octet. + octet := byte((as_hex(parser.buffer, parser.buffer_pos+1) << 4) + as_hex(parser.buffer, parser.buffer_pos+2)) + + // If it is the leading octet, determine the length of the UTF-8 sequence. + if w == 1024 { + w = width(octet) + if w == 0 { + return yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "found an incorrect leading UTF-8 octet") + } + } else { + // Check if the trailing octet is correct. + if octet&0xC0 != 0x80 { + return yaml_parser_set_scanner_tag_error(parser, directive, + start_mark, "found an incorrect trailing UTF-8 octet") + } + } + + // Copy the octet and move the pointers. + *s = append(*s, octet) + skip(parser) + skip(parser) + skip(parser) + w-- + } + return true +} + +// Scan a block scalar. +func yaml_parser_scan_block_scalar(parser *yaml_parser_t, token *yaml_token_t, literal bool) bool { + // Eat the indicator '|' or '>'. + start_mark := parser.mark + skip(parser) + + // Scan the additional block scalar indicators. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + // Check for a chomping indicator. + var chomping, increment int + if parser.buffer[parser.buffer_pos] == '+' || parser.buffer[parser.buffer_pos] == '-' { + // Set the chomping method and eat the indicator. + if parser.buffer[parser.buffer_pos] == '+' { + chomping = +1 + } else { + chomping = -1 + } + skip(parser) + + // Check for an indentation indicator. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if is_digit(parser.buffer, parser.buffer_pos) { + // Check that the indentation is greater than 0. + if parser.buffer[parser.buffer_pos] == '0' { + yaml_parser_set_scanner_error(parser, "while scanning a block scalar", + start_mark, "found an indentation indicator equal to 0") + return false + } + + // Get the indentation level and eat the indicator. + increment = as_digit(parser.buffer, parser.buffer_pos) + skip(parser) + } + + } else if is_digit(parser.buffer, parser.buffer_pos) { + // Do the same as above, but in the opposite order. + + if parser.buffer[parser.buffer_pos] == '0' { + yaml_parser_set_scanner_error(parser, "while scanning a block scalar", + start_mark, "found an indentation indicator equal to 0") + return false + } + increment = as_digit(parser.buffer, parser.buffer_pos) + skip(parser) + + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + if parser.buffer[parser.buffer_pos] == '+' || parser.buffer[parser.buffer_pos] == '-' { + if parser.buffer[parser.buffer_pos] == '+' { + chomping = +1 + } else { + chomping = -1 + } + skip(parser) + } + } + + // Eat whitespaces and comments to the end of the line. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + for is_blank(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + if parser.buffer[parser.buffer_pos] == '#' { + for !is_breakz(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + } + + // Check if we are at the end of the line. + if !is_breakz(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a block scalar", + start_mark, "did not find expected comment or line break") + return false + } + + // Eat a line break. + if is_break(parser.buffer, parser.buffer_pos) { + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + skip_line(parser) + } + + end_mark := parser.mark + + // Set the indentation level if it was specified. + var indent int + if increment > 0 { + if parser.indent >= 0 { + indent = parser.indent + increment + } else { + indent = increment + } + } + + // Scan the leading line breaks and determine the indentation level if needed. + var s, leading_break, trailing_breaks []byte + if !yaml_parser_scan_block_scalar_breaks(parser, &indent, &trailing_breaks, start_mark, &end_mark) { + return false + } + + // Scan the block scalar content. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + var leading_blank, trailing_blank bool + for parser.mark.column == indent && !is_z(parser.buffer, parser.buffer_pos) { + // We are at the beginning of a non-empty line. + + // Is it a trailing whitespace? + trailing_blank = is_blank(parser.buffer, parser.buffer_pos) + + // Check if we need to fold the leading line break. + if !literal && !leading_blank && !trailing_blank && len(leading_break) > 0 && leading_break[0] == '\n' { + // Do we need to join the lines by space? + if len(trailing_breaks) == 0 { + s = append(s, ' ') + } + } else { + s = append(s, leading_break...) + } + leading_break = leading_break[:0] + + // Append the remaining line breaks. + s = append(s, trailing_breaks...) + trailing_breaks = trailing_breaks[:0] + + // Is it a leading whitespace? + leading_blank = is_blank(parser.buffer, parser.buffer_pos) + + // Consume the current line. + for !is_breakz(parser.buffer, parser.buffer_pos) { + s = read(parser, s) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Consume the line break. + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + + leading_break = read_line(parser, leading_break) + + // Eat the following indentation spaces and line breaks. + if !yaml_parser_scan_block_scalar_breaks(parser, &indent, &trailing_breaks, start_mark, &end_mark) { + return false + } + } + + // Chomp the tail. + if chomping != -1 { + s = append(s, leading_break...) + } + if chomping == 1 { + s = append(s, trailing_breaks...) + } + + // Create a token. + *token = yaml_token_t{ + typ: yaml_SCALAR_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + value: s, + style: yaml_LITERAL_SCALAR_STYLE, + } + if !literal { + token.style = yaml_FOLDED_SCALAR_STYLE + } + return true +} + +// Scan indentation spaces and line breaks for a block scalar. Determine the +// indentation level if needed. +func yaml_parser_scan_block_scalar_breaks(parser *yaml_parser_t, indent *int, breaks *[]byte, start_mark yaml_mark_t, end_mark *yaml_mark_t) bool { + *end_mark = parser.mark + + // Eat the indentation spaces and line breaks. + max_indent := 0 + for { + // Eat the indentation spaces. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + for (*indent == 0 || parser.mark.column < *indent) && is_space(parser.buffer, parser.buffer_pos) { + skip(parser) + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + if parser.mark.column > max_indent { + max_indent = parser.mark.column + } + + // Check for a tab character messing the indentation. + if (*indent == 0 || parser.mark.column < *indent) && is_tab(parser.buffer, parser.buffer_pos) { + return yaml_parser_set_scanner_error(parser, "while scanning a block scalar", + start_mark, "found a tab character where an indentation space is expected") + } + + // Have we found a non-empty line? + if !is_break(parser.buffer, parser.buffer_pos) { + break + } + + // Consume the line break. + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + // [Go] Should really be returning breaks instead. + *breaks = read_line(parser, *breaks) + *end_mark = parser.mark + } + + // Determine the indentation level if needed. + if *indent == 0 { + *indent = max_indent + if *indent < parser.indent+1 { + *indent = parser.indent + 1 + } + if *indent < 1 { + *indent = 1 + } + } + return true +} + +// Scan a quoted scalar. +func yaml_parser_scan_flow_scalar(parser *yaml_parser_t, token *yaml_token_t, single bool) bool { + // Eat the left quote. + start_mark := parser.mark + skip(parser) + + // Consume the content of the quoted scalar. + var s, leading_break, trailing_breaks, whitespaces []byte + for { + // Check that there are no document indicators at the beginning of the line. + if parser.unread < 4 && !yaml_parser_update_buffer(parser, 4) { + return false + } + + if parser.mark.column == 0 && + ((parser.buffer[parser.buffer_pos+0] == '-' && + parser.buffer[parser.buffer_pos+1] == '-' && + parser.buffer[parser.buffer_pos+2] == '-') || + (parser.buffer[parser.buffer_pos+0] == '.' && + parser.buffer[parser.buffer_pos+1] == '.' && + parser.buffer[parser.buffer_pos+2] == '.')) && + is_blankz(parser.buffer, parser.buffer_pos+3) { + yaml_parser_set_scanner_error(parser, "while scanning a quoted scalar", + start_mark, "found unexpected document indicator") + return false + } + + // Check for EOF. + if is_z(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a quoted scalar", + start_mark, "found unexpected end of stream") + return false + } + + // Consume non-blank characters. + leading_blanks := false + for !is_blankz(parser.buffer, parser.buffer_pos) { + if single && parser.buffer[parser.buffer_pos] == '\'' && parser.buffer[parser.buffer_pos+1] == '\'' { + // Is is an escaped single quote. + s = append(s, '\'') + skip(parser) + skip(parser) + + } else if single && parser.buffer[parser.buffer_pos] == '\'' { + // It is a right single quote. + break + } else if !single && parser.buffer[parser.buffer_pos] == '"' { + // It is a right double quote. + break + + } else if !single && parser.buffer[parser.buffer_pos] == '\\' && is_break(parser.buffer, parser.buffer_pos+1) { + // It is an escaped line break. + if parser.unread < 3 && !yaml_parser_update_buffer(parser, 3) { + return false + } + skip(parser) + skip_line(parser) + leading_blanks = true + break + + } else if !single && parser.buffer[parser.buffer_pos] == '\\' { + // It is an escape sequence. + code_length := 0 + + // Check the escape character. + switch parser.buffer[parser.buffer_pos+1] { + case '0': + s = append(s, 0) + case 'a': + s = append(s, '\x07') + case 'b': + s = append(s, '\x08') + case 't', '\t': + s = append(s, '\x09') + case 'n': + s = append(s, '\x0A') + case 'v': + s = append(s, '\x0B') + case 'f': + s = append(s, '\x0C') + case 'r': + s = append(s, '\x0D') + case 'e': + s = append(s, '\x1B') + case ' ': + s = append(s, '\x20') + case '"': + s = append(s, '"') + case '\'': + s = append(s, '\'') + case '\\': + s = append(s, '\\') + case 'N': // NEL (#x85) + s = append(s, '\xC2') + s = append(s, '\x85') + case '_': // #xA0 + s = append(s, '\xC2') + s = append(s, '\xA0') + case 'L': // LS (#x2028) + s = append(s, '\xE2') + s = append(s, '\x80') + s = append(s, '\xA8') + case 'P': // PS (#x2029) + s = append(s, '\xE2') + s = append(s, '\x80') + s = append(s, '\xA9') + case 'x': + code_length = 2 + case 'u': + code_length = 4 + case 'U': + code_length = 8 + default: + yaml_parser_set_scanner_error(parser, "while parsing a quoted scalar", + start_mark, "found unknown escape character") + return false + } + + skip(parser) + skip(parser) + + // Consume an arbitrary escape code. + if code_length > 0 { + var value int + + // Scan the character value. + if parser.unread < code_length && !yaml_parser_update_buffer(parser, code_length) { + return false + } + for k := 0; k < code_length; k++ { + if !is_hex(parser.buffer, parser.buffer_pos+k) { + yaml_parser_set_scanner_error(parser, "while parsing a quoted scalar", + start_mark, "did not find expected hexdecimal number") + return false + } + value = (value << 4) + as_hex(parser.buffer, parser.buffer_pos+k) + } + + // Check the value and write the character. + if (value >= 0xD800 && value <= 0xDFFF) || value > 0x10FFFF { + yaml_parser_set_scanner_error(parser, "while parsing a quoted scalar", + start_mark, "found invalid Unicode character escape code") + return false + } + if value <= 0x7F { + s = append(s, byte(value)) + } else if value <= 0x7FF { + s = append(s, byte(0xC0+(value>>6))) + s = append(s, byte(0x80+(value&0x3F))) + } else if value <= 0xFFFF { + s = append(s, byte(0xE0+(value>>12))) + s = append(s, byte(0x80+((value>>6)&0x3F))) + s = append(s, byte(0x80+(value&0x3F))) + } else { + s = append(s, byte(0xF0+(value>>18))) + s = append(s, byte(0x80+((value>>12)&0x3F))) + s = append(s, byte(0x80+((value>>6)&0x3F))) + s = append(s, byte(0x80+(value&0x3F))) + } + + // Advance the pointer. + for k := 0; k < code_length; k++ { + skip(parser) + } + } + } else { + // It is a non-escaped non-blank character. + s = read(parser, s) + } + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + } + + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + // Check if we are at the end of the scalar. + if single { + if parser.buffer[parser.buffer_pos] == '\'' { + break + } + } else { + if parser.buffer[parser.buffer_pos] == '"' { + break + } + } + + // Consume blank characters. + for is_blank(parser.buffer, parser.buffer_pos) || is_break(parser.buffer, parser.buffer_pos) { + if is_blank(parser.buffer, parser.buffer_pos) { + // Consume a space or a tab character. + if !leading_blanks { + whitespaces = read(parser, whitespaces) + } else { + skip(parser) + } + } else { + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + + // Check if it is a first line break. + if !leading_blanks { + whitespaces = whitespaces[:0] + leading_break = read_line(parser, leading_break) + leading_blanks = true + } else { + trailing_breaks = read_line(parser, trailing_breaks) + } + } + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Join the whitespaces or fold line breaks. + if leading_blanks { + // Do we need to fold line breaks? + if len(leading_break) > 0 && leading_break[0] == '\n' { + if len(trailing_breaks) == 0 { + s = append(s, ' ') + } else { + s = append(s, trailing_breaks...) + } + } else { + s = append(s, leading_break...) + s = append(s, trailing_breaks...) + } + trailing_breaks = trailing_breaks[:0] + leading_break = leading_break[:0] + } else { + s = append(s, whitespaces...) + whitespaces = whitespaces[:0] + } + } + + // Eat the right quote. + skip(parser) + end_mark := parser.mark + + // Create a token. + *token = yaml_token_t{ + typ: yaml_SCALAR_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + value: s, + style: yaml_SINGLE_QUOTED_SCALAR_STYLE, + } + if !single { + token.style = yaml_DOUBLE_QUOTED_SCALAR_STYLE + } + return true +} + +// Scan a plain scalar. +func yaml_parser_scan_plain_scalar(parser *yaml_parser_t, token *yaml_token_t) bool { + + var s, leading_break, trailing_breaks, whitespaces []byte + var leading_blanks bool + var indent = parser.indent + 1 + + start_mark := parser.mark + end_mark := parser.mark + + // Consume the content of the plain scalar. + for { + // Check for a document indicator. + if parser.unread < 4 && !yaml_parser_update_buffer(parser, 4) { + return false + } + if parser.mark.column == 0 && + ((parser.buffer[parser.buffer_pos+0] == '-' && + parser.buffer[parser.buffer_pos+1] == '-' && + parser.buffer[parser.buffer_pos+2] == '-') || + (parser.buffer[parser.buffer_pos+0] == '.' && + parser.buffer[parser.buffer_pos+1] == '.' && + parser.buffer[parser.buffer_pos+2] == '.')) && + is_blankz(parser.buffer, parser.buffer_pos+3) { + break + } + + // Check for a comment. + if parser.buffer[parser.buffer_pos] == '#' { + break + } + + // Consume non-blank characters. + for !is_blankz(parser.buffer, parser.buffer_pos) { + + // Check for indicators that may end a plain scalar. + if (parser.buffer[parser.buffer_pos] == ':' && is_blankz(parser.buffer, parser.buffer_pos+1)) || + (parser.flow_level > 0 && + (parser.buffer[parser.buffer_pos] == ',' || + parser.buffer[parser.buffer_pos] == '?' || parser.buffer[parser.buffer_pos] == '[' || + parser.buffer[parser.buffer_pos] == ']' || parser.buffer[parser.buffer_pos] == '{' || + parser.buffer[parser.buffer_pos] == '}')) { + break + } + + // Check if we need to join whitespaces and breaks. + if leading_blanks || len(whitespaces) > 0 { + if leading_blanks { + // Do we need to fold line breaks? + if leading_break[0] == '\n' { + if len(trailing_breaks) == 0 { + s = append(s, ' ') + } else { + s = append(s, trailing_breaks...) + } + } else { + s = append(s, leading_break...) + s = append(s, trailing_breaks...) + } + trailing_breaks = trailing_breaks[:0] + leading_break = leading_break[:0] + leading_blanks = false + } else { + s = append(s, whitespaces...) + whitespaces = whitespaces[:0] + } + } + + // Copy the character. + s = read(parser, s) + + end_mark = parser.mark + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + } + + // Is it the end? + if !(is_blank(parser.buffer, parser.buffer_pos) || is_break(parser.buffer, parser.buffer_pos)) { + break + } + + // Consume blank characters. + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + + for is_blank(parser.buffer, parser.buffer_pos) || is_break(parser.buffer, parser.buffer_pos) { + if is_blank(parser.buffer, parser.buffer_pos) { + + // Check for tab characters that abuse indentation. + if leading_blanks && parser.mark.column < indent && is_tab(parser.buffer, parser.buffer_pos) { + yaml_parser_set_scanner_error(parser, "while scanning a plain scalar", + start_mark, "found a tab character that violates indentation") + return false + } + + // Consume a space or a tab character. + if !leading_blanks { + whitespaces = read(parser, whitespaces) + } else { + skip(parser) + } + } else { + if parser.unread < 2 && !yaml_parser_update_buffer(parser, 2) { + return false + } + + // Check if it is a first line break. + if !leading_blanks { + whitespaces = whitespaces[:0] + leading_break = read_line(parser, leading_break) + leading_blanks = true + } else { + trailing_breaks = read_line(parser, trailing_breaks) + } + } + if parser.unread < 1 && !yaml_parser_update_buffer(parser, 1) { + return false + } + } + + // Check indentation level. + if parser.flow_level == 0 && parser.mark.column < indent { + break + } + } + + // Create a token. + *token = yaml_token_t{ + typ: yaml_SCALAR_TOKEN, + start_mark: start_mark, + end_mark: end_mark, + value: s, + style: yaml_PLAIN_SCALAR_STYLE, + } + + // Note that we change the 'simple_key_allowed' flag. + if leading_blanks { + parser.simple_key_allowed = true + } + return true +} diff --git a/vendor/gopkg.in/yaml.v2/sorter.go b/vendor/gopkg.in/yaml.v2/sorter.go new file mode 100644 index 0000000..4c45e66 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/sorter.go @@ -0,0 +1,113 @@ +package yaml + +import ( + "reflect" + "unicode" +) + +type keyList []reflect.Value + +func (l keyList) Len() int { return len(l) } +func (l keyList) Swap(i, j int) { l[i], l[j] = l[j], l[i] } +func (l keyList) Less(i, j int) bool { + a := l[i] + b := l[j] + ak := a.Kind() + bk := b.Kind() + for (ak == reflect.Interface || ak == reflect.Ptr) && !a.IsNil() { + a = a.Elem() + ak = a.Kind() + } + for (bk == reflect.Interface || bk == reflect.Ptr) && !b.IsNil() { + b = b.Elem() + bk = b.Kind() + } + af, aok := keyFloat(a) + bf, bok := keyFloat(b) + if aok && bok { + if af != bf { + return af < bf + } + if ak != bk { + return ak < bk + } + return numLess(a, b) + } + if ak != reflect.String || bk != reflect.String { + return ak < bk + } + ar, br := []rune(a.String()), []rune(b.String()) + for i := 0; i < len(ar) && i < len(br); i++ { + if ar[i] == br[i] { + continue + } + al := unicode.IsLetter(ar[i]) + bl := unicode.IsLetter(br[i]) + if al && bl { + return ar[i] < br[i] + } + if al || bl { + return bl + } + var ai, bi int + var an, bn int64 + if ar[i] == '0' || br[i] == '0' { + for j := i-1; j >= 0 && unicode.IsDigit(ar[j]); j-- { + if ar[j] != '0' { + an = 1 + bn = 1 + break + } + } + } + for ai = i; ai < len(ar) && unicode.IsDigit(ar[ai]); ai++ { + an = an*10 + int64(ar[ai]-'0') + } + for bi = i; bi < len(br) && unicode.IsDigit(br[bi]); bi++ { + bn = bn*10 + int64(br[bi]-'0') + } + if an != bn { + return an < bn + } + if ai != bi { + return ai < bi + } + return ar[i] < br[i] + } + return len(ar) < len(br) +} + +// keyFloat returns a float value for v if it is a number/bool +// and whether it is a number/bool or not. +func keyFloat(v reflect.Value) (f float64, ok bool) { + switch v.Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return float64(v.Int()), true + case reflect.Float32, reflect.Float64: + return v.Float(), true + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return float64(v.Uint()), true + case reflect.Bool: + if v.Bool() { + return 1, true + } + return 0, true + } + return 0, false +} + +// numLess returns whether a < b. +// a and b must necessarily have the same kind. +func numLess(a, b reflect.Value) bool { + switch a.Kind() { + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return a.Int() < b.Int() + case reflect.Float32, reflect.Float64: + return a.Float() < b.Float() + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return a.Uint() < b.Uint() + case reflect.Bool: + return !a.Bool() && b.Bool() + } + panic("not a number") +} diff --git a/vendor/gopkg.in/yaml.v2/writerc.go b/vendor/gopkg.in/yaml.v2/writerc.go new file mode 100644 index 0000000..a2dde60 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/writerc.go @@ -0,0 +1,26 @@ +package yaml + +// Set the writer error and return false. +func yaml_emitter_set_writer_error(emitter *yaml_emitter_t, problem string) bool { + emitter.error = yaml_WRITER_ERROR + emitter.problem = problem + return false +} + +// Flush the output buffer. +func yaml_emitter_flush(emitter *yaml_emitter_t) bool { + if emitter.write_handler == nil { + panic("write handler not set") + } + + // Check if the buffer is empty. + if emitter.buffer_pos == 0 { + return true + } + + if err := emitter.write_handler(emitter, emitter.buffer[:emitter.buffer_pos]); err != nil { + return yaml_emitter_set_writer_error(emitter, "write error: "+err.Error()) + } + emitter.buffer_pos = 0 + return true +} diff --git a/vendor/gopkg.in/yaml.v2/yaml.go b/vendor/gopkg.in/yaml.v2/yaml.go new file mode 100644 index 0000000..de85aa4 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/yaml.go @@ -0,0 +1,466 @@ +// Package yaml implements YAML support for the Go language. +// +// Source code and other details for the project are available at GitHub: +// +// https://github.com/go-yaml/yaml +// +package yaml + +import ( + "errors" + "fmt" + "io" + "reflect" + "strings" + "sync" +) + +// MapSlice encodes and decodes as a YAML map. +// The order of keys is preserved when encoding and decoding. +type MapSlice []MapItem + +// MapItem is an item in a MapSlice. +type MapItem struct { + Key, Value interface{} +} + +// The Unmarshaler interface may be implemented by types to customize their +// behavior when being unmarshaled from a YAML document. The UnmarshalYAML +// method receives a function that may be called to unmarshal the original +// YAML value into a field or variable. It is safe to call the unmarshal +// function parameter more than once if necessary. +type Unmarshaler interface { + UnmarshalYAML(unmarshal func(interface{}) error) error +} + +// The Marshaler interface may be implemented by types to customize their +// behavior when being marshaled into a YAML document. The returned value +// is marshaled in place of the original value implementing Marshaler. +// +// If an error is returned by MarshalYAML, the marshaling procedure stops +// and returns with the provided error. +type Marshaler interface { + MarshalYAML() (interface{}, error) +} + +// Unmarshal decodes the first document found within the in byte slice +// and assigns decoded values into the out value. +// +// Maps and pointers (to a struct, string, int, etc) are accepted as out +// values. If an internal pointer within a struct is not initialized, +// the yaml package will initialize it if necessary for unmarshalling +// the provided data. The out parameter must not be nil. +// +// The type of the decoded values should be compatible with the respective +// values in out. If one or more values cannot be decoded due to a type +// mismatches, decoding continues partially until the end of the YAML +// content, and a *yaml.TypeError is returned with details for all +// missed values. +// +// Struct fields are only unmarshalled if they are exported (have an +// upper case first letter), and are unmarshalled using the field name +// lowercased as the default key. Custom keys may be defined via the +// "yaml" name in the field tag: the content preceding the first comma +// is used as the key, and the following comma-separated options are +// used to tweak the marshalling process (see Marshal). +// Conflicting names result in a runtime error. +// +// For example: +// +// type T struct { +// F int `yaml:"a,omitempty"` +// B int +// } +// var t T +// yaml.Unmarshal([]byte("a: 1\nb: 2"), &t) +// +// See the documentation of Marshal for the format of tags and a list of +// supported tag options. +// +func Unmarshal(in []byte, out interface{}) (err error) { + return unmarshal(in, out, false) +} + +// UnmarshalStrict is like Unmarshal except that any fields that are found +// in the data that do not have corresponding struct members, or mapping +// keys that are duplicates, will result in +// an error. +func UnmarshalStrict(in []byte, out interface{}) (err error) { + return unmarshal(in, out, true) +} + +// A Decorder reads and decodes YAML values from an input stream. +type Decoder struct { + strict bool + parser *parser +} + +// NewDecoder returns a new decoder that reads from r. +// +// The decoder introduces its own buffering and may read +// data from r beyond the YAML values requested. +func NewDecoder(r io.Reader) *Decoder { + return &Decoder{ + parser: newParserFromReader(r), + } +} + +// SetStrict sets whether strict decoding behaviour is enabled when +// decoding items in the data (see UnmarshalStrict). By default, decoding is not strict. +func (dec *Decoder) SetStrict(strict bool) { + dec.strict = strict +} + +// Decode reads the next YAML-encoded value from its input +// and stores it in the value pointed to by v. +// +// See the documentation for Unmarshal for details about the +// conversion of YAML into a Go value. +func (dec *Decoder) Decode(v interface{}) (err error) { + d := newDecoder(dec.strict) + defer handleErr(&err) + node := dec.parser.parse() + if node == nil { + return io.EOF + } + out := reflect.ValueOf(v) + if out.Kind() == reflect.Ptr && !out.IsNil() { + out = out.Elem() + } + d.unmarshal(node, out) + if len(d.terrors) > 0 { + return &TypeError{d.terrors} + } + return nil +} + +func unmarshal(in []byte, out interface{}, strict bool) (err error) { + defer handleErr(&err) + d := newDecoder(strict) + p := newParser(in) + defer p.destroy() + node := p.parse() + if node != nil { + v := reflect.ValueOf(out) + if v.Kind() == reflect.Ptr && !v.IsNil() { + v = v.Elem() + } + d.unmarshal(node, v) + } + if len(d.terrors) > 0 { + return &TypeError{d.terrors} + } + return nil +} + +// Marshal serializes the value provided into a YAML document. The structure +// of the generated document will reflect the structure of the value itself. +// Maps and pointers (to struct, string, int, etc) are accepted as the in value. +// +// Struct fields are only marshalled if they are exported (have an upper case +// first letter), and are marshalled using the field name lowercased as the +// default key. Custom keys may be defined via the "yaml" name in the field +// tag: the content preceding the first comma is used as the key, and the +// following comma-separated options are used to tweak the marshalling process. +// Conflicting names result in a runtime error. +// +// The field tag format accepted is: +// +// `(...) yaml:"[][,[,]]" (...)` +// +// The following flags are currently supported: +// +// omitempty Only include the field if it's not set to the zero +// value for the type or to empty slices or maps. +// Zero valued structs will be omitted if all their public +// fields are zero, unless they implement an IsZero +// method (see the IsZeroer interface type), in which +// case the field will be included if that method returns true. +// +// flow Marshal using a flow style (useful for structs, +// sequences and maps). +// +// inline Inline the field, which must be a struct or a map, +// causing all of its fields or keys to be processed as if +// they were part of the outer struct. For maps, keys must +// not conflict with the yaml keys of other struct fields. +// +// In addition, if the key is "-", the field is ignored. +// +// For example: +// +// type T struct { +// F int `yaml:"a,omitempty"` +// B int +// } +// yaml.Marshal(&T{B: 2}) // Returns "b: 2\n" +// yaml.Marshal(&T{F: 1}} // Returns "a: 1\nb: 0\n" +// +func Marshal(in interface{}) (out []byte, err error) { + defer handleErr(&err) + e := newEncoder() + defer e.destroy() + e.marshalDoc("", reflect.ValueOf(in)) + e.finish() + out = e.out + return +} + +// An Encoder writes YAML values to an output stream. +type Encoder struct { + encoder *encoder +} + +// NewEncoder returns a new encoder that writes to w. +// The Encoder should be closed after use to flush all data +// to w. +func NewEncoder(w io.Writer) *Encoder { + return &Encoder{ + encoder: newEncoderWithWriter(w), + } +} + +// Encode writes the YAML encoding of v to the stream. +// If multiple items are encoded to the stream, the +// second and subsequent document will be preceded +// with a "---" document separator, but the first will not. +// +// See the documentation for Marshal for details about the conversion of Go +// values to YAML. +func (e *Encoder) Encode(v interface{}) (err error) { + defer handleErr(&err) + e.encoder.marshalDoc("", reflect.ValueOf(v)) + return nil +} + +// Close closes the encoder by writing any remaining data. +// It does not write a stream terminating string "...". +func (e *Encoder) Close() (err error) { + defer handleErr(&err) + e.encoder.finish() + return nil +} + +func handleErr(err *error) { + if v := recover(); v != nil { + if e, ok := v.(yamlError); ok { + *err = e.err + } else { + panic(v) + } + } +} + +type yamlError struct { + err error +} + +func fail(err error) { + panic(yamlError{err}) +} + +func failf(format string, args ...interface{}) { + panic(yamlError{fmt.Errorf("yaml: "+format, args...)}) +} + +// A TypeError is returned by Unmarshal when one or more fields in +// the YAML document cannot be properly decoded into the requested +// types. When this error is returned, the value is still +// unmarshaled partially. +type TypeError struct { + Errors []string +} + +func (e *TypeError) Error() string { + return fmt.Sprintf("yaml: unmarshal errors:\n %s", strings.Join(e.Errors, "\n ")) +} + +// -------------------------------------------------------------------------- +// Maintain a mapping of keys to structure field indexes + +// The code in this section was copied from mgo/bson. + +// structInfo holds details for the serialization of fields of +// a given struct. +type structInfo struct { + FieldsMap map[string]fieldInfo + FieldsList []fieldInfo + + // InlineMap is the number of the field in the struct that + // contains an ,inline map, or -1 if there's none. + InlineMap int +} + +type fieldInfo struct { + Key string + Num int + OmitEmpty bool + Flow bool + // Id holds the unique field identifier, so we can cheaply + // check for field duplicates without maintaining an extra map. + Id int + + // Inline holds the field index if the field is part of an inlined struct. + Inline []int +} + +var structMap = make(map[reflect.Type]*structInfo) +var fieldMapMutex sync.RWMutex + +func getStructInfo(st reflect.Type) (*structInfo, error) { + fieldMapMutex.RLock() + sinfo, found := structMap[st] + fieldMapMutex.RUnlock() + if found { + return sinfo, nil + } + + n := st.NumField() + fieldsMap := make(map[string]fieldInfo) + fieldsList := make([]fieldInfo, 0, n) + inlineMap := -1 + for i := 0; i != n; i++ { + field := st.Field(i) + if field.PkgPath != "" && !field.Anonymous { + continue // Private field + } + + info := fieldInfo{Num: i} + + tag := field.Tag.Get("yaml") + if tag == "" && strings.Index(string(field.Tag), ":") < 0 { + tag = string(field.Tag) + } + if tag == "-" { + continue + } + + inline := false + fields := strings.Split(tag, ",") + if len(fields) > 1 { + for _, flag := range fields[1:] { + switch flag { + case "omitempty": + info.OmitEmpty = true + case "flow": + info.Flow = true + case "inline": + inline = true + default: + return nil, errors.New(fmt.Sprintf("Unsupported flag %q in tag %q of type %s", flag, tag, st)) + } + } + tag = fields[0] + } + + if inline { + switch field.Type.Kind() { + case reflect.Map: + if inlineMap >= 0 { + return nil, errors.New("Multiple ,inline maps in struct " + st.String()) + } + if field.Type.Key() != reflect.TypeOf("") { + return nil, errors.New("Option ,inline needs a map with string keys in struct " + st.String()) + } + inlineMap = info.Num + case reflect.Struct: + sinfo, err := getStructInfo(field.Type) + if err != nil { + return nil, err + } + for _, finfo := range sinfo.FieldsList { + if _, found := fieldsMap[finfo.Key]; found { + msg := "Duplicated key '" + finfo.Key + "' in struct " + st.String() + return nil, errors.New(msg) + } + if finfo.Inline == nil { + finfo.Inline = []int{i, finfo.Num} + } else { + finfo.Inline = append([]int{i}, finfo.Inline...) + } + finfo.Id = len(fieldsList) + fieldsMap[finfo.Key] = finfo + fieldsList = append(fieldsList, finfo) + } + default: + //return nil, errors.New("Option ,inline needs a struct value or map field") + return nil, errors.New("Option ,inline needs a struct value field") + } + continue + } + + if tag != "" { + info.Key = tag + } else { + info.Key = strings.ToLower(field.Name) + } + + if _, found = fieldsMap[info.Key]; found { + msg := "Duplicated key '" + info.Key + "' in struct " + st.String() + return nil, errors.New(msg) + } + + info.Id = len(fieldsList) + fieldsList = append(fieldsList, info) + fieldsMap[info.Key] = info + } + + sinfo = &structInfo{ + FieldsMap: fieldsMap, + FieldsList: fieldsList, + InlineMap: inlineMap, + } + + fieldMapMutex.Lock() + structMap[st] = sinfo + fieldMapMutex.Unlock() + return sinfo, nil +} + +// IsZeroer is used to check whether an object is zero to +// determine whether it should be omitted when marshaling +// with the omitempty flag. One notable implementation +// is time.Time. +type IsZeroer interface { + IsZero() bool +} + +func isZero(v reflect.Value) bool { + kind := v.Kind() + if z, ok := v.Interface().(IsZeroer); ok { + if (kind == reflect.Ptr || kind == reflect.Interface) && v.IsNil() { + return true + } + return z.IsZero() + } + switch kind { + case reflect.String: + return len(v.String()) == 0 + case reflect.Interface, reflect.Ptr: + return v.IsNil() + case reflect.Slice: + return v.Len() == 0 + case reflect.Map: + return v.Len() == 0 + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return v.Int() == 0 + case reflect.Float32, reflect.Float64: + return v.Float() == 0 + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return v.Uint() == 0 + case reflect.Bool: + return !v.Bool() + case reflect.Struct: + vt := v.Type() + for i := v.NumField() - 1; i >= 0; i-- { + if vt.Field(i).PkgPath != "" { + continue // Private field + } + if !isZero(v.Field(i)) { + return false + } + } + return true + } + return false +} diff --git a/vendor/gopkg.in/yaml.v2/yamlh.go b/vendor/gopkg.in/yaml.v2/yamlh.go new file mode 100644 index 0000000..e25cee5 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/yamlh.go @@ -0,0 +1,738 @@ +package yaml + +import ( + "fmt" + "io" +) + +// The version directive data. +type yaml_version_directive_t struct { + major int8 // The major version number. + minor int8 // The minor version number. +} + +// The tag directive data. +type yaml_tag_directive_t struct { + handle []byte // The tag handle. + prefix []byte // The tag prefix. +} + +type yaml_encoding_t int + +// The stream encoding. +const ( + // Let the parser choose the encoding. + yaml_ANY_ENCODING yaml_encoding_t = iota + + yaml_UTF8_ENCODING // The default UTF-8 encoding. + yaml_UTF16LE_ENCODING // The UTF-16-LE encoding with BOM. + yaml_UTF16BE_ENCODING // The UTF-16-BE encoding with BOM. +) + +type yaml_break_t int + +// Line break types. +const ( + // Let the parser choose the break type. + yaml_ANY_BREAK yaml_break_t = iota + + yaml_CR_BREAK // Use CR for line breaks (Mac style). + yaml_LN_BREAK // Use LN for line breaks (Unix style). + yaml_CRLN_BREAK // Use CR LN for line breaks (DOS style). +) + +type yaml_error_type_t int + +// Many bad things could happen with the parser and emitter. +const ( + // No error is produced. + yaml_NO_ERROR yaml_error_type_t = iota + + yaml_MEMORY_ERROR // Cannot allocate or reallocate a block of memory. + yaml_READER_ERROR // Cannot read or decode the input stream. + yaml_SCANNER_ERROR // Cannot scan the input stream. + yaml_PARSER_ERROR // Cannot parse the input stream. + yaml_COMPOSER_ERROR // Cannot compose a YAML document. + yaml_WRITER_ERROR // Cannot write to the output stream. + yaml_EMITTER_ERROR // Cannot emit a YAML stream. +) + +// The pointer position. +type yaml_mark_t struct { + index int // The position index. + line int // The position line. + column int // The position column. +} + +// Node Styles + +type yaml_style_t int8 + +type yaml_scalar_style_t yaml_style_t + +// Scalar styles. +const ( + // Let the emitter choose the style. + yaml_ANY_SCALAR_STYLE yaml_scalar_style_t = iota + + yaml_PLAIN_SCALAR_STYLE // The plain scalar style. + yaml_SINGLE_QUOTED_SCALAR_STYLE // The single-quoted scalar style. + yaml_DOUBLE_QUOTED_SCALAR_STYLE // The double-quoted scalar style. + yaml_LITERAL_SCALAR_STYLE // The literal scalar style. + yaml_FOLDED_SCALAR_STYLE // The folded scalar style. +) + +type yaml_sequence_style_t yaml_style_t + +// Sequence styles. +const ( + // Let the emitter choose the style. + yaml_ANY_SEQUENCE_STYLE yaml_sequence_style_t = iota + + yaml_BLOCK_SEQUENCE_STYLE // The block sequence style. + yaml_FLOW_SEQUENCE_STYLE // The flow sequence style. +) + +type yaml_mapping_style_t yaml_style_t + +// Mapping styles. +const ( + // Let the emitter choose the style. + yaml_ANY_MAPPING_STYLE yaml_mapping_style_t = iota + + yaml_BLOCK_MAPPING_STYLE // The block mapping style. + yaml_FLOW_MAPPING_STYLE // The flow mapping style. +) + +// Tokens + +type yaml_token_type_t int + +// Token types. +const ( + // An empty token. + yaml_NO_TOKEN yaml_token_type_t = iota + + yaml_STREAM_START_TOKEN // A STREAM-START token. + yaml_STREAM_END_TOKEN // A STREAM-END token. + + yaml_VERSION_DIRECTIVE_TOKEN // A VERSION-DIRECTIVE token. + yaml_TAG_DIRECTIVE_TOKEN // A TAG-DIRECTIVE token. + yaml_DOCUMENT_START_TOKEN // A DOCUMENT-START token. + yaml_DOCUMENT_END_TOKEN // A DOCUMENT-END token. + + yaml_BLOCK_SEQUENCE_START_TOKEN // A BLOCK-SEQUENCE-START token. + yaml_BLOCK_MAPPING_START_TOKEN // A BLOCK-SEQUENCE-END token. + yaml_BLOCK_END_TOKEN // A BLOCK-END token. + + yaml_FLOW_SEQUENCE_START_TOKEN // A FLOW-SEQUENCE-START token. + yaml_FLOW_SEQUENCE_END_TOKEN // A FLOW-SEQUENCE-END token. + yaml_FLOW_MAPPING_START_TOKEN // A FLOW-MAPPING-START token. + yaml_FLOW_MAPPING_END_TOKEN // A FLOW-MAPPING-END token. + + yaml_BLOCK_ENTRY_TOKEN // A BLOCK-ENTRY token. + yaml_FLOW_ENTRY_TOKEN // A FLOW-ENTRY token. + yaml_KEY_TOKEN // A KEY token. + yaml_VALUE_TOKEN // A VALUE token. + + yaml_ALIAS_TOKEN // An ALIAS token. + yaml_ANCHOR_TOKEN // An ANCHOR token. + yaml_TAG_TOKEN // A TAG token. + yaml_SCALAR_TOKEN // A SCALAR token. +) + +func (tt yaml_token_type_t) String() string { + switch tt { + case yaml_NO_TOKEN: + return "yaml_NO_TOKEN" + case yaml_STREAM_START_TOKEN: + return "yaml_STREAM_START_TOKEN" + case yaml_STREAM_END_TOKEN: + return "yaml_STREAM_END_TOKEN" + case yaml_VERSION_DIRECTIVE_TOKEN: + return "yaml_VERSION_DIRECTIVE_TOKEN" + case yaml_TAG_DIRECTIVE_TOKEN: + return "yaml_TAG_DIRECTIVE_TOKEN" + case yaml_DOCUMENT_START_TOKEN: + return "yaml_DOCUMENT_START_TOKEN" + case yaml_DOCUMENT_END_TOKEN: + return "yaml_DOCUMENT_END_TOKEN" + case yaml_BLOCK_SEQUENCE_START_TOKEN: + return "yaml_BLOCK_SEQUENCE_START_TOKEN" + case yaml_BLOCK_MAPPING_START_TOKEN: + return "yaml_BLOCK_MAPPING_START_TOKEN" + case yaml_BLOCK_END_TOKEN: + return "yaml_BLOCK_END_TOKEN" + case yaml_FLOW_SEQUENCE_START_TOKEN: + return "yaml_FLOW_SEQUENCE_START_TOKEN" + case yaml_FLOW_SEQUENCE_END_TOKEN: + return "yaml_FLOW_SEQUENCE_END_TOKEN" + case yaml_FLOW_MAPPING_START_TOKEN: + return "yaml_FLOW_MAPPING_START_TOKEN" + case yaml_FLOW_MAPPING_END_TOKEN: + return "yaml_FLOW_MAPPING_END_TOKEN" + case yaml_BLOCK_ENTRY_TOKEN: + return "yaml_BLOCK_ENTRY_TOKEN" + case yaml_FLOW_ENTRY_TOKEN: + return "yaml_FLOW_ENTRY_TOKEN" + case yaml_KEY_TOKEN: + return "yaml_KEY_TOKEN" + case yaml_VALUE_TOKEN: + return "yaml_VALUE_TOKEN" + case yaml_ALIAS_TOKEN: + return "yaml_ALIAS_TOKEN" + case yaml_ANCHOR_TOKEN: + return "yaml_ANCHOR_TOKEN" + case yaml_TAG_TOKEN: + return "yaml_TAG_TOKEN" + case yaml_SCALAR_TOKEN: + return "yaml_SCALAR_TOKEN" + } + return "" +} + +// The token structure. +type yaml_token_t struct { + // The token type. + typ yaml_token_type_t + + // The start/end of the token. + start_mark, end_mark yaml_mark_t + + // The stream encoding (for yaml_STREAM_START_TOKEN). + encoding yaml_encoding_t + + // The alias/anchor/scalar value or tag/tag directive handle + // (for yaml_ALIAS_TOKEN, yaml_ANCHOR_TOKEN, yaml_SCALAR_TOKEN, yaml_TAG_TOKEN, yaml_TAG_DIRECTIVE_TOKEN). + value []byte + + // The tag suffix (for yaml_TAG_TOKEN). + suffix []byte + + // The tag directive prefix (for yaml_TAG_DIRECTIVE_TOKEN). + prefix []byte + + // The scalar style (for yaml_SCALAR_TOKEN). + style yaml_scalar_style_t + + // The version directive major/minor (for yaml_VERSION_DIRECTIVE_TOKEN). + major, minor int8 +} + +// Events + +type yaml_event_type_t int8 + +// Event types. +const ( + // An empty event. + yaml_NO_EVENT yaml_event_type_t = iota + + yaml_STREAM_START_EVENT // A STREAM-START event. + yaml_STREAM_END_EVENT // A STREAM-END event. + yaml_DOCUMENT_START_EVENT // A DOCUMENT-START event. + yaml_DOCUMENT_END_EVENT // A DOCUMENT-END event. + yaml_ALIAS_EVENT // An ALIAS event. + yaml_SCALAR_EVENT // A SCALAR event. + yaml_SEQUENCE_START_EVENT // A SEQUENCE-START event. + yaml_SEQUENCE_END_EVENT // A SEQUENCE-END event. + yaml_MAPPING_START_EVENT // A MAPPING-START event. + yaml_MAPPING_END_EVENT // A MAPPING-END event. +) + +var eventStrings = []string{ + yaml_NO_EVENT: "none", + yaml_STREAM_START_EVENT: "stream start", + yaml_STREAM_END_EVENT: "stream end", + yaml_DOCUMENT_START_EVENT: "document start", + yaml_DOCUMENT_END_EVENT: "document end", + yaml_ALIAS_EVENT: "alias", + yaml_SCALAR_EVENT: "scalar", + yaml_SEQUENCE_START_EVENT: "sequence start", + yaml_SEQUENCE_END_EVENT: "sequence end", + yaml_MAPPING_START_EVENT: "mapping start", + yaml_MAPPING_END_EVENT: "mapping end", +} + +func (e yaml_event_type_t) String() string { + if e < 0 || int(e) >= len(eventStrings) { + return fmt.Sprintf("unknown event %d", e) + } + return eventStrings[e] +} + +// The event structure. +type yaml_event_t struct { + + // The event type. + typ yaml_event_type_t + + // The start and end of the event. + start_mark, end_mark yaml_mark_t + + // The document encoding (for yaml_STREAM_START_EVENT). + encoding yaml_encoding_t + + // The version directive (for yaml_DOCUMENT_START_EVENT). + version_directive *yaml_version_directive_t + + // The list of tag directives (for yaml_DOCUMENT_START_EVENT). + tag_directives []yaml_tag_directive_t + + // The anchor (for yaml_SCALAR_EVENT, yaml_SEQUENCE_START_EVENT, yaml_MAPPING_START_EVENT, yaml_ALIAS_EVENT). + anchor []byte + + // The tag (for yaml_SCALAR_EVENT, yaml_SEQUENCE_START_EVENT, yaml_MAPPING_START_EVENT). + tag []byte + + // The scalar value (for yaml_SCALAR_EVENT). + value []byte + + // Is the document start/end indicator implicit, or the tag optional? + // (for yaml_DOCUMENT_START_EVENT, yaml_DOCUMENT_END_EVENT, yaml_SEQUENCE_START_EVENT, yaml_MAPPING_START_EVENT, yaml_SCALAR_EVENT). + implicit bool + + // Is the tag optional for any non-plain style? (for yaml_SCALAR_EVENT). + quoted_implicit bool + + // The style (for yaml_SCALAR_EVENT, yaml_SEQUENCE_START_EVENT, yaml_MAPPING_START_EVENT). + style yaml_style_t +} + +func (e *yaml_event_t) scalar_style() yaml_scalar_style_t { return yaml_scalar_style_t(e.style) } +func (e *yaml_event_t) sequence_style() yaml_sequence_style_t { return yaml_sequence_style_t(e.style) } +func (e *yaml_event_t) mapping_style() yaml_mapping_style_t { return yaml_mapping_style_t(e.style) } + +// Nodes + +const ( + yaml_NULL_TAG = "tag:yaml.org,2002:null" // The tag !!null with the only possible value: null. + yaml_BOOL_TAG = "tag:yaml.org,2002:bool" // The tag !!bool with the values: true and false. + yaml_STR_TAG = "tag:yaml.org,2002:str" // The tag !!str for string values. + yaml_INT_TAG = "tag:yaml.org,2002:int" // The tag !!int for integer values. + yaml_FLOAT_TAG = "tag:yaml.org,2002:float" // The tag !!float for float values. + yaml_TIMESTAMP_TAG = "tag:yaml.org,2002:timestamp" // The tag !!timestamp for date and time values. + + yaml_SEQ_TAG = "tag:yaml.org,2002:seq" // The tag !!seq is used to denote sequences. + yaml_MAP_TAG = "tag:yaml.org,2002:map" // The tag !!map is used to denote mapping. + + // Not in original libyaml. + yaml_BINARY_TAG = "tag:yaml.org,2002:binary" + yaml_MERGE_TAG = "tag:yaml.org,2002:merge" + + yaml_DEFAULT_SCALAR_TAG = yaml_STR_TAG // The default scalar tag is !!str. + yaml_DEFAULT_SEQUENCE_TAG = yaml_SEQ_TAG // The default sequence tag is !!seq. + yaml_DEFAULT_MAPPING_TAG = yaml_MAP_TAG // The default mapping tag is !!map. +) + +type yaml_node_type_t int + +// Node types. +const ( + // An empty node. + yaml_NO_NODE yaml_node_type_t = iota + + yaml_SCALAR_NODE // A scalar node. + yaml_SEQUENCE_NODE // A sequence node. + yaml_MAPPING_NODE // A mapping node. +) + +// An element of a sequence node. +type yaml_node_item_t int + +// An element of a mapping node. +type yaml_node_pair_t struct { + key int // The key of the element. + value int // The value of the element. +} + +// The node structure. +type yaml_node_t struct { + typ yaml_node_type_t // The node type. + tag []byte // The node tag. + + // The node data. + + // The scalar parameters (for yaml_SCALAR_NODE). + scalar struct { + value []byte // The scalar value. + length int // The length of the scalar value. + style yaml_scalar_style_t // The scalar style. + } + + // The sequence parameters (for YAML_SEQUENCE_NODE). + sequence struct { + items_data []yaml_node_item_t // The stack of sequence items. + style yaml_sequence_style_t // The sequence style. + } + + // The mapping parameters (for yaml_MAPPING_NODE). + mapping struct { + pairs_data []yaml_node_pair_t // The stack of mapping pairs (key, value). + pairs_start *yaml_node_pair_t // The beginning of the stack. + pairs_end *yaml_node_pair_t // The end of the stack. + pairs_top *yaml_node_pair_t // The top of the stack. + style yaml_mapping_style_t // The mapping style. + } + + start_mark yaml_mark_t // The beginning of the node. + end_mark yaml_mark_t // The end of the node. + +} + +// The document structure. +type yaml_document_t struct { + + // The document nodes. + nodes []yaml_node_t + + // The version directive. + version_directive *yaml_version_directive_t + + // The list of tag directives. + tag_directives_data []yaml_tag_directive_t + tag_directives_start int // The beginning of the tag directives list. + tag_directives_end int // The end of the tag directives list. + + start_implicit int // Is the document start indicator implicit? + end_implicit int // Is the document end indicator implicit? + + // The start/end of the document. + start_mark, end_mark yaml_mark_t +} + +// The prototype of a read handler. +// +// The read handler is called when the parser needs to read more bytes from the +// source. The handler should write not more than size bytes to the buffer. +// The number of written bytes should be set to the size_read variable. +// +// [in,out] data A pointer to an application data specified by +// yaml_parser_set_input(). +// [out] buffer The buffer to write the data from the source. +// [in] size The size of the buffer. +// [out] size_read The actual number of bytes read from the source. +// +// On success, the handler should return 1. If the handler failed, +// the returned value should be 0. On EOF, the handler should set the +// size_read to 0 and return 1. +type yaml_read_handler_t func(parser *yaml_parser_t, buffer []byte) (n int, err error) + +// This structure holds information about a potential simple key. +type yaml_simple_key_t struct { + possible bool // Is a simple key possible? + required bool // Is a simple key required? + token_number int // The number of the token. + mark yaml_mark_t // The position mark. +} + +// The states of the parser. +type yaml_parser_state_t int + +const ( + yaml_PARSE_STREAM_START_STATE yaml_parser_state_t = iota + + yaml_PARSE_IMPLICIT_DOCUMENT_START_STATE // Expect the beginning of an implicit document. + yaml_PARSE_DOCUMENT_START_STATE // Expect DOCUMENT-START. + yaml_PARSE_DOCUMENT_CONTENT_STATE // Expect the content of a document. + yaml_PARSE_DOCUMENT_END_STATE // Expect DOCUMENT-END. + yaml_PARSE_BLOCK_NODE_STATE // Expect a block node. + yaml_PARSE_BLOCK_NODE_OR_INDENTLESS_SEQUENCE_STATE // Expect a block node or indentless sequence. + yaml_PARSE_FLOW_NODE_STATE // Expect a flow node. + yaml_PARSE_BLOCK_SEQUENCE_FIRST_ENTRY_STATE // Expect the first entry of a block sequence. + yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE // Expect an entry of a block sequence. + yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE // Expect an entry of an indentless sequence. + yaml_PARSE_BLOCK_MAPPING_FIRST_KEY_STATE // Expect the first key of a block mapping. + yaml_PARSE_BLOCK_MAPPING_KEY_STATE // Expect a block mapping key. + yaml_PARSE_BLOCK_MAPPING_VALUE_STATE // Expect a block mapping value. + yaml_PARSE_FLOW_SEQUENCE_FIRST_ENTRY_STATE // Expect the first entry of a flow sequence. + yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE // Expect an entry of a flow sequence. + yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_KEY_STATE // Expect a key of an ordered mapping. + yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE // Expect a value of an ordered mapping. + yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE // Expect the and of an ordered mapping entry. + yaml_PARSE_FLOW_MAPPING_FIRST_KEY_STATE // Expect the first key of a flow mapping. + yaml_PARSE_FLOW_MAPPING_KEY_STATE // Expect a key of a flow mapping. + yaml_PARSE_FLOW_MAPPING_VALUE_STATE // Expect a value of a flow mapping. + yaml_PARSE_FLOW_MAPPING_EMPTY_VALUE_STATE // Expect an empty value of a flow mapping. + yaml_PARSE_END_STATE // Expect nothing. +) + +func (ps yaml_parser_state_t) String() string { + switch ps { + case yaml_PARSE_STREAM_START_STATE: + return "yaml_PARSE_STREAM_START_STATE" + case yaml_PARSE_IMPLICIT_DOCUMENT_START_STATE: + return "yaml_PARSE_IMPLICIT_DOCUMENT_START_STATE" + case yaml_PARSE_DOCUMENT_START_STATE: + return "yaml_PARSE_DOCUMENT_START_STATE" + case yaml_PARSE_DOCUMENT_CONTENT_STATE: + return "yaml_PARSE_DOCUMENT_CONTENT_STATE" + case yaml_PARSE_DOCUMENT_END_STATE: + return "yaml_PARSE_DOCUMENT_END_STATE" + case yaml_PARSE_BLOCK_NODE_STATE: + return "yaml_PARSE_BLOCK_NODE_STATE" + case yaml_PARSE_BLOCK_NODE_OR_INDENTLESS_SEQUENCE_STATE: + return "yaml_PARSE_BLOCK_NODE_OR_INDENTLESS_SEQUENCE_STATE" + case yaml_PARSE_FLOW_NODE_STATE: + return "yaml_PARSE_FLOW_NODE_STATE" + case yaml_PARSE_BLOCK_SEQUENCE_FIRST_ENTRY_STATE: + return "yaml_PARSE_BLOCK_SEQUENCE_FIRST_ENTRY_STATE" + case yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE: + return "yaml_PARSE_BLOCK_SEQUENCE_ENTRY_STATE" + case yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE: + return "yaml_PARSE_INDENTLESS_SEQUENCE_ENTRY_STATE" + case yaml_PARSE_BLOCK_MAPPING_FIRST_KEY_STATE: + return "yaml_PARSE_BLOCK_MAPPING_FIRST_KEY_STATE" + case yaml_PARSE_BLOCK_MAPPING_KEY_STATE: + return "yaml_PARSE_BLOCK_MAPPING_KEY_STATE" + case yaml_PARSE_BLOCK_MAPPING_VALUE_STATE: + return "yaml_PARSE_BLOCK_MAPPING_VALUE_STATE" + case yaml_PARSE_FLOW_SEQUENCE_FIRST_ENTRY_STATE: + return "yaml_PARSE_FLOW_SEQUENCE_FIRST_ENTRY_STATE" + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE: + return "yaml_PARSE_FLOW_SEQUENCE_ENTRY_STATE" + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_KEY_STATE: + return "yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_KEY_STATE" + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE: + return "yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_VALUE_STATE" + case yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE: + return "yaml_PARSE_FLOW_SEQUENCE_ENTRY_MAPPING_END_STATE" + case yaml_PARSE_FLOW_MAPPING_FIRST_KEY_STATE: + return "yaml_PARSE_FLOW_MAPPING_FIRST_KEY_STATE" + case yaml_PARSE_FLOW_MAPPING_KEY_STATE: + return "yaml_PARSE_FLOW_MAPPING_KEY_STATE" + case yaml_PARSE_FLOW_MAPPING_VALUE_STATE: + return "yaml_PARSE_FLOW_MAPPING_VALUE_STATE" + case yaml_PARSE_FLOW_MAPPING_EMPTY_VALUE_STATE: + return "yaml_PARSE_FLOW_MAPPING_EMPTY_VALUE_STATE" + case yaml_PARSE_END_STATE: + return "yaml_PARSE_END_STATE" + } + return "" +} + +// This structure holds aliases data. +type yaml_alias_data_t struct { + anchor []byte // The anchor. + index int // The node id. + mark yaml_mark_t // The anchor mark. +} + +// The parser structure. +// +// All members are internal. Manage the structure using the +// yaml_parser_ family of functions. +type yaml_parser_t struct { + + // Error handling + + error yaml_error_type_t // Error type. + + problem string // Error description. + + // The byte about which the problem occurred. + problem_offset int + problem_value int + problem_mark yaml_mark_t + + // The error context. + context string + context_mark yaml_mark_t + + // Reader stuff + + read_handler yaml_read_handler_t // Read handler. + + input_reader io.Reader // File input data. + input []byte // String input data. + input_pos int + + eof bool // EOF flag + + buffer []byte // The working buffer. + buffer_pos int // The current position of the buffer. + + unread int // The number of unread characters in the buffer. + + raw_buffer []byte // The raw buffer. + raw_buffer_pos int // The current position of the buffer. + + encoding yaml_encoding_t // The input encoding. + + offset int // The offset of the current position (in bytes). + mark yaml_mark_t // The mark of the current position. + + // Scanner stuff + + stream_start_produced bool // Have we started to scan the input stream? + stream_end_produced bool // Have we reached the end of the input stream? + + flow_level int // The number of unclosed '[' and '{' indicators. + + tokens []yaml_token_t // The tokens queue. + tokens_head int // The head of the tokens queue. + tokens_parsed int // The number of tokens fetched from the queue. + token_available bool // Does the tokens queue contain a token ready for dequeueing. + + indent int // The current indentation level. + indents []int // The indentation levels stack. + + simple_key_allowed bool // May a simple key occur at the current position? + simple_keys []yaml_simple_key_t // The stack of simple keys. + + // Parser stuff + + state yaml_parser_state_t // The current parser state. + states []yaml_parser_state_t // The parser states stack. + marks []yaml_mark_t // The stack of marks. + tag_directives []yaml_tag_directive_t // The list of TAG directives. + + // Dumper stuff + + aliases []yaml_alias_data_t // The alias data. + + document *yaml_document_t // The currently parsed document. +} + +// Emitter Definitions + +// The prototype of a write handler. +// +// The write handler is called when the emitter needs to flush the accumulated +// characters to the output. The handler should write @a size bytes of the +// @a buffer to the output. +// +// @param[in,out] data A pointer to an application data specified by +// yaml_emitter_set_output(). +// @param[in] buffer The buffer with bytes to be written. +// @param[in] size The size of the buffer. +// +// @returns On success, the handler should return @c 1. If the handler failed, +// the returned value should be @c 0. +// +type yaml_write_handler_t func(emitter *yaml_emitter_t, buffer []byte) error + +type yaml_emitter_state_t int + +// The emitter states. +const ( + // Expect STREAM-START. + yaml_EMIT_STREAM_START_STATE yaml_emitter_state_t = iota + + yaml_EMIT_FIRST_DOCUMENT_START_STATE // Expect the first DOCUMENT-START or STREAM-END. + yaml_EMIT_DOCUMENT_START_STATE // Expect DOCUMENT-START or STREAM-END. + yaml_EMIT_DOCUMENT_CONTENT_STATE // Expect the content of a document. + yaml_EMIT_DOCUMENT_END_STATE // Expect DOCUMENT-END. + yaml_EMIT_FLOW_SEQUENCE_FIRST_ITEM_STATE // Expect the first item of a flow sequence. + yaml_EMIT_FLOW_SEQUENCE_ITEM_STATE // Expect an item of a flow sequence. + yaml_EMIT_FLOW_MAPPING_FIRST_KEY_STATE // Expect the first key of a flow mapping. + yaml_EMIT_FLOW_MAPPING_KEY_STATE // Expect a key of a flow mapping. + yaml_EMIT_FLOW_MAPPING_SIMPLE_VALUE_STATE // Expect a value for a simple key of a flow mapping. + yaml_EMIT_FLOW_MAPPING_VALUE_STATE // Expect a value of a flow mapping. + yaml_EMIT_BLOCK_SEQUENCE_FIRST_ITEM_STATE // Expect the first item of a block sequence. + yaml_EMIT_BLOCK_SEQUENCE_ITEM_STATE // Expect an item of a block sequence. + yaml_EMIT_BLOCK_MAPPING_FIRST_KEY_STATE // Expect the first key of a block mapping. + yaml_EMIT_BLOCK_MAPPING_KEY_STATE // Expect the key of a block mapping. + yaml_EMIT_BLOCK_MAPPING_SIMPLE_VALUE_STATE // Expect a value for a simple key of a block mapping. + yaml_EMIT_BLOCK_MAPPING_VALUE_STATE // Expect a value of a block mapping. + yaml_EMIT_END_STATE // Expect nothing. +) + +// The emitter structure. +// +// All members are internal. Manage the structure using the @c yaml_emitter_ +// family of functions. +type yaml_emitter_t struct { + + // Error handling + + error yaml_error_type_t // Error type. + problem string // Error description. + + // Writer stuff + + write_handler yaml_write_handler_t // Write handler. + + output_buffer *[]byte // String output data. + output_writer io.Writer // File output data. + + buffer []byte // The working buffer. + buffer_pos int // The current position of the buffer. + + raw_buffer []byte // The raw buffer. + raw_buffer_pos int // The current position of the buffer. + + encoding yaml_encoding_t // The stream encoding. + + // Emitter stuff + + canonical bool // If the output is in the canonical style? + best_indent int // The number of indentation spaces. + best_width int // The preferred width of the output lines. + unicode bool // Allow unescaped non-ASCII characters? + line_break yaml_break_t // The preferred line break. + + state yaml_emitter_state_t // The current emitter state. + states []yaml_emitter_state_t // The stack of states. + + events []yaml_event_t // The event queue. + events_head int // The head of the event queue. + + indents []int // The stack of indentation levels. + + tag_directives []yaml_tag_directive_t // The list of tag directives. + + indent int // The current indentation level. + + flow_level int // The current flow level. + + root_context bool // Is it the document root context? + sequence_context bool // Is it a sequence context? + mapping_context bool // Is it a mapping context? + simple_key_context bool // Is it a simple mapping key context? + + line int // The current line. + column int // The current column. + whitespace bool // If the last character was a whitespace? + indention bool // If the last character was an indentation character (' ', '-', '?', ':')? + open_ended bool // If an explicit document end is required? + + // Anchor analysis. + anchor_data struct { + anchor []byte // The anchor value. + alias bool // Is it an alias? + } + + // Tag analysis. + tag_data struct { + handle []byte // The tag handle. + suffix []byte // The tag suffix. + } + + // Scalar analysis. + scalar_data struct { + value []byte // The scalar value. + multiline bool // Does the scalar contain line breaks? + flow_plain_allowed bool // Can the scalar be expessed in the flow plain style? + block_plain_allowed bool // Can the scalar be expressed in the block plain style? + single_quoted_allowed bool // Can the scalar be expressed in the single quoted style? + block_allowed bool // Can the scalar be expressed in the literal or folded styles? + style yaml_scalar_style_t // The output style. + } + + // Dumper stuff + + opened bool // If the stream was already opened? + closed bool // If the stream was already closed? + + // The information associated with the document nodes. + anchors *struct { + references int // The number of references. + anchor int // The anchor id. + serialized bool // If the node has been emitted? + } + + last_anchor_id int // The last assigned anchor id. + + document *yaml_document_t // The currently emitted document. +} diff --git a/vendor/gopkg.in/yaml.v2/yamlprivateh.go b/vendor/gopkg.in/yaml.v2/yamlprivateh.go new file mode 100644 index 0000000..8110ce3 --- /dev/null +++ b/vendor/gopkg.in/yaml.v2/yamlprivateh.go @@ -0,0 +1,173 @@ +package yaml + +const ( + // The size of the input raw buffer. + input_raw_buffer_size = 512 + + // The size of the input buffer. + // It should be possible to decode the whole raw buffer. + input_buffer_size = input_raw_buffer_size * 3 + + // The size of the output buffer. + output_buffer_size = 128 + + // The size of the output raw buffer. + // It should be possible to encode the whole output buffer. + output_raw_buffer_size = (output_buffer_size*2 + 2) + + // The size of other stacks and queues. + initial_stack_size = 16 + initial_queue_size = 16 + initial_string_size = 16 +) + +// Check if the character at the specified position is an alphabetical +// character, a digit, '_', or '-'. +func is_alpha(b []byte, i int) bool { + return b[i] >= '0' && b[i] <= '9' || b[i] >= 'A' && b[i] <= 'Z' || b[i] >= 'a' && b[i] <= 'z' || b[i] == '_' || b[i] == '-' +} + +// Check if the character at the specified position is a digit. +func is_digit(b []byte, i int) bool { + return b[i] >= '0' && b[i] <= '9' +} + +// Get the value of a digit. +func as_digit(b []byte, i int) int { + return int(b[i]) - '0' +} + +// Check if the character at the specified position is a hex-digit. +func is_hex(b []byte, i int) bool { + return b[i] >= '0' && b[i] <= '9' || b[i] >= 'A' && b[i] <= 'F' || b[i] >= 'a' && b[i] <= 'f' +} + +// Get the value of a hex-digit. +func as_hex(b []byte, i int) int { + bi := b[i] + if bi >= 'A' && bi <= 'F' { + return int(bi) - 'A' + 10 + } + if bi >= 'a' && bi <= 'f' { + return int(bi) - 'a' + 10 + } + return int(bi) - '0' +} + +// Check if the character is ASCII. +func is_ascii(b []byte, i int) bool { + return b[i] <= 0x7F +} + +// Check if the character at the start of the buffer can be printed unescaped. +func is_printable(b []byte, i int) bool { + return ((b[i] == 0x0A) || // . == #x0A + (b[i] >= 0x20 && b[i] <= 0x7E) || // #x20 <= . <= #x7E + (b[i] == 0xC2 && b[i+1] >= 0xA0) || // #0xA0 <= . <= #xD7FF + (b[i] > 0xC2 && b[i] < 0xED) || + (b[i] == 0xED && b[i+1] < 0xA0) || + (b[i] == 0xEE) || + (b[i] == 0xEF && // #xE000 <= . <= #xFFFD + !(b[i+1] == 0xBB && b[i+2] == 0xBF) && // && . != #xFEFF + !(b[i+1] == 0xBF && (b[i+2] == 0xBE || b[i+2] == 0xBF)))) +} + +// Check if the character at the specified position is NUL. +func is_z(b []byte, i int) bool { + return b[i] == 0x00 +} + +// Check if the beginning of the buffer is a BOM. +func is_bom(b []byte, i int) bool { + return b[0] == 0xEF && b[1] == 0xBB && b[2] == 0xBF +} + +// Check if the character at the specified position is space. +func is_space(b []byte, i int) bool { + return b[i] == ' ' +} + +// Check if the character at the specified position is tab. +func is_tab(b []byte, i int) bool { + return b[i] == '\t' +} + +// Check if the character at the specified position is blank (space or tab). +func is_blank(b []byte, i int) bool { + //return is_space(b, i) || is_tab(b, i) + return b[i] == ' ' || b[i] == '\t' +} + +// Check if the character at the specified position is a line break. +func is_break(b []byte, i int) bool { + return (b[i] == '\r' || // CR (#xD) + b[i] == '\n' || // LF (#xA) + b[i] == 0xC2 && b[i+1] == 0x85 || // NEL (#x85) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA8 || // LS (#x2028) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA9) // PS (#x2029) +} + +func is_crlf(b []byte, i int) bool { + return b[i] == '\r' && b[i+1] == '\n' +} + +// Check if the character is a line break or NUL. +func is_breakz(b []byte, i int) bool { + //return is_break(b, i) || is_z(b, i) + return ( // is_break: + b[i] == '\r' || // CR (#xD) + b[i] == '\n' || // LF (#xA) + b[i] == 0xC2 && b[i+1] == 0x85 || // NEL (#x85) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA8 || // LS (#x2028) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA9 || // PS (#x2029) + // is_z: + b[i] == 0) +} + +// Check if the character is a line break, space, or NUL. +func is_spacez(b []byte, i int) bool { + //return is_space(b, i) || is_breakz(b, i) + return ( // is_space: + b[i] == ' ' || + // is_breakz: + b[i] == '\r' || // CR (#xD) + b[i] == '\n' || // LF (#xA) + b[i] == 0xC2 && b[i+1] == 0x85 || // NEL (#x85) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA8 || // LS (#x2028) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA9 || // PS (#x2029) + b[i] == 0) +} + +// Check if the character is a line break, space, tab, or NUL. +func is_blankz(b []byte, i int) bool { + //return is_blank(b, i) || is_breakz(b, i) + return ( // is_blank: + b[i] == ' ' || b[i] == '\t' || + // is_breakz: + b[i] == '\r' || // CR (#xD) + b[i] == '\n' || // LF (#xA) + b[i] == 0xC2 && b[i+1] == 0x85 || // NEL (#x85) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA8 || // LS (#x2028) + b[i] == 0xE2 && b[i+1] == 0x80 && b[i+2] == 0xA9 || // PS (#x2029) + b[i] == 0) +} + +// Determine the width of the character. +func width(b byte) int { + // Don't replace these by a switch without first + // confirming that it is being inlined. + if b&0x80 == 0x00 { + return 1 + } + if b&0xE0 == 0xC0 { + return 2 + } + if b&0xF0 == 0xE0 { + return 3 + } + if b&0xF8 == 0xF0 { + return 4 + } + return 0 + +}